From 8bbd4cfb2be54386b6640ab80f5810176d8ba8d2 Mon Sep 17 00:00:00 2001 From: ajhai Date: Thu, 1 Aug 2013 17:31:47 +0530 Subject: [PATCH 001/138] Importing emberjs and latest jquery, jquery-ui --- web/external/ember/ember-1.0.0-rc.6.1.js | 30984 +++++++++++++++++++ web/external/jquery-ui/jquery-ui-1.10.2.js | 14987 +++++++++ web/external/jquery/jquery-1.9.1.js | 9597 ++++++ 3 files changed, 55568 insertions(+) create mode 100644 web/external/ember/ember-1.0.0-rc.6.1.js create mode 100644 web/external/jquery-ui/jquery-ui-1.10.2.js create mode 100644 web/external/jquery/jquery-1.9.1.js diff --git a/web/external/ember/ember-1.0.0-rc.6.1.js b/web/external/ember/ember-1.0.0-rc.6.1.js new file mode 100644 index 0000000..1097ef8 --- /dev/null +++ b/web/external/ember/ember-1.0.0-rc.6.1.js @@ -0,0 +1,30984 @@ +// Version: v1.0.0-rc.6.1 +// Last commit: 2a9ce26 (2013-07-25 18:13:33 -0400) + + +(function() { +/*global __fail__*/ + +/** +Ember Debug + +@module ember +@submodule ember-debug +*/ + +/** +@class Ember +*/ + +if ('undefined' === typeof Ember) { + Ember = {}; + + if ('undefined' !== typeof window) { + window.Em = window.Ember = Em = Ember; + } +} + +Ember.ENV = 'undefined' === typeof ENV ? {} : ENV; + +if (!('MANDATORY_SETTER' in Ember.ENV)) { + Ember.ENV.MANDATORY_SETTER = true; // default to true for debug dist +} + +/** + Define an assertion that will throw an exception if the condition is not + met. Ember build tools will remove any calls to `Ember.assert()` when + doing a production build. Example: + + ```javascript + // Test for truthiness + Ember.assert('Must pass a valid object', obj); + // Fail unconditionally + Ember.assert('This code path should never be run') + ``` + + @method assert + @param {String} desc A description of the assertion. This will become + the text of the Error thrown if the assertion fails. + @param {Boolean} test Must be truthy for the assertion to pass. If + falsy, an exception will be thrown. +*/ +Ember.assert = function(desc, test) { + Ember.Logger.assert(test, desc); + + if (Ember.testing && !test) { + // when testing, ensure test failures when assertions fail + throw new Error("Assertion Failed: " + desc); + } +}; + + +/** + Display a warning with the provided message. Ember build tools will + remove any calls to `Ember.warn()` when doing a production build. + + @method warn + @param {String} message A warning to display. + @param {Boolean} test An optional boolean. If falsy, the warning + will be displayed. +*/ +Ember.warn = function(message, test) { + if (!test) { + Ember.Logger.warn("WARNING: "+message); + if ('trace' in Ember.Logger) Ember.Logger.trace(); + } +}; + +/** + Display a debug notice. Ember build tools will remove any calls to + `Ember.debug()` when doing a production build. + + ```javascript + Ember.debug("I'm a debug notice!"); + ``` + + @method debug + @param {String} message A debug message to display. +*/ +Ember.debug = function(message) { + Ember.Logger.debug("DEBUG: "+message); +}; + +/** + Display a deprecation warning with the provided message and a stack trace + (Chrome and Firefox only). Ember build tools will remove any calls to + `Ember.deprecate()` when doing a production build. + + @method deprecate + @param {String} message A description of the deprecation. + @param {Boolean} test An optional boolean. If falsy, the deprecation + will be displayed. +*/ +Ember.deprecate = function(message, test) { + if (Ember.TESTING_DEPRECATION) { return; } + + if (arguments.length === 1) { test = false; } + if (test) { return; } + + if (Ember.ENV.RAISE_ON_DEPRECATION) { throw new Error(message); } + + var error; + + // When using new Error, we can't do the arguments check for Chrome. Alternatives are welcome + try { __fail__.fail(); } catch (e) { error = e; } + + if (Ember.LOG_STACKTRACE_ON_DEPRECATION && error.stack) { + var stack, stackStr = ''; + if (error['arguments']) { + // Chrome + stack = error.stack.replace(/^\s+at\s+/gm, ''). + replace(/^([^\(]+?)([\n$])/gm, '{anonymous}($1)$2'). + replace(/^Object.\s*\(([^\)]+)\)/gm, '{anonymous}($1)').split('\n'); + stack.shift(); + } else { + // Firefox + stack = error.stack.replace(/(?:\n@:0)?\s+$/m, ''). + replace(/^\(/gm, '{anonymous}(').split('\n'); + } + + stackStr = "\n " + stack.slice(2).join("\n "); + message = message + stackStr; + } + + Ember.Logger.warn("DEPRECATION: "+message); +}; + + + +/** + Display a deprecation warning with the provided message and a stack trace + (Chrome and Firefox only) when the wrapped method is called. + + Ember build tools will not remove calls to `Ember.deprecateFunc()`, though + no warnings will be shown in production. + + @method deprecateFunc + @param {String} message A description of the deprecation. + @param {Function} func The function to be deprecated. + @return {Function} a new function that wrapped the original function with a deprecation warning +*/ +Ember.deprecateFunc = function(message, func) { + return function() { + Ember.deprecate(message); + return func.apply(this, arguments); + }; +}; + +})(); + +// Version: v1.0.0-rc.6-2-gaa6f429 +// Last commit: aa6f429 (2013-07-25 20:20:00 -0400) + + +(function() { +var define, requireModule; + +(function() { + var registry = {}, seen = {}; + + define = function(name, deps, callback) { + registry[name] = { deps: deps, callback: callback }; + }; + + requireModule = function(name) { + if (seen[name]) { return seen[name]; } + seen[name] = {}; + + var mod, deps, callback, reified, exports; + + mod = registry[name]; + + if (!mod) { + throw new Error("Module '" + name + "' not found."); + } + + deps = mod.deps; + callback = mod.callback; + reified = []; + exports; + + for (var i=0, l=deps.length; i -1; +}; + +// From: https://developer.mozilla.org/en/JavaScript/Reference/Global_Objects/array/map +var arrayMap = isNativeFunc(Array.prototype.map) ? Array.prototype.map : function(fun /*, thisp */) { + //"use strict"; + + if (this === void 0 || this === null) { + throw new TypeError(); + } + + var t = Object(this); + var len = t.length >>> 0; + if (typeof fun !== "function") { + throw new TypeError(); + } + + var res = new Array(len); + var thisp = arguments[1]; + for (var i = 0; i < len; i++) { + if (i in t) { + res[i] = fun.call(thisp, t[i], i, t); + } + } + + return res; +}; + +// From: https://developer.mozilla.org/en/JavaScript/Reference/Global_Objects/array/foreach +var arrayForEach = isNativeFunc(Array.prototype.forEach) ? Array.prototype.forEach : function(fun /*, thisp */) { + //"use strict"; + + if (this === void 0 || this === null) { + throw new TypeError(); + } + + var t = Object(this); + var len = t.length >>> 0; + if (typeof fun !== "function") { + throw new TypeError(); + } + + var thisp = arguments[1]; + for (var i = 0; i < len; i++) { + if (i in t) { + fun.call(thisp, t[i], i, t); + } + } +}; + +var arrayIndexOf = isNativeFunc(Array.prototype.indexOf) ? Array.prototype.indexOf : function (obj, fromIndex) { + if (fromIndex === null || fromIndex === undefined) { fromIndex = 0; } + else if (fromIndex < 0) { fromIndex = Math.max(0, this.length + fromIndex); } + for (var i = fromIndex, j = this.length; i < j; i++) { + if (this[i] === obj) { return i; } + } + return -1; +}; + +Ember.ArrayPolyfills = { + map: arrayMap, + forEach: arrayForEach, + indexOf: arrayIndexOf +}; + +if (Ember.SHIM_ES5) { + if (!Array.prototype.map) { + Array.prototype.map = arrayMap; + } + + if (!Array.prototype.forEach) { + Array.prototype.forEach = arrayForEach; + } + + if (!Array.prototype.indexOf) { + Array.prototype.indexOf = arrayIndexOf; + } +} + +})(); + + + +(function() { +/** +@module ember-metal +*/ + + +var o_defineProperty = Ember.platform.defineProperty, + o_create = Ember.create, + // Used for guid generation... + GUID_KEY = '__ember'+ (+ new Date()), + uuid = 0, + numberCache = [], + stringCache = {}; + +var MANDATORY_SETTER = Ember.ENV.MANDATORY_SETTER; + +/** + @private + + A unique key used to assign guids and other private metadata to objects. + If you inspect an object in your browser debugger you will often see these. + They can be safely ignored. + + On browsers that support it, these properties are added with enumeration + disabled so they won't show up when you iterate over your properties. + + @property GUID_KEY + @for Ember + @type String + @final +*/ +Ember.GUID_KEY = GUID_KEY; + +var GUID_DESC = { + writable: false, + configurable: false, + enumerable: false, + value: null +}; + +/** + @private + + Generates a new guid, optionally saving the guid to the object that you + pass in. You will rarely need to use this method. Instead you should + call `Ember.guidFor(obj)`, which return an existing guid if available. + + @method generateGuid + @for Ember + @param {Object} [obj] Object the guid will be used for. If passed in, the guid will + be saved on the object and reused whenever you pass the same object + again. + + If no object is passed, just generate a new guid. + @param {String} [prefix] Prefix to place in front of the guid. Useful when you want to + separate the guid into separate namespaces. + @return {String} the guid +*/ +Ember.generateGuid = function generateGuid(obj, prefix) { + if (!prefix) prefix = 'ember'; + var ret = (prefix + (uuid++)); + if (obj) { + GUID_DESC.value = ret; + o_defineProperty(obj, GUID_KEY, GUID_DESC); + } + return ret ; +}; + +/** + @private + + Returns a unique id for the object. If the object does not yet have a guid, + one will be assigned to it. You can call this on any object, + `Ember.Object`-based or not, but be aware that it will add a `_guid` + property. + + You can also use this method on DOM Element objects. + + @method guidFor + @for Ember + @param {Object} obj any object, string, number, Element, or primitive + @return {String} the unique guid for this instance. +*/ +Ember.guidFor = function guidFor(obj) { + + // special cases where we don't want to add a key to object + if (obj === undefined) return "(undefined)"; + if (obj === null) return "(null)"; + + var ret; + var type = typeof obj; + + // Don't allow prototype changes to String etc. to change the guidFor + switch(type) { + case 'number': + ret = numberCache[obj]; + if (!ret) ret = numberCache[obj] = 'nu'+obj; + return ret; + + case 'string': + ret = stringCache[obj]; + if (!ret) ret = stringCache[obj] = 'st'+(uuid++); + return ret; + + case 'boolean': + return obj ? '(true)' : '(false)'; + + default: + if (obj[GUID_KEY]) return obj[GUID_KEY]; + if (obj === Object) return '(Object)'; + if (obj === Array) return '(Array)'; + ret = 'ember'+(uuid++); + GUID_DESC.value = ret; + o_defineProperty(obj, GUID_KEY, GUID_DESC); + return ret; + } +}; + +// .......................................................... +// META +// + +var META_DESC = { + writable: true, + configurable: false, + enumerable: false, + value: null +}; + +var META_KEY = Ember.GUID_KEY+'_meta'; + +/** + The key used to store meta information on object for property observing. + + @property META_KEY + @for Ember + @private + @final + @type String +*/ +Ember.META_KEY = META_KEY; + +// Placeholder for non-writable metas. +var EMPTY_META = { + descs: {}, + watching: {} +}; + +if (MANDATORY_SETTER) { EMPTY_META.values = {}; } + +Ember.EMPTY_META = EMPTY_META; + +if (Object.freeze) Object.freeze(EMPTY_META); + +var isDefinePropertySimulated = Ember.platform.defineProperty.isSimulated; + +function Meta(obj) { + this.descs = {}; + this.watching = {}; + this.cache = {}; + this.source = obj; +} + +if (isDefinePropertySimulated) { + // on platforms that don't support enumerable false + // make meta fail jQuery.isPlainObject() to hide from + // jQuery.extend() by having a property that fails + // hasOwnProperty check. + Meta.prototype.__preventPlainObject__ = true; + + // Without non-enumerable properties, meta objects will be output in JSON + // unless explicitly suppressed + Meta.prototype.toJSON = function () { }; +} + +/** + Retrieves the meta hash for an object. If `writable` is true ensures the + hash is writable for this object as well. + + The meta object contains information about computed property descriptors as + well as any watched properties and other information. You generally will + not access this information directly but instead work with higher level + methods that manipulate this hash indirectly. + + @method meta + @for Ember + @private + + @param {Object} obj The object to retrieve meta for + @param {Boolean} [writable=true] Pass `false` if you do not intend to modify + the meta hash, allowing the method to avoid making an unnecessary copy. + @return {Object} the meta hash for an object +*/ +Ember.meta = function meta(obj, writable) { + + var ret = obj[META_KEY]; + if (writable===false) return ret || EMPTY_META; + + if (!ret) { + if (!isDefinePropertySimulated) o_defineProperty(obj, META_KEY, META_DESC); + + ret = new Meta(obj); + + if (MANDATORY_SETTER) { ret.values = {}; } + + obj[META_KEY] = ret; + + // make sure we don't accidentally try to create constructor like desc + ret.descs.constructor = null; + + } else if (ret.source !== obj) { + if (!isDefinePropertySimulated) o_defineProperty(obj, META_KEY, META_DESC); + + ret = o_create(ret); + ret.descs = o_create(ret.descs); + ret.watching = o_create(ret.watching); + ret.cache = {}; + ret.source = obj; + + if (MANDATORY_SETTER) { ret.values = o_create(ret.values); } + + obj[META_KEY] = ret; + } + return ret; +}; + +Ember.getMeta = function getMeta(obj, property) { + var meta = Ember.meta(obj, false); + return meta[property]; +}; + +Ember.setMeta = function setMeta(obj, property, value) { + var meta = Ember.meta(obj, true); + meta[property] = value; + return value; +}; + +/** + @deprecated + @private + + In order to store defaults for a class, a prototype may need to create + a default meta object, which will be inherited by any objects instantiated + from the class's constructor. + + However, the properties of that meta object are only shallow-cloned, + so if a property is a hash (like the event system's `listeners` hash), + it will by default be shared across all instances of that class. + + This method allows extensions to deeply clone a series of nested hashes or + other complex objects. For instance, the event system might pass + `['listeners', 'foo:change', 'ember157']` to `prepareMetaPath`, which will + walk down the keys provided. + + For each key, if the key does not exist, it is created. If it already + exists and it was inherited from its constructor, the constructor's + key is cloned. + + You can also pass false for `writable`, which will simply return + undefined if `prepareMetaPath` discovers any part of the path that + shared or undefined. + + @method metaPath + @for Ember + @param {Object} obj The object whose meta we are examining + @param {Array} path An array of keys to walk down + @param {Boolean} writable whether or not to create a new meta + (or meta property) if one does not already exist or if it's + shared with its constructor +*/ +Ember.metaPath = function metaPath(obj, path, writable) { + Ember.deprecate("Ember.metaPath is deprecated and will be removed from future releases."); + var meta = Ember.meta(obj, writable), keyName, value; + + for (var i=0, l=path.length; i= 0) { + intersection.push(element); + } + }); + + return intersection; + } +}; + +})(); + + + +(function() { +/** +@module ember-metal +*/ + +var META_KEY = Ember.META_KEY, get; + +var MANDATORY_SETTER = Ember.ENV.MANDATORY_SETTER; + +var IS_GLOBAL_PATH = /^([A-Z$]|([0-9][A-Z$])).*[\.\*]/; +var HAS_THIS = /^this[\.\*]/; +var FIRST_KEY = /^([^\.\*]+)/; + +// .......................................................... +// GET AND SET +// +// If we are on a platform that supports accessors we can use those. +// Otherwise simulate accessors by looking up the property directly on the +// object. + +/** + Gets the value of a property on an object. If the property is computed, + the function will be invoked. If the property is not defined but the + object implements the `unknownProperty` method then that will be invoked. + + If you plan to run on IE8 and older browsers then you should use this + method anytime you want to retrieve a property on an object that you don't + know for sure is private. (Properties beginning with an underscore '_' + are considered private.) + + On all newer browsers, you only need to use this method to retrieve + properties if the property might not be defined on the object and you want + to respect the `unknownProperty` handler. Otherwise you can ignore this + method. + + Note that if the object itself is `undefined`, this method will throw + an error. + + @method get + @for Ember + @param {Object} obj The object to retrieve from. + @param {String} keyName The property key to retrieve + @return {Object} the property value or `null`. +*/ +get = function get(obj, keyName) { + // Helpers that operate with 'this' within an #each + if (keyName === '') { + return obj; + } + + if (!keyName && 'string'===typeof obj) { + keyName = obj; + obj = null; + } + + Ember.assert("Cannot call get with "+ keyName +" key.", !!keyName); + Ember.assert("Cannot call get with '"+ keyName +"' on an undefined object.", obj !== undefined); + + if (obj === null || keyName.indexOf('.') !== -1) { + return getPath(obj, keyName); + } + + var meta = obj[META_KEY], desc = meta && meta.descs[keyName], ret; + if (desc) { + return desc.get(obj, keyName); + } else { + if (MANDATORY_SETTER && meta && meta.watching[keyName] > 0) { + ret = meta.values[keyName]; + } else { + ret = obj[keyName]; + } + + if (ret === undefined && + 'object' === typeof obj && !(keyName in obj) && 'function' === typeof obj.unknownProperty) { + return obj.unknownProperty(keyName); + } + + return ret; + } +}; + +// Currently used only by Ember Data tests +if (Ember.config.overrideAccessors) { + Ember.get = get; + Ember.config.overrideAccessors(); + get = Ember.get; +} + +/** + @private + + Normalizes a target/path pair to reflect that actual target/path that should + be observed, etc. This takes into account passing in global property + paths (i.e. a path beginning with a captial letter not defined on the + target) and * separators. + + @method normalizeTuple + @for Ember + @param {Object} target The current target. May be `null`. + @param {String} path A path on the target or a global property path. + @return {Array} a temporary array with the normalized target/path pair. +*/ +var normalizeTuple = Ember.normalizeTuple = function(target, path) { + var hasThis = HAS_THIS.test(path), + isGlobal = !hasThis && IS_GLOBAL_PATH.test(path), + key; + + if (!target || isGlobal) target = Ember.lookup; + if (hasThis) path = path.slice(5); + + if (target === Ember.lookup) { + key = path.match(FIRST_KEY)[0]; + target = get(target, key); + path = path.slice(key.length+1); + } + + // must return some kind of path to be valid else other things will break. + if (!path || path.length===0) throw new Error('Invalid Path'); + + return [ target, path ]; +}; + +var getPath = Ember._getPath = function(root, path) { + var hasThis, parts, tuple, idx, len; + + // If there is no root and path is a key name, return that + // property from the global object. + // E.g. get('Ember') -> Ember + if (root === null && path.indexOf('.') === -1) { return get(Ember.lookup, path); } + + // detect complicated paths and normalize them + hasThis = HAS_THIS.test(path); + + if (!root || hasThis) { + tuple = normalizeTuple(root, path); + root = tuple[0]; + path = tuple[1]; + tuple.length = 0; + } + + parts = path.split("."); + len = parts.length; + for (idx = 0; root != null && idx < len; idx++) { + root = get(root, parts[idx], true); + if (root && root.isDestroyed) { return undefined; } + } + return root; +}; + +Ember.getWithDefault = function(root, key, defaultValue) { + var value = get(root, key); + + if (value === undefined) { return defaultValue; } + return value; +}; + + +Ember.get = get; +Ember.getPath = Ember.deprecateFunc('getPath is deprecated since get now supports paths', Ember.get); + +})(); + + + +(function() { +/** +@module ember-metal +*/ + +var o_create = Ember.create, + metaFor = Ember.meta, + META_KEY = Ember.META_KEY, + /* listener flags */ + ONCE = 1, SUSPENDED = 2; + +/* + The event system uses a series of nested hashes to store listeners on an + object. When a listener is registered, or when an event arrives, these + hashes are consulted to determine which target and action pair to invoke. + + The hashes are stored in the object's meta hash, and look like this: + + // Object's meta hash + { + listeners: { // variable name: `listenerSet` + "foo:changed": [ // variable name: `actions` + [target, method, flags] + ] + } + } + +*/ + +function indexOf(array, target, method) { + var index = -1; + for (var i = 0, l = array.length; i < l; i++) { + if (target === array[i][0] && method === array[i][1]) { index = i; break; } + } + return index; +} + +function actionsFor(obj, eventName) { + var meta = metaFor(obj, true), + actions; + + if (!meta.listeners) { meta.listeners = {}; } + + if (!meta.hasOwnProperty('listeners')) { + // setup inherited copy of the listeners object + meta.listeners = o_create(meta.listeners); + } + + actions = meta.listeners[eventName]; + + // if there are actions, but the eventName doesn't exist in our listeners, then copy them from the prototype + if (actions && !meta.listeners.hasOwnProperty(eventName)) { + actions = meta.listeners[eventName] = meta.listeners[eventName].slice(); + } else if (!actions) { + actions = meta.listeners[eventName] = []; + } + + return actions; +} + +function actionsUnion(obj, eventName, otherActions) { + var meta = obj[META_KEY], + actions = meta && meta.listeners && meta.listeners[eventName]; + + if (!actions) { return; } + for (var i = actions.length - 1; i >= 0; i--) { + var target = actions[i][0], + method = actions[i][1], + flags = actions[i][2], + actionIndex = indexOf(otherActions, target, method); + + if (actionIndex === -1) { + otherActions.push([target, method, flags]); + } + } +} + +function actionsDiff(obj, eventName, otherActions) { + var meta = obj[META_KEY], + actions = meta && meta.listeners && meta.listeners[eventName], + diffActions = []; + + if (!actions) { return; } + for (var i = actions.length - 1; i >= 0; i--) { + var target = actions[i][0], + method = actions[i][1], + flags = actions[i][2], + actionIndex = indexOf(otherActions, target, method); + + if (actionIndex !== -1) { continue; } + + otherActions.push([target, method, flags]); + diffActions.push([target, method, flags]); + } + + return diffActions; +} + +/** + Add an event listener + + @method addListener + @for Ember + @param obj + @param {String} eventName + @param {Object|Function} targetOrMethod A target object or a function + @param {Function|String} method A function or the name of a function to be called on `target` + @param {Boolean} once A flag whether a function should only be called once +*/ +function addListener(obj, eventName, target, method, once) { + Ember.assert("You must pass at least an object and event name to Ember.addListener", !!obj && !!eventName); + + if (!method && 'function' === typeof target) { + method = target; + target = null; + } + + var actions = actionsFor(obj, eventName), + actionIndex = indexOf(actions, target, method), + flags = 0; + + if (once) flags |= ONCE; + + if (actionIndex !== -1) { return; } + + actions.push([target, method, flags]); + + if ('function' === typeof obj.didAddListener) { + obj.didAddListener(eventName, target, method); + } +} + +/** + Remove an event listener + + Arguments should match those passed to `Ember.addListener`. + + @method removeListener + @for Ember + @param obj + @param {String} eventName + @param {Object|Function} targetOrMethod A target object or a function + @param {Function|String} method A function or the name of a function to be called on `target` +*/ +function removeListener(obj, eventName, target, method) { + Ember.assert("You must pass at least an object and event name to Ember.removeListener", !!obj && !!eventName); + + if (!method && 'function' === typeof target) { + method = target; + target = null; + } + + function _removeListener(target, method) { + var actions = actionsFor(obj, eventName), + actionIndex = indexOf(actions, target, method); + + // action doesn't exist, give up silently + if (actionIndex === -1) { return; } + + actions.splice(actionIndex, 1); + + if ('function' === typeof obj.didRemoveListener) { + obj.didRemoveListener(eventName, target, method); + } + } + + if (method) { + _removeListener(target, method); + } else { + var meta = obj[META_KEY], + actions = meta && meta.listeners && meta.listeners[eventName]; + + if (!actions) { return; } + for (var i = actions.length - 1; i >= 0; i--) { + _removeListener(actions[i][0], actions[i][1]); + } + } +} + +/** + @private + + Suspend listener during callback. + + This should only be used by the target of the event listener + when it is taking an action that would cause the event, e.g. + an object might suspend its property change listener while it is + setting that property. + + @method suspendListener + @for Ember + @param obj + @param {String} eventName + @param {Object|Function} targetOrMethod A target object or a function + @param {Function|String} method A function or the name of a function to be called on `target` + @param {Function} callback +*/ +function suspendListener(obj, eventName, target, method, callback) { + if (!method && 'function' === typeof target) { + method = target; + target = null; + } + + var actions = actionsFor(obj, eventName), + actionIndex = indexOf(actions, target, method), + action; + + if (actionIndex !== -1) { + action = actions[actionIndex].slice(); // copy it, otherwise we're modifying a shared object + action[2] |= SUSPENDED; // mark the action as suspended + actions[actionIndex] = action; // replace the shared object with our copy + } + + function tryable() { return callback.call(target); } + function finalizer() { if (action) { action[2] &= ~SUSPENDED; } } + + return Ember.tryFinally(tryable, finalizer); +} + +/** + @private + + Suspend listener during callback. + + This should only be used by the target of the event listener + when it is taking an action that would cause the event, e.g. + an object might suspend its property change listener while it is + setting that property. + + @method suspendListener + @for Ember + @param obj + @param {Array} eventName Array of event names + @param {Object|Function} targetOrMethod A target object or a function + @param {Function|String} method A function or the name of a function to be called on `target` + @param {Function} callback +*/ +function suspendListeners(obj, eventNames, target, method, callback) { + if (!method && 'function' === typeof target) { + method = target; + target = null; + } + + var suspendedActions = [], + eventName, actions, action, i, l; + + for (i=0, l=eventNames.length; i= 0; i--) { // looping in reverse for once listeners + var action = actions[i]; + if (!action) { continue; } + var target = action[0], method = action[1], flags = action[2]; + if (flags & SUSPENDED) { continue; } + if (flags & ONCE) { removeListener(obj, eventName, target, method); } + if (!target) { target = obj; } + if ('string' === typeof method) { method = target[method]; } + if (params) { + method.apply(target, params); + } else { + method.call(target); + } + } + return true; +} + +/** + @private + @method hasListeners + @for Ember + @param obj + @param {String} eventName +*/ +function hasListeners(obj, eventName) { + var meta = obj[META_KEY], + actions = meta && meta.listeners && meta.listeners[eventName]; + + return !!(actions && actions.length); +} + +/** + @private + @method listenersFor + @for Ember + @param obj + @param {String} eventName +*/ +function listenersFor(obj, eventName) { + var ret = []; + var meta = obj[META_KEY], + actions = meta && meta.listeners && meta.listeners[eventName]; + + if (!actions) { return ret; } + + for (var i = 0, l = actions.length; i < l; i++) { + var target = actions[i][0], + method = actions[i][1]; + ret.push([target, method]); + } + + return ret; +} + +Ember.addListener = addListener; +Ember.removeListener = removeListener; +Ember._suspendListener = suspendListener; +Ember._suspendListeners = suspendListeners; +Ember.sendEvent = sendEvent; +Ember.hasListeners = hasListeners; +Ember.watchedEvents = watchedEvents; +Ember.listenersFor = listenersFor; +Ember.listenersDiff = actionsDiff; +Ember.listenersUnion = actionsUnion; + +})(); + + + +(function() { +var guidFor = Ember.guidFor, + sendEvent = Ember.sendEvent; + +/* + this.observerSet = { + [senderGuid]: { // variable name: `keySet` + [keyName]: listIndex + } + }, + this.observers = [ + { + sender: obj, + keyName: keyName, + eventName: eventName, + listeners: [ + [target, method, flags] + ] + }, + ... + ] +*/ +var ObserverSet = Ember._ObserverSet = function() { + this.clear(); +}; + +ObserverSet.prototype.add = function(sender, keyName, eventName) { + var observerSet = this.observerSet, + observers = this.observers, + senderGuid = guidFor(sender), + keySet = observerSet[senderGuid], + index; + + if (!keySet) { + observerSet[senderGuid] = keySet = {}; + } + index = keySet[keyName]; + if (index === undefined) { + index = observers.push({ + sender: sender, + keyName: keyName, + eventName: eventName, + listeners: [] + }) - 1; + keySet[keyName] = index; + } + return observers[index].listeners; +}; + +ObserverSet.prototype.flush = function() { + var observers = this.observers, i, len, observer, sender; + this.clear(); + for (i=0, len=observers.length; i < len; ++i) { + observer = observers[i]; + sender = observer.sender; + if (sender.isDestroying || sender.isDestroyed) { continue; } + sendEvent(sender, observer.eventName, [sender, observer.keyName], observer.listeners); + } +}; + +ObserverSet.prototype.clear = function() { + this.observerSet = {}; + this.observers = []; +}; +})(); + + + +(function() { +var metaFor = Ember.meta, + guidFor = Ember.guidFor, + tryFinally = Ember.tryFinally, + sendEvent = Ember.sendEvent, + listenersUnion = Ember.listenersUnion, + listenersDiff = Ember.listenersDiff, + ObserverSet = Ember._ObserverSet, + beforeObserverSet = new ObserverSet(), + observerSet = new ObserverSet(), + deferred = 0; + +// .......................................................... +// PROPERTY CHANGES +// + +/** + This function is called just before an object property is about to change. + It will notify any before observers and prepare caches among other things. + + Normally you will not need to call this method directly but if for some + reason you can't directly watch a property you can invoke this method + manually along with `Ember.propertyDidChange()` which you should call just + after the property value changes. + + @method propertyWillChange + @for Ember + @param {Object} obj The object with the property that will change + @param {String} keyName The property key (or path) that will change. + @return {void} +*/ +var propertyWillChange = Ember.propertyWillChange = function(obj, keyName) { + var m = metaFor(obj, false), + watching = m.watching[keyName] > 0 || keyName === 'length', + proto = m.proto, + desc = m.descs[keyName]; + + if (!watching) { return; } + if (proto === obj) { return; } + if (desc && desc.willChange) { desc.willChange(obj, keyName); } + dependentKeysWillChange(obj, keyName, m); + chainsWillChange(obj, keyName, m); + notifyBeforeObservers(obj, keyName); +}; + +/** + This function is called just after an object property has changed. + It will notify any observers and clear caches among other things. + + Normally you will not need to call this method directly but if for some + reason you can't directly watch a property you can invoke this method + manually along with `Ember.propertyWilLChange()` which you should call just + before the property value changes. + + @method propertyDidChange + @for Ember + @param {Object} obj The object with the property that will change + @param {String} keyName The property key (or path) that will change. + @return {void} +*/ +var propertyDidChange = Ember.propertyDidChange = function(obj, keyName) { + var m = metaFor(obj, false), + watching = m.watching[keyName] > 0 || keyName === 'length', + proto = m.proto, + desc = m.descs[keyName]; + + if (proto === obj) { return; } + + // shouldn't this mean that we're watching this key? + if (desc && desc.didChange) { desc.didChange(obj, keyName); } + if (!watching && keyName !== 'length') { return; } + + dependentKeysDidChange(obj, keyName, m); + chainsDidChange(obj, keyName, m); + notifyObservers(obj, keyName); +}; + +var WILL_SEEN, DID_SEEN; + +// called whenever a property is about to change to clear the cache of any dependent keys (and notify those properties of changes, etc...) +function dependentKeysWillChange(obj, depKey, meta) { + if (obj.isDestroying) { return; } + + var seen = WILL_SEEN, top = !seen; + if (top) { seen = WILL_SEEN = {}; } + iterDeps(propertyWillChange, obj, depKey, seen, meta); + if (top) { WILL_SEEN = null; } +} + +// called whenever a property has just changed to update dependent keys +function dependentKeysDidChange(obj, depKey, meta) { + if (obj.isDestroying) { return; } + + var seen = DID_SEEN, top = !seen; + if (top) { seen = DID_SEEN = {}; } + iterDeps(propertyDidChange, obj, depKey, seen, meta); + if (top) { DID_SEEN = null; } +} + +function iterDeps(method, obj, depKey, seen, meta) { + var guid = guidFor(obj); + if (!seen[guid]) seen[guid] = {}; + if (seen[guid][depKey]) return; + seen[guid][depKey] = true; + + var deps = meta.deps; + deps = deps && deps[depKey]; + if (deps) { + for(var key in deps) { + var desc = meta.descs[key]; + if (desc && desc._suspended === obj) continue; + method(obj, key); + } + } +} + +var chainsWillChange = function(obj, keyName, m, arg) { + if (!m.hasOwnProperty('chainWatchers')) { return; } // nothing to do + + var nodes = m.chainWatchers; + + nodes = nodes[keyName]; + if (!nodes) { return; } + + for(var i = 0, l = nodes.length; i < l; i++) { + nodes[i].willChange(arg); + } +}; + +var chainsDidChange = function(obj, keyName, m, arg) { + if (!m.hasOwnProperty('chainWatchers')) { return; } // nothing to do + + var nodes = m.chainWatchers; + + nodes = nodes[keyName]; + if (!nodes) { return; } + + // looping in reverse because the chainWatchers array can be modified inside didChange + for (var i = nodes.length - 1; i >= 0; i--) { + nodes[i].didChange(arg); + } +}; + +Ember.overrideChains = function(obj, keyName, m) { + chainsDidChange(obj, keyName, m, true); +}; + +/** + @method beginPropertyChanges + @chainable +*/ +var beginPropertyChanges = Ember.beginPropertyChanges = function() { + deferred++; +}; + +/** + @method endPropertyChanges +*/ +var endPropertyChanges = Ember.endPropertyChanges = function() { + deferred--; + if (deferred<=0) { + beforeObserverSet.clear(); + observerSet.flush(); + } +}; + +/** + Make a series of property changes together in an + exception-safe way. + + ```javascript + Ember.changeProperties(function() { + obj1.set('foo', mayBlowUpWhenSet); + obj2.set('bar', baz); + }); + ``` + + @method changeProperties + @param {Function} callback + @param [binding] +*/ +Ember.changeProperties = function(cb, binding){ + beginPropertyChanges(); + tryFinally(cb, endPropertyChanges, binding); +}; + +var notifyBeforeObservers = function(obj, keyName) { + if (obj.isDestroying) { return; } + + var eventName = keyName + ':before', listeners, diff; + if (deferred) { + listeners = beforeObserverSet.add(obj, keyName, eventName); + diff = listenersDiff(obj, eventName, listeners); + sendEvent(obj, eventName, [obj, keyName], diff); + } else { + sendEvent(obj, eventName, [obj, keyName]); + } +}; + +var notifyObservers = function(obj, keyName) { + if (obj.isDestroying) { return; } + + var eventName = keyName + ':change', listeners; + if (deferred) { + listeners = observerSet.add(obj, keyName, eventName); + listenersUnion(obj, eventName, listeners); + } else { + sendEvent(obj, eventName, [obj, keyName]); + } +}; +})(); + + + +(function() { +// META_KEY +// _getPath +// propertyWillChange, propertyDidChange + +var META_KEY = Ember.META_KEY, + MANDATORY_SETTER = Ember.ENV.MANDATORY_SETTER, + IS_GLOBAL = /^([A-Z$]|([0-9][A-Z$]))/, + getPath = Ember._getPath; + +/** + Sets the value of a property on an object, respecting computed properties + and notifying observers and other listeners of the change. If the + property is not defined but the object implements the `unknownProperty` + method then that will be invoked as well. + + If you plan to run on IE8 and older browsers then you should use this + method anytime you want to set a property on an object that you don't + know for sure is private. (Properties beginning with an underscore '_' + are considered private.) + + On all newer browsers, you only need to use this method to set + properties if the property might not be defined on the object and you want + to respect the `unknownProperty` handler. Otherwise you can ignore this + method. + + @method set + @for Ember + @param {Object} obj The object to modify. + @param {String} keyName The property key to set + @param {Object} value The value to set + @return {Object} the passed value. +*/ +var set = function set(obj, keyName, value, tolerant) { + if (typeof obj === 'string') { + Ember.assert("Path '" + obj + "' must be global if no obj is given.", IS_GLOBAL.test(obj)); + value = keyName; + keyName = obj; + obj = null; + } + + Ember.assert("Cannot call set with "+ keyName +" key.", !!keyName); + + if (!obj || keyName.indexOf('.') !== -1) { + return setPath(obj, keyName, value, tolerant); + } + + Ember.assert("You need to provide an object and key to `set`.", !!obj && keyName !== undefined); + Ember.assert('calling set on destroyed object', !obj.isDestroyed); + + var meta = obj[META_KEY], desc = meta && meta.descs[keyName], + isUnknown, currentValue; + if (desc) { + desc.set(obj, keyName, value); + } else { + isUnknown = 'object' === typeof obj && !(keyName in obj); + + // setUnknownProperty is called if `obj` is an object, + // the property does not already exist, and the + // `setUnknownProperty` method exists on the object + if (isUnknown && 'function' === typeof obj.setUnknownProperty) { + obj.setUnknownProperty(keyName, value); + } else if (meta && meta.watching[keyName] > 0) { + if (MANDATORY_SETTER) { + currentValue = meta.values[keyName]; + } else { + currentValue = obj[keyName]; + } + // only trigger a change if the value has changed + if (value !== currentValue) { + Ember.propertyWillChange(obj, keyName); + if (MANDATORY_SETTER) { + if (currentValue === undefined && !(keyName in obj)) { + Ember.defineProperty(obj, keyName, null, value); // setup mandatory setter + } else { + meta.values[keyName] = value; + } + } else { + obj[keyName] = value; + } + Ember.propertyDidChange(obj, keyName); + } + } else { + obj[keyName] = value; + } + } + return value; +}; + +// Currently used only by Ember Data tests +if (Ember.config.overrideAccessors) { + Ember.set = set; + Ember.config.overrideAccessors(); + set = Ember.set; +} + +function setPath(root, path, value, tolerant) { + var keyName; + + // get the last part of the path + keyName = path.slice(path.lastIndexOf('.') + 1); + + // get the first part of the part + path = path.slice(0, path.length-(keyName.length+1)); + + // unless the path is this, look up the first part to + // get the root + if (path !== 'this') { + root = getPath(root, path); + } + + if (!keyName || keyName.length === 0) { + throw new Error('You passed an empty path'); + } + + if (!root) { + if (tolerant) { return; } + else { throw new Error('Object in path '+path+' could not be found or was destroyed.'); } + } + + return set(root, keyName, value); +} + +Ember.set = set; +Ember.setPath = Ember.deprecateFunc('setPath is deprecated since set now supports paths', Ember.set); + +/** + Error-tolerant form of `Ember.set`. Will not blow up if any part of the + chain is `undefined`, `null`, or destroyed. + + This is primarily used when syncing bindings, which may try to update after + an object has been destroyed. + + @method trySet + @for Ember + @param {Object} obj The object to modify. + @param {String} path The property path to set + @param {Object} value The value to set +*/ +Ember.trySet = function(root, path, value) { + return set(root, path, value, true); +}; +Ember.trySetPath = Ember.deprecateFunc('trySetPath has been renamed to trySet', Ember.trySet); + +})(); + + + +(function() { +/** +@module ember-metal +*/ + +/* + JavaScript (before ES6) does not have a Map implementation. Objects, + which are often used as dictionaries, may only have Strings as keys. + + Because Ember has a way to get a unique identifier for every object + via `Ember.guidFor`, we can implement a performant Map with arbitrary + keys. Because it is commonly used in low-level bookkeeping, Map is + implemented as a pure JavaScript object for performance. + + This implementation follows the current iteration of the ES6 proposal for + maps (http://wiki.ecmascript.org/doku.php?id=harmony:simple_maps_and_sets), + with two exceptions. First, because we need our implementation to be pleasant + on older browsers, we do not use the `delete` name (using `remove` instead). + Second, as we do not have the luxury of in-VM iteration, we implement a + forEach method for iteration. + + Map is mocked out to look like an Ember object, so you can do + `Ember.Map.create()` for symmetry with other Ember classes. +*/ +var get = Ember.get, + set = Ember.set, + guidFor = Ember.guidFor, + indexOf = Ember.ArrayPolyfills.indexOf; + +var copy = function(obj) { + var output = {}; + + for (var prop in obj) { + if (obj.hasOwnProperty(prop)) { output[prop] = obj[prop]; } + } + + return output; +}; + +var copyMap = function(original, newObject) { + var keys = original.keys.copy(), + values = copy(original.values); + + newObject.keys = keys; + newObject.values = values; + newObject.length = original.length; + + return newObject; +}; + +/** + This class is used internally by Ember and Ember Data. + Please do not use it at this time. We plan to clean it up + and add many tests soon. + + @class OrderedSet + @namespace Ember + @constructor + @private +*/ +var OrderedSet = Ember.OrderedSet = function() { + this.clear(); +}; + +/** + @method create + @static + @return {Ember.OrderedSet} +*/ +OrderedSet.create = function() { + return new OrderedSet(); +}; + + +OrderedSet.prototype = { + /** + @method clear + */ + clear: function() { + this.presenceSet = {}; + this.list = []; + }, + + /** + @method add + @param obj + */ + add: function(obj) { + var guid = guidFor(obj), + presenceSet = this.presenceSet, + list = this.list; + + if (guid in presenceSet) { return; } + + presenceSet[guid] = true; + list.push(obj); + }, + + /** + @method remove + @param obj + */ + remove: function(obj) { + var guid = guidFor(obj), + presenceSet = this.presenceSet, + list = this.list; + + delete presenceSet[guid]; + + var index = indexOf.call(list, obj); + if (index > -1) { + list.splice(index, 1); + } + }, + + /** + @method isEmpty + @return {Boolean} + */ + isEmpty: function() { + return this.list.length === 0; + }, + + /** + @method has + @param obj + @return {Boolean} + */ + has: function(obj) { + var guid = guidFor(obj), + presenceSet = this.presenceSet; + + return guid in presenceSet; + }, + + /** + @method forEach + @param {Function} fn + @param self + */ + forEach: function(fn, self) { + // allow mutation during iteration + var list = this.toArray(); + + for (var i = 0, j = list.length; i < j; i++) { + fn.call(self, list[i]); + } + }, + + /** + @method toArray + @return {Array} + */ + toArray: function() { + return this.list.slice(); + }, + + /** + @method copy + @return {Ember.OrderedSet} + */ + copy: function() { + var set = new OrderedSet(); + + set.presenceSet = copy(this.presenceSet); + set.list = this.toArray(); + + return set; + } +}; + +/** + A Map stores values indexed by keys. Unlike JavaScript's + default Objects, the keys of a Map can be any JavaScript + object. + + Internally, a Map has two data structures: + + 1. `keys`: an OrderedSet of all of the existing keys + 2. `values`: a JavaScript Object indexed by the `Ember.guidFor(key)` + + When a key/value pair is added for the first time, we + add the key to the `keys` OrderedSet, and create or + replace an entry in `values`. When an entry is deleted, + we delete its entry in `keys` and `values`. + + @class Map + @namespace Ember + @private + @constructor +*/ +var Map = Ember.Map = function() { + this.keys = Ember.OrderedSet.create(); + this.values = {}; +}; + +/** + @method create + @static +*/ +Map.create = function() { + return new Map(); +}; + +Map.prototype = { + /** + This property will change as the number of objects in the map changes. + + @property length + @type number + @default 0 + */ + length: 0, + + + /** + Retrieve the value associated with a given key. + + @method get + @param {*} key + @return {*} the value associated with the key, or `undefined` + */ + get: function(key) { + var values = this.values, + guid = guidFor(key); + + return values[guid]; + }, + + /** + Adds a value to the map. If a value for the given key has already been + provided, the new value will replace the old value. + + @method set + @param {*} key + @param {*} value + */ + set: function(key, value) { + var keys = this.keys, + values = this.values, + guid = guidFor(key); + + keys.add(key); + values[guid] = value; + set(this, 'length', keys.list.length); + }, + + /** + Removes a value from the map for an associated key. + + @method remove + @param {*} key + @return {Boolean} true if an item was removed, false otherwise + */ + remove: function(key) { + // don't use ES6 "delete" because it will be annoying + // to use in browsers that are not ES6 friendly; + var keys = this.keys, + values = this.values, + guid = guidFor(key); + + if (values.hasOwnProperty(guid)) { + keys.remove(key); + delete values[guid]; + set(this, 'length', keys.list.length); + return true; + } else { + return false; + } + }, + + /** + Check whether a key is present. + + @method has + @param {*} key + @return {Boolean} true if the item was present, false otherwise + */ + has: function(key) { + var values = this.values, + guid = guidFor(key); + + return values.hasOwnProperty(guid); + }, + + /** + Iterate over all the keys and values. Calls the function once + for each key, passing in the key and value, in that order. + + The keys are guaranteed to be iterated over in insertion order. + + @method forEach + @param {Function} callback + @param {*} self if passed, the `this` value inside the + callback. By default, `this` is the map. + */ + forEach: function(callback, self) { + var keys = this.keys, + values = this.values; + + keys.forEach(function(key) { + var guid = guidFor(key); + callback.call(self, key, values[guid]); + }); + }, + + /** + @method copy + @return {Ember.Map} + */ + copy: function() { + return copyMap(this, new Map()); + } +}; + +/** + @class MapWithDefault + @namespace Ember + @extends Ember.Map + @private + @constructor + @param [options] + @param {*} [options.defaultValue] +*/ +var MapWithDefault = Ember.MapWithDefault = function(options) { + Map.call(this); + this.defaultValue = options.defaultValue; +}; + +/** + @method create + @static + @param [options] + @param {*} [options.defaultValue] + @return {Ember.MapWithDefault|Ember.Map} If options are passed, returns + `Ember.MapWithDefault` otherwise returns `Ember.Map` +*/ +MapWithDefault.create = function(options) { + if (options) { + return new MapWithDefault(options); + } else { + return new Map(); + } +}; + +MapWithDefault.prototype = Ember.create(Map.prototype); + +/** + Retrieve the value associated with a given key. + + @method get + @param {*} key + @return {*} the value associated with the key, or the default value +*/ +MapWithDefault.prototype.get = function(key) { + var hasValue = this.has(key); + + if (hasValue) { + return Map.prototype.get.call(this, key); + } else { + var defaultValue = this.defaultValue(key); + this.set(key, defaultValue); + return defaultValue; + } +}; + +/** + @method copy + @return {Ember.MapWithDefault} +*/ +MapWithDefault.prototype.copy = function() { + return copyMap(this, new MapWithDefault({ + defaultValue: this.defaultValue + })); +}; + +})(); + + + +(function() { +/** +@module ember-metal +*/ + +var META_KEY = Ember.META_KEY, + metaFor = Ember.meta, + objectDefineProperty = Ember.platform.defineProperty; + +var MANDATORY_SETTER = Ember.ENV.MANDATORY_SETTER; + +// .......................................................... +// DESCRIPTOR +// + +/** + Objects of this type can implement an interface to respond to requests to + get and set. The default implementation handles simple properties. + + You generally won't need to create or subclass this directly. + + @class Descriptor + @namespace Ember + @private + @constructor +*/ +Ember.Descriptor = function() {}; + +// .......................................................... +// DEFINING PROPERTIES API +// + +var MANDATORY_SETTER_FUNCTION = Ember.MANDATORY_SETTER_FUNCTION = function(value) { + Ember.assert("You must use Ember.set() to access this property (of " + this + ")", false); +}; + +var DEFAULT_GETTER_FUNCTION = Ember.DEFAULT_GETTER_FUNCTION = function(name) { + return function() { + var meta = this[META_KEY]; + return meta && meta.values[name]; + }; +}; + +/** + @private + + NOTE: This is a low-level method used by other parts of the API. You almost + never want to call this method directly. Instead you should use + `Ember.mixin()` to define new properties. + + Defines a property on an object. This method works much like the ES5 + `Object.defineProperty()` method except that it can also accept computed + properties and other special descriptors. + + Normally this method takes only three parameters. However if you pass an + instance of `Ember.Descriptor` as the third param then you can pass an + optional value as the fourth parameter. This is often more efficient than + creating new descriptor hashes for each property. + + ## Examples + + ```javascript + // ES5 compatible mode + Ember.defineProperty(contact, 'firstName', { + writable: true, + configurable: false, + enumerable: true, + value: 'Charles' + }); + + // define a simple property + Ember.defineProperty(contact, 'lastName', undefined, 'Jolley'); + + // define a computed property + Ember.defineProperty(contact, 'fullName', Ember.computed(function() { + return this.firstName+' '+this.lastName; + }).property('firstName', 'lastName')); + ``` + + @method defineProperty + @for Ember + @param {Object} obj the object to define this property on. This may be a prototype. + @param {String} keyName the name of the property + @param {Ember.Descriptor} [desc] an instance of `Ember.Descriptor` (typically a + computed property) or an ES5 descriptor. + You must provide this or `data` but not both. + @param {*} [data] something other than a descriptor, that will + become the explicit value of this property. +*/ +Ember.defineProperty = function(obj, keyName, desc, data, meta) { + var descs, existingDesc, watching, value; + + if (!meta) meta = metaFor(obj); + descs = meta.descs; + existingDesc = meta.descs[keyName]; + watching = meta.watching[keyName] > 0; + + if (existingDesc instanceof Ember.Descriptor) { + existingDesc.teardown(obj, keyName); + } + + if (desc instanceof Ember.Descriptor) { + value = desc; + + descs[keyName] = desc; + if (MANDATORY_SETTER && watching) { + objectDefineProperty(obj, keyName, { + configurable: true, + enumerable: true, + writable: true, + value: undefined // make enumerable + }); + } else { + obj[keyName] = undefined; // make enumerable + } + desc.setup(obj, keyName); + } else { + descs[keyName] = undefined; // shadow descriptor in proto + if (desc == null) { + value = data; + + if (MANDATORY_SETTER && watching) { + meta.values[keyName] = data; + objectDefineProperty(obj, keyName, { + configurable: true, + enumerable: true, + set: MANDATORY_SETTER_FUNCTION, + get: DEFAULT_GETTER_FUNCTION(keyName) + }); + } else { + obj[keyName] = data; + } + } else { + value = desc; + + // compatibility with ES5 + objectDefineProperty(obj, keyName, desc); + } + } + + // if key is being watched, override chains that + // were initialized with the prototype + if (watching) { Ember.overrideChains(obj, keyName, meta); } + + // The `value` passed to the `didDefineProperty` hook is + // either the descriptor or data, whichever was passed. + if (obj.didDefineProperty) { obj.didDefineProperty(obj, keyName, value); } + + return this; +}; + + +})(); + + + +(function() { +var changeProperties = Ember.changeProperties, + set = Ember.set; + +/** + Set a list of properties on an object. These properties are set inside + a single `beginPropertyChanges` and `endPropertyChanges` batch, so + observers will be buffered. + + @method setProperties + @param self + @param {Object} hash + @return self +*/ +Ember.setProperties = function(self, hash) { + changeProperties(function(){ + for(var prop in hash) { + if (hash.hasOwnProperty(prop)) { set(self, prop, hash[prop]); } + } + }); + return self; +}; +})(); + + + +(function() { +var metaFor = Ember.meta, // utils.js + typeOf = Ember.typeOf, // utils.js + MANDATORY_SETTER = Ember.ENV.MANDATORY_SETTER, + o_defineProperty = Ember.platform.defineProperty; + +Ember.watchKey = function(obj, keyName) { + // can't watch length on Array - it is special... + if (keyName === 'length' && typeOf(obj) === 'array') { return; } + + var m = metaFor(obj), watching = m.watching, desc; + + // activate watching first time + if (!watching[keyName]) { + watching[keyName] = 1; + desc = m.descs[keyName]; + if (desc && desc.willWatch) { desc.willWatch(obj, keyName); } + + if ('function' === typeof obj.willWatchProperty) { + obj.willWatchProperty(keyName); + } + + if (MANDATORY_SETTER && keyName in obj) { + m.values[keyName] = obj[keyName]; + o_defineProperty(obj, keyName, { + configurable: true, + enumerable: true, + set: Ember.MANDATORY_SETTER_FUNCTION, + get: Ember.DEFAULT_GETTER_FUNCTION(keyName) + }); + } + } else { + watching[keyName] = (watching[keyName] || 0) + 1; + } +}; + + +Ember.unwatchKey = function(obj, keyName) { + var m = metaFor(obj), watching = m.watching, desc; + + if (watching[keyName] === 1) { + watching[keyName] = 0; + desc = m.descs[keyName]; + + if (desc && desc.didUnwatch) { desc.didUnwatch(obj, keyName); } + + if ('function' === typeof obj.didUnwatchProperty) { + obj.didUnwatchProperty(keyName); + } + + if (MANDATORY_SETTER && keyName in obj) { + o_defineProperty(obj, keyName, { + configurable: true, + enumerable: true, + writable: true, + value: m.values[keyName] + }); + delete m.values[keyName]; + } + } else if (watching[keyName] > 1) { + watching[keyName]--; + } +}; +})(); + + + +(function() { +var metaFor = Ember.meta, // utils.js + get = Ember.get, // property_get.js + normalizeTuple = Ember.normalizeTuple, // property_get.js + forEach = Ember.ArrayPolyfills.forEach, // array.js + warn = Ember.warn, + watchKey = Ember.watchKey, + unwatchKey = Ember.unwatchKey, + propertyWillChange = Ember.propertyWillChange, + propertyDidChange = Ember.propertyDidChange, + FIRST_KEY = /^([^\.\*]+)/; + +function firstKey(path) { + return path.match(FIRST_KEY)[0]; +} + +var pendingQueue = []; + +// attempts to add the pendingQueue chains again. If some of them end up +// back in the queue and reschedule is true, schedules a timeout to try +// again. +Ember.flushPendingChains = function() { + if (pendingQueue.length === 0) { return; } // nothing to do + + var queue = pendingQueue; + pendingQueue = []; + + forEach.call(queue, function(q) { q[0].add(q[1]); }); + + warn('Watching an undefined global, Ember expects watched globals to be setup by the time the run loop is flushed, check for typos', pendingQueue.length === 0); +}; + + +function addChainWatcher(obj, keyName, node) { + if (!obj || ('object' !== typeof obj)) { return; } // nothing to do + + var m = metaFor(obj), nodes = m.chainWatchers; + + if (!m.hasOwnProperty('chainWatchers')) { + nodes = m.chainWatchers = {}; + } + + if (!nodes[keyName]) { nodes[keyName] = []; } + nodes[keyName].push(node); + watchKey(obj, keyName); +} + +var removeChainWatcher = Ember.removeChainWatcher = function(obj, keyName, node) { + if (!obj || 'object' !== typeof obj) { return; } // nothing to do + + var m = metaFor(obj, false); + if (!m.hasOwnProperty('chainWatchers')) { return; } // nothing to do + + var nodes = m.chainWatchers; + + if (nodes[keyName]) { + nodes = nodes[keyName]; + for (var i = 0, l = nodes.length; i < l; i++) { + if (nodes[i] === node) { nodes.splice(i, 1); } + } + } + unwatchKey(obj, keyName); +}; + +function isProto(pvalue) { + return metaFor(pvalue, false).proto === pvalue; +} + +// A ChainNode watches a single key on an object. If you provide a starting +// value for the key then the node won't actually watch it. For a root node +// pass null for parent and key and object for value. +var ChainNode = Ember._ChainNode = function(parent, key, value) { + this._parent = parent; + this._key = key; + + // _watching is true when calling get(this._parent, this._key) will + // return the value of this node. + // + // It is false for the root of a chain (because we have no parent) + // and for global paths (because the parent node is the object with + // the observer on it) + this._watching = value===undefined; + + this._value = value; + this._paths = {}; + if (this._watching) { + this._object = parent.value(); + if (this._object) { addChainWatcher(this._object, this._key, this); } + } + + // Special-case: the EachProxy relies on immediate evaluation to + // establish its observers. + // + // TODO: Replace this with an efficient callback that the EachProxy + // can implement. + if (this._parent && this._parent._key === '@each') { + this.value(); + } +}; + +var ChainNodePrototype = ChainNode.prototype; + +ChainNodePrototype.value = function() { + if (this._value === undefined && this._watching) { + var obj = this._parent.value(); + this._value = (obj && !isProto(obj)) ? get(obj, this._key) : undefined; + } + return this._value; +}; + +ChainNodePrototype.destroy = function() { + if (this._watching) { + var obj = this._object; + if (obj) { removeChainWatcher(obj, this._key, this); } + this._watching = false; // so future calls do nothing + } +}; + +// copies a top level object only +ChainNodePrototype.copy = function(obj) { + var ret = new ChainNode(null, null, obj), + paths = this._paths, path; + for (path in paths) { + if (paths[path] <= 0) { continue; } // this check will also catch non-number vals. + ret.add(path); + } + return ret; +}; + +// called on the root node of a chain to setup watchers on the specified +// path. +ChainNodePrototype.add = function(path) { + var obj, tuple, key, src, paths; + + paths = this._paths; + paths[path] = (paths[path] || 0) + 1; + + obj = this.value(); + tuple = normalizeTuple(obj, path); + + // the path was a local path + if (tuple[0] && tuple[0] === obj) { + path = tuple[1]; + key = firstKey(path); + path = path.slice(key.length+1); + + // global path, but object does not exist yet. + // put into a queue and try to connect later. + } else if (!tuple[0]) { + pendingQueue.push([this, path]); + tuple.length = 0; + return; + + // global path, and object already exists + } else { + src = tuple[0]; + key = path.slice(0, 0-(tuple[1].length+1)); + path = tuple[1]; + } + + tuple.length = 0; + this.chain(key, path, src); +}; + +// called on the root node of a chain to teardown watcher on the specified +// path +ChainNodePrototype.remove = function(path) { + var obj, tuple, key, src, paths; + + paths = this._paths; + if (paths[path] > 0) { paths[path]--; } + + obj = this.value(); + tuple = normalizeTuple(obj, path); + if (tuple[0] === obj) { + path = tuple[1]; + key = firstKey(path); + path = path.slice(key.length+1); + } else { + src = tuple[0]; + key = path.slice(0, 0-(tuple[1].length+1)); + path = tuple[1]; + } + + tuple.length = 0; + this.unchain(key, path); +}; + +ChainNodePrototype.count = 0; + +ChainNodePrototype.chain = function(key, path, src) { + var chains = this._chains, node; + if (!chains) { chains = this._chains = {}; } + + node = chains[key]; + if (!node) { node = chains[key] = new ChainNode(this, key, src); } + node.count++; // count chains... + + // chain rest of path if there is one + if (path && path.length>0) { + key = firstKey(path); + path = path.slice(key.length+1); + node.chain(key, path); // NOTE: no src means it will observe changes... + } +}; + +ChainNodePrototype.unchain = function(key, path) { + var chains = this._chains, node = chains[key]; + + // unchain rest of path first... + if (path && path.length>1) { + key = firstKey(path); + path = path.slice(key.length+1); + node.unchain(key, path); + } + + // delete node if needed. + node.count--; + if (node.count<=0) { + delete chains[node._key]; + node.destroy(); + } + +}; + +ChainNodePrototype.willChange = function() { + var chains = this._chains; + if (chains) { + for(var key in chains) { + if (!chains.hasOwnProperty(key)) { continue; } + chains[key].willChange(); + } + } + + if (this._parent) { this._parent.chainWillChange(this, this._key, 1); } +}; + +ChainNodePrototype.chainWillChange = function(chain, path, depth) { + if (this._key) { path = this._key + '.' + path; } + + if (this._parent) { + this._parent.chainWillChange(this, path, depth+1); + } else { + if (depth > 1) { propertyWillChange(this.value(), path); } + path = 'this.' + path; + if (this._paths[path] > 0) { propertyWillChange(this.value(), path); } + } +}; + +ChainNodePrototype.chainDidChange = function(chain, path, depth) { + if (this._key) { path = this._key + '.' + path; } + if (this._parent) { + this._parent.chainDidChange(this, path, depth+1); + } else { + if (depth > 1) { propertyDidChange(this.value(), path); } + path = 'this.' + path; + if (this._paths[path] > 0) { propertyDidChange(this.value(), path); } + } +}; + +ChainNodePrototype.didChange = function(suppressEvent) { + // invalidate my own value first. + if (this._watching) { + var obj = this._parent.value(); + if (obj !== this._object) { + removeChainWatcher(this._object, this._key, this); + this._object = obj; + addChainWatcher(obj, this._key, this); + } + this._value = undefined; + + // Special-case: the EachProxy relies on immediate evaluation to + // establish its observers. + if (this._parent && this._parent._key === '@each') + this.value(); + } + + // then notify chains... + var chains = this._chains; + if (chains) { + for(var key in chains) { + if (!chains.hasOwnProperty(key)) { continue; } + chains[key].didChange(suppressEvent); + } + } + + if (suppressEvent) { return; } + + // and finally tell parent about my path changing... + if (this._parent) { this._parent.chainDidChange(this, this._key, 1); } +}; + +Ember.finishChains = function(obj) { + var m = metaFor(obj, false), chains = m.chains; + if (chains) { + if (chains.value() !== obj) { + m.chains = chains = chains.copy(obj); + } + chains.didChange(true); + } +}; +})(); + + + +(function() { +var metaFor = Ember.meta, // utils.js + typeOf = Ember.typeOf, // utils.js + ChainNode = Ember._ChainNode; // chains.js + +// get the chains for the current object. If the current object has +// chains inherited from the proto they will be cloned and reconfigured for +// the current object. +function chainsFor(obj) { + var m = metaFor(obj), ret = m.chains; + if (!ret) { + ret = m.chains = new ChainNode(null, null, obj); + } else if (ret.value() !== obj) { + ret = m.chains = ret.copy(obj); + } + return ret; +} + +Ember.watchPath = function(obj, keyPath) { + // can't watch length on Array - it is special... + if (keyPath === 'length' && typeOf(obj) === 'array') { return; } + + var m = metaFor(obj), watching = m.watching; + + if (!watching[keyPath]) { // activate watching first time + watching[keyPath] = 1; + chainsFor(obj).add(keyPath); + } else { + watching[keyPath] = (watching[keyPath] || 0) + 1; + } +}; + +Ember.unwatchPath = function(obj, keyPath) { + var m = metaFor(obj), watching = m.watching; + + if (watching[keyPath] === 1) { + watching[keyPath] = 0; + chainsFor(obj).remove(keyPath); + } else if (watching[keyPath] > 1) { + watching[keyPath]--; + } +}; +})(); + + + +(function() { +/** +@module ember-metal +*/ + +var metaFor = Ember.meta, // utils.js + GUID_KEY = Ember.GUID_KEY, // utils.js + META_KEY = Ember.META_KEY, // utils.js + removeChainWatcher = Ember.removeChainWatcher, + watchKey = Ember.watchKey, // watch_key.js + unwatchKey = Ember.unwatchKey, + watchPath = Ember.watchPath, // watch_path.js + unwatchPath = Ember.unwatchPath, + typeOf = Ember.typeOf, // utils.js + generateGuid = Ember.generateGuid, + IS_PATH = /[\.\*]/; + +// returns true if the passed path is just a keyName +function isKeyName(path) { + return path==='*' || !IS_PATH.test(path); +} + +/** + @private + + Starts watching a property on an object. Whenever the property changes, + invokes `Ember.propertyWillChange` and `Ember.propertyDidChange`. This is the + primitive used by observers and dependent keys; usually you will never call + this method directly but instead use higher level methods like + `Ember.addObserver()` + + @method watch + @for Ember + @param obj + @param {String} keyName +*/ +Ember.watch = function(obj, keyPath) { + // can't watch length on Array - it is special... + if (keyPath === 'length' && typeOf(obj) === 'array') { return; } + + if (isKeyName(keyPath)) { + watchKey(obj, keyPath); + } else { + watchPath(obj, keyPath); + } +}; + +Ember.isWatching = function isWatching(obj, key) { + var meta = obj[META_KEY]; + return (meta && meta.watching[key]) > 0; +}; + +Ember.watch.flushPending = Ember.flushPendingChains; + +Ember.unwatch = function(obj, keyPath) { + // can't watch length on Array - it is special... + if (keyPath === 'length' && typeOf(obj) === 'array') { return; } + + if (isKeyName(keyPath)) { + unwatchKey(obj, keyPath); + } else { + unwatchPath(obj, keyPath); + } +}; + +/** + @private + + Call on an object when you first beget it from another object. This will + setup any chained watchers on the object instance as needed. This method is + safe to call multiple times. + + @method rewatch + @for Ember + @param obj +*/ +Ember.rewatch = function(obj) { + var m = metaFor(obj, false), chains = m.chains; + + // make sure the object has its own guid. + if (GUID_KEY in obj && !obj.hasOwnProperty(GUID_KEY)) { + generateGuid(obj, 'ember'); + } + + // make sure any chained watchers update. + if (chains && chains.value() !== obj) { + m.chains = chains.copy(obj); + } +}; + +var NODE_STACK = []; + +/** + Tears down the meta on an object so that it can be garbage collected. + Multiple calls will have no effect. + + @method destroy + @for Ember + @param {Object} obj the object to destroy + @return {void} +*/ +Ember.destroy = function (obj) { + var meta = obj[META_KEY], node, nodes, key, nodeObject; + if (meta) { + obj[META_KEY] = null; + // remove chainWatchers to remove circular references that would prevent GC + node = meta.chains; + if (node) { + NODE_STACK.push(node); + // process tree + while (NODE_STACK.length > 0) { + node = NODE_STACK.pop(); + // push children + nodes = node._chains; + if (nodes) { + for (key in nodes) { + if (nodes.hasOwnProperty(key)) { + NODE_STACK.push(nodes[key]); + } + } + } + // remove chainWatcher in node object + if (node._watching) { + nodeObject = node._object; + if (nodeObject) { + removeChainWatcher(nodeObject, node._key, node); + } + } + } + } + } +}; + +})(); + + + +(function() { +/** +@module ember-metal +*/ + +Ember.warn("The CP_DEFAULT_CACHEABLE flag has been removed and computed properties are always cached by default. Use `volatile` if you don't want caching.", Ember.ENV.CP_DEFAULT_CACHEABLE !== false); + + +var get = Ember.get, + set = Ember.set, + metaFor = Ember.meta, + a_slice = [].slice, + o_create = Ember.create, + META_KEY = Ember.META_KEY, + watch = Ember.watch, + unwatch = Ember.unwatch; + +// .......................................................... +// DEPENDENT KEYS +// + +// data structure: +// meta.deps = { +// 'depKey': { +// 'keyName': count, +// } +// } + +/* + This function returns a map of unique dependencies for a + given object and key. +*/ +function keysForDep(depsMeta, depKey) { + var keys = depsMeta[depKey]; + if (!keys) { + // if there are no dependencies yet for a the given key + // create a new empty list of dependencies for the key + keys = depsMeta[depKey] = {}; + } else if (!depsMeta.hasOwnProperty(depKey)) { + // otherwise if the dependency list is inherited from + // a superclass, clone the hash + keys = depsMeta[depKey] = o_create(keys); + } + return keys; +} + +function metaForDeps(meta) { + return keysForDep(meta, 'deps'); +} + +function addDependentKeys(desc, obj, keyName, meta) { + // the descriptor has a list of dependent keys, so + // add all of its dependent keys. + var depKeys = desc._dependentKeys, depsMeta, idx, len, depKey, keys; + if (!depKeys) return; + + depsMeta = metaForDeps(meta); + + for(idx = 0, len = depKeys.length; idx < len; idx++) { + depKey = depKeys[idx]; + // Lookup keys meta for depKey + keys = keysForDep(depsMeta, depKey); + // Increment the number of times depKey depends on keyName. + keys[keyName] = (keys[keyName] || 0) + 1; + // Watch the depKey + watch(obj, depKey); + } +} + +function removeDependentKeys(desc, obj, keyName, meta) { + // the descriptor has a list of dependent keys, so + // add all of its dependent keys. + var depKeys = desc._dependentKeys, depsMeta, idx, len, depKey, keys; + if (!depKeys) return; + + depsMeta = metaForDeps(meta); + + for(idx = 0, len = depKeys.length; idx < len; idx++) { + depKey = depKeys[idx]; + // Lookup keys meta for depKey + keys = keysForDep(depsMeta, depKey); + // Increment the number of times depKey depends on keyName. + keys[keyName] = (keys[keyName] || 0) - 1; + // Watch the depKey + unwatch(obj, depKey); + } +} + +// .......................................................... +// COMPUTED PROPERTY +// + +/** + @class ComputedProperty + @namespace Ember + @extends Ember.Descriptor + @constructor +*/ +function ComputedProperty(func, opts) { + this.func = func; + + this._cacheable = (opts && opts.cacheable !== undefined) ? opts.cacheable : true; + this._dependentKeys = opts && opts.dependentKeys; + this._readOnly = opts && (opts.readOnly !== undefined || !!opts.readOnly); +} + +Ember.ComputedProperty = ComputedProperty; +ComputedProperty.prototype = new Ember.Descriptor(); + +var ComputedPropertyPrototype = ComputedProperty.prototype; + +/* + Properties are cacheable by default. Computed property will automatically + cache the return value of your function until one of the dependent keys changes. + + Call `volatile()` to set it into non-cached mode. When in this mode + the computed property will not automatically cache the return value. + + However, if a property is properly observable, there is no reason to disable + caching. + + @method cacheable + @param {Boolean} aFlag optional set to `false` to disable caching + @return {Ember.ComputedProperty} this + @chainable +*/ +ComputedPropertyPrototype.cacheable = function(aFlag) { + this._cacheable = aFlag !== false; + return this; +}; + +/** + Call on a computed property to set it into non-cached mode. When in this + mode the computed property will not automatically cache the return value. + + ```javascript + MyApp.outsideService = Ember.Object.create({ + value: function() { + return OutsideService.getValue(); + }.property().volatile() + }); + ``` + + @method volatile + @return {Ember.ComputedProperty} this + @chainable +*/ +ComputedPropertyPrototype.volatile = function() { + return this.cacheable(false); +}; + +/** + Call on a computed property to set it into read-only mode. When in this + mode the computed property will throw an error when set. + + ```javascript + MyApp.person = Ember.Object.create({ + guid: function() { + return 'guid-guid-guid'; + }.property().readOnly() + }); + + MyApp.person.set('guid', 'new-guid'); // will throw an exception + ``` + + @method readOnly + @return {Ember.ComputedProperty} this + @chainable +*/ +ComputedPropertyPrototype.readOnly = function(readOnly) { + this._readOnly = readOnly === undefined || !!readOnly; + return this; +}; + +/** + Sets the dependent keys on this computed property. Pass any number of + arguments containing key paths that this computed property depends on. + + ```javascript + MyApp.president = Ember.Object.create({ + fullName: Ember.computed(function() { + return this.get('firstName') + ' ' + this.get('lastName'); + + // Tell Ember that this computed property depends on firstName + // and lastName + }).property('firstName', 'lastName') + }); + ``` + + @method property + @param {String} path* zero or more property paths + @return {Ember.ComputedProperty} this + @chainable +*/ +ComputedPropertyPrototype.property = function() { + var args = []; + for (var i = 0, l = arguments.length; i < l; i++) { + args.push(arguments[i]); + } + this._dependentKeys = args; + return this; +}; + +/** + In some cases, you may want to annotate computed properties with additional + metadata about how they function or what values they operate on. For example, + computed property functions may close over variables that are then no longer + available for introspection. + + You can pass a hash of these values to a computed property like this: + + ``` + person: function() { + var personId = this.get('personId'); + return App.Person.create({ id: personId }); + }.property().meta({ type: App.Person }) + ``` + + The hash that you pass to the `meta()` function will be saved on the + computed property descriptor under the `_meta` key. Ember runtime + exposes a public API for retrieving these values from classes, + via the `metaForProperty()` function. + + @method meta + @param {Hash} meta + @chainable +*/ + +ComputedPropertyPrototype.meta = function(meta) { + if (arguments.length === 0) { + return this._meta || {}; + } else { + this._meta = meta; + return this; + } +}; + +/* impl descriptor API */ +ComputedPropertyPrototype.willWatch = function(obj, keyName) { + // watch already creates meta for this instance + var meta = obj[META_KEY]; + Ember.assert('watch should have setup meta to be writable', meta.source === obj); + if (!(keyName in meta.cache)) { + addDependentKeys(this, obj, keyName, meta); + } +}; + +ComputedPropertyPrototype.didUnwatch = function(obj, keyName) { + var meta = obj[META_KEY]; + Ember.assert('unwatch should have setup meta to be writable', meta.source === obj); + if (!(keyName in meta.cache)) { + // unwatch already creates meta for this instance + removeDependentKeys(this, obj, keyName, meta); + } +}; + +/* impl descriptor API */ +ComputedPropertyPrototype.didChange = function(obj, keyName) { + // _suspended is set via a CP.set to ensure we don't clear + // the cached value set by the setter + if (this._cacheable && this._suspended !== obj) { + var meta = metaFor(obj); + if (keyName in meta.cache) { + delete meta.cache[keyName]; + if (!meta.watching[keyName]) { + removeDependentKeys(this, obj, keyName, meta); + } + } + } +}; + +/* impl descriptor API */ +ComputedPropertyPrototype.get = function(obj, keyName) { + var ret, cache, meta; + if (this._cacheable) { + meta = metaFor(obj); + cache = meta.cache; + if (keyName in cache) { return cache[keyName]; } + ret = cache[keyName] = this.func.call(obj, keyName); + if (!meta.watching[keyName]) { + addDependentKeys(this, obj, keyName, meta); + } + } else { + ret = this.func.call(obj, keyName); + } + return ret; +}; + +/* impl descriptor API */ +ComputedPropertyPrototype.set = function(obj, keyName, value) { + var cacheable = this._cacheable, + func = this.func, + meta = metaFor(obj, cacheable), + watched = meta.watching[keyName], + oldSuspended = this._suspended, + hadCachedValue = false, + cache = meta.cache, + cachedValue, ret; + + if (this._readOnly) { + throw new Error('Cannot Set: ' + keyName + ' on: ' + obj.toString() ); + } + + this._suspended = obj; + + try { + + if (cacheable && cache.hasOwnProperty(keyName)) { + cachedValue = cache[keyName]; + hadCachedValue = true; + } + + // Check if the CP has been wrapped + if (func.wrappedFunction) { func = func.wrappedFunction; } + + // For backwards-compatibility with computed properties + // that check for arguments.length === 2 to determine if + // they are being get or set, only pass the old cached + // value if the computed property opts into a third + // argument. + if (func.length === 3) { + ret = func.call(obj, keyName, value, cachedValue); + } else if (func.length === 2) { + ret = func.call(obj, keyName, value); + } else { + Ember.defineProperty(obj, keyName, null, cachedValue); + Ember.set(obj, keyName, value); + return; + } + + if (hadCachedValue && cachedValue === ret) { return; } + + if (watched) { Ember.propertyWillChange(obj, keyName); } + + if (hadCachedValue) { + delete cache[keyName]; + } + + if (cacheable) { + if (!watched && !hadCachedValue) { + addDependentKeys(this, obj, keyName, meta); + } + cache[keyName] = ret; + } + + if (watched) { Ember.propertyDidChange(obj, keyName); } + } finally { + this._suspended = oldSuspended; + } + return ret; +}; + +/* called when property is defined */ +ComputedPropertyPrototype.setup = function(obj, keyName) { + var meta = obj[META_KEY]; + if (meta && meta.watching[keyName]) { + addDependentKeys(this, obj, keyName, metaFor(obj)); + } +}; + +/* called before property is overridden */ +ComputedPropertyPrototype.teardown = function(obj, keyName) { + var meta = metaFor(obj); + + if (meta.watching[keyName] || keyName in meta.cache) { + removeDependentKeys(this, obj, keyName, meta); + } + + if (this._cacheable) { delete meta.cache[keyName]; } + + return null; // no value to restore +}; + + +/** + This helper returns a new property descriptor that wraps the passed + computed property function. You can use this helper to define properties + with mixins or via `Ember.defineProperty()`. + + The function you pass will be used to both get and set property values. + The function should accept two parameters, key and value. If value is not + undefined you should set the value first. In either case return the + current value of the property. + @method computed + @for Ember + @param {Function} func The computed property function. + @return {Ember.ComputedProperty} property descriptor instance +*/ +Ember.computed = function(func) { + var args; + + if (arguments.length > 1) { + args = a_slice.call(arguments, 0, -1); + func = a_slice.call(arguments, -1)[0]; + } + + if ( typeof func !== "function" ) { + throw new Error("Computed Property declared without a property function"); + } + + var cp = new ComputedProperty(func); + + if (args) { + cp.property.apply(cp, args); + } + + return cp; +}; + +/** + Returns the cached value for a property, if one exists. + This can be useful for peeking at the value of a computed + property that is generated lazily, without accidentally causing + it to be created. + + @method cacheFor + @for Ember + @param {Object} obj the object whose property you want to check + @param {String} key the name of the property whose cached value you want + to return + @return {*} the cached value +*/ +Ember.cacheFor = function cacheFor(obj, key) { + var cache = metaFor(obj, false).cache; + + if (cache && key in cache) { + return cache[key]; + } +}; + +function getProperties(self, propertyNames) { + var ret = {}; + for(var i = 0; i < propertyNames.length; i++) { + ret[propertyNames[i]] = get(self, propertyNames[i]); + } + return ret; +} + +function registerComputed(name, macro) { + Ember.computed[name] = function(dependentKey) { + var args = a_slice.call(arguments); + return Ember.computed(dependentKey, function() { + return macro.apply(this, args); + }); + }; +} + +function registerComputedWithProperties(name, macro) { + Ember.computed[name] = function() { + var properties = a_slice.call(arguments); + + var computed = Ember.computed(function() { + return macro.apply(this, [getProperties(this, properties)]); + }); + + return computed.property.apply(computed, properties); + }; +} + +/** + @method computed.empty + @for Ember + @param {String} dependentKey + @return {Ember.ComputedProperty} computed property which negate + the original value for property +*/ +registerComputed('empty', function(dependentKey) { + return Ember.isEmpty(get(this, dependentKey)); +}); + +/** + @method computed.notEmpty + @for Ember + @param {String} dependentKey + @return {Ember.ComputedProperty} computed property which returns true if + original value for property is not empty. +*/ +registerComputed('notEmpty', function(dependentKey) { + return !Ember.isEmpty(get(this, dependentKey)); +}); + +/** + @method computed.none + @for Ember + @param {String} dependentKey + @return {Ember.ComputedProperty} computed property which + rturns true if original value for property is null or undefined. +*/ +registerComputed('none', function(dependentKey) { + return Ember.isNone(get(this, dependentKey)); +}); + +/** + @method computed.not + @for Ember + @param {String} dependentKey + @return {Ember.ComputedProperty} computed property which returns + inverse of the original value for property +*/ +registerComputed('not', function(dependentKey) { + return !get(this, dependentKey); +}); + +/** + @method computed.bool + @for Ember + @param {String} dependentKey + @return {Ember.ComputedProperty} computed property which convert + to boolean the original value for property +*/ +registerComputed('bool', function(dependentKey) { + return !!get(this, dependentKey); +}); + +/** + @method computed.match + @for Ember + @param {String} dependentKey + @param {RegExp} regexp + @return {Ember.ComputedProperty} computed property which match + the original value for property against a given RegExp +*/ +registerComputed('match', function(dependentKey, regexp) { + var value = get(this, dependentKey); + return typeof value === 'string' ? !!value.match(regexp) : false; +}); + +/** + @method computed.equal + @for Ember + @param {String} dependentKey + @param {String|Number|Object} value + @return {Ember.ComputedProperty} computed property which returns true if + the original value for property is equal to the given value. +*/ +registerComputed('equal', function(dependentKey, value) { + return get(this, dependentKey) === value; +}); + +/** + @method computed.gt + @for Ember + @param {String} dependentKey + @param {Number} value + @return {Ember.ComputedProperty} computed property which returns true if + the original value for property is greater then given value. +*/ +registerComputed('gt', function(dependentKey, value) { + return get(this, dependentKey) > value; +}); + +/** + @method computed.gte + @for Ember + @param {String} dependentKey + @param {Number} value + @return {Ember.ComputedProperty} computed property which returns true if + the original value for property is greater or equal then given value. +*/ +registerComputed('gte', function(dependentKey, value) { + return get(this, dependentKey) >= value; +}); + +/** + @method computed.lt + @for Ember + @param {String} dependentKey + @param {Number} value + @return {Ember.ComputedProperty} computed property which returns true if + the original value for property is less then given value. +*/ +registerComputed('lt', function(dependentKey, value) { + return get(this, dependentKey) < value; +}); + +/** + @method computed.lte + @for Ember + @param {String} dependentKey + @param {Number} value + @return {Ember.ComputedProperty} computed property which returns true if + the original value for property is less or equal then given value. +*/ +registerComputed('lte', function(dependentKey, value) { + return get(this, dependentKey) <= value; +}); + +/** + @method computed.and + @for Ember + @param {String} dependentKey, [dependentKey...] + @return {Ember.ComputedProperty} computed property which peforms + a logical `and` on the values of all the original values for properties. +*/ +registerComputedWithProperties('and', function(properties) { + for (var key in properties) { + if (properties.hasOwnProperty(key) && !properties[key]) { + return false; + } + } + return true; +}); + +/** + @method computed.or + @for Ember + @param {String} dependentKey, [dependentKey...] + @return {Ember.ComputedProperty} computed property which peforms + a logical `or` on the values of all the original values for properties. +*/ +registerComputedWithProperties('or', function(properties) { + for (var key in properties) { + if (properties.hasOwnProperty(key) && properties[key]) { + return true; + } + } + return false; +}); + +/** + @method computed.any + @for Ember + @param {String} dependentKey, [dependentKey...] + @return {Ember.ComputedProperty} computed property which returns + the first truthy value of given list of properties. +*/ +registerComputedWithProperties('any', function(properties) { + for (var key in properties) { + if (properties.hasOwnProperty(key) && properties[key]) { + return properties[key]; + } + } + return null; +}); + +/** + @method computed.map + @for Ember + @param {String} dependentKey, [dependentKey...] + @return {Ember.ComputedProperty} computed property which maps + values of all passed properties in to an array. +*/ +registerComputedWithProperties('map', function(properties) { + var res = []; + for (var key in properties) { + if (properties.hasOwnProperty(key)) { + if (Ember.isNone(properties[key])) { + res.push(null); + } else { + res.push(properties[key]); + } + } + } + return res; +}); + +/** + @method computed.alias + @for Ember + @param {String} dependentKey + @return {Ember.ComputedProperty} computed property which creates an + alias to the original value for property. +*/ +Ember.computed.alias = function(dependentKey) { + return Ember.computed(dependentKey, function(key, value){ + if (arguments.length > 1) { + set(this, dependentKey, value); + return value; + } else { + return get(this, dependentKey); + } + }); +}; + +/** + @method computed.oneWay + @for Ember + @param {String} dependentKey + @return {Ember.ComputedProperty} computed property which creates an + one way computed property to the original value for property. + + Where `computed.alias` aliases `get` and `set`, and allows for bidirectional + data flow, `computed.oneWay` only provides an aliased `get`. The `set` will + not mutate the upstream property, rather causes the current property to + become the value set. This causes the downstream property to permentantly + diverge from the upstream property. + + ```javascript + User = Ember.Object.extend({ + firstName: null, + lastName: null, + nickName: Ember.computed.oneWay('firstName') + }); + + user = User.create({ + firstName: 'Teddy', + lastName: 'Zeenny' + }); + + user.get('nickName'); + # 'Teddy' + + user.set('nickName', 'TeddyBear'); + # 'TeddyBear' + + user.get('firstName'); + # 'Teddy' + ``` +*/ +Ember.computed.oneWay = function(dependentKey) { + return Ember.computed(dependentKey, function() { + return get(this, dependentKey); + }); +}; + + +/** + @method computed.defaultTo + @for Ember + @param {String} defaultPath + @return {Ember.ComputedProperty} computed property which acts like + a standard getter and setter, but defaults to the value from `defaultPath`. +*/ +Ember.computed.defaultTo = function(defaultPath) { + return Ember.computed(function(key, newValue, cachedValue) { + if (arguments.length === 1) { + return cachedValue != null ? cachedValue : get(this, defaultPath); + } + return newValue != null ? newValue : get(this, defaultPath); + }); +}; + +})(); + + + +(function() { +// Ember.tryFinally +/** +@module ember-metal +*/ + +var AFTER_OBSERVERS = ':change'; +var BEFORE_OBSERVERS = ':before'; + +function changeEvent(keyName) { + return keyName+AFTER_OBSERVERS; +} + +function beforeEvent(keyName) { + return keyName+BEFORE_OBSERVERS; +} + +/** + @method addObserver + @param obj + @param {String} path + @param {Object|Function} targetOrMethod + @param {Function|String} [method] +*/ +Ember.addObserver = function(obj, path, target, method) { + Ember.addListener(obj, changeEvent(path), target, method); + Ember.watch(obj, path); + return this; +}; + +Ember.observersFor = function(obj, path) { + return Ember.listenersFor(obj, changeEvent(path)); +}; + +/** + @method removeObserver + @param obj + @param {String} path + @param {Object|Function} targetOrMethod + @param {Function|String} [method] +*/ +Ember.removeObserver = function(obj, path, target, method) { + Ember.unwatch(obj, path); + Ember.removeListener(obj, changeEvent(path), target, method); + return this; +}; + +/** + @method addBeforeObserver + @param obj + @param {String} path + @param {Object|Function} targetOrMethod + @param {Function|String} [method] +*/ +Ember.addBeforeObserver = function(obj, path, target, method) { + Ember.addListener(obj, beforeEvent(path), target, method); + Ember.watch(obj, path); + return this; +}; + +// Suspend observer during callback. +// +// This should only be used by the target of the observer +// while it is setting the observed path. +Ember._suspendBeforeObserver = function(obj, path, target, method, callback) { + return Ember._suspendListener(obj, beforeEvent(path), target, method, callback); +}; + +Ember._suspendObserver = function(obj, path, target, method, callback) { + return Ember._suspendListener(obj, changeEvent(path), target, method, callback); +}; + +var map = Ember.ArrayPolyfills.map; + +Ember._suspendBeforeObservers = function(obj, paths, target, method, callback) { + var events = map.call(paths, beforeEvent); + return Ember._suspendListeners(obj, events, target, method, callback); +}; + +Ember._suspendObservers = function(obj, paths, target, method, callback) { + var events = map.call(paths, changeEvent); + return Ember._suspendListeners(obj, events, target, method, callback); +}; + +Ember.beforeObserversFor = function(obj, path) { + return Ember.listenersFor(obj, beforeEvent(path)); +}; + +/** + @method removeBeforeObserver + @param obj + @param {String} path + @param {Object|Function} targetOrMethod + @param {Function|String} [method] +*/ +Ember.removeBeforeObserver = function(obj, path, target, method) { + Ember.unwatch(obj, path); + Ember.removeListener(obj, beforeEvent(path), target, method); + return this; +}; +})(); + + + +(function() { +define("backburner", + ["backburner/deferred_action_queues","exports"], + function(__dependency1__, __exports__) { + "use strict"; + var DeferredActionQueues = __dependency1__.DeferredActionQueues; + + var slice = [].slice, + pop = [].pop, + debouncees = [], + timers = [], + autorun, laterTimer, laterTimerExpiresAt; + + function Backburner(queueNames, options) { + this.queueNames = queueNames; + this.options = options || {}; + if (!this.options.defaultQueue) { + this.options.defaultQueue = queueNames[0]; + } + this.instanceStack = []; + } + + Backburner.prototype = { + queueNames: null, + options: null, + currentInstance: null, + instanceStack: null, + + begin: function() { + var onBegin = this.options && this.options.onBegin, + previousInstance = this.currentInstance; + + if (previousInstance) { + this.instanceStack.push(previousInstance); + } + + this.currentInstance = new DeferredActionQueues(this.queueNames, this.options); + if (onBegin) { + onBegin(this.currentInstance, previousInstance); + } + }, + + end: function() { + var onEnd = this.options && this.options.onEnd, + currentInstance = this.currentInstance, + nextInstance = null; + + try { + currentInstance.flush(); + } finally { + this.currentInstance = null; + + if (this.instanceStack.length) { + nextInstance = this.instanceStack.pop(); + this.currentInstance = nextInstance; + } + + if (onEnd) { + onEnd(currentInstance, nextInstance); + } + } + }, + + run: function(target, method /*, args */) { + var ret; + this.begin(); + + if (!method) { + method = target; + target = null; + } + + if (typeof method === 'string') { + method = target[method]; + } + + // Prevent Safari double-finally. + var finallyAlreadyCalled = false; + try { + if (arguments.length > 2) { + ret = method.apply(target, slice.call(arguments, 2)); + } else { + ret = method.call(target); + } + } finally { + if (!finallyAlreadyCalled) { + finallyAlreadyCalled = true; + this.end(); + } + } + return ret; + }, + + defer: function(queueName, target, method /* , args */) { + if (!method) { + method = target; + target = null; + } + + if (typeof method === 'string') { + method = target[method]; + } + + var stack = this.DEBUG ? new Error().stack : undefined, + args = arguments.length > 3 ? slice.call(arguments, 3) : undefined; + if (!this.currentInstance) { createAutorun(this); } + return this.currentInstance.schedule(queueName, target, method, args, false, stack); + }, + + deferOnce: function(queueName, target, method /* , args */) { + if (!method) { + method = target; + target = null; + } + + if (typeof method === 'string') { + method = target[method]; + } + + var stack = this.DEBUG ? new Error().stack : undefined, + args = arguments.length > 3 ? slice.call(arguments, 3) : undefined; + if (!this.currentInstance) { createAutorun(this); } + return this.currentInstance.schedule(queueName, target, method, args, true, stack); + }, + + setTimeout: function() { + var self = this, + wait = pop.call(arguments), + target = arguments[0], + method = arguments[1], + executeAt = (+new Date()) + wait; + + if (!method) { + method = target; + target = null; + } + + if (typeof method === 'string') { + method = target[method]; + } + + var fn, args; + if (arguments.length > 2) { + args = slice.call(arguments, 2); + + fn = function() { + method.apply(target, args); + }; + } else { + fn = function() { + method.call(target); + }; + } + + // find position to insert - TODO: binary search + var i, l; + for (i = 0, l = timers.length; i < l; i += 2) { + if (executeAt < timers[i]) { break; } + } + + timers.splice(i, 0, executeAt, fn); + + if (laterTimer && laterTimerExpiresAt < executeAt) { return fn; } + + if (laterTimer) { + clearTimeout(laterTimer); + laterTimer = null; + } + laterTimer = window.setTimeout(function() { + executeTimers(self); + laterTimer = null; + laterTimerExpiresAt = null; + }, wait); + laterTimerExpiresAt = executeAt; + + return fn; + }, + + debounce: function(target, method /* , args, wait */) { + var self = this, + args = arguments, + wait = pop.call(args), + debouncee; + + for (var i = 0, l = debouncees.length; i < l; i++) { + debouncee = debouncees[i]; + if (debouncee[0] === target && debouncee[1] === method) { return; } // do nothing + } + + var timer = window.setTimeout(function() { + self.run.apply(self, args); + + // remove debouncee + var index = -1; + for (var i = 0, l = debouncees.length; i < l; i++) { + debouncee = debouncees[i]; + if (debouncee[0] === target && debouncee[1] === method) { + index = i; + break; + } + } + + if (index > -1) { debouncees.splice(index, 1); } + }, wait); + + debouncees.push([target, method, timer]); + }, + + cancelTimers: function() { + for (var i = 0, l = debouncees.length; i < l; i++) { + clearTimeout(debouncees[i][2]); + } + debouncees = []; + + if (laterTimer) { + clearTimeout(laterTimer); + laterTimer = null; + } + timers = []; + + if (autorun) { + clearTimeout(autorun); + autorun = null; + } + }, + + hasTimers: function() { + return !!timers.length || autorun; + }, + + cancel: function(timer) { + if (timer && typeof timer === 'object' && timer.queue && timer.method) { // we're cancelling a deferOnce + return timer.queue.cancel(timer); + } else if (typeof timer === 'function') { // we're cancelling a setTimeout + for (var i = 0, l = timers.length; i < l; i += 2) { + if (timers[i + 1] === timer) { + timers.splice(i, 2); // remove the two elements + return true; + } + } + } else { + return; // timer was null or not a timer + } + } + }; + + Backburner.prototype.schedule = Backburner.prototype.defer; + Backburner.prototype.scheduleOnce = Backburner.prototype.deferOnce; + Backburner.prototype.later = Backburner.prototype.setTimeout; + + function createAutorun(backburner) { + backburner.begin(); + autorun = window.setTimeout(function() { + backburner.end(); + autorun = null; + }); + } + + function executeTimers(self) { + var now = +new Date(), + time, fns, i, l; + + self.run(function() { + // TODO: binary search + for (i = 0, l = timers.length; i < l; i += 2) { + time = timers[i]; + if (time > now) { break; } + } + + fns = timers.splice(0, i); + + for (i = 1, l = fns.length; i < l; i += 2) { + self.schedule(self.options.defaultQueue, null, fns[i]); + } + }); + + if (timers.length) { + laterTimer = window.setTimeout(function() { + executeTimers(self); + laterTimer = null; + laterTimerExpiresAt = null; + }, timers[0] - now); + laterTimerExpiresAt = timers[0]; + } + } + + + __exports__.Backburner = Backburner; + }); + +define("backburner/deferred_action_queues", + ["backburner/queue","exports"], + function(__dependency1__, __exports__) { + "use strict"; + var Queue = __dependency1__.Queue; + + function DeferredActionQueues(queueNames, options) { + var queues = this.queues = {}; + this.queueNames = queueNames = queueNames || []; + + var queueName; + for (var i = 0, l = queueNames.length; i < l; i++) { + queueName = queueNames[i]; + queues[queueName] = new Queue(this, queueName, options[queueName]); + } + } + + DeferredActionQueues.prototype = { + queueNames: null, + queues: null, + + schedule: function(queueName, target, method, args, onceFlag, stack) { + var queues = this.queues, + queue = queues[queueName]; + + if (!queue) { throw new Error("You attempted to schedule an action in a queue (" + queueName + ") that doesn't exist"); } + + if (onceFlag) { + return queue.pushUnique(target, method, args, stack); + } else { + return queue.push(target, method, args, stack); + } + }, + + flush: function() { + var queues = this.queues, + queueNames = this.queueNames, + queueName, queue, queueItems, priorQueueNameIndex, + queueNameIndex = 0, numberOfQueues = queueNames.length; + + outerloop: + while (queueNameIndex < numberOfQueues) { + queueName = queueNames[queueNameIndex]; + queue = queues[queueName]; + queueItems = queue._queueBeingFlushed = queue._queue.slice(); + queue._queue = []; + + var options = queue.options, + before = options && options.before, + after = options && options.after, + target, method, args, stack, + queueIndex = 0, numberOfQueueItems = queueItems.length; + + if (numberOfQueueItems && before) { before(); } + while (queueIndex < numberOfQueueItems) { + target = queueItems[queueIndex]; + method = queueItems[queueIndex+1]; + args = queueItems[queueIndex+2]; + stack = queueItems[queueIndex+3]; // Debugging assistance + + if (typeof method === 'string') { method = target[method]; } + + // method could have been nullified / canceled during flush + if (method) { + // TODO: error handling + if (args && args.length > 0) { + method.apply(target, args); + } else { + method.call(target); + } + } + + queueIndex += 4; + } + queue._queueBeingFlushed = null; + if (numberOfQueueItems && after) { after(); } + + if ((priorQueueNameIndex = indexOfPriorQueueWithActions(this, queueNameIndex)) !== -1) { + queueNameIndex = priorQueueNameIndex; + continue outerloop; + } + + queueNameIndex++; + } + } + }; + + function indexOfPriorQueueWithActions(daq, currentQueueIndex) { + var queueName, queue; + + for (var i = 0, l = currentQueueIndex; i <= l; i++) { + queueName = daq.queueNames[i]; + queue = daq.queues[queueName]; + if (queue._queue.length) { return i; } + } + + return -1; + } + + + __exports__.DeferredActionQueues = DeferredActionQueues; + }); + +define("backburner/queue", + ["exports"], + function(__exports__) { + "use strict"; + function Queue(daq, name, options) { + this.daq = daq; + this.name = name; + this.options = options; + this._queue = []; + } + + Queue.prototype = { + daq: null, + name: null, + options: null, + _queue: null, + + push: function(target, method, args, stack) { + var queue = this._queue; + queue.push(target, method, args, stack); + return {queue: this, target: target, method: method}; + }, + + pushUnique: function(target, method, args, stack) { + var queue = this._queue, currentTarget, currentMethod, i, l; + + for (i = 0, l = queue.length; i < l; i += 4) { + currentTarget = queue[i]; + currentMethod = queue[i+1]; + + if (currentTarget === target && currentMethod === method) { + queue[i+2] = args; // replace args + queue[i+3] = stack; // replace stack + return {queue: this, target: target, method: method}; // TODO: test this code path + } + } + + this._queue.push(target, method, args, stack); + return {queue: this, target: target, method: method}; + }, + + // TODO: remove me, only being used for Ember.run.sync + flush: function() { + var queue = this._queue, + options = this.options, + before = options && options.before, + after = options && options.after, + target, method, args, stack, i, l = queue.length; + + if (l && before) { before(); } + for (i = 0; i < l; i += 4) { + target = queue[i]; + method = queue[i+1]; + args = queue[i+2]; + stack = queue[i+3]; // Debugging assistance + + // TODO: error handling + if (args && args.length > 0) { + method.apply(target, args); + } else { + method.call(target); + } + } + if (l && after) { after(); } + + // check if new items have been added + if (queue.length > l) { + this._queue = queue.slice(l); + this.flush(); + } else { + this._queue.length = 0; + } + }, + + cancel: function(actionToCancel) { + var queue = this._queue, currentTarget, currentMethod, i, l; + + for (i = 0, l = queue.length; i < l; i += 4) { + currentTarget = queue[i]; + currentMethod = queue[i+1]; + + if (currentTarget === actionToCancel.target && currentMethod === actionToCancel.method) { + queue.splice(i, 4); + return true; + } + } + + // if not found in current queue + // could be in the queue that is being flushed + queue = this._queueBeingFlushed; + if (!queue) { + return; + } + for (i = 0, l = queue.length; i < l; i += 4) { + currentTarget = queue[i]; + currentMethod = queue[i+1]; + + if (currentTarget === actionToCancel.target && currentMethod === actionToCancel.method) { + // don't mess with array during flush + // just nullify the method + queue[i+1] = null; + return true; + } + } + } + }; + + + __exports__.Queue = Queue; + }); +})(); + + + +(function() { +var onBegin = function(current) { + Ember.run.currentRunLoop = current; +}; + +var onEnd = function(current, next) { + Ember.run.currentRunLoop = next; +}; + +var Backburner = requireModule('backburner').Backburner, + backburner = new Backburner(['sync', 'actions', 'destroy'], { + sync: { + before: Ember.beginPropertyChanges, + after: Ember.endPropertyChanges + }, + defaultQueue: 'actions', + onBegin: onBegin, + onEnd: onEnd + }), + slice = [].slice; + +// .......................................................... +// Ember.run - this is ideally the only public API the dev sees +// + +/** + Runs the passed target and method inside of a RunLoop, ensuring any + deferred actions including bindings and views updates are flushed at the + end. + + Normally you should not need to invoke this method yourself. However if + you are implementing raw event handlers when interfacing with other + libraries or plugins, you should probably wrap all of your code inside this + call. + + ```javascript + Ember.run(function(){ + // code to be execute within a RunLoop + }); + ``` + + @class run + @namespace Ember + @static + @constructor + @param {Object} [target] target of method to call + @param {Function|String} method Method to invoke. + May be a function or a string. If you pass a string + then it will be looked up on the passed target. + @param {Object} [args*] Any additional arguments you wish to pass to the method. + @return {Object} return value from invoking the passed function. +*/ +Ember.run = function(target, method) { + var ret; + + if (Ember.onerror) { + try { + ret = backburner.run.apply(backburner, arguments); + } catch (e) { + Ember.onerror(e); + } + } else { + ret = backburner.run.apply(backburner, arguments); + } + + return ret; +}; + +/** + + If no run-loop is present, it creates a new one. If a run loop is + present it will queue itself to run on the existing run-loops action + queue. + + Please note: This is not for normal usage, and should be used sparingly. + + If invoked when not within a run loop: + + ```javascript + Ember.run.join(function(){ + // creates a new run-loop + }); + ``` + + Alternatively, if called within an existing run loop: + + ```javascript + Ember.run(function(){ + // creates a new run-loop + Ember.run.join(function(){ + // joins with the existing run-loop, and queues for invocation on + // the existing run-loops action queue. + }); + }); + ``` + + @method join + @namespace Ember + @param {Object} [target] target of method to call + @param {Function|String} method Method to invoke. + May be a function or a string. If you pass a string + then it will be looked up on the passed target. + @param {Object} [args*] Any additional arguments you wish to pass to the method. + @return {Object} return value from invoking the passed function. Please note, + when called within an existing loop, no return value is possible. +*/ +Ember.run.join = function(target, method) { + if (!Ember.run.currentRunLoop) { + return Ember.run.apply(Ember.run, arguments); + } + + var args = slice.call(arguments); + args.unshift('actions'); + Ember.run.schedule.apply(Ember.run, args); +}; + +Ember.run.backburner = backburner; + +var run = Ember.run; + +Ember.run.currentRunLoop = null; + +Ember.run.queues = backburner.queueNames; + +/** + Begins a new RunLoop. Any deferred actions invoked after the begin will + be buffered until you invoke a matching call to `Ember.run.end()`. This is + a lower-level way to use a RunLoop instead of using `Ember.run()`. + + ```javascript + Ember.run.begin(); + // code to be execute within a RunLoop + Ember.run.end(); + ``` + + @method begin + @return {void} +*/ +Ember.run.begin = function() { + backburner.begin(); +}; + +/** + Ends a RunLoop. This must be called sometime after you call + `Ember.run.begin()` to flush any deferred actions. This is a lower-level way + to use a RunLoop instead of using `Ember.run()`. + + ```javascript + Ember.run.begin(); + // code to be execute within a RunLoop + Ember.run.end(); + ``` + + @method end + @return {void} +*/ +Ember.run.end = function() { + backburner.end(); +}; + +/** + Array of named queues. This array determines the order in which queues + are flushed at the end of the RunLoop. You can define your own queues by + simply adding the queue name to this array. Normally you should not need + to inspect or modify this property. + + @property queues + @type Array + @default ['sync', 'actions', 'destroy'] +*/ + +/** + Adds the passed target/method and any optional arguments to the named + queue to be executed at the end of the RunLoop. If you have not already + started a RunLoop when calling this method one will be started for you + automatically. + + At the end of a RunLoop, any methods scheduled in this way will be invoked. + Methods will be invoked in an order matching the named queues defined in + the `Ember.run.queues` property. + + ```javascript + Ember.run.schedule('sync', this, function(){ + // this will be executed in the first RunLoop queue, when bindings are synced + console.log("scheduled on sync queue"); + }); + + Ember.run.schedule('actions', this, function(){ + // this will be executed in the 'actions' queue, after bindings have synced. + console.log("scheduled on actions queue"); + }); + + // Note the functions will be run in order based on the run queues order. Output would be: + // scheduled on sync queue + // scheduled on actions queue + ``` + + @method schedule + @param {String} queue The name of the queue to schedule against. + Default queues are 'sync' and 'actions' + @param {Object} [target] target object to use as the context when invoking a method. + @param {String|Function} method The method to invoke. If you pass a string it + will be resolved on the target object at the time the scheduled item is + invoked allowing you to change the target function. + @param {Object} [arguments*] Optional arguments to be passed to the queued method. + @return {void} +*/ +Ember.run.schedule = function(queue, target, method) { + checkAutoRun(); + backburner.schedule.apply(backburner, arguments); +}; + +// Used by global test teardown +Ember.run.hasScheduledTimers = function() { + return backburner.hasTimers(); +}; + +// Used by global test teardown +Ember.run.cancelTimers = function () { + backburner.cancelTimers(); +}; + +/** + Immediately flushes any events scheduled in the 'sync' queue. Bindings + use this queue so this method is a useful way to immediately force all + bindings in the application to sync. + + You should call this method anytime you need any changed state to propagate + throughout the app immediately without repainting the UI (which happens + in the later 'render' queue added by the `ember-views` package). + + ```javascript + Ember.run.sync(); + ``` + + @method sync + @return {void} +*/ +Ember.run.sync = function() { + if (backburner.currentInstance) { + backburner.currentInstance.queues.sync.flush(); + } +}; + +/** + Invokes the passed target/method and optional arguments after a specified + period if time. The last parameter of this method must always be a number + of milliseconds. + + You should use this method whenever you need to run some action after a + period of time instead of using `setTimeout()`. This method will ensure that + items that expire during the same script execution cycle all execute + together, which is often more efficient than using a real setTimeout. + + ```javascript + Ember.run.later(myContext, function(){ + // code here will execute within a RunLoop in about 500ms with this == myContext + }, 500); + ``` + + @method later + @param {Object} [target] target of method to invoke + @param {Function|String} method The method to invoke. + If you pass a string it will be resolved on the + target at the time the method is invoked. + @param {Object} [args*] Optional arguments to pass to the timeout. + @param {Number} wait Number of milliseconds to wait. + @return {String} a string you can use to cancel the timer in + `Ember.run.cancel` later. +*/ +Ember.run.later = function(target, method) { + return backburner.later.apply(backburner, arguments); +}; + +/** + Schedule a function to run one time during the current RunLoop. This is equivalent + to calling `scheduleOnce` with the "actions" queue. + + @method once + @param {Object} [target] The target of the method to invoke. + @param {Function|String} method The method to invoke. + If you pass a string it will be resolved on the + target at the time the method is invoked. + @param {Object} [args*] Optional arguments to pass to the timeout. + @return {Object} timer +*/ +Ember.run.once = function(target, method) { + checkAutoRun(); + var args = slice.call(arguments); + args.unshift('actions'); + return backburner.scheduleOnce.apply(backburner, args); +}; + +/** + Schedules a function to run one time in a given queue of the current RunLoop. + Calling this method with the same queue/target/method combination will have + no effect (past the initial call). + + Note that although you can pass optional arguments these will not be + considered when looking for duplicates. New arguments will replace previous + calls. + + ```javascript + Ember.run(function(){ + var sayHi = function() { console.log('hi'); } + Ember.run.scheduleOnce('afterRender', myContext, sayHi); + Ember.run.scheduleOnce('afterRender', myContext, sayHi); + // doFoo will only be executed once, in the afterRender queue of the RunLoop + }); + ``` + + Also note that passing an anonymous function to `Ember.run.scheduleOnce` will + not prevent additional calls with an identical anonymous function from + scheduling the items multiple times, e.g.: + + ```javascript + function scheduleIt() { + Ember.run.scheduleOnce('actions', myContext, function() { console.log("Closure"); }); + } + scheduleIt(); + scheduleIt(); + // "Closure" will print twice, even though we're using `Ember.run.scheduleOnce`, + // because the function we pass to it is anonymous and won't match the + // previously scheduled operation. + ``` + + Available queues, and their order, can be found at `Ember.run.queues` + + @method scheduleOnce + @param {String} [queue] The name of the queue to schedule against. Default queues are 'sync' and 'actions'. + @param {Object} [target] The target of the method to invoke. + @param {Function|String} method The method to invoke. + If you pass a string it will be resolved on the + target at the time the method is invoked. + @param {Object} [args*] Optional arguments to pass to the timeout. + @return {Object} timer +*/ +Ember.run.scheduleOnce = function(queue, target, method) { + checkAutoRun(); + return backburner.scheduleOnce.apply(backburner, arguments); +}; + +/** + Schedules an item to run from within a separate run loop, after + control has been returned to the system. This is equivalent to calling + `Ember.run.later` with a wait time of 1ms. + + ```javascript + Ember.run.next(myContext, function(){ + // code to be executed in the next run loop, which will be scheduled after the current one + }); + ``` + + Multiple operations scheduled with `Ember.run.next` will coalesce + into the same later run loop, along with any other operations + scheduled by `Ember.run.later` that expire right around the same + time that `Ember.run.next` operations will fire. + + Note that there are often alternatives to using `Ember.run.next`. + For instance, if you'd like to schedule an operation to happen + after all DOM element operations have completed within the current + run loop, you can make use of the `afterRender` run loop queue (added + by the `ember-views` package, along with the preceding `render` queue + where all the DOM element operations happen). Example: + + ```javascript + App.MyCollectionView = Ember.CollectionView.extend({ + didInsertElement: function() { + Ember.run.scheduleOnce('afterRender', this, 'processChildElements'); + }, + processChildElements: function() { + // ... do something with collectionView's child view + // elements after they've finished rendering, which + // can't be done within the CollectionView's + // `didInsertElement` hook because that gets run + // before the child elements have been added to the DOM. + } + }); + ``` + + One benefit of the above approach compared to using `Ember.run.next` is + that you will be able to perform DOM/CSS operations before unprocessed + elements are rendered to the screen, which may prevent flickering or + other artifacts caused by delaying processing until after rendering. + + The other major benefit to the above approach is that `Ember.run.next` + introduces an element of non-determinism, which can make things much + harder to test, due to its reliance on `setTimeout`; it's much harder + to guarantee the order of scheduled operations when they are scheduled + outside of the current run loop, i.e. with `Ember.run.next`. + + @method next + @param {Object} [target] target of method to invoke + @param {Function|String} method The method to invoke. + If you pass a string it will be resolved on the + target at the time the method is invoked. + @param {Object} [args*] Optional arguments to pass to the timeout. + @return {Object} timer +*/ +Ember.run.next = function() { + var args = slice.call(arguments); + args.push(1); + return backburner.later.apply(backburner, args); +}; + +/** + Cancels a scheduled item. Must be a value returned by `Ember.run.later()`, + `Ember.run.once()`, or `Ember.run.next()`. + + ```javascript + var runNext = Ember.run.next(myContext, function(){ + // will not be executed + }); + Ember.run.cancel(runNext); + + var runLater = Ember.run.later(myContext, function(){ + // will not be executed + }, 500); + Ember.run.cancel(runLater); + + var runOnce = Ember.run.once(myContext, function(){ + // will not be executed + }); + Ember.run.cancel(runOnce); + ``` + + @method cancel + @param {Object} timer Timer object to cancel + @return {void} +*/ +Ember.run.cancel = function(timer) { + return backburner.cancel(timer); +}; + +/** + Execute the passed method in a specified amount of time, reset timer + upon additional calls. + + ```javascript + var myFunc = function() { console.log(this.name + ' ran.'); }; + var myContext = {name: 'debounce'}; + + Ember.run.debounce(myContext, myFunc, 150); + + // less than 150ms passes + + Ember.run.debounce(myContext, myFunc, 150); + + // 150ms passes + // myFunc is invoked with context myContext + // console logs 'debounce ran.' one time. + ``` + + @method debounce + @param {Object} [target] target of method to invoke + @param {Function|String} method The method to invoke. + May be a function or a string. If you pass a string + then it will be looked up on the passed target. + @param {Object} [args*] Optional arguments to pass to the timeout. + @param {Number} wait Number of milliseconds to wait. + @return {void} +*/ +Ember.run.debounce = function() { + return backburner.debounce.apply(backburner, arguments); +}; + +// Make sure it's not an autorun during testing +function checkAutoRun() { + if (!Ember.run.currentRunLoop) { + Ember.assert("You have turned on testing mode, which disabled the run-loop's autorun. You will need to wrap any code with asynchronous side-effects in an Ember.run", !Ember.testing); + } +} + +})(); + + + +(function() { +// Ember.Logger +// get +// set +// guidFor, meta +// addObserver, removeObserver +// Ember.run.schedule +/** +@module ember-metal +*/ + +// .......................................................... +// CONSTANTS +// + +/** + Debug parameter you can turn on. This will log all bindings that fire to + the console. This should be disabled in production code. Note that you + can also enable this from the console or temporarily. + + @property LOG_BINDINGS + @for Ember + @type Boolean + @default false +*/ +Ember.LOG_BINDINGS = false || !!Ember.ENV.LOG_BINDINGS; + +var get = Ember.get, + set = Ember.set, + guidFor = Ember.guidFor, + IS_GLOBAL = /^([A-Z$]|([0-9][A-Z$]))/; + +/** + Returns true if the provided path is global (e.g., `MyApp.fooController.bar`) + instead of local (`foo.bar.baz`). + + @method isGlobalPath + @for Ember + @private + @param {String} path + @return Boolean +*/ +var isGlobalPath = Ember.isGlobalPath = function(path) { + return IS_GLOBAL.test(path); +}; + +function getWithGlobals(obj, path) { + return get(isGlobalPath(path) ? Ember.lookup : obj, path); +} + +// .......................................................... +// BINDING +// + +var Binding = function(toPath, fromPath) { + this._direction = 'fwd'; + this._from = fromPath; + this._to = toPath; + this._directionMap = Ember.Map.create(); +}; + +/** +@class Binding +@namespace Ember +*/ + +Binding.prototype = { + /** + This copies the Binding so it can be connected to another object. + + @method copy + @return {Ember.Binding} + */ + copy: function () { + var copy = new Binding(this._to, this._from); + if (this._oneWay) { copy._oneWay = true; } + return copy; + }, + + // .......................................................... + // CONFIG + // + + /** + This will set `from` property path to the specified value. It will not + attempt to resolve this property path to an actual object until you + connect the binding. + + The binding will search for the property path starting at the root object + you pass when you `connect()` the binding. It follows the same rules as + `get()` - see that method for more information. + + @method from + @param {String} path the property path to connect to + @return {Ember.Binding} `this` + */ + from: function(path) { + this._from = path; + return this; + }, + + /** + This will set the `to` property path to the specified value. It will not + attempt to resolve this property path to an actual object until you + connect the binding. + + The binding will search for the property path starting at the root object + you pass when you `connect()` the binding. It follows the same rules as + `get()` - see that method for more information. + + @method to + @param {String|Tuple} path A property path or tuple + @return {Ember.Binding} `this` + */ + to: function(path) { + this._to = path; + return this; + }, + + /** + Configures the binding as one way. A one-way binding will relay changes + on the `from` side to the `to` side, but not the other way around. This + means that if you change the `to` side directly, the `from` side may have + a different value. + + @method oneWay + @return {Ember.Binding} `this` + */ + oneWay: function() { + this._oneWay = true; + return this; + }, + + /** + @method toString + @return {String} string representation of binding + */ + toString: function() { + var oneWay = this._oneWay ? '[oneWay]' : ''; + return "Ember.Binding<" + guidFor(this) + ">(" + this._from + " -> " + this._to + ")" + oneWay; + }, + + // .......................................................... + // CONNECT AND SYNC + // + + /** + Attempts to connect this binding instance so that it can receive and relay + changes. This method will raise an exception if you have not set the + from/to properties yet. + + @method connect + @param {Object} obj The root object for this binding. + @return {Ember.Binding} `this` + */ + connect: function(obj) { + Ember.assert('Must pass a valid object to Ember.Binding.connect()', !!obj); + + var fromPath = this._from, toPath = this._to; + Ember.trySet(obj, toPath, getWithGlobals(obj, fromPath)); + + // add an observer on the object to be notified when the binding should be updated + Ember.addObserver(obj, fromPath, this, this.fromDidChange); + + // if the binding is a two-way binding, also set up an observer on the target + if (!this._oneWay) { Ember.addObserver(obj, toPath, this, this.toDidChange); } + + this._readyToSync = true; + + return this; + }, + + /** + Disconnects the binding instance. Changes will no longer be relayed. You + will not usually need to call this method. + + @method disconnect + @param {Object} obj The root object you passed when connecting the binding. + @return {Ember.Binding} `this` + */ + disconnect: function(obj) { + Ember.assert('Must pass a valid object to Ember.Binding.disconnect()', !!obj); + + var twoWay = !this._oneWay; + + // remove an observer on the object so we're no longer notified of + // changes that should update bindings. + Ember.removeObserver(obj, this._from, this, this.fromDidChange); + + // if the binding is two-way, remove the observer from the target as well + if (twoWay) { Ember.removeObserver(obj, this._to, this, this.toDidChange); } + + this._readyToSync = false; // disable scheduled syncs... + return this; + }, + + // .......................................................... + // PRIVATE + // + + /* called when the from side changes */ + fromDidChange: function(target) { + this._scheduleSync(target, 'fwd'); + }, + + /* called when the to side changes */ + toDidChange: function(target) { + this._scheduleSync(target, 'back'); + }, + + _scheduleSync: function(obj, dir) { + var directionMap = this._directionMap; + var existingDir = directionMap.get(obj); + + // if we haven't scheduled the binding yet, schedule it + if (!existingDir) { + Ember.run.schedule('sync', this, this._sync, obj); + directionMap.set(obj, dir); + } + + // If both a 'back' and 'fwd' sync have been scheduled on the same object, + // default to a 'fwd' sync so that it remains deterministic. + if (existingDir === 'back' && dir === 'fwd') { + directionMap.set(obj, 'fwd'); + } + }, + + _sync: function(obj) { + var log = Ember.LOG_BINDINGS; + + // don't synchronize destroyed objects or disconnected bindings + if (obj.isDestroyed || !this._readyToSync) { return; } + + // get the direction of the binding for the object we are + // synchronizing from + var directionMap = this._directionMap; + var direction = directionMap.get(obj); + + var fromPath = this._from, toPath = this._to; + + directionMap.remove(obj); + + // if we're synchronizing from the remote object... + if (direction === 'fwd') { + var fromValue = getWithGlobals(obj, this._from); + if (log) { + Ember.Logger.log(' ', this.toString(), '->', fromValue, obj); + } + if (this._oneWay) { + Ember.trySet(obj, toPath, fromValue); + } else { + Ember._suspendObserver(obj, toPath, this, this.toDidChange, function () { + Ember.trySet(obj, toPath, fromValue); + }); + } + // if we're synchronizing *to* the remote object + } else if (direction === 'back') { + var toValue = get(obj, this._to); + if (log) { + Ember.Logger.log(' ', this.toString(), '<-', toValue, obj); + } + Ember._suspendObserver(obj, fromPath, this, this.fromDidChange, function () { + Ember.trySet(Ember.isGlobalPath(fromPath) ? Ember.lookup : obj, fromPath, toValue); + }); + } + } + +}; + +function mixinProperties(to, from) { + for (var key in from) { + if (from.hasOwnProperty(key)) { + to[key] = from[key]; + } + } +} + +mixinProperties(Binding, { + + /** + See `Ember.Binding.from`. + + @method from + @static + */ + from: function() { + var C = this, binding = new C(); + return binding.from.apply(binding, arguments); + }, + + /** + See `Ember.Binding.to`. + + @method to + @static + */ + to: function() { + var C = this, binding = new C(); + return binding.to.apply(binding, arguments); + }, + + /** + Creates a new Binding instance and makes it apply in a single direction. + A one-way binding will relay changes on the `from` side object (supplied + as the `from` argument) the `to` side, but not the other way around. + This means that if you change the "to" side directly, the "from" side may have + a different value. + + See `Binding.oneWay`. + + @method oneWay + @param {String} from from path. + @param {Boolean} [flag] (Optional) passing nothing here will make the + binding `oneWay`. You can instead pass `false` to disable `oneWay`, making the + binding two way again. + */ + oneWay: function(from, flag) { + var C = this, binding = new C(null, from); + return binding.oneWay(flag); + } + +}); + +/** + An `Ember.Binding` connects the properties of two objects so that whenever + the value of one property changes, the other property will be changed also. + + ## Automatic Creation of Bindings with `/^*Binding/`-named Properties + + You do not usually create Binding objects directly but instead describe + bindings in your class or object definition using automatic binding + detection. + + Properties ending in a `Binding` suffix will be converted to `Ember.Binding` + instances. The value of this property should be a string representing a path + to another object or a custom binding instanced created using Binding helpers + (see "One Way Bindings"): + + ``` + valueBinding: "MyApp.someController.title" + ``` + + This will create a binding from `MyApp.someController.title` to the `value` + property of your object instance automatically. Now the two values will be + kept in sync. + + ## One Way Bindings + + One especially useful binding customization you can use is the `oneWay()` + helper. This helper tells Ember that you are only interested in + receiving changes on the object you are binding from. For example, if you + are binding to a preference and you want to be notified if the preference + has changed, but your object will not be changing the preference itself, you + could do: + + ``` + bigTitlesBinding: Ember.Binding.oneWay("MyApp.preferencesController.bigTitles") + ``` + + This way if the value of `MyApp.preferencesController.bigTitles` changes the + `bigTitles` property of your object will change also. However, if you + change the value of your `bigTitles` property, it will not update the + `preferencesController`. + + One way bindings are almost twice as fast to setup and twice as fast to + execute because the binding only has to worry about changes to one side. + + You should consider using one way bindings anytime you have an object that + may be created frequently and you do not intend to change a property; only + to monitor it for changes (such as in the example above). + + ## Adding Bindings Manually + + All of the examples above show you how to configure a custom binding, but the + result of these customizations will be a binding template, not a fully active + Binding instance. The binding will actually become active only when you + instantiate the object the binding belongs to. It is useful however, to + understand what actually happens when the binding is activated. + + For a binding to function it must have at least a `from` property and a `to` + property. The `from` property path points to the object/key that you want to + bind from while the `to` path points to the object/key you want to bind to. + + When you define a custom binding, you are usually describing the property + you want to bind from (such as `MyApp.someController.value` in the examples + above). When your object is created, it will automatically assign the value + you want to bind `to` based on the name of your binding key. In the + examples above, during init, Ember objects will effectively call + something like this on your binding: + + ```javascript + binding = Ember.Binding.from(this.valueBinding).to("value"); + ``` + + This creates a new binding instance based on the template you provide, and + sets the to path to the `value` property of the new object. Now that the + binding is fully configured with a `from` and a `to`, it simply needs to be + connected to become active. This is done through the `connect()` method: + + ```javascript + binding.connect(this); + ``` + + Note that when you connect a binding you pass the object you want it to be + connected to. This object will be used as the root for both the from and + to side of the binding when inspecting relative paths. This allows the + binding to be automatically inherited by subclassed objects as well. + + Now that the binding is connected, it will observe both the from and to side + and relay changes. + + If you ever needed to do so (you almost never will, but it is useful to + understand this anyway), you could manually create an active binding by + using the `Ember.bind()` helper method. (This is the same method used by + to setup your bindings on objects): + + ```javascript + Ember.bind(MyApp.anotherObject, "value", "MyApp.someController.value"); + ``` + + Both of these code fragments have the same effect as doing the most friendly + form of binding creation like so: + + ```javascript + MyApp.anotherObject = Ember.Object.create({ + valueBinding: "MyApp.someController.value", + + // OTHER CODE FOR THIS OBJECT... + }); + ``` + + Ember's built in binding creation method makes it easy to automatically + create bindings for you. You should always use the highest-level APIs + available, even if you understand how it works underneath. + + @class Binding + @namespace Ember + @since Ember 0.9 +*/ +Ember.Binding = Binding; + + +/** + Global helper method to create a new binding. Just pass the root object + along with a `to` and `from` path to create and connect the binding. + + @method bind + @for Ember + @param {Object} obj The root object of the transform. + @param {String} to The path to the 'to' side of the binding. + Must be relative to obj. + @param {String} from The path to the 'from' side of the binding. + Must be relative to obj or a global path. + @return {Ember.Binding} binding instance +*/ +Ember.bind = function(obj, to, from) { + return new Ember.Binding(to, from).connect(obj); +}; + +/** + @method oneWay + @for Ember + @param {Object} obj The root object of the transform. + @param {String} to The path to the 'to' side of the binding. + Must be relative to obj. + @param {String} from The path to the 'from' side of the binding. + Must be relative to obj or a global path. + @return {Ember.Binding} binding instance +*/ +Ember.oneWay = function(obj, to, from) { + return new Ember.Binding(to, from).oneWay().connect(obj); +}; + +})(); + + + +(function() { +/** +@module ember-metal +*/ + +var Mixin, REQUIRED, Alias, + a_map = Ember.ArrayPolyfills.map, + a_indexOf = Ember.ArrayPolyfills.indexOf, + a_forEach = Ember.ArrayPolyfills.forEach, + a_slice = [].slice, + o_create = Ember.create, + defineProperty = Ember.defineProperty, + guidFor = Ember.guidFor; + +function mixinsMeta(obj) { + var m = Ember.meta(obj, true), ret = m.mixins; + if (!ret) { + ret = m.mixins = {}; + } else if (!m.hasOwnProperty('mixins')) { + ret = m.mixins = o_create(ret); + } + return ret; +} + +function initMixin(mixin, args) { + if (args && args.length > 0) { + mixin.mixins = a_map.call(args, function(x) { + if (x instanceof Mixin) { return x; } + + // Note: Manually setup a primitive mixin here. This is the only + // way to actually get a primitive mixin. This way normal creation + // of mixins will give you combined mixins... + var mixin = new Mixin(); + mixin.properties = x; + return mixin; + }); + } + return mixin; +} + +function isMethod(obj) { + return 'function' === typeof obj && + obj.isMethod !== false && + obj !== Boolean && obj !== Object && obj !== Number && obj !== Array && obj !== Date && obj !== String; +} + +var CONTINUE = {}; + +function mixinProperties(mixinsMeta, mixin) { + var guid; + + if (mixin instanceof Mixin) { + guid = guidFor(mixin); + if (mixinsMeta[guid]) { return CONTINUE; } + mixinsMeta[guid] = mixin; + return mixin.properties; + } else { + return mixin; // apply anonymous mixin properties + } +} + +function concatenatedProperties(props, values, base) { + var concats; + + // reset before adding each new mixin to pickup concats from previous + concats = values.concatenatedProperties || base.concatenatedProperties; + if (props.concatenatedProperties) { + concats = concats ? concats.concat(props.concatenatedProperties) : props.concatenatedProperties; + } + + return concats; +} + +function giveDescriptorSuper(meta, key, property, values, descs) { + var superProperty; + + // Computed properties override methods, and do not call super to them + if (values[key] === undefined) { + // Find the original descriptor in a parent mixin + superProperty = descs[key]; + } + + // If we didn't find the original descriptor in a parent mixin, find + // it on the original object. + superProperty = superProperty || meta.descs[key]; + + if (!superProperty || !(superProperty instanceof Ember.ComputedProperty)) { + return property; + } + + // Since multiple mixins may inherit from the same parent, we need + // to clone the computed property so that other mixins do not receive + // the wrapped version. + property = o_create(property); + property.func = Ember.wrap(property.func, superProperty.func); + + return property; +} + +function giveMethodSuper(obj, key, method, values, descs) { + var superMethod; + + // Methods overwrite computed properties, and do not call super to them. + if (descs[key] === undefined) { + // Find the original method in a parent mixin + superMethod = values[key]; + } + + // If we didn't find the original value in a parent mixin, find it in + // the original object + superMethod = superMethod || obj[key]; + + // Only wrap the new method if the original method was a function + if ('function' !== typeof superMethod) { + return method; + } + + return Ember.wrap(method, superMethod); +} + +function applyConcatenatedProperties(obj, key, value, values) { + var baseValue = values[key] || obj[key]; + + if (baseValue) { + if ('function' === typeof baseValue.concat) { + return baseValue.concat(value); + } else { + return Ember.makeArray(baseValue).concat(value); + } + } else { + return Ember.makeArray(value); + } +} + +function addNormalizedProperty(base, key, value, meta, descs, values, concats) { + if (value instanceof Ember.Descriptor) { + if (value === REQUIRED && descs[key]) { return CONTINUE; } + + // Wrap descriptor function to implement + // _super() if needed + if (value.func) { + value = giveDescriptorSuper(meta, key, value, values, descs); + } + + descs[key] = value; + values[key] = undefined; + } else { + // impl super if needed... + if (isMethod(value)) { + value = giveMethodSuper(base, key, value, values, descs); + } else if ((concats && a_indexOf.call(concats, key) >= 0) || key === 'concatenatedProperties') { + value = applyConcatenatedProperties(base, key, value, values); + } + + descs[key] = undefined; + values[key] = value; + } +} + +function mergeMixins(mixins, m, descs, values, base, keys) { + var mixin, props, key, concats, meta; + + function removeKeys(keyName) { + delete descs[keyName]; + delete values[keyName]; + } + + for(var i=0, l=mixins.length; i= 0) { + if (_detect(mixins[loc], targetMixin, seen)) { return true; } + } + return false; +} + +/** + @method detect + @param obj + @return {Boolean} +*/ +MixinPrototype.detect = function(obj) { + if (!obj) { return false; } + if (obj instanceof Mixin) { return _detect(obj, this, {}); } + var mixins = Ember.meta(obj, false).mixins; + if (mixins) { + return !!mixins[guidFor(this)]; + } + return false; +}; + +MixinPrototype.without = function() { + var ret = new Mixin(this); + ret._without = a_slice.call(arguments); + return ret; +}; + +function _keys(ret, mixin, seen) { + if (seen[guidFor(mixin)]) { return; } + seen[guidFor(mixin)] = true; + + if (mixin.properties) { + var props = mixin.properties; + for (var key in props) { + if (props.hasOwnProperty(key)) { ret[key] = true; } + } + } else if (mixin.mixins) { + a_forEach.call(mixin.mixins, function(x) { _keys(ret, x, seen); }); + } +} + +MixinPrototype.keys = function() { + var keys = {}, seen = {}, ret = []; + _keys(keys, this, seen); + for(var key in keys) { + if (keys.hasOwnProperty(key)) { ret.push(key); } + } + return ret; +}; + +// returns the mixins currently applied to the specified object +// TODO: Make Ember.mixin +Mixin.mixins = function(obj) { + var mixins = Ember.meta(obj, false).mixins, ret = []; + + if (!mixins) { return ret; } + + for (var key in mixins) { + var mixin = mixins[key]; + + // skip primitive mixins since these are always anonymous + if (!mixin.properties) { ret.push(mixin); } + } + + return ret; +}; + +REQUIRED = new Ember.Descriptor(); +REQUIRED.toString = function() { return '(Required Property)'; }; + +/** + Denotes a required property for a mixin + + @method required + @for Ember +*/ +Ember.required = function() { + return REQUIRED; +}; + +Alias = function(methodName) { + this.methodName = methodName; +}; +Alias.prototype = new Ember.Descriptor(); + +/** + Makes a property or method available via an additional name. + + ```javascript + App.PaintSample = Ember.Object.extend({ + color: 'red', + colour: Ember.alias('color'), + name: function(){ + return "Zed"; + }, + moniker: Ember.alias("name") + }); + + var paintSample = App.PaintSample.create() + paintSample.get('colour'); // 'red' + paintSample.moniker(); // 'Zed' + ``` + + @method alias + @for Ember + @param {String} methodName name of the method or property to alias + @return {Ember.Descriptor} + @deprecated Use `Ember.aliasMethod` or `Ember.computed.alias` instead +*/ +Ember.alias = function(methodName) { + return new Alias(methodName); +}; + +Ember.alias = Ember.deprecateFunc("Ember.alias is deprecated. Please use Ember.aliasMethod or Ember.computed.alias instead.", Ember.alias); + +/** + Makes a method available via an additional name. + + ```javascript + App.Person = Ember.Object.extend({ + name: function(){ + return 'Tomhuda Katzdale'; + }, + moniker: Ember.aliasMethod('name') + }); + + var goodGuy = App.Person.create() + ``` + + @method aliasMethod + @for Ember + @param {String} methodName name of the method to alias + @return {Ember.Descriptor} +*/ +Ember.aliasMethod = function(methodName) { + return new Alias(methodName); +}; + +// .......................................................... +// OBSERVER HELPER +// + +/** + @method observer + @for Ember + @param {Function} func + @param {String} propertyNames* + @return func +*/ +Ember.observer = function(func) { + var paths = a_slice.call(arguments, 1); + func.__ember_observes__ = paths; + return func; +}; + +// If observers ever become asynchronous, Ember.immediateObserver +// must remain synchronous. +/** + @method immediateObserver + @for Ember + @param {Function} func + @param {String} propertyNames* + @return func +*/ +Ember.immediateObserver = function() { + for (var i=0, l=arguments.length; i this.changingFrom ? 'green' : 'red'; + // logic + } + }.observes('content.value') + }); + ``` + + @method beforeObserver + @for Ember + @param {Function} func + @param {String} propertyNames* + @return func +*/ +Ember.beforeObserver = function(func) { + var paths = a_slice.call(arguments, 1); + func.__ember_observesBefore__ = paths; + return func; +}; + +})(); + + + +(function() { +/** +Ember Metal + +@module ember +@submodule ember-metal +*/ + +})(); + +(function() { +define("rsvp/all", + ["rsvp/defer","exports"], + function(__dependency1__, __exports__) { + "use strict"; + var defer = __dependency1__.defer; + + function all(promises) { + var results = [], deferred = defer(), remaining = promises.length; + + if (remaining === 0) { + deferred.resolve([]); + } + + var resolver = function(index) { + return function(value) { + resolveAll(index, value); + }; + }; + + var resolveAll = function(index, value) { + results[index] = value; + if (--remaining === 0) { + deferred.resolve(results); + } + }; + + var rejectAll = function(error) { + deferred.reject(error); + }; + + for (var i = 0; i < promises.length; i++) { + if (promises[i] && typeof promises[i].then === 'function') { + promises[i].then(resolver(i), rejectAll); + } else { + resolveAll(i, promises[i]); + } + } + return deferred.promise; + } + + __exports__.all = all; + }); + +define("rsvp/async", + ["exports"], + function(__exports__) { + "use strict"; + var browserGlobal = (typeof window !== 'undefined') ? window : {}; + + var BrowserMutationObserver = browserGlobal.MutationObserver || browserGlobal.WebKitMutationObserver; + var async; + + if (typeof process !== 'undefined' && + {}.toString.call(process) === '[object process]') { + async = function(callback, binding) { + process.nextTick(function() { + callback.call(binding); + }); + }; + } else if (BrowserMutationObserver) { + var queue = []; + + var observer = new BrowserMutationObserver(function() { + var toProcess = queue.slice(); + queue = []; + + toProcess.forEach(function(tuple) { + var callback = tuple[0], binding = tuple[1]; + callback.call(binding); + }); + }); + + var element = document.createElement('div'); + observer.observe(element, { attributes: true }); + + // Chrome Memory Leak: https://bugs.webkit.org/show_bug.cgi?id=93661 + window.addEventListener('unload', function(){ + observer.disconnect(); + observer = null; + }); + + async = function(callback, binding) { + queue.push([callback, binding]); + element.setAttribute('drainQueue', 'drainQueue'); + }; + } else { + async = function(callback, binding) { + setTimeout(function() { + callback.call(binding); + }, 1); + }; + } + + + __exports__.async = async; + }); + +define("rsvp/config", + ["rsvp/async","exports"], + function(__dependency1__, __exports__) { + "use strict"; + var async = __dependency1__.async; + + var config = {}; + config.async = async; + + __exports__.config = config; + }); + +define("rsvp/defer", + ["rsvp/promise","exports"], + function(__dependency1__, __exports__) { + "use strict"; + var Promise = __dependency1__.Promise; + + function defer() { + var deferred = {}; + + var promise = new Promise(function(resolve, reject) { + deferred.resolve = resolve; + deferred.reject = reject; + }); + + deferred.promise = promise; + return deferred; + } + + __exports__.defer = defer; + }); + +define("rsvp/events", + ["exports"], + function(__exports__) { + "use strict"; + var Event = function(type, options) { + this.type = type; + + for (var option in options) { + if (!options.hasOwnProperty(option)) { continue; } + + this[option] = options[option]; + } + }; + + var indexOf = function(callbacks, callback) { + for (var i=0, l=callbacks.length; i 2) { + resolve(Array.prototype.slice.call(arguments, 1)); + } else { + resolve(value); + } + }; + } + + function denodeify(nodeFunc) { + return function() { + var nodeArgs = Array.prototype.slice.call(arguments), resolve, reject; + + var promise = new Promise(function(nodeResolve, nodeReject) { + resolve = nodeResolve; + reject = nodeReject; + }); + + all(nodeArgs).then(function(nodeArgs) { + nodeArgs.push(makeNodeCallbackFor(resolve, reject)); + + try { + nodeFunc.apply(this, nodeArgs); + } catch(e) { + reject(e); + } + }); + + return promise; + }; + } + + __exports__.denodeify = denodeify; + }); + +define("rsvp/promise", + ["rsvp/config","rsvp/events","exports"], + function(__dependency1__, __dependency2__, __exports__) { + "use strict"; + var config = __dependency1__.config; + var EventTarget = __dependency2__.EventTarget; + + function objectOrFunction(x) { + return isFunction(x) || (typeof x === "object" && x !== null); + } + + function isFunction(x){ + return typeof x === "function"; + } + + var Promise = function(resolver) { + var promise = this, + resolved = false; + + if (typeof resolver !== 'function') { + throw new TypeError('You must pass a resolver function as the sole argument to the promise constructor'); + } + + if (!(promise instanceof Promise)) { + return new Promise(resolver); + } + + var resolvePromise = function(value) { + if (resolved) { return; } + resolved = true; + resolve(promise, value); + }; + + var rejectPromise = function(value) { + if (resolved) { return; } + resolved = true; + reject(promise, value); + }; + + this.on('promise:resolved', function(event) { + this.trigger('success', { detail: event.detail }); + }, this); + + this.on('promise:failed', function(event) { + this.trigger('error', { detail: event.detail }); + }, this); + + try { + resolver(resolvePromise, rejectPromise); + } catch(e) { + rejectPromise(e); + } + }; + + var invokeCallback = function(type, promise, callback, event) { + var hasCallback = isFunction(callback), + value, error, succeeded, failed; + + if (hasCallback) { + try { + value = callback(event.detail); + succeeded = true; + } catch(e) { + failed = true; + error = e; + } + } else { + value = event.detail; + succeeded = true; + } + + if (handleThenable(promise, value)) { + return; + } else if (hasCallback && succeeded) { + resolve(promise, value); + } else if (failed) { + reject(promise, error); + } else if (type === 'resolve') { + resolve(promise, value); + } else if (type === 'reject') { + reject(promise, value); + } + }; + + Promise.prototype = { + constructor: Promise, + + then: function(done, fail) { + var thenPromise = new Promise(function() {}); + + if (this.isFulfilled) { + config.async(function() { + invokeCallback('resolve', thenPromise, done, { detail: this.fulfillmentValue }); + }, this); + } + + if (this.isRejected) { + config.async(function() { + invokeCallback('reject', thenPromise, fail, { detail: this.rejectedReason }); + }, this); + } + + this.on('promise:resolved', function(event) { + invokeCallback('resolve', thenPromise, done, event); + }); + + this.on('promise:failed', function(event) { + invokeCallback('reject', thenPromise, fail, event); + }); + + return thenPromise; + } + }; + + EventTarget.mixin(Promise.prototype); + + function resolve(promise, value) { + if (promise === value) { + fulfill(promise, value); + } else if (!handleThenable(promise, value)) { + fulfill(promise, value); + } + } + + function handleThenable(promise, value) { + var then = null; + + if (objectOrFunction(value)) { + try { + then = value.then; + } catch(e) { + reject(promise, e); + return true; + } + + if (isFunction(then)) { + try { + then.call(value, function(val) { + if (value !== val) { + resolve(promise, val); + } else { + fulfill(promise, val); + } + }, function(val) { + reject(promise, val); + }); + } catch (e) { + reject(promise, e); + } + return true; + } + } + + return false; + } + + function fulfill(promise, value) { + config.async(function() { + promise.trigger('promise:resolved', { detail: value }); + promise.isFulfilled = true; + promise.fulfillmentValue = value; + }); + } + + function reject(promise, value) { + config.async(function() { + promise.trigger('promise:failed', { detail: value }); + promise.isRejected = true; + promise.rejectedReason = value; + }); + } + + + __exports__.Promise = Promise; + }); + +define("rsvp/reject", + ["rsvp/promise","exports"], + function(__dependency1__, __exports__) { + "use strict"; + var Promise = __dependency1__.Promise; + + + function objectOrFunction(x) { + return typeof x === "function" || (typeof x === "object" && x !== null); + } + + + function reject(reason) { + return new Promise(function (resolve, reject) { + reject(reason); + }); + } + + + __exports__.reject = reject; + }); + +define("rsvp/resolve", + ["rsvp/promise","exports"], + function(__dependency1__, __exports__) { + "use strict"; + var Promise = __dependency1__.Promise; + + + function objectOrFunction(x) { + return typeof x === "function" || (typeof x === "object" && x !== null); + } + + function resolve(thenable){ + var promise = new Promise(function(resolve, reject){ + var then; + + try { + if ( objectOrFunction(thenable) ) { + then = thenable.then; + + if (typeof then === "function") { + then.call(thenable, resolve, reject); + } else { + resolve(thenable); + } + + } else { + resolve(thenable); + } + + } catch(error) { + reject(error); + } + }); + + return promise; + } + + + __exports__.resolve = resolve; + }); + +define("rsvp", + ["rsvp/events","rsvp/promise","rsvp/node","rsvp/all","rsvp/hash","rsvp/defer","rsvp/config","rsvp/resolve","rsvp/reject","exports"], + function(__dependency1__, __dependency2__, __dependency3__, __dependency4__, __dependency5__, __dependency6__, __dependency7__, __dependency8__, __dependency9__, __exports__) { + "use strict"; + var EventTarget = __dependency1__.EventTarget; + var Promise = __dependency2__.Promise; + var denodeify = __dependency3__.denodeify; + var all = __dependency4__.all; + var hash = __dependency5__.hash; + var defer = __dependency6__.defer; + var config = __dependency7__.config; + var resolve = __dependency8__.resolve; + var reject = __dependency9__.reject; + + function configure(name, value) { + config[name] = value; + } + + + __exports__.Promise = Promise; + __exports__.EventTarget = EventTarget; + __exports__.all = all; + __exports__.hash = hash; + __exports__.defer = defer; + __exports__.denodeify = denodeify; + __exports__.configure = configure; + __exports__.resolve = resolve; + __exports__.reject = reject; + }); + + + +})(); + +(function() { +define("container", + [], + function() { + + function InheritingDict(parent) { + this.parent = parent; + this.dict = {}; + } + + InheritingDict.prototype = { + get: function(key) { + var dict = this.dict; + + if (dict.hasOwnProperty(key)) { + return dict[key]; + } + + if (this.parent) { + return this.parent.get(key); + } + }, + + set: function(key, value) { + this.dict[key] = value; + }, + + has: function(key) { + var dict = this.dict; + + if (dict.hasOwnProperty(key)) { + return true; + } + + if (this.parent) { + return this.parent.has(key); + } + + return false; + }, + + eachLocal: function(callback, binding) { + var dict = this.dict; + + for (var prop in dict) { + if (dict.hasOwnProperty(prop)) { + callback.call(binding, prop, dict[prop]); + } + } + } + }; + + function Container(parent) { + this.parent = parent; + this.children = []; + + this.resolver = parent && parent.resolver || function() {}; + this.registry = new InheritingDict(parent && parent.registry); + this.cache = new InheritingDict(parent && parent.cache); + this.typeInjections = new InheritingDict(parent && parent.typeInjections); + this.injections = {}; + this._options = new InheritingDict(parent && parent._options); + this._typeOptions = new InheritingDict(parent && parent._typeOptions); + } + + Container.prototype = { + child: function() { + var container = new Container(this); + this.children.push(container); + return container; + }, + + set: function(object, key, value) { + object[key] = value; + }, + + register: function(type, name, factory, options) { + var fullName; + + if (type.indexOf(':') !== -1){ + options = factory; + factory = name; + fullName = type; + } else { + Ember.deprecate('register("'+type +'", "'+ name+'") is now deprecated in-favour of register("'+type+':'+name+'");', false); + fullName = type + ":" + name; + } + + var normalizedName = this.normalize(fullName); + + this.registry.set(normalizedName, factory); + this._options.set(normalizedName, options || {}); + }, + + resolve: function(fullName) { + return this.resolver(fullName) || this.registry.get(fullName); + }, + + normalize: function(fullName) { + return fullName; + }, + + lookup: function(fullName, options) { + fullName = this.normalize(fullName); + + options = options || {}; + + if (this.cache.has(fullName) && options.singleton !== false) { + return this.cache.get(fullName); + } + + var value = instantiate(this, fullName); + + if (!value) { return; } + + if (isSingleton(this, fullName) && options.singleton !== false) { + this.cache.set(fullName, value); + } + + return value; + }, + + lookupFactory: function(fullName) { + return factoryFor(this, fullName); + }, + + has: function(fullName) { + if (this.cache.has(fullName)) { + return true; + } + + return !!factoryFor(this, fullName); + }, + + optionsForType: function(type, options) { + if (this.parent) { illegalChildOperation('optionsForType'); } + + this._typeOptions.set(type, options); + }, + + options: function(type, options) { + this.optionsForType(type, options); + }, + + typeInjection: function(type, property, fullName) { + if (this.parent) { illegalChildOperation('typeInjection'); } + + var injections = this.typeInjections.get(type); + if (!injections) { + injections = []; + this.typeInjections.set(type, injections); + } + injections.push({ property: property, fullName: fullName }); + }, + + injection: function(factoryName, property, injectionName) { + if (this.parent) { illegalChildOperation('injection'); } + + if (factoryName.indexOf(':') === -1) { + return this.typeInjection(factoryName, property, injectionName); + } + + var injections = this.injections[factoryName] = this.injections[factoryName] || []; + injections.push({ property: property, fullName: injectionName }); + }, + + destroy: function() { + this.isDestroyed = true; + + for (var i=0, l=this.children.length; i w. +*/ +Ember.compare = function compare(v, w) { + if (v === w) { return 0; } + + var type1 = Ember.typeOf(v); + var type2 = Ember.typeOf(w); + + var Comparable = Ember.Comparable; + if (Comparable) { + if (type1==='instance' && Comparable.detect(v.constructor)) { + return v.constructor.compare(v, w); + } + + if (type2 === 'instance' && Comparable.detect(w.constructor)) { + return 1-w.constructor.compare(w, v); + } + } + + // If we haven't yet generated a reverse-mapping of Ember.ORDER_DEFINITION, + // do so now. + var mapping = Ember.ORDER_DEFINITION_MAPPING; + if (!mapping) { + var order = Ember.ORDER_DEFINITION; + mapping = Ember.ORDER_DEFINITION_MAPPING = {}; + var idx, len; + for (idx = 0, len = order.length; idx < len; ++idx) { + mapping[order[idx]] = idx; + } + + // We no longer need Ember.ORDER_DEFINITION. + delete Ember.ORDER_DEFINITION; + } + + var type1Index = mapping[type1]; + var type2Index = mapping[type2]; + + if (type1Index < type2Index) { return -1; } + if (type1Index > type2Index) { return 1; } + + // types are equal - so we have to check values now + switch (type1) { + case 'boolean': + case 'number': + if (v < w) { return -1; } + if (v > w) { return 1; } + return 0; + + case 'string': + var comp = v.localeCompare(w); + if (comp < 0) { return -1; } + if (comp > 0) { return 1; } + return 0; + + case 'array': + var vLen = v.length; + var wLen = w.length; + var l = Math.min(vLen, wLen); + var r = 0; + var i = 0; + while (r === 0 && i < l) { + r = compare(v[i],w[i]); + i++; + } + if (r !== 0) { return r; } + + // all elements are equal now + // shorter array should be ordered first + if (vLen < wLen) { return -1; } + if (vLen > wLen) { return 1; } + // arrays are equal now + return 0; + + case 'instance': + if (Ember.Comparable && Ember.Comparable.detect(v)) { + return v.compare(v, w); + } + return 0; + + case 'date': + var vNum = v.getTime(); + var wNum = w.getTime(); + if (vNum < wNum) { return -1; } + if (vNum > wNum) { return 1; } + return 0; + + default: + return 0; + } +}; + +function _copy(obj, deep, seen, copies) { + var ret, loc, key; + + // primitive data types are immutable, just return them. + if ('object' !== typeof obj || obj===null) return obj; + + // avoid cyclical loops + if (deep && (loc=indexOf(seen, obj))>=0) return copies[loc]; + + Ember.assert('Cannot clone an Ember.Object that does not implement Ember.Copyable', !(obj instanceof Ember.Object) || (Ember.Copyable && Ember.Copyable.detect(obj))); + + // IMPORTANT: this specific test will detect a native array only. Any other + // object will need to implement Copyable. + if (Ember.typeOf(obj) === 'array') { + ret = obj.slice(); + if (deep) { + loc = ret.length; + while(--loc>=0) ret[loc] = _copy(ret[loc], deep, seen, copies); + } + } else if (Ember.Copyable && Ember.Copyable.detect(obj)) { + ret = obj.copy(deep, seen, copies); + } else { + ret = {}; + for(key in obj) { + if (!obj.hasOwnProperty(key)) continue; + + // Prevents browsers that don't respect non-enumerability from + // copying internal Ember properties + if (key.substring(0,2) === '__') continue; + + ret[key] = deep ? _copy(obj[key], deep, seen, copies) : obj[key]; + } + } + + if (deep) { + seen.push(obj); + copies.push(ret); + } + + return ret; +} + +/** + Creates a clone of the passed object. This function can take just about + any type of object and create a clone of it, including primitive values + (which are not actually cloned because they are immutable). + + If the passed object implements the `clone()` method, then this function + will simply call that method and return the result. + + @method copy + @for Ember + @param {Object} obj The object to clone + @param {Boolean} deep If true, a deep copy of the object is made + @return {Object} The cloned object +*/ +Ember.copy = function(obj, deep) { + // fast paths + if ('object' !== typeof obj || obj===null) return obj; // can't copy primitives + if (Ember.Copyable && Ember.Copyable.detect(obj)) return obj.copy(deep); + return _copy(obj, deep, deep ? [] : null, deep ? [] : null); +}; + +/** + Convenience method to inspect an object. This method will attempt to + convert the object into a useful string description. + + It is a pretty simple implementation. If you want something more robust, + use something like JSDump: https://github.com/NV/jsDump + + @method inspect + @for Ember + @param {Object} obj The object you want to inspect. + @return {String} A description of the object +*/ +Ember.inspect = function(obj) { + if (typeof obj !== 'object' || obj === null) { + return obj + ''; + } + + var v, ret = []; + for(var key in obj) { + if (obj.hasOwnProperty(key)) { + v = obj[key]; + if (v === 'toString') { continue; } // ignore useless items + if (Ember.typeOf(v) === 'function') { v = "function() { ... }"; } + ret.push(key + ": " + v); + } + } + return "{" + ret.join(", ") + "}"; +}; + +/** + Compares two objects, returning true if they are logically equal. This is + a deeper comparison than a simple triple equal. For sets it will compare the + internal objects. For any other object that implements `isEqual()` it will + respect that method. + + ```javascript + Ember.isEqual('hello', 'hello'); // true + Ember.isEqual(1, 2); // false + Ember.isEqual([4,2], [4,2]); // false + ``` + + @method isEqual + @for Ember + @param {Object} a first object to compare + @param {Object} b second object to compare + @return {Boolean} +*/ +Ember.isEqual = function(a, b) { + if (a && 'function'===typeof a.isEqual) return a.isEqual(b); + return a === b; +}; + +// Used by Ember.compare +Ember.ORDER_DEFINITION = Ember.ENV.ORDER_DEFINITION || [ + 'undefined', + 'null', + 'boolean', + 'number', + 'string', + 'array', + 'object', + 'instance', + 'function', + 'class', + 'date' +]; + +/** + Returns all of the keys defined on an object or hash. This is useful + when inspecting objects for debugging. On browsers that support it, this + uses the native `Object.keys` implementation. + + @method keys + @for Ember + @param {Object} obj + @return {Array} Array containing keys of obj +*/ +Ember.keys = Object.keys; + +if (!Ember.keys || Ember.create.isSimulated) { + Ember.keys = function(obj) { + var ret = []; + for(var key in obj) { + // Prevents browsers that don't respect non-enumerability from + // copying internal Ember properties + if (key.substring(0,2) === '__') continue; + if (key === '_super') continue; + + if (obj.hasOwnProperty(key)) { ret.push(key); } + } + return ret; + }; +} + +// .......................................................... +// ERROR +// + +var errorProps = ['description', 'fileName', 'lineNumber', 'message', 'name', 'number', 'stack']; + +/** + A subclass of the JavaScript Error object for use in Ember. + + @class Error + @namespace Ember + @extends Error + @constructor +*/ +Ember.Error = function() { + var tmp = Error.apply(this, arguments); + + // Unfortunately errors are not enumerable in Chrome (at least), so `for prop in tmp` doesn't work. + for (var idx = 0; idx < errorProps.length; idx++) { + this[errorProps[idx]] = tmp[errorProps[idx]]; + } +}; + +Ember.Error.prototype = Ember.create(Error.prototype); + +})(); + + + +(function() { +/** + Expose RSVP implementation + + @class RSVP + @namespace Ember + @constructor +*/ +Ember.RSVP = requireModule('rsvp'); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-runtime +*/ + +var STRING_DASHERIZE_REGEXP = (/[ _]/g); +var STRING_DASHERIZE_CACHE = {}; +var STRING_DECAMELIZE_REGEXP = (/([a-z])([A-Z])/g); +var STRING_CAMELIZE_REGEXP = (/(\-|_|\.|\s)+(.)?/g); +var STRING_UNDERSCORE_REGEXP_1 = (/([a-z\d])([A-Z]+)/g); +var STRING_UNDERSCORE_REGEXP_2 = (/\-|\s+/g); + +/** + Defines the hash of localized strings for the current language. Used by + the `Ember.String.loc()` helper. To localize, add string values to this + hash. + + @property STRINGS + @for Ember + @type Hash +*/ +Ember.STRINGS = {}; + +/** + Defines string helper methods including string formatting and localization. + Unless `Ember.EXTEND_PROTOTYPES.String` is `false` these methods will also be + added to the `String.prototype` as well. + + @class String + @namespace Ember + @static +*/ +Ember.String = { + + /** + Apply formatting options to the string. This will look for occurrences + of "%@" in your string and substitute them with the arguments you pass into + this method. If you want to control the specific order of replacement, + you can add a number after the key as well to indicate which argument + you want to insert. + + Ordered insertions are most useful when building loc strings where values + you need to insert may appear in different orders. + + ```javascript + "Hello %@ %@".fmt('John', 'Doe'); // "Hello John Doe" + "Hello %@2, %@1".fmt('John', 'Doe'); // "Hello Doe, John" + ``` + + @method fmt + @param {String} str The string to format + @param {Array} formats An array of parameters to interpolate into string. + @return {String} formatted string + */ + fmt: function(str, formats) { + // first, replace any ORDERED replacements. + var idx = 0; // the current index for non-numerical replacements + return str.replace(/%@([0-9]+)?/g, function(s, argIndex) { + argIndex = (argIndex) ? parseInt(argIndex,0) - 1 : idx++ ; + s = formats[argIndex]; + return ((s === null) ? '(null)' : (s === undefined) ? '' : s).toString(); + }) ; + }, + + /** + Formats the passed string, but first looks up the string in the localized + strings hash. This is a convenient way to localize text. See + `Ember.String.fmt()` for more information on formatting. + + Note that it is traditional but not required to prefix localized string + keys with an underscore or other character so you can easily identify + localized strings. + + ```javascript + Ember.STRINGS = { + '_Hello World': 'Bonjour le monde', + '_Hello %@ %@': 'Bonjour %@ %@' + }; + + Ember.String.loc("_Hello World"); // 'Bonjour le monde'; + Ember.String.loc("_Hello %@ %@", ["John", "Smith"]); // "Bonjour John Smith"; + ``` + + @method loc + @param {String} str The string to format + @param {Array} formats Optional array of parameters to interpolate into string. + @return {String} formatted string + */ + loc: function(str, formats) { + str = Ember.STRINGS[str] || str; + return Ember.String.fmt(str, formats) ; + }, + + /** + Splits a string into separate units separated by spaces, eliminating any + empty strings in the process. This is a convenience method for split that + is mostly useful when applied to the `String.prototype`. + + ```javascript + Ember.String.w("alpha beta gamma").forEach(function(key) { + console.log(key); + }); + + // > alpha + // > beta + // > gamma + ``` + + @method w + @param {String} str The string to split + @return {String} split string + */ + w: function(str) { return str.split(/\s+/); }, + + /** + Converts a camelized string into all lower case separated by underscores. + + ```javascript + 'innerHTML'.decamelize(); // 'inner_html' + 'action_name'.decamelize(); // 'action_name' + 'css-class-name'.decamelize(); // 'css-class-name' + 'my favorite items'.decamelize(); // 'my favorite items' + ``` + + @method decamelize + @param {String} str The string to decamelize. + @return {String} the decamelized string. + */ + decamelize: function(str) { + return str.replace(STRING_DECAMELIZE_REGEXP, '$1_$2').toLowerCase(); + }, + + /** + Replaces underscores or spaces with dashes. + + ```javascript + 'innerHTML'.dasherize(); // 'inner-html' + 'action_name'.dasherize(); // 'action-name' + 'css-class-name'.dasherize(); // 'css-class-name' + 'my favorite items'.dasherize(); // 'my-favorite-items' + ``` + + @method dasherize + @param {String} str The string to dasherize. + @return {String} the dasherized string. + */ + dasherize: function(str) { + var cache = STRING_DASHERIZE_CACHE, + hit = cache.hasOwnProperty(str), + ret; + + if (hit) { + return cache[str]; + } else { + ret = Ember.String.decamelize(str).replace(STRING_DASHERIZE_REGEXP,'-'); + cache[str] = ret; + } + + return ret; + }, + + /** + Returns the lowerCamelCase form of a string. + + ```javascript + 'innerHTML'.camelize(); // 'innerHTML' + 'action_name'.camelize(); // 'actionName' + 'css-class-name'.camelize(); // 'cssClassName' + 'my favorite items'.camelize(); // 'myFavoriteItems' + 'My Favorite Items'.camelize(); // 'myFavoriteItems' + ``` + + @method camelize + @param {String} str The string to camelize. + @return {String} the camelized string. + */ + camelize: function(str) { + return str.replace(STRING_CAMELIZE_REGEXP, function(match, separator, chr) { + return chr ? chr.toUpperCase() : ''; + }).replace(/^([A-Z])/, function(match, separator, chr) { + return match.toLowerCase(); + }); + }, + + /** + Returns the UpperCamelCase form of a string. + + ```javascript + 'innerHTML'.classify(); // 'InnerHTML' + 'action_name'.classify(); // 'ActionName' + 'css-class-name'.classify(); // 'CssClassName' + 'my favorite items'.classify(); // 'MyFavoriteItems' + ``` + + @method classify + @param {String} str the string to classify + @return {String} the classified string + */ + classify: function(str) { + var parts = str.split("."), + out = []; + + for (var i=0, l=parts.length; i1) args = a_slice.call(arguments, 1); + + this.forEach(function(x, idx) { + var method = x && x[methodName]; + if ('function' === typeof method) { + ret[idx] = args ? method.apply(x, args) : method.call(x); + } + }, this); + + return ret; + }, + + /** + Simply converts the enumerable into a genuine array. The order is not + guaranteed. Corresponds to the method implemented by Prototype. + + @method toArray + @return {Array} the enumerable as an array. + */ + toArray: function() { + var ret = Ember.A([]); + this.forEach(function(o, idx) { ret[idx] = o; }); + return ret ; + }, + + /** + Returns a copy of the array with all null and undefined elements removed. + + ```javascript + var arr = ["a", null, "c", undefined]; + arr.compact(); // ["a", "c"] + ``` + + @method compact + @return {Array} the array without null and undefined elements. + */ + compact: function() { + return this.filter(function(value) { return value != null; }); + }, + + /** + Returns a new enumerable that excludes the passed value. The default + implementation returns an array regardless of the receiver type unless + the receiver does not contain the value. + + ```javascript + var arr = ["a", "b", "a", "c"]; + arr.without("a"); // ["b", "c"] + ``` + + @method without + @param {Object} value + @return {Ember.Enumerable} + */ + without: function(value) { + if (!this.contains(value)) return this; // nothing to do + var ret = Ember.A([]); + this.forEach(function(k) { + if (k !== value) ret[ret.length] = k; + }) ; + return ret ; + }, + + /** + Returns a new enumerable that contains only unique values. The default + implementation returns an array regardless of the receiver type. + + ```javascript + var arr = ["a", "a", "b", "b"]; + arr.uniq(); // ["a", "b"] + ``` + + @method uniq + @return {Ember.Enumerable} + */ + uniq: function() { + var ret = Ember.A([]); + this.forEach(function(k){ + if (a_indexOf(ret, k)<0) ret.push(k); + }); + return ret; + }, + + /** + This property will trigger anytime the enumerable's content changes. + You can observe this property to be notified of changes to the enumerables + content. + + For plain enumerables, this property is read only. `Ember.Array` overrides + this method. + + @property [] + @type Ember.Array + @return this + */ + '[]': Ember.computed(function(key, value) { + return this; + }), + + // .......................................................... + // ENUMERABLE OBSERVERS + // + + /** + Registers an enumerable observer. Must implement `Ember.EnumerableObserver` + mixin. + + @method addEnumerableObserver + @param {Object} target + @param {Hash} [opts] + @return this + */ + addEnumerableObserver: function(target, opts) { + var willChange = (opts && opts.willChange) || 'enumerableWillChange', + didChange = (opts && opts.didChange) || 'enumerableDidChange'; + + var hasObservers = get(this, 'hasEnumerableObservers'); + if (!hasObservers) Ember.propertyWillChange(this, 'hasEnumerableObservers'); + Ember.addListener(this, '@enumerable:before', target, willChange); + Ember.addListener(this, '@enumerable:change', target, didChange); + if (!hasObservers) Ember.propertyDidChange(this, 'hasEnumerableObservers'); + return this; + }, + + /** + Removes a registered enumerable observer. + + @method removeEnumerableObserver + @param {Object} target + @param {Hash} [opts] + @return this + */ + removeEnumerableObserver: function(target, opts) { + var willChange = (opts && opts.willChange) || 'enumerableWillChange', + didChange = (opts && opts.didChange) || 'enumerableDidChange'; + + var hasObservers = get(this, 'hasEnumerableObservers'); + if (hasObservers) Ember.propertyWillChange(this, 'hasEnumerableObservers'); + Ember.removeListener(this, '@enumerable:before', target, willChange); + Ember.removeListener(this, '@enumerable:change', target, didChange); + if (hasObservers) Ember.propertyDidChange(this, 'hasEnumerableObservers'); + return this; + }, + + /** + Becomes true whenever the array currently has observers watching changes + on the array. + + @property hasEnumerableObservers + @type Boolean + */ + hasEnumerableObservers: Ember.computed(function() { + return Ember.hasListeners(this, '@enumerable:change') || Ember.hasListeners(this, '@enumerable:before'); + }), + + + /** + Invoke this method just before the contents of your enumerable will + change. You can either omit the parameters completely or pass the objects + to be removed or added if available or just a count. + + @method enumerableContentWillChange + @param {Ember.Enumerable|Number} removing An enumerable of the objects to + be removed or the number of items to be removed. + @param {Ember.Enumerable|Number} adding An enumerable of the objects to be + added or the number of items to be added. + @chainable + */ + enumerableContentWillChange: function(removing, adding) { + + var removeCnt, addCnt, hasDelta; + + if ('number' === typeof removing) removeCnt = removing; + else if (removing) removeCnt = get(removing, 'length'); + else removeCnt = removing = -1; + + if ('number' === typeof adding) addCnt = adding; + else if (adding) addCnt = get(adding,'length'); + else addCnt = adding = -1; + + hasDelta = addCnt<0 || removeCnt<0 || addCnt-removeCnt!==0; + + if (removing === -1) removing = null; + if (adding === -1) adding = null; + + Ember.propertyWillChange(this, '[]'); + if (hasDelta) Ember.propertyWillChange(this, 'length'); + Ember.sendEvent(this, '@enumerable:before', [this, removing, adding]); + + return this; + }, + + /** + Invoke this method when the contents of your enumerable has changed. + This will notify any observers watching for content changes. If your are + implementing an ordered enumerable (such as an array), also pass the + start and end values where the content changed so that it can be used to + notify range observers. + + @method enumerableContentDidChange + @param {Number} [start] optional start offset for the content change. + For unordered enumerables, you should always pass -1. + @param {Ember.Enumerable|Number} removing An enumerable of the objects to + be removed or the number of items to be removed. + @param {Ember.Enumerable|Number} adding An enumerable of the objects to + be added or the number of items to be added. + @chainable + */ + enumerableContentDidChange: function(removing, adding) { + var removeCnt, addCnt, hasDelta; + + if ('number' === typeof removing) removeCnt = removing; + else if (removing) removeCnt = get(removing, 'length'); + else removeCnt = removing = -1; + + if ('number' === typeof adding) addCnt = adding; + else if (adding) addCnt = get(adding, 'length'); + else addCnt = adding = -1; + + hasDelta = addCnt<0 || removeCnt<0 || addCnt-removeCnt!==0; + + if (removing === -1) removing = null; + if (adding === -1) adding = null; + + Ember.sendEvent(this, '@enumerable:change', [this, removing, adding]); + if (hasDelta) Ember.propertyDidChange(this, 'length'); + Ember.propertyDidChange(this, '[]'); + + return this ; + } + +}) ; + +})(); + + + +(function() { +/** +@module ember +@submodule ember-runtime +*/ + +// .......................................................... +// HELPERS +// + +var get = Ember.get, set = Ember.set, isNone = Ember.isNone, map = Ember.EnumerableUtils.map, cacheFor = Ember.cacheFor; + +// .......................................................... +// ARRAY +// +/** + This module implements Observer-friendly Array-like behavior. This mixin is + picked up by the Array class as well as other controllers, etc. that want to + appear to be arrays. + + Unlike `Ember.Enumerable,` this mixin defines methods specifically for + collections that provide index-ordered access to their contents. When you + are designing code that needs to accept any kind of Array-like object, you + should use these methods instead of Array primitives because these will + properly notify observers of changes to the array. + + Although these methods are efficient, they do add a layer of indirection to + your application so it is a good idea to use them only when you need the + flexibility of using both true JavaScript arrays and "virtual" arrays such + as controllers and collections. + + You can use the methods defined in this module to access and modify array + contents in a KVO-friendly way. You can also be notified whenever the + membership of an array changes by changing the syntax of the property to + `.observes('*myProperty.[]')`. + + To support `Ember.Array` in your own class, you must override two + primitives to use it: `replace()` and `objectAt()`. + + Note that the Ember.Array mixin also incorporates the `Ember.Enumerable` + mixin. All `Ember.Array`-like objects are also enumerable. + + @class Array + @namespace Ember + @extends Ember.Mixin + @uses Ember.Enumerable + @since Ember 0.9.0 +*/ +Ember.Array = Ember.Mixin.create(Ember.Enumerable, /** @scope Ember.Array.prototype */ { + + /** + Your array must support the `length` property. Your replace methods should + set this property whenever it changes. + + @property {Number} length + */ + length: Ember.required(), + + /** + Returns the object at the given `index`. If the given `index` is negative + or is greater or equal than the array length, returns `undefined`. + + This is one of the primitives you must implement to support `Ember.Array`. + If your object supports retrieving the value of an array item using `get()` + (i.e. `myArray.get(0)`), then you do not need to implement this method + yourself. + + ```javascript + var arr = ['a', 'b', 'c', 'd']; + arr.objectAt(0); // "a" + arr.objectAt(3); // "d" + arr.objectAt(-1); // undefined + arr.objectAt(4); // undefined + arr.objectAt(5); // undefined + ``` + + @method objectAt + @param {Number} idx The index of the item to return. + @return {*} item at index or undefined + */ + objectAt: function(idx) { + if ((idx < 0) || (idx>=get(this, 'length'))) return undefined ; + return get(this, idx); + }, + + /** + This returns the objects at the specified indexes, using `objectAt`. + + ```javascript + var arr = ['a', 'b', 'c', 'd']; + arr.objectsAt([0, 1, 2]); // ["a", "b", "c"] + arr.objectsAt([2, 3, 4]); // ["c", "d", undefined] + ``` + + @method objectsAt + @param {Array} indexes An array of indexes of items to return. + @return {Array} + */ + objectsAt: function(indexes) { + var self = this; + return map(indexes, function(idx){ return self.objectAt(idx); }); + }, + + // overrides Ember.Enumerable version + nextObject: function(idx) { + return this.objectAt(idx); + }, + + /** + This is the handler for the special array content property. If you get + this property, it will return this. If you set this property it a new + array, it will replace the current content. + + This property overrides the default property defined in `Ember.Enumerable`. + + @property [] + @return this + */ + '[]': Ember.computed(function(key, value) { + if (value !== undefined) this.replace(0, get(this, 'length'), value) ; + return this ; + }), + + firstObject: Ember.computed(function() { + return this.objectAt(0); + }), + + lastObject: Ember.computed(function() { + return this.objectAt(get(this, 'length')-1); + }), + + // optimized version from Enumerable + contains: function(obj){ + return this.indexOf(obj) >= 0; + }, + + // Add any extra methods to Ember.Array that are native to the built-in Array. + /** + Returns a new array that is a slice of the receiver. This implementation + uses the observable array methods to retrieve the objects for the new + slice. + + ```javascript + var arr = ['red', 'green', 'blue']; + arr.slice(0); // ['red', 'green', 'blue'] + arr.slice(0, 2); // ['red', 'green'] + arr.slice(1, 100); // ['green', 'blue'] + ``` + + @method slice + @param {Integer} beginIndex (Optional) index to begin slicing from. + @param {Integer} endIndex (Optional) index to end the slice at. + @return {Array} New array with specified slice + */ + slice: function(beginIndex, endIndex) { + var ret = Ember.A([]); + var length = get(this, 'length') ; + if (isNone(beginIndex)) beginIndex = 0 ; + if (isNone(endIndex) || (endIndex > length)) endIndex = length ; + + if (beginIndex < 0) beginIndex = length + beginIndex; + if (endIndex < 0) endIndex = length + endIndex; + + while(beginIndex < endIndex) { + ret[ret.length] = this.objectAt(beginIndex++) ; + } + return ret ; + }, + + /** + Returns the index of the given object's first occurrence. + If no `startAt` argument is given, the starting location to + search is 0. If it's negative, will count backward from + the end of the array. Returns -1 if no match is found. + + ```javascript + var arr = ["a", "b", "c", "d", "a"]; + arr.indexOf("a"); // 0 + arr.indexOf("z"); // -1 + arr.indexOf("a", 2); // 4 + arr.indexOf("a", -1); // 4 + arr.indexOf("b", 3); // -1 + arr.indexOf("a", 100); // -1 + ``` + + @method indexOf + @param {Object} object the item to search for + @param {Number} startAt optional starting location to search, default 0 + @return {Number} index or -1 if not found + */ + indexOf: function(object, startAt) { + var idx, len = get(this, 'length'); + + if (startAt === undefined) startAt = 0; + if (startAt < 0) startAt += len; + + for(idx=startAt;idx= len) startAt = len-1; + if (startAt < 0) startAt += len; + + for(idx=startAt;idx>=0;idx--) { + if (this.objectAt(idx) === object) return idx ; + } + return -1; + }, + + // .......................................................... + // ARRAY OBSERVERS + // + + /** + Adds an array observer to the receiving array. The array observer object + normally must implement two methods: + + * `arrayWillChange(observedObj, start, removeCount, addCount)` - This method will be + called just before the array is modified. + * `arrayDidChange(observedObj, start, removeCount, addCount)` - This method will be + called just after the array is modified. + + Both callbacks will be passed the observed object, starting index of the + change as well a a count of the items to be removed and added. You can use + these callbacks to optionally inspect the array during the change, clear + caches, or do any other bookkeeping necessary. + + In addition to passing a target, you can also include an options hash + which you can use to override the method names that will be invoked on the + target. + + @method addArrayObserver + @param {Object} target The observer object. + @param {Hash} opts Optional hash of configuration options including + `willChange` and `didChange` option. + @return {Ember.Array} receiver + */ + addArrayObserver: function(target, opts) { + var willChange = (opts && opts.willChange) || 'arrayWillChange', + didChange = (opts && opts.didChange) || 'arrayDidChange'; + + var hasObservers = get(this, 'hasArrayObservers'); + if (!hasObservers) Ember.propertyWillChange(this, 'hasArrayObservers'); + Ember.addListener(this, '@array:before', target, willChange); + Ember.addListener(this, '@array:change', target, didChange); + if (!hasObservers) Ember.propertyDidChange(this, 'hasArrayObservers'); + return this; + }, + + /** + Removes an array observer from the object if the observer is current + registered. Calling this method multiple times with the same object will + have no effect. + + @method removeArrayObserver + @param {Object} target The object observing the array. + @param {Hash} opts Optional hash of configuration options including + `willChange` and `didChange` option. + @return {Ember.Array} receiver + */ + removeArrayObserver: function(target, opts) { + var willChange = (opts && opts.willChange) || 'arrayWillChange', + didChange = (opts && opts.didChange) || 'arrayDidChange'; + + var hasObservers = get(this, 'hasArrayObservers'); + if (hasObservers) Ember.propertyWillChange(this, 'hasArrayObservers'); + Ember.removeListener(this, '@array:before', target, willChange); + Ember.removeListener(this, '@array:change', target, didChange); + if (hasObservers) Ember.propertyDidChange(this, 'hasArrayObservers'); + return this; + }, + + /** + Becomes true whenever the array currently has observers watching changes + on the array. + + @property Boolean + */ + hasArrayObservers: Ember.computed(function() { + return Ember.hasListeners(this, '@array:change') || Ember.hasListeners(this, '@array:before'); + }), + + /** + If you are implementing an object that supports `Ember.Array`, call this + method just before the array content changes to notify any observers and + invalidate any related properties. Pass the starting index of the change + as well as a delta of the amounts to change. + + @method arrayContentWillChange + @param {Number} startIdx The starting index in the array that will change. + @param {Number} removeAmt The number of items that will be removed. If you + pass `null` assumes 0 + @param {Number} addAmt The number of items that will be added. If you + pass `null` assumes 0. + @return {Ember.Array} receiver + */ + arrayContentWillChange: function(startIdx, removeAmt, addAmt) { + + // if no args are passed assume everything changes + if (startIdx===undefined) { + startIdx = 0; + removeAmt = addAmt = -1; + } else { + if (removeAmt === undefined) removeAmt=-1; + if (addAmt === undefined) addAmt=-1; + } + + // Make sure the @each proxy is set up if anyone is observing @each + if (Ember.isWatching(this, '@each')) { get(this, '@each'); } + + Ember.sendEvent(this, '@array:before', [this, startIdx, removeAmt, addAmt]); + + var removing, lim; + if (startIdx>=0 && removeAmt>=0 && get(this, 'hasEnumerableObservers')) { + removing = []; + lim = startIdx+removeAmt; + for(var idx=startIdx;idx=0 && addAmt>=0 && get(this, 'hasEnumerableObservers')) { + adding = []; + lim = startIdx+addAmt; + for(var idx=startIdx;idx b` + + Default implementation raises an exception. + + @method compare + @param a {Object} the first object to compare + @param b {Object} the second object to compare + @return {Integer} the result of the comparison + */ + compare: Ember.required(Function) + +}); + + +})(); + + + +(function() { +/** +@module ember +@submodule ember-runtime +*/ + + + +var get = Ember.get, set = Ember.set; + +/** + Implements some standard methods for copying an object. Add this mixin to + any object you create that can create a copy of itself. This mixin is + added automatically to the built-in array. + + You should generally implement the `copy()` method to return a copy of the + receiver. + + Note that `frozenCopy()` will only work if you also implement + `Ember.Freezable`. + + @class Copyable + @namespace Ember + @extends Ember.Mixin + @since Ember 0.9 +*/ +Ember.Copyable = Ember.Mixin.create(/** @scope Ember.Copyable.prototype */ { + + /** + Override to return a copy of the receiver. Default implementation raises + an exception. + + @method copy + @param {Boolean} deep if `true`, a deep copy of the object should be made + @return {Object} copy of receiver + */ + copy: Ember.required(Function), + + /** + If the object implements `Ember.Freezable`, then this will return a new + copy if the object is not frozen and the receiver if the object is frozen. + + Raises an exception if you try to call this method on a object that does + not support freezing. + + You should use this method whenever you want a copy of a freezable object + since a freezable object can simply return itself without actually + consuming more memory. + + @method frozenCopy + @return {Object} copy of receiver or receiver + */ + frozenCopy: function() { + if (Ember.Freezable && Ember.Freezable.detect(this)) { + return get(this, 'isFrozen') ? this : this.copy().freeze(); + } else { + throw new Error(Ember.String.fmt("%@ does not support freezing", [this])); + } + } +}); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-runtime +*/ + + +var get = Ember.get, set = Ember.set; + +/** + The `Ember.Freezable` mixin implements some basic methods for marking an + object as frozen. Once an object is frozen it should be read only. No changes + may be made the internal state of the object. + + ## Enforcement + + To fully support freezing in your subclass, you must include this mixin and + override any method that might alter any property on the object to instead + raise an exception. You can check the state of an object by checking the + `isFrozen` property. + + Although future versions of JavaScript may support language-level freezing + object objects, that is not the case today. Even if an object is freezable, + it is still technically possible to modify the object, even though it could + break other parts of your application that do not expect a frozen object to + change. It is, therefore, very important that you always respect the + `isFrozen` property on all freezable objects. + + ## Example Usage + + The example below shows a simple object that implement the `Ember.Freezable` + protocol. + + ```javascript + Contact = Ember.Object.extend(Ember.Freezable, { + firstName: null, + lastName: null, + + // swaps the names + swapNames: function() { + if (this.get('isFrozen')) throw Ember.FROZEN_ERROR; + var tmp = this.get('firstName'); + this.set('firstName', this.get('lastName')); + this.set('lastName', tmp); + return this; + } + + }); + + c = Context.create({ firstName: "John", lastName: "Doe" }); + c.swapNames(); // returns c + c.freeze(); + c.swapNames(); // EXCEPTION + ``` + + ## Copying + + Usually the `Ember.Freezable` protocol is implemented in cooperation with the + `Ember.Copyable` protocol, which defines a `frozenCopy()` method that will + return a frozen object, if the object implements this method as well. + + @class Freezable + @namespace Ember + @extends Ember.Mixin + @since Ember 0.9 +*/ +Ember.Freezable = Ember.Mixin.create(/** @scope Ember.Freezable.prototype */ { + + /** + Set to `true` when the object is frozen. Use this property to detect + whether your object is frozen or not. + + @property isFrozen + @type Boolean + */ + isFrozen: false, + + /** + Freezes the object. Once this method has been called the object should + no longer allow any properties to be edited. + + @method freeze + @return {Object} receiver + */ + freeze: function() { + if (get(this, 'isFrozen')) return this; + set(this, 'isFrozen', true); + return this; + } + +}); + +Ember.FROZEN_ERROR = "Frozen object cannot be modified."; + +})(); + + + +(function() { +/** +@module ember +@submodule ember-runtime +*/ + +var forEach = Ember.EnumerableUtils.forEach; + +/** + This mixin defines the API for modifying generic enumerables. These methods + can be applied to an object regardless of whether it is ordered or + unordered. + + Note that an Enumerable can change even if it does not implement this mixin. + For example, a MappedEnumerable cannot be directly modified but if its + underlying enumerable changes, it will change also. + + ## Adding Objects + + To add an object to an enumerable, use the `addObject()` method. This + method will only add the object to the enumerable if the object is not + already present and is of a type supported by the enumerable. + + ```javascript + set.addObject(contact); + ``` + + ## Removing Objects + + To remove an object from an enumerable, use the `removeObject()` method. This + will only remove the object if it is present in the enumerable, otherwise + this method has no effect. + + ```javascript + set.removeObject(contact); + ``` + + ## Implementing In Your Own Code + + If you are implementing an object and want to support this API, just include + this mixin in your class and implement the required methods. In your unit + tests, be sure to apply the Ember.MutableEnumerableTests to your object. + + @class MutableEnumerable + @namespace Ember + @extends Ember.Mixin + @uses Ember.Enumerable +*/ +Ember.MutableEnumerable = Ember.Mixin.create(Ember.Enumerable, { + + /** + __Required.__ You must implement this method to apply this mixin. + + Attempts to add the passed object to the receiver if the object is not + already present in the collection. If the object is present, this method + has no effect. + + If the passed object is of a type not supported by the receiver, + then this method should raise an exception. + + @method addObject + @param {Object} object The object to add to the enumerable. + @return {Object} the passed object + */ + addObject: Ember.required(Function), + + /** + Adds each object in the passed enumerable to the receiver. + + @method addObjects + @param {Ember.Enumerable} objects the objects to add. + @return {Object} receiver + */ + addObjects: function(objects) { + Ember.beginPropertyChanges(this); + forEach(objects, function(obj) { this.addObject(obj); }, this); + Ember.endPropertyChanges(this); + return this; + }, + + /** + __Required.__ You must implement this method to apply this mixin. + + Attempts to remove the passed object from the receiver collection if the + object is present in the collection. If the object is not present, + this method has no effect. + + If the passed object is of a type not supported by the receiver, + then this method should raise an exception. + + @method removeObject + @param {Object} object The object to remove from the enumerable. + @return {Object} the passed object + */ + removeObject: Ember.required(Function), + + + /** + Removes each object in the passed enumerable from the receiver. + + @method removeObjects + @param {Ember.Enumerable} objects the objects to remove + @return {Object} receiver + */ + removeObjects: function(objects) { + Ember.beginPropertyChanges(this); + forEach(objects, function(obj) { this.removeObject(obj); }, this); + Ember.endPropertyChanges(this); + return this; + } + +}); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-runtime +*/ +// .......................................................... +// CONSTANTS +// + +var OUT_OF_RANGE_EXCEPTION = "Index out of range" ; +var EMPTY = []; + +// .......................................................... +// HELPERS +// + +var get = Ember.get, set = Ember.set; + +/** + This mixin defines the API for modifying array-like objects. These methods + can be applied only to a collection that keeps its items in an ordered set. + + Note that an Array can change even if it does not implement this mixin. + For example, one might implement a SparseArray that cannot be directly + modified, but if its underlying enumerable changes, it will change also. + + @class MutableArray + @namespace Ember + @extends Ember.Mixin + @uses Ember.Array + @uses Ember.MutableEnumerable +*/ +Ember.MutableArray = Ember.Mixin.create(Ember.Array, Ember.MutableEnumerable,/** @scope Ember.MutableArray.prototype */ { + + /** + __Required.__ You must implement this method to apply this mixin. + + This is one of the primitives you must implement to support `Ember.Array`. + You should replace amt objects started at idx with the objects in the + passed array. You should also call `this.enumerableContentDidChange()` + + @method replace + @param {Number} idx Starting index in the array to replace. If + idx >= length, then append to the end of the array. + @param {Number} amt Number of elements that should be removed from + the array, starting at *idx*. + @param {Array} objects An array of zero or more objects that should be + inserted into the array at *idx* + */ + replace: Ember.required(), + + /** + Remove all elements from self. This is useful if you + want to reuse an existing array without having to recreate it. + + ```javascript + var colors = ["red", "green", "blue"]; + color.length(); // 3 + colors.clear(); // [] + colors.length(); // 0 + ``` + + @method clear + @return {Ember.Array} An empty Array. + */ + clear: function () { + var len = get(this, 'length'); + if (len === 0) return this; + this.replace(0, len, EMPTY); + return this; + }, + + /** + This will use the primitive `replace()` method to insert an object at the + specified index. + + ```javascript + var colors = ["red", "green", "blue"]; + colors.insertAt(2, "yellow"); // ["red", "green", "yellow", "blue"] + colors.insertAt(5, "orange"); // Error: Index out of range + ``` + + @method insertAt + @param {Number} idx index of insert the object at. + @param {Object} object object to insert + @return this + */ + insertAt: function(idx, object) { + if (idx > get(this, 'length')) throw new Error(OUT_OF_RANGE_EXCEPTION) ; + this.replace(idx, 0, [object]) ; + return this ; + }, + + /** + Remove an object at the specified index using the `replace()` primitive + method. You can pass either a single index, or a start and a length. + + If you pass a start and length that is beyond the + length this method will throw an `Ember.OUT_OF_RANGE_EXCEPTION` + + ```javascript + var colors = ["red", "green", "blue", "yellow", "orange"]; + colors.removeAt(0); // ["green", "blue", "yellow", "orange"] + colors.removeAt(2, 2); // ["green", "blue"] + colors.removeAt(4, 2); // Error: Index out of range + ``` + + @method removeAt + @param {Number} start index, start of range + @param {Number} len length of passing range + @return {Object} receiver + */ + removeAt: function(start, len) { + if ('number' === typeof start) { + + if ((start < 0) || (start >= get(this, 'length'))) { + throw new Error(OUT_OF_RANGE_EXCEPTION); + } + + // fast case + if (len === undefined) len = 1; + this.replace(start, len, EMPTY); + } + + return this ; + }, + + /** + Push the object onto the end of the array. Works just like `push()` but it + is KVO-compliant. + + ```javascript + var colors = ["red", "green", "blue"]; + colors.pushObject("black"); // ["red", "green", "blue", "black"] + colors.pushObject(["yellow", "orange"]); // ["red", "green", "blue", "black", ["yellow", "orange"]] + ``` + + @method pushObject + @param {*} obj object to push + @return {*} the same obj passed as param + */ + pushObject: function(obj) { + this.insertAt(get(this, 'length'), obj) ; + return obj ; + }, + + /** + Add the objects in the passed numerable to the end of the array. Defers + notifying observers of the change until all objects are added. + + ```javascript + var colors = ["red", "green", "blue"]; + colors.pushObjects("black"); // ["red", "green", "blue", "black"] + colors.pushObjects(["yellow", "orange"]); // ["red", "green", "blue", "black", "yellow", "orange"] + ``` + + @method pushObjects + @param {Ember.Enumerable} objects the objects to add + @return {Ember.Array} receiver + */ + pushObjects: function(objects) { + this.replace(get(this, 'length'), 0, objects); + return this; + }, + + /** + Pop object from array or nil if none are left. Works just like `pop()` but + it is KVO-compliant. + + ```javascript + var colors = ["red", "green", "blue"]; + colors.popObject(); // "blue" + console.log(colors); // ["red", "green"] + ``` + + @method popObject + @return object + */ + popObject: function() { + var len = get(this, 'length') ; + if (len === 0) return null ; + + var ret = this.objectAt(len-1) ; + this.removeAt(len-1, 1) ; + return ret ; + }, + + /** + Shift an object from start of array or nil if none are left. Works just + like `shift()` but it is KVO-compliant. + + ```javascript + var colors = ["red", "green", "blue"]; + colors.shiftObject(); // "red" + console.log(colors); // ["green", "blue"] + ``` + + @method shiftObject + @return object + */ + shiftObject: function() { + if (get(this, 'length') === 0) return null ; + var ret = this.objectAt(0) ; + this.removeAt(0) ; + return ret ; + }, + + /** + Unshift an object to start of array. Works just like `unshift()` but it is + KVO-compliant. + + ```javascript + var colors = ["red", "green", "blue"]; + colors.unshiftObject("yellow"); // ["yellow", "red", "green", "blue"] + colors.unshiftObject(["black", "white"]); // [["black", "white"], "yellow", "red", "green", "blue"] + ``` + + @method unshiftObject + @param {*} obj object to unshift + @return {*} the same obj passed as param + */ + unshiftObject: function(obj) { + this.insertAt(0, obj) ; + return obj ; + }, + + /** + Adds the named objects to the beginning of the array. Defers notifying + observers until all objects have been added. + + ```javascript + var colors = ["red", "green", "blue"]; + colors.unshiftObjects(["black", "white"]); // ["black", "white", "red", "green", "blue"] + colors.unshiftObjects("yellow"); // Type Error: 'undefined' is not a function + ``` + + @method unshiftObjects + @param {Ember.Enumerable} objects the objects to add + @return {Ember.Array} receiver + */ + unshiftObjects: function(objects) { + this.replace(0, 0, objects); + return this; + }, + + /** + Reverse objects in the array. Works just like `reverse()` but it is + KVO-compliant. + + @method reverseObjects + @return {Ember.Array} receiver + */ + reverseObjects: function() { + var len = get(this, 'length'); + if (len === 0) return this; + var objects = this.toArray().reverse(); + this.replace(0, len, objects); + return this; + }, + + /** + Replace all the the receiver's content with content of the argument. + If argument is an empty array receiver will be cleared. + + ```javascript + var colors = ["red", "green", "blue"]; + colors.setObjects(["black", "white"]); // ["black", "white"] + colors.setObjects([]); // [] + ``` + + @method setObjects + @param {Ember.Array} objects array whose content will be used for replacing + the content of the receiver + @return {Ember.Array} receiver with the new content + */ + setObjects: function(objects) { + if (objects.length === 0) return this.clear(); + + var len = get(this, 'length'); + this.replace(0, len, objects); + return this; + }, + + // .......................................................... + // IMPLEMENT Ember.MutableEnumerable + // + + removeObject: function(obj) { + var loc = get(this, 'length') || 0; + while(--loc >= 0) { + var curObject = this.objectAt(loc) ; + if (curObject === obj) this.removeAt(loc) ; + } + return this ; + }, + + addObject: function(obj) { + if (!this.contains(obj)) this.pushObject(obj); + return this ; + } + +}); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-runtime +*/ + +var get = Ember.get, set = Ember.set; + +/** + ## Overview + + This mixin provides properties and property observing functionality, core + features of the Ember object model. + + Properties and observers allow one object to observe changes to a + property on another object. This is one of the fundamental ways that + models, controllers and views communicate with each other in an Ember + application. + + Any object that has this mixin applied can be used in observer + operations. That includes `Ember.Object` and most objects you will + interact with as you write your Ember application. + + Note that you will not generally apply this mixin to classes yourself, + but you will use the features provided by this module frequently, so it + is important to understand how to use it. + + ## Using `get()` and `set()` + + Because of Ember's support for bindings and observers, you will always + access properties using the get method, and set properties using the + set method. This allows the observing objects to be notified and + computed properties to be handled properly. + + More documentation about `get` and `set` are below. + + ## Observing Property Changes + + You typically observe property changes simply by adding the `observes` + call to the end of your method declarations in classes that you write. + For example: + + ```javascript + Ember.Object.extend({ + valueObserver: function() { + // Executes whenever the "value" property changes + }.observes('value') + }); + ``` + + Although this is the most common way to add an observer, this capability + is actually built into the `Ember.Object` class on top of two methods + defined in this mixin: `addObserver` and `removeObserver`. You can use + these two methods to add and remove observers yourself if you need to + do so at runtime. + + To add an observer for a property, call: + + ```javascript + object.addObserver('propertyKey', targetObject, targetAction) + ``` + + This will call the `targetAction` method on the `targetObject` whenever + the value of the `propertyKey` changes. + + Note that if `propertyKey` is a computed property, the observer will be + called when any of the property dependencies are changed, even if the + resulting value of the computed property is unchanged. This is necessary + because computed properties are not computed until `get` is called. + + @class Observable + @namespace Ember + @extends Ember.Mixin +*/ +Ember.Observable = Ember.Mixin.create(/** @scope Ember.Observable.prototype */ { + + /** + Retrieves the value of a property from the object. + + This method is usually similar to using `object[keyName]` or `object.keyName`, + however it supports both computed properties and the unknownProperty + handler. + + Because `get` unifies the syntax for accessing all these kinds + of properties, it can make many refactorings easier, such as replacing a + simple property with a computed property, or vice versa. + + ### Computed Properties + + Computed properties are methods defined with the `property` modifier + declared at the end, such as: + + ```javascript + fullName: function() { + return this.getEach('firstName', 'lastName').compact().join(' '); + }.property('firstName', 'lastName') + ``` + + When you call `get` on a computed property, the function will be + called and the return value will be returned instead of the function + itself. + + ### Unknown Properties + + Likewise, if you try to call `get` on a property whose value is + `undefined`, the `unknownProperty()` method will be called on the object. + If this method returns any value other than `undefined`, it will be returned + instead. This allows you to implement "virtual" properties that are + not defined upfront. + + @method get + @param {String} keyName The property to retrieve + @return {Object} The property value or undefined. + */ + get: function(keyName) { + return get(this, keyName); + }, + + /** + To get multiple properties at once, call `getProperties` + with a list of strings or an array: + + ```javascript + record.getProperties('firstName', 'lastName', 'zipCode'); // { firstName: 'John', lastName: 'Doe', zipCode: '10011' } + ``` + + is equivalent to: + + ```javascript + record.getProperties(['firstName', 'lastName', 'zipCode']); // { firstName: 'John', lastName: 'Doe', zipCode: '10011' } + ``` + + @method getProperties + @param {String...|Array} list of keys to get + @return {Hash} + */ + getProperties: function() { + var ret = {}; + var propertyNames = arguments; + if (arguments.length === 1 && Ember.typeOf(arguments[0]) === 'array') { + propertyNames = arguments[0]; + } + for(var i = 0; i < propertyNames.length; i++) { + ret[propertyNames[i]] = get(this, propertyNames[i]); + } + return ret; + }, + + /** + Sets the provided key or path to the value. + + This method is generally very similar to calling `object[key] = value` or + `object.key = value`, except that it provides support for computed + properties, the `unknownProperty()` method and property observers. + + ### Computed Properties + + If you try to set a value on a key that has a computed property handler + defined (see the `get()` method for an example), then `set()` will call + that method, passing both the value and key instead of simply changing + the value itself. This is useful for those times when you need to + implement a property that is composed of one or more member + properties. + + ### Unknown Properties + + If you try to set a value on a key that is undefined in the target + object, then the `unknownProperty()` handler will be called instead. This + gives you an opportunity to implement complex "virtual" properties that + are not predefined on the object. If `unknownProperty()` returns + undefined, then `set()` will simply set the value on the object. + + ### Property Observers + + In addition to changing the property, `set()` will also register a property + change with the object. Unless you have placed this call inside of a + `beginPropertyChanges()` and `endPropertyChanges(),` any "local" observers + (i.e. observer methods declared on the same object), will be called + immediately. Any "remote" observers (i.e. observer methods declared on + another object) will be placed in a queue and called at a later time in a + coalesced manner. + + ### Chaining + + In addition to property changes, `set()` returns the value of the object + itself so you can do chaining like this: + + ```javascript + record.set('firstName', 'Charles').set('lastName', 'Jolley'); + ``` + + @method set + @param {String} keyName The property to set + @param {Object} value The value to set or `null`. + @return {Ember.Observable} + */ + set: function(keyName, value) { + set(this, keyName, value); + return this; + }, + + /** + To set multiple properties at once, call `setProperties` + with a Hash: + + ```javascript + record.setProperties({ firstName: 'Charles', lastName: 'Jolley' }); + ``` + + @method setProperties + @param {Hash} hash the hash of keys and values to set + @return {Ember.Observable} + */ + setProperties: function(hash) { + return Ember.setProperties(this, hash); + }, + + /** + Begins a grouping of property changes. + + You can use this method to group property changes so that notifications + will not be sent until the changes are finished. If you plan to make a + large number of changes to an object at one time, you should call this + method at the beginning of the changes to begin deferring change + notifications. When you are done making changes, call + `endPropertyChanges()` to deliver the deferred change notifications and end + deferring. + + @method beginPropertyChanges + @return {Ember.Observable} + */ + beginPropertyChanges: function() { + Ember.beginPropertyChanges(); + return this; + }, + + /** + Ends a grouping of property changes. + + You can use this method to group property changes so that notifications + will not be sent until the changes are finished. If you plan to make a + large number of changes to an object at one time, you should call + `beginPropertyChanges()` at the beginning of the changes to defer change + notifications. When you are done making changes, call this method to + deliver the deferred change notifications and end deferring. + + @method endPropertyChanges + @return {Ember.Observable} + */ + endPropertyChanges: function() { + Ember.endPropertyChanges(); + return this; + }, + + /** + Notify the observer system that a property is about to change. + + Sometimes you need to change a value directly or indirectly without + actually calling `get()` or `set()` on it. In this case, you can use this + method and `propertyDidChange()` instead. Calling these two methods + together will notify all observers that the property has potentially + changed value. + + Note that you must always call `propertyWillChange` and `propertyDidChange` + as a pair. If you do not, it may get the property change groups out of + order and cause notifications to be delivered more often than you would + like. + + @method propertyWillChange + @param {String} keyName The property key that is about to change. + @return {Ember.Observable} + */ + propertyWillChange: function(keyName){ + Ember.propertyWillChange(this, keyName); + return this; + }, + + /** + Notify the observer system that a property has just changed. + + Sometimes you need to change a value directly or indirectly without + actually calling `get()` or `set()` on it. In this case, you can use this + method and `propertyWillChange()` instead. Calling these two methods + together will notify all observers that the property has potentially + changed value. + + Note that you must always call `propertyWillChange` and `propertyDidChange` + as a pair. If you do not, it may get the property change groups out of + order and cause notifications to be delivered more often than you would + like. + + @method propertyDidChange + @param {String} keyName The property key that has just changed. + @return {Ember.Observable} + */ + propertyDidChange: function(keyName) { + Ember.propertyDidChange(this, keyName); + return this; + }, + + /** + Convenience method to call `propertyWillChange` and `propertyDidChange` in + succession. + + @method notifyPropertyChange + @param {String} keyName The property key to be notified about. + @return {Ember.Observable} + */ + notifyPropertyChange: function(keyName) { + this.propertyWillChange(keyName); + this.propertyDidChange(keyName); + return this; + }, + + addBeforeObserver: function(key, target, method) { + Ember.addBeforeObserver(this, key, target, method); + }, + + /** + Adds an observer on a property. + + This is the core method used to register an observer for a property. + + Once you call this method, any time the key's value is set, your observer + will be notified. Note that the observers are triggered any time the + value is set, regardless of whether it has actually changed. Your + observer should be prepared to handle that. + + You can also pass an optional context parameter to this method. The + context will be passed to your observer method whenever it is triggered. + Note that if you add the same target/method pair on a key multiple times + with different context parameters, your observer will only be called once + with the last context you passed. + + ### Observer Methods + + Observer methods you pass should generally have the following signature if + you do not pass a `context` parameter: + + ```javascript + fooDidChange: function(sender, key, value, rev) { }; + ``` + + The sender is the object that changed. The key is the property that + changes. The value property is currently reserved and unused. The rev + is the last property revision of the object when it changed, which you can + use to detect if the key value has really changed or not. + + If you pass a `context` parameter, the context will be passed before the + revision like so: + + ```javascript + fooDidChange: function(sender, key, value, context, rev) { }; + ``` + + Usually you will not need the value, context or revision parameters at + the end. In this case, it is common to write observer methods that take + only a sender and key value as parameters or, if you aren't interested in + any of these values, to write an observer that has no parameters at all. + + @method addObserver + @param {String} key The key to observer + @param {Object} target The target object to invoke + @param {String|Function} method The method to invoke. + @return {Ember.Object} self + */ + addObserver: function(key, target, method) { + Ember.addObserver(this, key, target, method); + }, + + /** + Remove an observer you have previously registered on this object. Pass + the same key, target, and method you passed to `addObserver()` and your + target will no longer receive notifications. + + @method removeObserver + @param {String} key The key to observer + @param {Object} target The target object to invoke + @param {String|Function} method The method to invoke. + @return {Ember.Observable} receiver + */ + removeObserver: function(key, target, method) { + Ember.removeObserver(this, key, target, method); + }, + + /** + Returns `true` if the object currently has observers registered for a + particular key. You can use this method to potentially defer performing + an expensive action until someone begins observing a particular property + on the object. + + @method hasObserverFor + @param {String} key Key to check + @return {Boolean} + */ + hasObserverFor: function(key) { + return Ember.hasListeners(this, key+':change'); + }, + + /** + @deprecated + @method getPath + @param {String} path The property path to retrieve + @return {Object} The property value or undefined. + */ + getPath: function(path) { + Ember.deprecate("getPath is deprecated since get now supports paths"); + return this.get(path); + }, + + /** + @deprecated + @method setPath + @param {String} path The path to the property that will be set + @param {Object} value The value to set or `null`. + @return {Ember.Observable} + */ + setPath: function(path, value) { + Ember.deprecate("setPath is deprecated since set now supports paths"); + return this.set(path, value); + }, + + /** + Retrieves the value of a property, or a default value in the case that the + property returns `undefined`. + + ```javascript + person.getWithDefault('lastName', 'Doe'); + ``` + + @method getWithDefault + @param {String} keyName The name of the property to retrieve + @param {Object} defaultValue The value to return if the property value is undefined + @return {Object} The property value or the defaultValue. + */ + getWithDefault: function(keyName, defaultValue) { + return Ember.getWithDefault(this, keyName, defaultValue); + }, + + /** + Set the value of a property to the current value plus some amount. + + ```javascript + person.incrementProperty('age'); + team.incrementProperty('score', 2); + ``` + + @method incrementProperty + @param {String} keyName The name of the property to increment + @param {Number} increment The amount to increment by. Defaults to 1 + @return {Number} The new property value + */ + incrementProperty: function(keyName, increment) { + if (Ember.isNone(increment)) { increment = 1; } + set(this, keyName, (get(this, keyName) || 0)+increment); + return get(this, keyName); + }, + + /** + Set the value of a property to the current value minus some amount. + + ```javascript + player.decrementProperty('lives'); + orc.decrementProperty('health', 5); + ``` + + @method decrementProperty + @param {String} keyName The name of the property to decrement + @param {Number} decrement The amount to decrement by. Defaults to 1 + @return {Number} The new property value + */ + decrementProperty: function(keyName, decrement) { + if (Ember.isNone(decrement)) { decrement = 1; } + set(this, keyName, (get(this, keyName) || 0)-decrement); + return get(this, keyName); + }, + + /** + Set the value of a boolean property to the opposite of it's + current value. + + ```javascript + starship.toggleProperty('warpDriveEngaged'); + ``` + + @method toggleProperty + @param {String} keyName The name of the property to toggle + @return {Object} The new property value + */ + toggleProperty: function(keyName) { + set(this, keyName, !get(this, keyName)); + return get(this, keyName); + }, + + /** + Returns the cached value of a computed property, if it exists. + This allows you to inspect the value of a computed property + without accidentally invoking it if it is intended to be + generated lazily. + + @method cacheFor + @param {String} keyName + @return {Object} The cached value of the computed property, if any + */ + cacheFor: function(keyName) { + return Ember.cacheFor(this, keyName); + }, + + // intended for debugging purposes + observersForKey: function(keyName) { + return Ember.observersFor(this, keyName); + } +}); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-runtime +*/ + +var get = Ember.get, set = Ember.set; + +/** +`Ember.TargetActionSupport` is a mixin that can be included in a class +to add a `triggerAction` method with semantics similar to the Handlebars +`{{action}}` helper. In normal Ember usage, the `{{action}}` helper is +usually the best choice. This mixin is most often useful when you are +doing more complex event handling in View objects. + +See also `Ember.ViewTargetActionSupport`, which has +view-aware defaults for target and actionContext. + +@class TargetActionSupport +@namespace Ember +@extends Ember.Mixin +*/ +Ember.TargetActionSupport = Ember.Mixin.create({ + target: null, + action: null, + actionContext: null, + + targetObject: Ember.computed(function() { + var target = get(this, 'target'); + + if (Ember.typeOf(target) === "string") { + var value = get(this, target); + if (value === undefined) { value = get(Ember.lookup, target); } + return value; + } else { + return target; + } + }).property('target'), + + actionContextObject: Ember.computed(function() { + var actionContext = get(this, 'actionContext'); + + if (Ember.typeOf(actionContext) === "string") { + var value = get(this, actionContext); + if (value === undefined) { value = get(Ember.lookup, actionContext); } + return value; + } else { + return actionContext; + } + }).property('actionContext'), + + /** + Send an "action" with an "actionContext" to a "target". The action, actionContext + and target will be retrieved from properties of the object. For example: + + ```javascript + App.SaveButtonView = Ember.View.extend(Ember.TargetActionSupport, { + target: Ember.computed.alias('controller'), + action: 'save', + actionContext: Ember.computed.alias('context'), + click: function(){ + this.triggerAction(); // Sends the `save` action, along with the current context + // to the current controller + } + }); + ``` + + The `target`, `action`, and `actionContext` can be provided as properties of + an optional object argument to `triggerAction` as well. + + ```javascript + App.SaveButtonView = Ember.View.extend(Ember.TargetActionSupport, { + click: function(){ + this.triggerAction({ + action: 'save', + target: this.get('controller'), + actionContext: this.get('context'), + }); // Sends the `save` action, along with the current context + // to the current controller + } + }); + ``` + + The `actionContext` defaults to the object you mixing `TargetActionSupport` into. + But `target` and `action` must be specified either as properties or with the argument + to `triggerAction`, or a combination: + + ```javascript + App.SaveButtonView = Ember.View.extend(Ember.TargetActionSupport, { + target: Ember.computed.alias('controller'), + click: function(){ + this.triggerAction({ + action: 'save' + }); // Sends the `save` action, along with a reference to `this`, + // to the current controller + } + }); + ``` + + @method triggerAction + @param opts {Hash} (optional, with the optional keys action, target and/or actionContext) + @return {Boolean} true if the action was sent successfully and did not return false + */ + triggerAction: function(opts) { + opts = opts || {}; + var action = opts['action'] || get(this, 'action'), + target = opts['target'] || get(this, 'targetObject'), + actionContext = opts['actionContext'] || get(this, 'actionContextObject') || this; + + if (target && action) { + var ret; + + if (target.send) { + ret = target.send.apply(target, [action, actionContext]); + } else { + Ember.assert("The action '" + action + "' did not exist on " + target, typeof target[action] === 'function'); + ret = target[action].apply(target, [actionContext]); + } + + if (ret !== false) ret = true; + + return ret; + } else { + return false; + } + } +}); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-runtime +*/ + +/** + This mixin allows for Ember objects to subscribe to and emit events. + + ```javascript + App.Person = Ember.Object.extend(Ember.Evented, { + greet: function() { + // ... + this.trigger('greet'); + } + }); + + var person = App.Person.create(); + + person.on('greet', function() { + console.log('Our person has greeted'); + }); + + person.greet(); + + // outputs: 'Our person has greeted' + ``` + + You can also chain multiple event subscriptions: + + ```javascript + person.on('greet', function() { + console.log('Our person has greeted'); + }).one('greet', function() { + console.log('Offer one-time special'); + }).off('event', this, forgetThis); + ``` + + @class Evented + @namespace Ember + @extends Ember.Mixin + */ +Ember.Evented = Ember.Mixin.create({ + + /** + Subscribes to a named event with given function. + + ```javascript + person.on('didLoad', function() { + // fired once the person has loaded + }); + ``` + + An optional target can be passed in as the 2nd argument that will + be set as the "this" for the callback. This is a good way to give your + function access to the object triggering the event. When the target + parameter is used the callback becomes the third argument. + + @method on + @param {String} name The name of the event + @param {Object} [target] The "this" binding for the callback + @param {Function} method The callback to execute + @return this + */ + on: function(name, target, method) { + Ember.addListener(this, name, target, method); + return this; + }, + + /** + Subscribes a function to a named event and then cancels the subscription + after the first time the event is triggered. It is good to use ``one`` when + you only care about the first time an event has taken place. + + This function takes an optional 2nd argument that will become the "this" + value for the callback. If this argument is passed then the 3rd argument + becomes the function. + + @method one + @param {String} name The name of the event + @param {Object} [target] The "this" binding for the callback + @param {Function} method The callback to execute + @return this + */ + one: function(name, target, method) { + if (!method) { + method = target; + target = null; + } + + Ember.addListener(this, name, target, method, true); + return this; + }, + + /** + Triggers a named event for the object. Any additional arguments + will be passed as parameters to the functions that are subscribed to the + event. + + ```javascript + person.on('didEat', function(food) { + console.log('person ate some ' + food); + }); + + person.trigger('didEat', 'broccoli'); + + // outputs: person ate some broccoli + ``` + @method trigger + @param {String} name The name of the event + @param {Object...} args Optional arguments to pass on + */ + trigger: function(name) { + var args = [], i, l; + for (i = 1, l = arguments.length; i < l; i++) { + args.push(arguments[i]); + } + Ember.sendEvent(this, name, args); + }, + + fire: function(name) { + Ember.deprecate("Ember.Evented#fire() has been deprecated in favor of trigger() for compatibility with jQuery. It will be removed in 1.0. Please update your code to call trigger() instead."); + this.trigger.apply(this, arguments); + }, + + /** + Cancels subscription for give name, target, and method. + + @method off + @param {String} name The name of the event + @param {Object} target The target of the subscription + @param {Function} method The function of the subscription + @return this + */ + off: function(name, target, method) { + Ember.removeListener(this, name, target, method); + return this; + }, + + /** + Checks to see if object has any subscriptions for named event. + + @method has + @param {String} name The name of the event + @return {Boolean} does the object have a subscription for event + */ + has: function(name) { + return Ember.hasListeners(this, name); + } +}); + +})(); + + + +(function() { +var RSVP = requireModule("rsvp"); + +RSVP.configure('async', function(callback, binding) { + Ember.run.schedule('actions', binding, callback); +}); + +/** +@module ember +@submodule ember-runtime +*/ + +var get = Ember.get; + +/** + @class Deferred + @namespace Ember + @extends Ember.Mixin + */ +Ember.DeferredMixin = Ember.Mixin.create({ + /** + Add handlers to be called when the Deferred object is resolved or rejected. + + @method then + @param {Function} doneCallback a callback function to be called when done + @param {Function} failCallback a callback function to be called when failed + */ + then: function(resolve, reject) { + var deferred, promise, entity; + + entity = this; + deferred = get(this, '_deferred'); + promise = deferred.promise; + + function fulfillmentHandler(fulfillment) { + if (fulfillment === promise) { + return resolve(entity); + } else { + return resolve(fulfillment); + } + } + + return promise.then(resolve && fulfillmentHandler, reject); + }, + + /** + Resolve a Deferred object and call any `doneCallbacks` with the given args. + + @method resolve + */ + resolve: function(value) { + var deferred, promise; + + deferred = get(this, '_deferred'); + promise = deferred.promise; + + if (value === this){ + deferred.resolve(promise); + } else { + deferred.resolve(value); + } + }, + + /** + Reject a Deferred object and call any `failCallbacks` with the given args. + + @method reject + */ + reject: function(value) { + get(this, '_deferred').reject(value); + }, + + _deferred: Ember.computed(function() { + return RSVP.defer(); + }) +}); + + +})(); + + + +(function() { + +})(); + + + +(function() { +Ember.Container = requireModule('container'); +Ember.Container.set = Ember.set; + +})(); + + + +(function() { +/** +@module ember +@submodule ember-runtime +*/ + + +// NOTE: this object should never be included directly. Instead use Ember. +// Ember.Object. We only define this separately so that Ember.Set can depend on it + + +var set = Ember.set, get = Ember.get, + o_create = Ember.create, + o_defineProperty = Ember.platform.defineProperty, + GUID_KEY = Ember.GUID_KEY, + guidFor = Ember.guidFor, + generateGuid = Ember.generateGuid, + meta = Ember.meta, + rewatch = Ember.rewatch, + finishChains = Ember.finishChains, + destroy = Ember.destroy, + schedule = Ember.run.schedule, + Mixin = Ember.Mixin, + applyMixin = Mixin._apply, + finishPartial = Mixin.finishPartial, + reopen = Mixin.prototype.reopen, + MANDATORY_SETTER = Ember.ENV.MANDATORY_SETTER, + indexOf = Ember.EnumerableUtils.indexOf; + +var undefinedDescriptor = { + configurable: true, + writable: true, + enumerable: false, + value: undefined +}; + +function makeCtor() { + + // Note: avoid accessing any properties on the object since it makes the + // method a lot faster. This is glue code so we want it to be as fast as + // possible. + + var wasApplied = false, initMixins, initProperties; + + var Class = function() { + if (!wasApplied) { + Class.proto(); // prepare prototype... + } + o_defineProperty(this, GUID_KEY, undefinedDescriptor); + o_defineProperty(this, '_super', undefinedDescriptor); + var m = meta(this); + m.proto = this; + if (initMixins) { + // capture locally so we can clear the closed over variable + var mixins = initMixins; + initMixins = null; + this.reopen.apply(this, mixins); + } + if (initProperties) { + // capture locally so we can clear the closed over variable + var props = initProperties; + initProperties = null; + + var concatenatedProperties = this.concatenatedProperties; + + for (var i = 0, l = props.length; i < l; i++) { + var properties = props[i]; + + Ember.assert("Ember.Object.create no longer supports mixing in other definitions, use createWithMixins instead.", !(properties instanceof Ember.Mixin)); + + for (var keyName in properties) { + if (!properties.hasOwnProperty(keyName)) { continue; } + + var value = properties[keyName], + IS_BINDING = Ember.IS_BINDING; + + if (IS_BINDING.test(keyName)) { + var bindings = m.bindings; + if (!bindings) { + bindings = m.bindings = {}; + } else if (!m.hasOwnProperty('bindings')) { + bindings = m.bindings = o_create(m.bindings); + } + bindings[keyName] = value; + } + + var desc = m.descs[keyName]; + + Ember.assert("Ember.Object.create no longer supports defining computed properties.", !(value instanceof Ember.ComputedProperty)); + Ember.assert("Ember.Object.create no longer supports defining methods that call _super.", !(typeof value === 'function' && value.toString().indexOf('._super') !== -1)); + + if (concatenatedProperties && indexOf(concatenatedProperties, keyName) >= 0) { + var baseValue = this[keyName]; + + if (baseValue) { + if ('function' === typeof baseValue.concat) { + value = baseValue.concat(value); + } else { + value = Ember.makeArray(baseValue).concat(value); + } + } else { + value = Ember.makeArray(value); + } + } + + if (desc) { + desc.set(this, keyName, value); + } else { + if (typeof this.setUnknownProperty === 'function' && !(keyName in this)) { + this.setUnknownProperty(keyName, value); + } else if (MANDATORY_SETTER) { + Ember.defineProperty(this, keyName, null, value); // setup mandatory setter + } else { + this[keyName] = value; + } + } + } + } + } + finishPartial(this, m); + delete m.proto; + finishChains(this); + this.init.apply(this, arguments); + }; + + Class.toString = Mixin.prototype.toString; + Class.willReopen = function() { + if (wasApplied) { + Class.PrototypeMixin = Mixin.create(Class.PrototypeMixin); + } + + wasApplied = false; + }; + Class._initMixins = function(args) { initMixins = args; }; + Class._initProperties = function(args) { initProperties = args; }; + + Class.proto = function() { + var superclass = Class.superclass; + if (superclass) { superclass.proto(); } + + if (!wasApplied) { + wasApplied = true; + Class.PrototypeMixin.applyPartial(Class.prototype); + rewatch(Class.prototype); + } + + return this.prototype; + }; + + return Class; + +} + +var CoreObject = makeCtor(); +CoreObject.toString = function() { return "Ember.CoreObject"; }; + +CoreObject.PrototypeMixin = Mixin.create({ + reopen: function() { + applyMixin(this, arguments, true); + return this; + }, + + isInstance: true, + + /** + An overridable method called when objects are instantiated. By default, + does nothing unless it is overridden during class definition. + + Example: + + ```javascript + App.Person = Ember.Object.extend({ + init: function() { + this._super(); + alert('Name is ' + this.get('name')); + } + }); + + var steve = App.Person.create({ + name: "Steve" + }); + + // alerts 'Name is Steve'. + ``` + + NOTE: If you do override `init` for a framework class like `Ember.View` or + `Ember.ArrayController`, be sure to call `this._super()` in your + `init` declaration! If you don't, Ember may not have an opportunity to + do important setup work, and you'll see strange behavior in your + application. + + @method init + */ + init: function() {}, + + /** + Defines the properties that will be concatenated from the superclass + (instead of overridden). + + By default, when you extend an Ember class a property defined in + the subclass overrides a property with the same name that is defined + in the superclass. However, there are some cases where it is preferable + to build up a property's value by combining the superclass' property + value with the subclass' value. An example of this in use within Ember + is the `classNames` property of `Ember.View`. + + Here is some sample code showing the difference between a concatenated + property and a normal one: + + ```javascript + App.BarView = Ember.View.extend({ + someNonConcatenatedProperty: ['bar'], + classNames: ['bar'] + }); + + App.FooBarView = App.BarView.extend({ + someNonConcatenatedProperty: ['foo'], + classNames: ['foo'], + }); + + var fooBarView = App.FooBarView.create(); + fooBarView.get('someNonConcatenatedProperty'); // ['foo'] + fooBarView.get('classNames'); // ['ember-view', 'bar', 'foo'] + ``` + + This behavior extends to object creation as well. Continuing the + above example: + + ```javascript + var view = App.FooBarView.create({ + someNonConcatenatedProperty: ['baz'], + classNames: ['baz'] + }) + view.get('someNonConcatenatedProperty'); // ['baz'] + view.get('classNames'); // ['ember-view', 'bar', 'foo', 'baz'] + ``` + Adding a single property that is not an array will just add it in the array: + + ```javascript + var view = App.FooBarView.create({ + classNames: 'baz' + }) + view.get('classNames'); // ['ember-view', 'bar', 'foo', 'baz'] + ``` + + Using the `concatenatedProperties` property, we can tell to Ember that mix + the content of the properties. + + In `Ember.View` the `classNameBindings` and `attributeBindings` properties + are also concatenated, in addition to `classNames`. + + This feature is available for you to use throughout the Ember object model, + although typical app developers are likely to use it infrequently. + + @property concatenatedProperties + @type Array + @default null + */ + concatenatedProperties: null, + + /** + Destroyed object property flag. + + if this property is `true` the observers and bindings were already + removed by the effect of calling the `destroy()` method. + + @property isDestroyed + @default false + */ + isDestroyed: false, + + /** + Destruction scheduled flag. The `destroy()` method has been called. + + The object stays intact until the end of the run loop at which point + the `isDestroyed` flag is set. + + @property isDestroying + @default false + */ + isDestroying: false, + + /** + Destroys an object by setting the `isDestroyed` flag and removing its + metadata, which effectively destroys observers and bindings. + + If you try to set a property on a destroyed object, an exception will be + raised. + + Note that destruction is scheduled for the end of the run loop and does not + happen immediately. It will set an isDestroying flag immediately. + + @method destroy + @return {Ember.Object} receiver + */ + destroy: function() { + if (this.isDestroying) { return; } + this.isDestroying = true; + + schedule('actions', this, this.willDestroy); + schedule('destroy', this, this._scheduledDestroy); + return this; + }, + + /** + Override to implement teardown. + */ + willDestroy: Ember.K, + + /** + @private + + Invoked by the run loop to actually destroy the object. This is + scheduled for execution by the `destroy` method. + + @method _scheduledDestroy + */ + _scheduledDestroy: function() { + if (this.isDestroyed) { return; } + destroy(this); + this.isDestroyed = true; + }, + + bind: function(to, from) { + if (!(from instanceof Ember.Binding)) { from = Ember.Binding.from(from); } + from.to(to).connect(this); + return from; + }, + + /** + Returns a string representation which attempts to provide more information + than Javascript's `toString` typically does, in a generic way for all Ember + objects. + + App.Person = Em.Object.extend() + person = App.Person.create() + person.toString() //=> "" + + If the object's class is not defined on an Ember namespace, it will + indicate it is a subclass of the registered superclass: + + Student = App.Person.extend() + student = Student.create() + student.toString() //=> "<(subclass of App.Person):ember1025>" + + If the method `toStringExtension` is defined, its return value will be + included in the output. + + App.Teacher = App.Person.extend({ + toStringExtension: function(){ + return this.get('fullName'); + } + }); + teacher = App.Teacher.create() + teacher.toString(); //=> "" + + @method toString + @return {String} string representation + */ + toString: function toString() { + var hasToStringExtension = typeof this.toStringExtension === 'function', + extension = hasToStringExtension ? ":" + this.toStringExtension() : ''; + var ret = '<'+this.constructor.toString()+':'+guidFor(this)+extension+'>'; + this.toString = makeToString(ret); + return ret; + } +}); + +CoreObject.PrototypeMixin.ownerConstructor = CoreObject; + +function makeToString(ret) { + return function() { return ret; }; +} + +if (Ember.config.overridePrototypeMixin) { + Ember.config.overridePrototypeMixin(CoreObject.PrototypeMixin); +} + +CoreObject.__super__ = null; + +var ClassMixin = Mixin.create({ + + ClassMixin: Ember.required(), + + PrototypeMixin: Ember.required(), + + isClass: true, + + isMethod: false, + + extend: function() { + var Class = makeCtor(), proto; + Class.ClassMixin = Mixin.create(this.ClassMixin); + Class.PrototypeMixin = Mixin.create(this.PrototypeMixin); + + Class.ClassMixin.ownerConstructor = Class; + Class.PrototypeMixin.ownerConstructor = Class; + + reopen.apply(Class.PrototypeMixin, arguments); + + Class.superclass = this; + Class.__super__ = this.prototype; + + proto = Class.prototype = o_create(this.prototype); + proto.constructor = Class; + generateGuid(proto, 'ember'); + meta(proto).proto = proto; // this will disable observers on prototype + + Class.ClassMixin.apply(Class); + return Class; + }, + + createWithMixins: function() { + var C = this; + if (arguments.length>0) { this._initMixins(arguments); } + return new C(); + }, + + create: function() { + var C = this; + if (arguments.length>0) { this._initProperties(arguments); } + return new C(); + }, + + reopen: function() { + this.willReopen(); + reopen.apply(this.PrototypeMixin, arguments); + return this; + }, + + reopenClass: function() { + reopen.apply(this.ClassMixin, arguments); + applyMixin(this, arguments, false); + return this; + }, + + detect: function(obj) { + if ('function' !== typeof obj) { return false; } + while(obj) { + if (obj===this) { return true; } + obj = obj.superclass; + } + return false; + }, + + detectInstance: function(obj) { + return obj instanceof this; + }, + + /** + In some cases, you may want to annotate computed properties with additional + metadata about how they function or what values they operate on. For + example, computed property functions may close over variables that are then + no longer available for introspection. + + You can pass a hash of these values to a computed property like this: + + ```javascript + person: function() { + var personId = this.get('personId'); + return App.Person.create({ id: personId }); + }.property().meta({ type: App.Person }) + ``` + + Once you've done this, you can retrieve the values saved to the computed + property from your class like this: + + ```javascript + MyClass.metaForProperty('person'); + ``` + + This will return the original hash that was passed to `meta()`. + + @method metaForProperty + @param key {String} property name + */ + metaForProperty: function(key) { + var desc = meta(this.proto(), false).descs[key]; + + Ember.assert("metaForProperty() could not find a computed property with key '"+key+"'.", !!desc && desc instanceof Ember.ComputedProperty); + return desc._meta || {}; + }, + + /** + Iterate over each computed property for the class, passing its name + and any associated metadata (see `metaForProperty`) to the callback. + + @method eachComputedProperty + @param {Function} callback + @param {Object} binding + */ + eachComputedProperty: function(callback, binding) { + var proto = this.proto(), + descs = meta(proto).descs, + empty = {}, + property; + + for (var name in descs) { + property = descs[name]; + + if (property instanceof Ember.ComputedProperty) { + callback.call(binding || this, name, property._meta || empty); + } + } + } + +}); + +ClassMixin.ownerConstructor = CoreObject; + +if (Ember.config.overrideClassMixin) { + Ember.config.overrideClassMixin(ClassMixin); +} + +CoreObject.ClassMixin = ClassMixin; +ClassMixin.apply(CoreObject); + +/** + @class CoreObject + @namespace Ember +*/ +Ember.CoreObject = CoreObject; + +})(); + + + +(function() { +/** +@module ember +@submodule ember-runtime +*/ + +/** + `Ember.Object` is the main base class for all Ember objects. It is a subclass + of `Ember.CoreObject` with the `Ember.Observable` mixin applied. For details, + see the documentation for each of these. + + @class Object + @namespace Ember + @extends Ember.CoreObject + @uses Ember.Observable +*/ +Ember.Object = Ember.CoreObject.extend(Ember.Observable); +Ember.Object.toString = function() { return "Ember.Object"; }; + +})(); + + + +(function() { +/** +@module ember +@submodule ember-runtime +*/ + +var get = Ember.get, indexOf = Ember.ArrayPolyfills.indexOf; + +/** + A Namespace is an object usually used to contain other objects or methods + such as an application or framework. Create a namespace anytime you want + to define one of these new containers. + + # Example Usage + + ```javascript + MyFramework = Ember.Namespace.create({ + VERSION: '1.0.0' + }); + ``` + + @class Namespace + @namespace Ember + @extends Ember.Object +*/ +var Namespace = Ember.Namespace = Ember.Object.extend({ + isNamespace: true, + + init: function() { + Ember.Namespace.NAMESPACES.push(this); + Ember.Namespace.PROCESSED = false; + }, + + toString: function() { + var name = get(this, 'name'); + if (name) { return name; } + + findNamespaces(); + return this[Ember.GUID_KEY+'_name']; + }, + + nameClasses: function() { + processNamespace([this.toString()], this, {}); + }, + + destroy: function() { + var namespaces = Ember.Namespace.NAMESPACES; + Ember.lookup[this.toString()] = undefined; + namespaces.splice(indexOf.call(namespaces, this), 1); + this._super(); + } +}); + +Namespace.reopenClass({ + NAMESPACES: [Ember], + NAMESPACES_BY_ID: {}, + PROCESSED: false, + processAll: processAllNamespaces, + byName: function(name) { + if (!Ember.BOOTED) { + processAllNamespaces(); + } + + return NAMESPACES_BY_ID[name]; + } +}); + +var NAMESPACES_BY_ID = Namespace.NAMESPACES_BY_ID; + +var hasOwnProp = ({}).hasOwnProperty, + guidFor = Ember.guidFor; + +function processNamespace(paths, root, seen) { + var idx = paths.length; + + NAMESPACES_BY_ID[paths.join('.')] = root; + + // Loop over all of the keys in the namespace, looking for classes + for(var key in root) { + if (!hasOwnProp.call(root, key)) { continue; } + var obj = root[key]; + + // If we are processing the `Ember` namespace, for example, the + // `paths` will start with `["Ember"]`. Every iteration through + // the loop will update the **second** element of this list with + // the key, so processing `Ember.View` will make the Array + // `['Ember', 'View']`. + paths[idx] = key; + + // If we have found an unprocessed class + if (obj && obj.toString === classToString) { + // Replace the class' `toString` with the dot-separated path + // and set its `NAME_KEY` + obj.toString = makeToString(paths.join('.')); + obj[NAME_KEY] = paths.join('.'); + + // Support nested namespaces + } else if (obj && obj.isNamespace) { + // Skip aliased namespaces + if (seen[guidFor(obj)]) { continue; } + seen[guidFor(obj)] = true; + + // Process the child namespace + processNamespace(paths, obj, seen); + } + } + + paths.length = idx; // cut out last item +} + +function findNamespaces() { + var Namespace = Ember.Namespace, lookup = Ember.lookup, obj, isNamespace; + + if (Namespace.PROCESSED) { return; } + + for (var prop in lookup) { + // These don't raise exceptions but can cause warnings + if (prop === "parent" || prop === "top" || prop === "frameElement" || prop === "webkitStorageInfo") { continue; } + + // get(window.globalStorage, 'isNamespace') would try to read the storage for domain isNamespace and cause exception in Firefox. + // globalStorage is a storage obsoleted by the WhatWG storage specification. See https://developer.mozilla.org/en/DOM/Storage#globalStorage + if (prop === "globalStorage" && lookup.StorageList && lookup.globalStorage instanceof lookup.StorageList) { continue; } + // Unfortunately, some versions of IE don't support window.hasOwnProperty + if (lookup.hasOwnProperty && !lookup.hasOwnProperty(prop)) { continue; } + + // At times we are not allowed to access certain properties for security reasons. + // There are also times where even if we can access them, we are not allowed to access their properties. + try { + obj = Ember.lookup[prop]; + isNamespace = obj && obj.isNamespace; + } catch (e) { + continue; + } + + if (isNamespace) { + Ember.deprecate("Namespaces should not begin with lowercase.", /^[A-Z]/.test(prop)); + obj[NAME_KEY] = prop; + } + } +} + +var NAME_KEY = Ember.NAME_KEY = Ember.GUID_KEY + '_name'; + +function superClassString(mixin) { + var superclass = mixin.superclass; + if (superclass) { + if (superclass[NAME_KEY]) { return superclass[NAME_KEY]; } + else { return superClassString(superclass); } + } else { + return; + } +} + +function classToString() { + if (!Ember.BOOTED && !this[NAME_KEY]) { + processAllNamespaces(); + } + + var ret; + + if (this[NAME_KEY]) { + ret = this[NAME_KEY]; + } else { + var str = superClassString(this); + if (str) { + ret = "(subclass of " + str + ")"; + } else { + ret = "(unknown mixin)"; + } + this.toString = makeToString(ret); + } + + return ret; +} + +function processAllNamespaces() { + var unprocessedNamespaces = !Namespace.PROCESSED, + unprocessedMixins = Ember.anyUnprocessedMixins; + + if (unprocessedNamespaces) { + findNamespaces(); + Namespace.PROCESSED = true; + } + + if (unprocessedNamespaces || unprocessedMixins) { + var namespaces = Namespace.NAMESPACES, namespace; + for (var i=0, l=namespaces.length; i get(this, 'content.length')) throw new Error(OUT_OF_RANGE_EXCEPTION); + this._replace(idx, 0, [object]); + return this; + }, + + insertAt: function(idx, object) { + if (get(this, 'arrangedContent') === get(this, 'content')) { + return this._insertAt(idx, object); + } else { + throw new Ember.Error("Using insertAt on an arranged ArrayProxy is not allowed."); + } + }, + + removeAt: function(start, len) { + if ('number' === typeof start) { + var content = get(this, 'content'), + arrangedContent = get(this, 'arrangedContent'), + indices = [], i; + + if ((start < 0) || (start >= get(this, 'length'))) { + throw new Error(OUT_OF_RANGE_EXCEPTION); + } + + if (len === undefined) len = 1; + + // Get a list of indices in original content to remove + for (i=start; i=idx) { + var item = content.objectAt(loc); + if (item) { + Ember.addBeforeObserver(item, keyName, proxy, 'contentKeyWillChange'); + Ember.addObserver(item, keyName, proxy, 'contentKeyDidChange'); + + // keep track of the index each item was found at so we can map + // it back when the obj changes. + guid = guidFor(item); + if (!objects[guid]) objects[guid] = []; + objects[guid].push(loc); + } + } +} + +function removeObserverForContentKey(content, keyName, proxy, idx, loc) { + var objects = proxy._objects; + if (!objects) objects = proxy._objects = {}; + var indicies, guid; + + while(--loc>=idx) { + var item = content.objectAt(loc); + if (item) { + Ember.removeBeforeObserver(item, keyName, proxy, 'contentKeyWillChange'); + Ember.removeObserver(item, keyName, proxy, 'contentKeyDidChange'); + + guid = guidFor(item); + indicies = objects[guid]; + indicies[indicies.indexOf(loc)] = null; + } + } +} + +/** + This is the object instance returned when you get the `@each` property on an + array. It uses the unknownProperty handler to automatically create + EachArray instances for property names. + + @private + @class EachProxy + @namespace Ember + @extends Ember.Object +*/ +Ember.EachProxy = Ember.Object.extend({ + + init: function(content) { + this._super(); + this._content = content; + content.addArrayObserver(this); + + // in case someone is already observing some keys make sure they are + // added + forEach(Ember.watchedEvents(this), function(eventName) { + this.didAddListener(eventName); + }, this); + }, + + /** + You can directly access mapped properties by simply requesting them. + The `unknownProperty` handler will generate an EachArray of each item. + + @method unknownProperty + @param keyName {String} + @param value {*} + */ + unknownProperty: function(keyName, value) { + var ret; + ret = new EachArray(this._content, keyName, this); + Ember.defineProperty(this, keyName, null, ret); + this.beginObservingContentKey(keyName); + return ret; + }, + + // .......................................................... + // ARRAY CHANGES + // Invokes whenever the content array itself changes. + + arrayWillChange: function(content, idx, removedCnt, addedCnt) { + var keys = this._keys, key, lim; + + lim = removedCnt>0 ? idx+removedCnt : -1; + Ember.beginPropertyChanges(this); + + for(key in keys) { + if (!keys.hasOwnProperty(key)) { continue; } + + if (lim>0) removeObserverForContentKey(content, key, this, idx, lim); + + Ember.propertyWillChange(this, key); + } + + Ember.propertyWillChange(this._content, '@each'); + Ember.endPropertyChanges(this); + }, + + arrayDidChange: function(content, idx, removedCnt, addedCnt) { + var keys = this._keys, key, lim; + + lim = addedCnt>0 ? idx+addedCnt : -1; + Ember.beginPropertyChanges(this); + + for(key in keys) { + if (!keys.hasOwnProperty(key)) { continue; } + + if (lim>0) addObserverForContentKey(content, key, this, idx, lim); + + Ember.propertyDidChange(this, key); + } + + Ember.propertyDidChange(this._content, '@each'); + Ember.endPropertyChanges(this); + }, + + // .......................................................... + // LISTEN FOR NEW OBSERVERS AND OTHER EVENT LISTENERS + // Start monitoring keys based on who is listening... + + didAddListener: function(eventName) { + if (IS_OBSERVER.test(eventName)) { + this.beginObservingContentKey(eventName.slice(0, -7)); + } + }, + + didRemoveListener: function(eventName) { + if (IS_OBSERVER.test(eventName)) { + this.stopObservingContentKey(eventName.slice(0, -7)); + } + }, + + // .......................................................... + // CONTENT KEY OBSERVING + // Actual watch keys on the source content. + + beginObservingContentKey: function(keyName) { + var keys = this._keys; + if (!keys) keys = this._keys = {}; + if (!keys[keyName]) { + keys[keyName] = 1; + var content = this._content, + len = get(content, 'length'); + addObserverForContentKey(content, keyName, this, 0, len); + } else { + keys[keyName]++; + } + }, + + stopObservingContentKey: function(keyName) { + var keys = this._keys; + if (keys && (keys[keyName]>0) && (--keys[keyName]<=0)) { + var content = this._content, + len = get(content, 'length'); + removeObserverForContentKey(content, keyName, this, 0, len); + } + }, + + contentKeyWillChange: function(obj, keyName) { + Ember.propertyWillChange(this, keyName); + }, + + contentKeyDidChange: function(obj, keyName) { + Ember.propertyDidChange(this, keyName); + } + +}); + + + +})(); + + + +(function() { +/** +@module ember +@submodule ember-runtime +*/ + + +var get = Ember.get, set = Ember.set; + +// Add Ember.Array to Array.prototype. Remove methods with native +// implementations and supply some more optimized versions of generic methods +// because they are so common. +var NativeArray = Ember.Mixin.create(Ember.MutableArray, Ember.Observable, Ember.Copyable, { + + // because length is a built-in property we need to know to just get the + // original property. + get: function(key) { + if (key==='length') return this.length; + else if ('number' === typeof key) return this[key]; + else return this._super(key); + }, + + objectAt: function(idx) { + return this[idx]; + }, + + // primitive for array support. + replace: function(idx, amt, objects) { + + if (this.isFrozen) throw Ember.FROZEN_ERROR ; + + // if we replaced exactly the same number of items, then pass only the + // replaced range. Otherwise, pass the full remaining array length + // since everything has shifted + var len = objects ? get(objects, 'length') : 0; + this.arrayContentWillChange(idx, amt, len); + + if (!objects || objects.length === 0) { + this.splice(idx, amt) ; + } else { + var args = [idx, amt].concat(objects) ; + this.splice.apply(this,args) ; + } + + this.arrayContentDidChange(idx, amt, len); + return this ; + }, + + // If you ask for an unknown property, then try to collect the value + // from member items. + unknownProperty: function(key, value) { + var ret;// = this.reducedProperty(key, value) ; + if ((value !== undefined) && ret === undefined) { + ret = this[key] = value; + } + return ret ; + }, + + // If browser did not implement indexOf natively, then override with + // specialized version + indexOf: function(object, startAt) { + var idx, len = this.length; + + if (startAt === undefined) startAt = 0; + else startAt = (startAt < 0) ? Math.ceil(startAt) : Math.floor(startAt); + if (startAt < 0) startAt += len; + + for(idx=startAt;idx=0;idx--) { + if (this[idx] === object) return idx ; + } + return -1; + }, + + copy: function(deep) { + if (deep) { + return this.map(function(item){ return Ember.copy(item, true); }); + } + + return this.slice(); + } +}); + +// Remove any methods implemented natively so we don't override them +var ignore = ['length']; +Ember.EnumerableUtils.forEach(NativeArray.keys(), function(methodName) { + if (Array.prototype[methodName]) ignore.push(methodName); +}); + +if (ignore.length>0) { + NativeArray = NativeArray.without.apply(NativeArray, ignore); +} + +/** + The NativeArray mixin contains the properties needed to to make the native + Array support Ember.MutableArray and all of its dependent APIs. Unless you + have `Ember.EXTEND_PROTOTYPES` or `Ember.EXTEND_PROTOTYPES.Array` set to + false, this will be applied automatically. Otherwise you can apply the mixin + at anytime by calling `Ember.NativeArray.activate`. + + @class NativeArray + @namespace Ember + @extends Ember.Mixin + @uses Ember.MutableArray + @uses Ember.Observable + @uses Ember.Copyable +*/ +Ember.NativeArray = NativeArray; + +/** + Creates an `Ember.NativeArray` from an Array like object. + Does not modify the original object. + + @method A + @for Ember + @return {Ember.NativeArray} +*/ +Ember.A = function(arr){ + if (arr === undefined) { arr = []; } + return Ember.Array.detect(arr) ? arr : Ember.NativeArray.apply(arr); +}; + +/** + Activates the mixin on the Array.prototype if not already applied. Calling + this method more than once is safe. + + @method activate + @for Ember.NativeArray + @static + @return {void} +*/ +Ember.NativeArray.activate = function() { + NativeArray.apply(Array.prototype); + + Ember.A = function(arr) { return arr || []; }; +}; + +if (Ember.EXTEND_PROTOTYPES === true || Ember.EXTEND_PROTOTYPES.Array) { + Ember.NativeArray.activate(); +} + + +})(); + + + +(function() { +/** +@module ember +@submodule ember-runtime +*/ + +var get = Ember.get, set = Ember.set, guidFor = Ember.guidFor, isNone = Ember.isNone, fmt = Ember.String.fmt; + +/** + An unordered collection of objects. + + A Set works a bit like an array except that its items are not ordered. You + can create a set to efficiently test for membership for an object. You can + also iterate through a set just like an array, even accessing objects by + index, however there is no guarantee as to their order. + + All Sets are observable via the Enumerable Observer API - which works + on any enumerable object including both Sets and Arrays. + + ## Creating a Set + + You can create a set like you would most objects using + `new Ember.Set()`. Most new sets you create will be empty, but you can + also initialize the set with some content by passing an array or other + enumerable of objects to the constructor. + + Finally, you can pass in an existing set and the set will be copied. You + can also create a copy of a set by calling `Ember.Set#copy()`. + + ```javascript + // creates a new empty set + var foundNames = new Ember.Set(); + + // creates a set with four names in it. + var names = new Ember.Set(["Charles", "Tom", "Juan", "Alex"]); // :P + + // creates a copy of the names set. + var namesCopy = new Ember.Set(names); + + // same as above. + var anotherNamesCopy = names.copy(); + ``` + + ## Adding/Removing Objects + + You generally add or remove objects from a set using `add()` or + `remove()`. You can add any type of object including primitives such as + numbers, strings, and booleans. + + Unlike arrays, objects can only exist one time in a set. If you call `add()` + on a set with the same object multiple times, the object will only be added + once. Likewise, calling `remove()` with the same object multiple times will + remove the object the first time and have no effect on future calls until + you add the object to the set again. + + NOTE: You cannot add/remove `null` or `undefined` to a set. Any attempt to do + so will be ignored. + + In addition to add/remove you can also call `push()`/`pop()`. Push behaves + just like `add()` but `pop()`, unlike `remove()` will pick an arbitrary + object, remove it and return it. This is a good way to use a set as a job + queue when you don't care which order the jobs are executed in. + + ## Testing for an Object + + To test for an object's presence in a set you simply call + `Ember.Set#contains()`. + + ## Observing changes + + When using `Ember.Set`, you can observe the `"[]"` property to be + alerted whenever the content changes. You can also add an enumerable + observer to the set to be notified of specific objects that are added and + removed from the set. See `Ember.Enumerable` for more information on + enumerables. + + This is often unhelpful. If you are filtering sets of objects, for instance, + it is very inefficient to re-filter all of the items each time the set + changes. It would be better if you could just adjust the filtered set based + on what was changed on the original set. The same issue applies to merging + sets, as well. + + ## Other Methods + + `Ember.Set` primary implements other mixin APIs. For a complete reference + on the methods you will use with `Ember.Set`, please consult these mixins. + The most useful ones will be `Ember.Enumerable` and + `Ember.MutableEnumerable` which implement most of the common iterator + methods you are used to on Array. + + Note that you can also use the `Ember.Copyable` and `Ember.Freezable` + APIs on `Ember.Set` as well. Once a set is frozen it can no longer be + modified. The benefit of this is that when you call `frozenCopy()` on it, + Ember will avoid making copies of the set. This allows you to write + code that can know with certainty when the underlying set data will or + will not be modified. + + @class Set + @namespace Ember + @extends Ember.CoreObject + @uses Ember.MutableEnumerable + @uses Ember.Copyable + @uses Ember.Freezable + @since Ember 0.9 +*/ +Ember.Set = Ember.CoreObject.extend(Ember.MutableEnumerable, Ember.Copyable, Ember.Freezable, + /** @scope Ember.Set.prototype */ { + + // .......................................................... + // IMPLEMENT ENUMERABLE APIS + // + + /** + This property will change as the number of objects in the set changes. + + @property length + @type number + @default 0 + */ + length: 0, + + /** + Clears the set. This is useful if you want to reuse an existing set + without having to recreate it. + + ```javascript + var colors = new Ember.Set(["red", "green", "blue"]); + colors.length; // 3 + colors.clear(); + colors.length; // 0 + ``` + + @method clear + @return {Ember.Set} An empty Set + */ + clear: function() { + if (this.isFrozen) { throw new Error(Ember.FROZEN_ERROR); } + + var len = get(this, 'length'); + if (len === 0) { return this; } + + var guid; + + this.enumerableContentWillChange(len, 0); + Ember.propertyWillChange(this, 'firstObject'); + Ember.propertyWillChange(this, 'lastObject'); + + for (var i=0; i < len; i++){ + guid = guidFor(this[i]); + delete this[guid]; + delete this[i]; + } + + set(this, 'length', 0); + + Ember.propertyDidChange(this, 'firstObject'); + Ember.propertyDidChange(this, 'lastObject'); + this.enumerableContentDidChange(len, 0); + + return this; + }, + + /** + Returns true if the passed object is also an enumerable that contains the + same objects as the receiver. + + ```javascript + var colors = ["red", "green", "blue"], + same_colors = new Ember.Set(colors); + + same_colors.isEqual(colors); // true + same_colors.isEqual(["purple", "brown"]); // false + ``` + + @method isEqual + @param {Ember.Set} obj the other object. + @return {Boolean} + */ + isEqual: function(obj) { + // fail fast + if (!Ember.Enumerable.detect(obj)) return false; + + var loc = get(this, 'length'); + if (get(obj, 'length') !== loc) return false; + + while(--loc >= 0) { + if (!obj.contains(this[loc])) return false; + } + + return true; + }, + + /** + Adds an object to the set. Only non-`null` objects can be added to a set + and those can only be added once. If the object is already in the set or + the passed value is null this method will have no effect. + + This is an alias for `Ember.MutableEnumerable.addObject()`. + + ```javascript + var colors = new Ember.Set(); + colors.add("blue"); // ["blue"] + colors.add("blue"); // ["blue"] + colors.add("red"); // ["blue", "red"] + colors.add(null); // ["blue", "red"] + colors.add(undefined); // ["blue", "red"] + ``` + + @method add + @param {Object} obj The object to add. + @return {Ember.Set} The set itself. + */ + add: Ember.aliasMethod('addObject'), + + /** + Removes the object from the set if it is found. If you pass a `null` value + or an object that is already not in the set, this method will have no + effect. This is an alias for `Ember.MutableEnumerable.removeObject()`. + + ```javascript + var colors = new Ember.Set(["red", "green", "blue"]); + colors.remove("red"); // ["blue", "green"] + colors.remove("purple"); // ["blue", "green"] + colors.remove(null); // ["blue", "green"] + ``` + + @method remove + @param {Object} obj The object to remove + @return {Ember.Set} The set itself. + */ + remove: Ember.aliasMethod('removeObject'), + + /** + Removes the last element from the set and returns it, or `null` if it's empty. + + ```javascript + var colors = new Ember.Set(["green", "blue"]); + colors.pop(); // "blue" + colors.pop(); // "green" + colors.pop(); // null + ``` + + @method pop + @return {Object} The removed object from the set or null. + */ + pop: function() { + if (get(this, 'isFrozen')) throw new Error(Ember.FROZEN_ERROR); + var obj = this.length > 0 ? this[this.length-1] : null; + this.remove(obj); + return obj; + }, + + /** + Inserts the given object on to the end of the set. It returns + the set itself. + + This is an alias for `Ember.MutableEnumerable.addObject()`. + + ```javascript + var colors = new Ember.Set(); + colors.push("red"); // ["red"] + colors.push("green"); // ["red", "green"] + colors.push("blue"); // ["red", "green", "blue"] + ``` + + @method push + @return {Ember.Set} The set itself. + */ + push: Ember.aliasMethod('addObject'), + + /** + Removes the last element from the set and returns it, or `null` if it's empty. + + This is an alias for `Ember.Set.pop()`. + + ```javascript + var colors = new Ember.Set(["green", "blue"]); + colors.shift(); // "blue" + colors.shift(); // "green" + colors.shift(); // null + ``` + + @method shift + @return {Object} The removed object from the set or null. + */ + shift: Ember.aliasMethod('pop'), + + /** + Inserts the given object on to the end of the set. It returns + the set itself. + + This is an alias of `Ember.Set.push()` + + ```javascript + var colors = new Ember.Set(); + colors.unshift("red"); // ["red"] + colors.unshift("green"); // ["red", "green"] + colors.unshift("blue"); // ["red", "green", "blue"] + ``` + + @method unshift + @return {Ember.Set} The set itself. + */ + unshift: Ember.aliasMethod('push'), + + /** + Adds each object in the passed enumerable to the set. + + This is an alias of `Ember.MutableEnumerable.addObjects()` + + ```javascript + var colors = new Ember.Set(); + colors.addEach(["red", "green", "blue"]); // ["red", "green", "blue"] + ``` + + @method addEach + @param {Ember.Enumerable} objects the objects to add. + @return {Ember.Set} The set itself. + */ + addEach: Ember.aliasMethod('addObjects'), + + /** + Removes each object in the passed enumerable to the set. + + This is an alias of `Ember.MutableEnumerable.removeObjects()` + + ```javascript + var colors = new Ember.Set(["red", "green", "blue"]); + colors.removeEach(["red", "blue"]); // ["green"] + ``` + + @method removeEach + @param {Ember.Enumerable} objects the objects to remove. + @return {Ember.Set} The set itself. + */ + removeEach: Ember.aliasMethod('removeObjects'), + + // .......................................................... + // PRIVATE ENUMERABLE SUPPORT + // + + init: function(items) { + this._super(); + if (items) this.addObjects(items); + }, + + // implement Ember.Enumerable + nextObject: function(idx) { + return this[idx]; + }, + + // more optimized version + firstObject: Ember.computed(function() { + return this.length > 0 ? this[0] : undefined; + }), + + // more optimized version + lastObject: Ember.computed(function() { + return this.length > 0 ? this[this.length-1] : undefined; + }), + + // implements Ember.MutableEnumerable + addObject: function(obj) { + if (get(this, 'isFrozen')) throw new Error(Ember.FROZEN_ERROR); + if (isNone(obj)) return this; // nothing to do + + var guid = guidFor(obj), + idx = this[guid], + len = get(this, 'length'), + added ; + + if (idx>=0 && idx=0 && idx=0; + }, + + copy: function() { + var C = this.constructor, ret = new C(), loc = get(this, 'length'); + set(ret, 'length', loc); + while(--loc>=0) { + ret[loc] = this[loc]; + ret[guidFor(this[loc])] = loc; + } + return ret; + }, + + toString: function() { + var len = this.length, idx, array = []; + for(idx = 0; idx < len; idx++) { + array[idx] = this[idx]; + } + return fmt("Ember.Set<%@>", [array.join(',')]); + } + +}); + +})(); + + + +(function() { +var DeferredMixin = Ember.DeferredMixin, // mixins/deferred + get = Ember.get; + +var Deferred = Ember.Object.extend(DeferredMixin); + +Deferred.reopenClass({ + promise: function(callback, binding) { + var deferred = Deferred.create(); + callback.call(binding, deferred); + return deferred; + } +}); + +Ember.Deferred = Deferred; + +})(); + + + +(function() { +var forEach = Ember.ArrayPolyfills.forEach; + +/** +@module ember +@submodule ember-runtime +*/ + +var loadHooks = Ember.ENV.EMBER_LOAD_HOOKS || {}; +var loaded = {}; + +/** +@method onLoad +@for Ember +@param name {String} name of hook +@param callback {Function} callback to be called +*/ +Ember.onLoad = function(name, callback) { + var object; + + loadHooks[name] = loadHooks[name] || Ember.A(); + loadHooks[name].pushObject(callback); + + if (object = loaded[name]) { + callback(object); + } +}; + +/** +@method runLoadHooks +@for Ember +@param name {String} name of hook +@param object {Object} object to pass to callbacks +*/ +Ember.runLoadHooks = function(name, object) { + loaded[name] = object; + + if (loadHooks[name]) { + forEach.call(loadHooks[name], function(callback) { + callback(object); + }); + } +}; + +})(); + + + +(function() { + +})(); + + + +(function() { +var get = Ember.get; + +/** +@module ember +@submodule ember-runtime +*/ + +/** + `Ember.ControllerMixin` provides a standard interface for all classes that + compose Ember's controller layer: `Ember.Controller`, + `Ember.ArrayController`, and `Ember.ObjectController`. + + Within an `Ember.Router`-managed application single shared instaces of every + Controller object in your application's namespace will be added to the + application's `Ember.Router` instance. See `Ember.Application#initialize` + for additional information. + + ## Views + + By default a controller instance will be the rendering context + for its associated `Ember.View.` This connection is made during calls to + `Ember.ControllerMixin#connectOutlet`. + + Within the view's template, the `Ember.View` instance can be accessed + through the controller with `{{view}}`. + + ## Target Forwarding + + By default a controller will target your application's `Ember.Router` + instance. Calls to `{{action}}` within the template of a controller's view + are forwarded to the router. See `Ember.Handlebars.helpers.action` for + additional information. + + @class ControllerMixin + @namespace Ember + @extends Ember.Mixin +*/ +Ember.ControllerMixin = Ember.Mixin.create({ + /* ducktype as a controller */ + isController: true, + + /** + The object to which events from the view should be sent. + + For example, when a Handlebars template uses the `{{action}}` helper, + it will attempt to send the event to the view's controller's `target`. + + By default, a controller's `target` is set to the router after it is + instantiated by `Ember.Application#initialize`. + + @property target + @default null + */ + target: null, + + container: null, + + parentController: null, + + store: null, + + model: Ember.computed.alias('content'), + + send: function(actionName) { + var args = [].slice.call(arguments, 1), target; + + if (this[actionName]) { + Ember.assert("The controller " + this + " does not have the action " + actionName, typeof this[actionName] === 'function'); + this[actionName].apply(this, args); + } else if(target = get(this, 'target')) { + Ember.assert("The target for controller " + this + " (" + target + ") did not define a `send` method", typeof target.send === 'function'); + target.send.apply(target, arguments); + } + } +}); + +/** + @class Controller + @namespace Ember + @extends Ember.Object + @uses Ember.ControllerMixin +*/ +Ember.Controller = Ember.Object.extend(Ember.ControllerMixin); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-runtime +*/ + +var get = Ember.get, set = Ember.set, forEach = Ember.EnumerableUtils.forEach; + +/** + `Ember.SortableMixin` provides a standard interface for array proxies + to specify a sort order and maintain this sorting when objects are added, + removed, or updated without changing the implicit order of their underlying + content array: + + ```javascript + songs = [ + {trackNumber: 4, title: 'Ob-La-Di, Ob-La-Da'}, + {trackNumber: 2, title: 'Back in the U.S.S.R.'}, + {trackNumber: 3, title: 'Glass Onion'}, + ]; + + songsController = Ember.ArrayController.create({ + content: songs, + sortProperties: ['trackNumber'], + sortAscending: true + }); + + songsController.get('firstObject'); // {trackNumber: 2, title: 'Back in the U.S.S.R.'} + + songsController.addObject({trackNumber: 1, title: 'Dear Prudence'}); + songsController.get('firstObject'); // {trackNumber: 1, title: 'Dear Prudence'} + ``` + + @class SortableMixin + @namespace Ember + @extends Ember.Mixin + @uses Ember.MutableEnumerable +*/ +Ember.SortableMixin = Ember.Mixin.create(Ember.MutableEnumerable, { + + /** + Specifies which properties dictate the arrangedContent's sort order. + + @property {Array} sortProperties + */ + sortProperties: null, + + /** + Specifies the arrangedContent's sort direction + + @property {Boolean} sortAscending + */ + sortAscending: true, + + /** + The function used to compare two values. You can override this if you + want to do custom comparisons.Functions must be of the type expected by + Array#sort, i.e. + return 0 if the two parameters are equal, + return a negative value if the first parameter is smaller than the second or + return a positive value otherwise: + + ```javascript + function(x,y){ // These are assumed to be integers + if(x === y) + return 0; + return x < y ? -1 : 1; + } + ``` + + @property sortFunction + @type {Function} + @default Ember.compare + */ + sortFunction: Ember.compare, + + orderBy: function(item1, item2) { + var result = 0, + sortProperties = get(this, 'sortProperties'), + sortAscending = get(this, 'sortAscending'), + sortFunction = get(this, 'sortFunction'); + + Ember.assert("you need to define `sortProperties`", !!sortProperties); + + forEach(sortProperties, function(propertyName) { + if (result === 0) { + result = sortFunction(get(item1, propertyName), get(item2, propertyName)); + if ((result !== 0) && !sortAscending) { + result = (-1) * result; + } + } + }); + + return result; + }, + + destroy: function() { + var content = get(this, 'content'), + sortProperties = get(this, 'sortProperties'); + + if (content && sortProperties) { + forEach(content, function(item) { + forEach(sortProperties, function(sortProperty) { + Ember.removeObserver(item, sortProperty, this, 'contentItemSortPropertyDidChange'); + }, this); + }, this); + } + + return this._super(); + }, + + isSorted: Ember.computed.bool('sortProperties'), + + arrangedContent: Ember.computed('content', 'sortProperties.@each', function(key, value) { + var content = get(this, 'content'), + isSorted = get(this, 'isSorted'), + sortProperties = get(this, 'sortProperties'), + self = this; + + if (content && isSorted) { + content = content.slice(); + content.sort(function(item1, item2) { + return self.orderBy(item1, item2); + }); + forEach(content, function(item) { + forEach(sortProperties, function(sortProperty) { + Ember.addObserver(item, sortProperty, this, 'contentItemSortPropertyDidChange'); + }, this); + }, this); + return Ember.A(content); + } + + return content; + }), + + _contentWillChange: Ember.beforeObserver(function() { + var content = get(this, 'content'), + sortProperties = get(this, 'sortProperties'); + + if (content && sortProperties) { + forEach(content, function(item) { + forEach(sortProperties, function(sortProperty) { + Ember.removeObserver(item, sortProperty, this, 'contentItemSortPropertyDidChange'); + }, this); + }, this); + } + + this._super(); + }, 'content'), + + sortAscendingWillChange: Ember.beforeObserver(function() { + this._lastSortAscending = get(this, 'sortAscending'); + }, 'sortAscending'), + + sortAscendingDidChange: Ember.observer(function() { + if (get(this, 'sortAscending') !== this._lastSortAscending) { + var arrangedContent = get(this, 'arrangedContent'); + arrangedContent.reverseObjects(); + } + }, 'sortAscending'), + + contentArrayWillChange: function(array, idx, removedCount, addedCount) { + var isSorted = get(this, 'isSorted'); + + if (isSorted) { + var arrangedContent = get(this, 'arrangedContent'); + var removedObjects = array.slice(idx, idx+removedCount); + var sortProperties = get(this, 'sortProperties'); + + forEach(removedObjects, function(item) { + arrangedContent.removeObject(item); + + forEach(sortProperties, function(sortProperty) { + Ember.removeObserver(item, sortProperty, this, 'contentItemSortPropertyDidChange'); + }, this); + }, this); + } + + return this._super(array, idx, removedCount, addedCount); + }, + + contentArrayDidChange: function(array, idx, removedCount, addedCount) { + var isSorted = get(this, 'isSorted'), + sortProperties = get(this, 'sortProperties'); + + if (isSorted) { + var addedObjects = array.slice(idx, idx+addedCount); + + forEach(addedObjects, function(item) { + this.insertItemSorted(item); + + forEach(sortProperties, function(sortProperty) { + Ember.addObserver(item, sortProperty, this, 'contentItemSortPropertyDidChange'); + }, this); + }, this); + } + + return this._super(array, idx, removedCount, addedCount); + }, + + insertItemSorted: function(item) { + var arrangedContent = get(this, 'arrangedContent'); + var length = get(arrangedContent, 'length'); + + var idx = this._binarySearch(item, 0, length); + arrangedContent.insertAt(idx, item); + }, + + contentItemSortPropertyDidChange: function(item) { + var arrangedContent = get(this, 'arrangedContent'), + oldIndex = arrangedContent.indexOf(item), + leftItem = arrangedContent.objectAt(oldIndex - 1), + rightItem = arrangedContent.objectAt(oldIndex + 1), + leftResult = leftItem && this.orderBy(item, leftItem), + rightResult = rightItem && this.orderBy(item, rightItem); + + if (leftResult < 0 || rightResult > 0) { + arrangedContent.removeObject(item); + this.insertItemSorted(item); + } + }, + + _binarySearch: function(item, low, high) { + var mid, midItem, res, arrangedContent; + + if (low === high) { + return low; + } + + arrangedContent = get(this, 'arrangedContent'); + + mid = low + Math.floor((high - low) / 2); + midItem = arrangedContent.objectAt(mid); + + res = this.orderBy(midItem, item); + + if (res < 0) { + return this._binarySearch(item, mid+1, high); + } else if (res > 0) { + return this._binarySearch(item, low, mid); + } + + return mid; + } +}); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-runtime +*/ + +var get = Ember.get, set = Ember.set, forEach = Ember.EnumerableUtils.forEach, + replace = Ember.EnumerableUtils.replace; + +/** + `Ember.ArrayController` provides a way for you to publish a collection of + objects so that you can easily bind to the collection from a Handlebars + `#each` helper, an `Ember.CollectionView`, or other controllers. + + The advantage of using an `ArrayController` is that you only have to set up + your view bindings once; to change what's displayed, simply swap out the + `content` property on the controller. + + For example, imagine you wanted to display a list of items fetched via an XHR + request. Create an `Ember.ArrayController` and set its `content` property: + + ```javascript + MyApp.listController = Ember.ArrayController.create(); + + $.get('people.json', function(data) { + MyApp.listController.set('content', data); + }); + ``` + + Then, create a view that binds to your new controller: + + ```handlebars + {{#each MyApp.listController}} + {{firstName}} {{lastName}} + {{/each}} + ``` + + Although you are binding to the controller, the behavior of this controller + is to pass through any methods or properties to the underlying array. This + capability comes from `Ember.ArrayProxy`, which this class inherits from. + + Sometimes you want to display computed properties within the body of an + `#each` helper that depend on the underlying items in `content`, but are not + present on those items. To do this, set `itemController` to the name of a + controller (probably an `ObjectController`) that will wrap each individual item. + + For example: + + ```handlebars + {{#each post in controller}} +
  • {{title}} ({{titleLength}} characters)
    • + {{/each}} + ``` + + ```javascript + App.PostsController = Ember.ArrayController.extend({ + itemController: 'post' + }); + + App.PostController = Ember.ObjectController.extend({ + // the `title` property will be proxied to the underlying post. + + titleLength: function() { + return this.get('title').length; + }.property('title') + }); + ``` + + In some cases it is helpful to return a different `itemController` depending + on the particular item. Subclasses can do this by overriding + `lookupItemController`. + + For example: + + ```javascript + App.MyArrayController = Ember.ArrayController.extend({ + lookupItemController: function( object ) { + if (object.get('isSpecial')) { + return "special"; // use App.SpecialController + } else { + return "regular"; // use App.RegularController + } + } + }); + ``` + + The itemController instances will have a `parentController` property set to + either the the `parentController` property of the `ArrayController` + or to the `ArrayController` instance itself. + + @class ArrayController + @namespace Ember + @extends Ember.ArrayProxy + @uses Ember.SortableMixin + @uses Ember.ControllerMixin +*/ + +Ember.ArrayController = Ember.ArrayProxy.extend(Ember.ControllerMixin, + Ember.SortableMixin, { + + /** + The controller used to wrap items, if any. + + @property itemController + @type String + @default null + */ + itemController: null, + + /** + Return the name of the controller to wrap items, or `null` if items should + be returned directly. The default implementation simply returns the + `itemController` property, but subclasses can override this method to return + different controllers for different objects. + + For example: + + ```javascript + App.MyArrayController = Ember.ArrayController.extend({ + lookupItemController: function( object ) { + if (object.get('isSpecial')) { + return "special"; // use App.SpecialController + } else { + return "regular"; // use App.RegularController + } + } + }); + ``` + + @method lookupItemController + @param {Object} object + @return {String} + */ + lookupItemController: function(object) { + return get(this, 'itemController'); + }, + + objectAtContent: function(idx) { + var length = get(this, 'length'), + arrangedContent = get(this,'arrangedContent'), + object = arrangedContent && arrangedContent.objectAt(idx); + + if (idx >= 0 && idx < length) { + var controllerClass = this.lookupItemController(object); + if (controllerClass) { + return this.controllerAt(idx, object, controllerClass); + } + } + + // When `controllerClass` is falsy, we have not opted in to using item + // controllers, so return the object directly. + + // When the index is out of range, we want to return the "out of range" + // value, whatever that might be. Rather than make assumptions + // (e.g. guessing `null` or `undefined`) we defer this to `arrangedContent`. + return object; + }, + + arrangedContentDidChange: function() { + this._super(); + this._resetSubControllers(); + }, + + arrayContentDidChange: function(idx, removedCnt, addedCnt) { + var subControllers = get(this, '_subControllers'), + subControllersToRemove = subControllers.slice(idx, idx+removedCnt); + + forEach(subControllersToRemove, function(subController) { + if (subController) { subController.destroy(); } + }); + + replace(subControllers, idx, removedCnt, new Array(addedCnt)); + + // The shadow array of subcontrollers must be updated before we trigger + // observers, otherwise observers will get the wrong subcontainer when + // calling `objectAt` + this._super(idx, removedCnt, addedCnt); + }, + + init: function() { + if (!this.get('content')) { Ember.defineProperty(this, 'content', undefined, Ember.A()); } + this._super(); + this.set('_subControllers', Ember.A()); + }, + + controllerAt: function(idx, object, controllerClass) { + var container = get(this, 'container'), + subControllers = get(this, '_subControllers'), + subController = subControllers[idx]; + + if (!subController) { + subController = container.lookup("controller:" + controllerClass, { singleton: false }); + subControllers[idx] = subController; + } + + if (!subController) { + throw new Error('Could not resolve itemController: "' + controllerClass + '"'); + } + + subController.set('target', this); + subController.set('parentController', get(this, 'parentController') || this); + subController.set('content', object); + + return subController; + }, + + _subControllers: null, + + _resetSubControllers: function() { + var subControllers = get(this, '_subControllers'); + if (subControllers) { + forEach(subControllers, function(subController) { + if (subController) { subController.destroy(); } + }); + } + + this.set('_subControllers', Ember.A()); + } +}); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-runtime +*/ + +/** + `Ember.ObjectController` is part of Ember's Controller layer. A single shared + instance of each `Ember.ObjectController` subclass in your application's + namespace will be created at application initialization and be stored on your + application's `Ember.Router` instance. + + `Ember.ObjectController` derives its functionality from its superclass + `Ember.ObjectProxy` and the `Ember.ControllerMixin` mixin. + + @class ObjectController + @namespace Ember + @extends Ember.ObjectProxy + @uses Ember.ControllerMixin +**/ +Ember.ObjectController = Ember.ObjectProxy.extend(Ember.ControllerMixin); + +})(); + + + +(function() { + +})(); + + + +(function() { +/** +Ember Runtime + +@module ember +@submodule ember-runtime +@requires ember-metal +*/ + +})(); + +(function() { +/** +@module ember +@submodule ember-views +*/ + +var jQuery = Ember.imports.jQuery; +Ember.assert("Ember Views require jQuery 1.7, 1.8, 1.9, 1.10, or 2.0", jQuery && (jQuery().jquery.match(/^((1\.(7|8|9|10))|2.0)(\.\d+)?(pre|rc\d?)?/) || Ember.ENV.FORCE_JQUERY)); + +/** + Alias for jQuery + + @method $ + @for Ember +*/ +Ember.$ = jQuery; + +})(); + + + +(function() { +/** +@module ember +@submodule ember-views +*/ +if (Ember.$) { + // http://www.whatwg.org/specs/web-apps/current-work/multipage/dnd.html#dndevents + var dragEvents = Ember.String.w('dragstart drag dragenter dragleave dragover drop dragend'); + + // Copies the `dataTransfer` property from a browser event object onto the + // jQuery event object for the specified events + Ember.EnumerableUtils.forEach(dragEvents, function(eventName) { + Ember.$.event.fixHooks[eventName] = { props: ['dataTransfer'] }; + }); +} + +})(); + + + +(function() { +/** +@module ember +@submodule ember-views +*/ + +/* BEGIN METAMORPH HELPERS */ + +// Internet Explorer prior to 9 does not allow setting innerHTML if the first element +// is a "zero-scope" element. This problem can be worked around by making +// the first node an invisible text node. We, like Modernizr, use ­ + +var needsShy = this.document && (function(){ + var testEl = document.createElement('div'); + testEl.innerHTML = "
    "; + testEl.firstChild.innerHTML = ""; + return testEl.firstChild.innerHTML === ''; +})(); + +// IE 8 (and likely earlier) likes to move whitespace preceeding +// a script tag to appear after it. This means that we can +// accidentally remove whitespace when updating a morph. +var movesWhitespace = this.document && (function() { + var testEl = document.createElement('div'); + testEl.innerHTML = "Test: Value"; + return testEl.childNodes[0].nodeValue === 'Test:' && + testEl.childNodes[2].nodeValue === ' Value'; +})(); + +// Use this to find children by ID instead of using jQuery +var findChildById = function(element, id) { + if (element.getAttribute('id') === id) { return element; } + + var len = element.childNodes.length, idx, node, found; + for (idx=0; idx 0) { + var len = matches.length, idx; + for (idx=0; idxTest'); + canSet = el.options.length === 1; + } + + innerHTMLTags[tagName] = canSet; + + return canSet; +}; + +var setInnerHTML = function(element, html) { + var tagName = element.tagName; + + if (canSetInnerHTML(tagName)) { + setInnerHTMLWithoutFix(element, html); + } else { + // Firefox versions < 11 do not have support for element.outerHTML. + var outerHTML = element.outerHTML || new XMLSerializer().serializeToString(element); + Ember.assert("Can't set innerHTML on "+element.tagName+" in this browser", outerHTML); + + var startTag = outerHTML.match(new RegExp("<"+tagName+"([^>]*)>", 'i'))[0], + endTag = ''; + + var wrapper = document.createElement('div'); + setInnerHTMLWithoutFix(wrapper, startTag + html + endTag); + element = wrapper.firstChild; + while (element.tagName !== tagName) { + element = element.nextSibling; + } + } + + return element; +}; + +function isSimpleClick(event) { + var modifier = event.shiftKey || event.metaKey || event.altKey || event.ctrlKey, + secondaryClick = event.which > 1; // IE9 may return undefined + + return !modifier && !secondaryClick; +} + +Ember.ViewUtils = { + setInnerHTML: setInnerHTML, + isSimpleClick: isSimpleClick +}; + +})(); + + + +(function() { +/** +@module ember +@submodule ember-views +*/ + +var get = Ember.get, set = Ember.set; + +var ClassSet = function() { + this.seen = {}; + this.list = []; +}; + +ClassSet.prototype = { + add: function(string) { + if (string in this.seen) { return; } + this.seen[string] = true; + + this.list.push(string); + }, + + toDOM: function() { + return this.list.join(" "); + } +}; + +var BAD_TAG_NAME_TEST_REGEXP = /[^a-zA-Z\-]/; +var BAD_TAG_NAME_REPLACE_REGEXP = /[^a-zA-Z\-]/g; + +function stripTagName(tagName) { + if (!tagName) { + return tagName; + } + + if (!BAD_TAG_NAME_TEST_REGEXP.test(tagName)) { + return tagName; + } + + return tagName.replace(BAD_TAG_NAME_REPLACE_REGEXP, ''); +} + +var BAD_CHARS_REGEXP = /&(?!\w+;)|[<>"'`]/g; +var POSSIBLE_CHARS_REGEXP = /[&<>"'`]/; + +function escapeAttribute(value) { + // Stolen shamelessly from Handlebars + + var escape = { + "<": "<", + ">": ">", + '"': """, + "'": "'", + "`": "`" + }; + + var escapeChar = function(chr) { + return escape[chr] || "&"; + }; + + var string = value.toString(); + + if(!POSSIBLE_CHARS_REGEXP.test(string)) { return string; } + return string.replace(BAD_CHARS_REGEXP, escapeChar); +} + +/** + `Ember.RenderBuffer` gathers information regarding the a view and generates the + final representation. `Ember.RenderBuffer` will generate HTML which can be pushed + to the DOM. + + @class RenderBuffer + @namespace Ember + @constructor +*/ +Ember.RenderBuffer = function(tagName) { + return new Ember._RenderBuffer(tagName); +}; + +Ember._RenderBuffer = function(tagName) { + this.tagNames = [tagName || null]; + this.buffer = ""; +}; + +Ember._RenderBuffer.prototype = +/** @scope Ember.RenderBuffer.prototype */ { + + // The root view's element + _element: null, + + _hasElement: true, + + /** + @private + + An internal set used to de-dupe class names when `addClass()` is + used. After each call to `addClass()`, the `classes` property + will be updated. + + @property elementClasses + @type Array + @default [] + */ + elementClasses: null, + + /** + Array of class names which will be applied in the class attribute. + + You can use `setClasses()` to set this property directly. If you + use `addClass()`, it will be maintained for you. + + @property classes + @type Array + @default [] + */ + classes: null, + + /** + The id in of the element, to be applied in the id attribute. + + You should not set this property yourself, rather, you should use + the `id()` method of `Ember.RenderBuffer`. + + @property elementId + @type String + @default null + */ + elementId: null, + + /** + A hash keyed on the name of the attribute and whose value will be + applied to that attribute. For example, if you wanted to apply a + `data-view="Foo.bar"` property to an element, you would set the + elementAttributes hash to `{'data-view':'Foo.bar'}`. + + You should not maintain this hash yourself, rather, you should use + the `attr()` method of `Ember.RenderBuffer`. + + @property elementAttributes + @type Hash + @default {} + */ + elementAttributes: null, + + /** + A hash keyed on the name of the properties and whose value will be + applied to that property. For example, if you wanted to apply a + `checked=true` property to an element, you would set the + elementProperties hash to `{'checked':true}`. + + You should not maintain this hash yourself, rather, you should use + the `prop()` method of `Ember.RenderBuffer`. + + @property elementProperties + @type Hash + @default {} + */ + elementProperties: null, + + /** + The tagname of the element an instance of `Ember.RenderBuffer` represents. + + Usually, this gets set as the first parameter to `Ember.RenderBuffer`. For + example, if you wanted to create a `p` tag, then you would call + + ```javascript + Ember.RenderBuffer('p') + ``` + + @property elementTag + @type String + @default null + */ + elementTag: null, + + /** + A hash keyed on the name of the style attribute and whose value will + be applied to that attribute. For example, if you wanted to apply a + `background-color:black;` style to an element, you would set the + elementStyle hash to `{'background-color':'black'}`. + + You should not maintain this hash yourself, rather, you should use + the `style()` method of `Ember.RenderBuffer`. + + @property elementStyle + @type Hash + @default {} + */ + elementStyle: null, + + /** + Nested `RenderBuffers` will set this to their parent `RenderBuffer` + instance. + + @property parentBuffer + @type Ember._RenderBuffer + */ + parentBuffer: null, + + /** + Adds a string of HTML to the `RenderBuffer`. + + @method push + @param {String} string HTML to push into the buffer + @chainable + */ + push: function(string) { + this.buffer += string; + return this; + }, + + /** + Adds a class to the buffer, which will be rendered to the class attribute. + + @method addClass + @param {String} className Class name to add to the buffer + @chainable + */ + addClass: function(className) { + // lazily create elementClasses + this.elementClasses = (this.elementClasses || new ClassSet()); + this.elementClasses.add(className); + this.classes = this.elementClasses.list; + + return this; + }, + + setClasses: function(classNames) { + this.classes = classNames; + }, + + /** + Sets the elementID to be used for the element. + + @method id + @param {String} id + @chainable + */ + id: function(id) { + this.elementId = id; + return this; + }, + + // duck type attribute functionality like jQuery so a render buffer + // can be used like a jQuery object in attribute binding scenarios. + + /** + Adds an attribute which will be rendered to the element. + + @method attr + @param {String} name The name of the attribute + @param {String} value The value to add to the attribute + @chainable + @return {Ember.RenderBuffer|String} this or the current attribute value + */ + attr: function(name, value) { + var attributes = this.elementAttributes = (this.elementAttributes || {}); + + if (arguments.length === 1) { + return attributes[name]; + } else { + attributes[name] = value; + } + + return this; + }, + + /** + Remove an attribute from the list of attributes to render. + + @method removeAttr + @param {String} name The name of the attribute + @chainable + */ + removeAttr: function(name) { + var attributes = this.elementAttributes; + if (attributes) { delete attributes[name]; } + + return this; + }, + + /** + Adds an property which will be rendered to the element. + + @method prop + @param {String} name The name of the property + @param {String} value The value to add to the property + @chainable + @return {Ember.RenderBuffer|String} this or the current property value + */ + prop: function(name, value) { + var properties = this.elementProperties = (this.elementProperties || {}); + + if (arguments.length === 1) { + return properties[name]; + } else { + properties[name] = value; + } + + return this; + }, + + /** + Remove an property from the list of properties to render. + + @method removeProp + @param {String} name The name of the property + @chainable + */ + removeProp: function(name) { + var properties = this.elementProperties; + if (properties) { delete properties[name]; } + + return this; + }, + + /** + Adds a style to the style attribute which will be rendered to the element. + + @method style + @param {String} name Name of the style + @param {String} value + @chainable + */ + style: function(name, value) { + this.elementStyle = (this.elementStyle || {}); + + this.elementStyle[name] = value; + return this; + }, + + begin: function(tagName) { + this.tagNames.push(tagName || null); + return this; + }, + + pushOpeningTag: function() { + var tagName = this.currentTagName(); + if (!tagName) { return; } + + if (this._hasElement && !this._element && this.buffer.length === 0) { + this._element = this.generateElement(); + return; + } + + var buffer = this.buffer, + id = this.elementId, + classes = this.classes, + attrs = this.elementAttributes, + props = this.elementProperties, + style = this.elementStyle, + attr, prop; + + buffer += '<' + stripTagName(tagName); + + if (id) { + buffer += ' id="' + escapeAttribute(id) + '"'; + this.elementId = null; + } + if (classes) { + buffer += ' class="' + escapeAttribute(classes.join(' ')) + '"'; + this.classes = null; + } + + if (style) { + buffer += ' style="'; + + for (prop in style) { + if (style.hasOwnProperty(prop)) { + buffer += prop + ':' + escapeAttribute(style[prop]) + ';'; + } + } + + buffer += '"'; + + this.elementStyle = null; + } + + if (attrs) { + for (attr in attrs) { + if (attrs.hasOwnProperty(attr)) { + buffer += ' ' + attr + '="' + escapeAttribute(attrs[attr]) + '"'; + } + } + + this.elementAttributes = null; + } + + if (props) { + for (prop in props) { + if (props.hasOwnProperty(prop)) { + var value = props[prop]; + if (value || typeof(value) === 'number') { + if (value === true) { + buffer += ' ' + prop + '="' + prop + '"'; + } else { + buffer += ' ' + prop + '="' + escapeAttribute(props[prop]) + '"'; + } + } + } + } + + this.elementProperties = null; + } + + buffer += '>'; + this.buffer = buffer; + }, + + pushClosingTag: function() { + var tagName = this.tagNames.pop(); + if (tagName) { this.buffer += ''; } + }, + + currentTagName: function() { + return this.tagNames[this.tagNames.length-1]; + }, + + generateElement: function() { + var tagName = this.tagNames.pop(), // pop since we don't need to close + element = document.createElement(tagName), + $element = Ember.$(element), + id = this.elementId, + classes = this.classes, + attrs = this.elementAttributes, + props = this.elementProperties, + style = this.elementStyle, + styleBuffer = '', attr, prop; + + if (id) { + $element.attr('id', id); + this.elementId = null; + } + if (classes) { + $element.attr('class', classes.join(' ')); + this.classes = null; + } + + if (style) { + for (prop in style) { + if (style.hasOwnProperty(prop)) { + styleBuffer += (prop + ':' + style[prop] + ';'); + } + } + + $element.attr('style', styleBuffer); + + this.elementStyle = null; + } + + if (attrs) { + for (attr in attrs) { + if (attrs.hasOwnProperty(attr)) { + $element.attr(attr, attrs[attr]); + } + } + + this.elementAttributes = null; + } + + if (props) { + for (prop in props) { + if (props.hasOwnProperty(prop)) { + $element.prop(prop, props[prop]); + } + } + + this.elementProperties = null; + } + + return element; + }, + + /** + @method element + @return {DOMElement} The element corresponding to the generated HTML + of this buffer + */ + element: function() { + var html = this.innerString(); + + if (html) { + this._element = Ember.ViewUtils.setInnerHTML(this._element, html); + } + + return this._element; + }, + + /** + Generates the HTML content for this buffer. + + @method string + @return {String} The generated HTML + */ + string: function() { + if (this._hasElement && this._element) { + // Firefox versions < 11 do not have support for element.outerHTML. + var thisElement = this.element(), outerHTML = thisElement.outerHTML; + if (typeof outerHTML === 'undefined'){ + return Ember.$('
    ').append(thisElement).html(); + } + return outerHTML; + } else { + return this.innerString(); + } + }, + + innerString: function() { + return this.buffer; + } +}; + +})(); + + + +(function() { +/** +@module ember +@submodule ember-views +*/ + +var get = Ember.get, set = Ember.set, fmt = Ember.String.fmt; + +/** + `Ember.EventDispatcher` handles delegating browser events to their + corresponding `Ember.Views.` For example, when you click on a view, + `Ember.EventDispatcher` ensures that that view's `mouseDown` method gets + called. + + @class EventDispatcher + @namespace Ember + @private + @extends Ember.Object +*/ +Ember.EventDispatcher = Ember.Object.extend(/** @scope Ember.EventDispatcher.prototype */{ + + /** + The set of events names (and associated handler function names) to be setup + and dispatched by the `EventDispatcher`. Custom events can added to this list at setup + time, generally via the `Ember.Application.customEvents` hash. Only override this + default set to prevent the EventDispatcher from listening on some events all together. + + This set will be modified by `setup` to also include any events added at that time. + + @property events + @type Object + */ + events: { + touchstart : 'touchStart', + touchmove : 'touchMove', + touchend : 'touchEnd', + touchcancel : 'touchCancel', + keydown : 'keyDown', + keyup : 'keyUp', + keypress : 'keyPress', + mousedown : 'mouseDown', + mouseup : 'mouseUp', + contextmenu : 'contextMenu', + click : 'click', + dblclick : 'doubleClick', + mousemove : 'mouseMove', + focusin : 'focusIn', + focusout : 'focusOut', + mouseenter : 'mouseEnter', + mouseleave : 'mouseLeave', + submit : 'submit', + input : 'input', + change : 'change', + dragstart : 'dragStart', + drag : 'drag', + dragenter : 'dragEnter', + dragleave : 'dragLeave', + dragover : 'dragOver', + drop : 'drop', + dragend : 'dragEnd' + }, + + /** + @private + + The root DOM element to which event listeners should be attached. Event + listeners will be attached to the document unless this is overridden. + + Can be specified as a DOMElement or a selector string. + + The default body is a string since this may be evaluated before document.body + exists in the DOM. + + @property rootElement + @type DOMElement + @default 'body' + */ + rootElement: 'body', + + /** + @private + + Sets up event listeners for standard browser events. + + This will be called after the browser sends a `DOMContentReady` event. By + default, it will set up all of the listeners on the document body. If you + would like to register the listeners on a different element, set the event + dispatcher's `root` property. + + @method setup + @param addedEvents {Hash} + */ + setup: function(addedEvents, rootElement) { + var event, events = get(this, 'events'); + + Ember.$.extend(events, addedEvents || {}); + + + if (!Ember.isNone(rootElement)) { + set(this, 'rootElement', rootElement); + } + + rootElement = Ember.$(get(this, 'rootElement')); + + Ember.assert(fmt('You cannot use the same root element (%@) multiple times in an Ember.Application', [rootElement.selector || rootElement[0].tagName]), !rootElement.is('.ember-application')); + Ember.assert('You cannot make a new Ember.Application using a root element that is a descendent of an existing Ember.Application', !rootElement.closest('.ember-application').length); + Ember.assert('You cannot make a new Ember.Application using a root element that is an ancestor of an existing Ember.Application', !rootElement.find('.ember-application').length); + + rootElement.addClass('ember-application'); + + Ember.assert('Unable to add "ember-application" class to rootElement. Make sure you set rootElement to the body or an element in the body.', rootElement.is('.ember-application')); + + for (event in events) { + if (events.hasOwnProperty(event)) { + this.setupHandler(rootElement, event, events[event]); + } + } + }, + + /** + @private + + Registers an event listener on the document. If the given event is + triggered, the provided event handler will be triggered on the target view. + + If the target view does not implement the event handler, or if the handler + returns `false`, the parent view will be called. The event will continue to + bubble to each successive parent view until it reaches the top. + + For example, to have the `mouseDown` method called on the target view when + a `mousedown` event is received from the browser, do the following: + + ```javascript + setupHandler('mousedown', 'mouseDown'); + ``` + + @method setupHandler + @param {Element} rootElement + @param {String} event the browser-originated event to listen to + @param {String} eventName the name of the method to call on the view + */ + setupHandler: function(rootElement, event, eventName) { + var self = this; + + rootElement.on(event + '.ember', '.ember-view', function(evt, triggeringManager) { + return Ember.handleErrors(function() { + var view = Ember.View.views[this.id], + result = true, manager = null; + + manager = self._findNearestEventManager(view,eventName); + + if (manager && manager !== triggeringManager) { + result = self._dispatchEvent(manager, evt, eventName, view); + } else if (view) { + result = self._bubbleEvent(view,evt,eventName); + } else { + evt.stopPropagation(); + } + + return result; + }, this); + }); + + rootElement.on(event + '.ember', '[data-ember-action]', function(evt) { + return Ember.handleErrors(function() { + var actionId = Ember.$(evt.currentTarget).attr('data-ember-action'), + action = Ember.Handlebars.ActionHelper.registeredActions[actionId]; + + // We have to check for action here since in some cases, jQuery will trigger + // an event on `removeChild` (i.e. focusout) after we've already torn down the + // action handlers for the view. + if (action && action.eventName === eventName) { + return action.handler(evt); + } + }, this); + }); + }, + + _findNearestEventManager: function(view, eventName) { + var manager = null; + + while (view) { + manager = get(view, 'eventManager'); + if (manager && manager[eventName]) { break; } + + view = get(view, 'parentView'); + } + + return manager; + }, + + _dispatchEvent: function(object, evt, eventName, view) { + var result = true; + + var handler = object[eventName]; + if (Ember.typeOf(handler) === 'function') { + result = handler.call(object, evt, view); + // Do not preventDefault in eventManagers. + evt.stopPropagation(); + } + else { + result = this._bubbleEvent(view, evt, eventName); + } + + return result; + }, + + _bubbleEvent: function(view, evt, eventName) { + return Ember.run(function() { + return view.handleEvent(eventName, evt); + }); + }, + + destroy: function() { + var rootElement = get(this, 'rootElement'); + Ember.$(rootElement).off('.ember', '**').removeClass('ember-application'); + return this._super(); + } +}); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-views +*/ + +// Add a new named queue for rendering views that happens +// after bindings have synced, and a queue for scheduling actions +// that that should occur after view rendering. +var queues = Ember.run.queues, + indexOf = Ember.ArrayPolyfills.indexOf; +queues.splice(indexOf.call(queues, 'actions')+1, 0, 'render', 'afterRender'); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-views +*/ + +var get = Ember.get, set = Ember.set; + +// Original class declaration and documentation in runtime/lib/controllers/controller.js +// NOTE: It may be possible with YUIDoc to combine docs in two locations + +/** +Additional methods for the ControllerMixin + +@class ControllerMixin +@namespace Ember +*/ +Ember.ControllerMixin.reopen({ + target: null, + namespace: null, + view: null, + container: null, + _childContainers: null, + + init: function() { + this._super(); + set(this, '_childContainers', {}); + }, + + _modelDidChange: Ember.observer(function() { + var containers = get(this, '_childContainers'); + + for (var prop in containers) { + if (!containers.hasOwnProperty(prop)) { continue; } + containers[prop].destroy(); + } + + set(this, '_childContainers', {}); + }, 'model') +}); + +})(); + + + +(function() { + +})(); + + + +(function() { +var states = {}; + +/** +@module ember +@submodule ember-views +*/ + +var get = Ember.get, set = Ember.set; +var guidFor = Ember.guidFor; +var a_forEach = Ember.EnumerableUtils.forEach; +var a_addObject = Ember.EnumerableUtils.addObject; + +var childViewsProperty = Ember.computed(function() { + var childViews = this._childViews, ret = Ember.A(), view = this; + + a_forEach(childViews, function(view) { + if (view.isVirtual) { + ret.pushObjects(get(view, 'childViews')); + } else { + ret.push(view); + } + }); + + ret.replace = function (idx, removedCount, addedViews) { + if (view instanceof Ember.ContainerView) { + Ember.deprecate("Manipulating an Ember.ContainerView through its childViews property is deprecated. Please use the ContainerView instance itself as an Ember.MutableArray."); + return view.replace(idx, removedCount, addedViews); + } + throw new Error("childViews is immutable"); + }; + + return ret; +}); + +Ember.warn("The VIEW_PRESERVES_CONTEXT flag has been removed and the functionality can no longer be disabled.", Ember.ENV.VIEW_PRESERVES_CONTEXT !== false); + +/** + Global hash of shared templates. This will automatically be populated + by the build tools so that you can store your Handlebars templates in + separate files that get loaded into JavaScript at buildtime. + + @property TEMPLATES + @for Ember + @type Hash +*/ +Ember.TEMPLATES = {}; + +/** + `Ember.CoreView` is + + @class CoreView + @namespace Ember + @extends Ember.Object + @uses Ember.Evented +*/ + +Ember.CoreView = Ember.Object.extend(Ember.Evented, { + isView: true, + + states: states, + + init: function() { + this._super(); + this.transitionTo('preRender'); + }, + + /** + If the view is currently inserted into the DOM of a parent view, this + property will point to the parent of the view. + + @property parentView + @type Ember.View + @default null + */ + parentView: Ember.computed(function() { + var parent = this._parentView; + + if (parent && parent.isVirtual) { + return get(parent, 'parentView'); + } else { + return parent; + } + }).property('_parentView'), + + state: null, + + _parentView: null, + + // return the current view, not including virtual views + concreteView: Ember.computed(function() { + if (!this.isVirtual) { return this; } + else { return get(this, 'parentView'); } + }).property('parentView'), + + instrumentName: 'core_view', + + instrumentDetails: function(hash) { + hash.object = this.toString(); + }, + + /** + @private + + Invoked by the view system when this view needs to produce an HTML + representation. This method will create a new render buffer, if needed, + then apply any default attributes, such as class names and visibility. + Finally, the `render()` method is invoked, which is responsible for + doing the bulk of the rendering. + + You should not need to override this method; instead, implement the + `template` property, or if you need more control, override the `render` + method. + + @method renderToBuffer + @param {Ember.RenderBuffer} buffer the render buffer. If no buffer is + passed, a default buffer, using the current view's `tagName`, will + be used. + */ + renderToBuffer: function(parentBuffer, bufferOperation) { + var name = 'render.' + this.instrumentName, + details = {}; + + this.instrumentDetails(details); + + return Ember.instrument(name, details, function() { + return this._renderToBuffer(parentBuffer, bufferOperation); + }, this); + }, + + _renderToBuffer: function(parentBuffer, bufferOperation) { + // If this is the top-most view, start a new buffer. Otherwise, + // create a new buffer relative to the original using the + // provided buffer operation (for example, `insertAfter` will + // insert a new buffer after the "parent buffer"). + var tagName = this.tagName; + + if (tagName === null || tagName === undefined) { + tagName = 'div'; + } + + var buffer = this.buffer = parentBuffer && parentBuffer.begin(tagName) || Ember.RenderBuffer(tagName); + this.transitionTo('inBuffer', false); + + this.beforeRender(buffer); + this.render(buffer); + this.afterRender(buffer); + + return buffer; + }, + + /** + @private + + Override the default event firing from `Ember.Evented` to + also call methods with the given name. + + @method trigger + @param name {String} + */ + trigger: function(name) { + this._super.apply(this, arguments); + var method = this[name]; + if (method) { + var args = [], i, l; + for (i = 1, l = arguments.length; i < l; i++) { + args.push(arguments[i]); + } + return method.apply(this, args); + } + }, + + has: function(name) { + return Ember.typeOf(this[name]) === 'function' || this._super(name); + }, + + destroy: function() { + var parent = this._parentView; + + if (!this._super()) { return; } + + // destroy the element -- this will avoid each child view destroying + // the element over and over again... + if (!this.removedFromDOM) { this.destroyElement(); } + + // remove from parent if found. Don't call removeFromParent, + // as removeFromParent will try to remove the element from + // the DOM again. + if (parent) { parent.removeChild(this); } + + this.transitionTo('destroying', false); + + return this; + }, + + clearRenderedChildren: Ember.K, + triggerRecursively: Ember.K, + invokeRecursively: Ember.K, + transitionTo: Ember.K, + destroyElement: Ember.K +}); + +var ViewCollection = Ember._ViewCollection = function(initialViews) { + var views = this.views = initialViews || []; + this.length = views.length; +}; + +ViewCollection.prototype = { + length: 0, + + trigger: function(eventName) { + var views = this.views, view; + for (var i = 0, l = views.length; i < l; i++) { + view = views[i]; + if (view.trigger) { view.trigger(eventName); } + } + }, + + triggerRecursively: function(eventName) { + var views = this.views; + for (var i = 0, l = views.length; i < l; i++) { + views[i].triggerRecursively(eventName); + } + }, + + invokeRecursively: function(fn) { + var views = this.views, view; + + for (var i = 0, l = views.length; i < l; i++) { + view = views[i]; + fn(view); + } + }, + + transitionTo: function(state, children) { + var views = this.views; + for (var i = 0, l = views.length; i < l; i++) { + views[i].transitionTo(state, children); + } + }, + + push: function() { + this.length += arguments.length; + var views = this.views; + return views.push.apply(views, arguments); + }, + + objectAt: function(idx) { + return this.views[idx]; + }, + + forEach: function(callback) { + var views = this.views; + return a_forEach(views, callback); + }, + + clear: function() { + this.length = 0; + this.views.length = 0; + } +}; + +var EMPTY_ARRAY = []; + +/** + `Ember.View` is the class in Ember responsible for encapsulating templates of + HTML content, combining templates with data to render as sections of a page's + DOM, and registering and responding to user-initiated events. + + ## HTML Tag + + The default HTML tag name used for a view's DOM representation is `div`. This + can be customized by setting the `tagName` property. The following view +class: + + ```javascript + ParagraphView = Ember.View.extend({ + tagName: 'em' + }); + ``` + + Would result in instances with the following HTML: + + ```html + + ``` + + ## HTML `class` Attribute + + The HTML `class` attribute of a view's tag can be set by providing a + `classNames` property that is set to an array of strings: + + ```javascript + MyView = Ember.View.extend({ + classNames: ['my-class', 'my-other-class'] + }); + ``` + + Will result in view instances with an HTML representation of: + + ```html +
    + ``` + + `class` attribute values can also be set by providing a `classNameBindings` + property set to an array of properties names for the view. The return value + of these properties will be added as part of the value for the view's `class` + attribute. These properties can be computed properties: + + ```javascript + MyView = Ember.View.extend({ + classNameBindings: ['propertyA', 'propertyB'], + propertyA: 'from-a', + propertyB: function(){ + if(someLogic){ return 'from-b'; } + }.property() + }); + ``` + + Will result in view instances with an HTML representation of: + + ```html +
    + ``` + + If the value of a class name binding returns a boolean the property name + itself will be used as the class name if the property is true. The class name + will not be added if the value is `false` or `undefined`. + + ```javascript + MyView = Ember.View.extend({ + classNameBindings: ['hovered'], + hovered: true + }); + ``` + + Will result in view instances with an HTML representation of: + + ```html +
    + ``` + + When using boolean class name bindings you can supply a string value other + than the property name for use as the `class` HTML attribute by appending the + preferred value after a ":" character when defining the binding: + + ```javascript + MyView = Ember.View.extend({ + classNameBindings: ['awesome:so-very-cool'], + awesome: true + }); + ``` + + Will result in view instances with an HTML representation of: + + ```html +
    + ``` + + Boolean value class name bindings whose property names are in a + camelCase-style format will be converted to a dasherized format: + + ```javascript + MyView = Ember.View.extend({ + classNameBindings: ['isUrgent'], + isUrgent: true + }); + ``` + + Will result in view instances with an HTML representation of: + + ```html +
    + ``` + + Class name bindings can also refer to object values that are found by + traversing a path relative to the view itself: + + ```javascript + MyView = Ember.View.extend({ + classNameBindings: ['messages.empty'] + messages: Ember.Object.create({ + empty: true + }) + }); + ``` + + Will result in view instances with an HTML representation of: + + ```html +
    + ``` + + If you want to add a class name for a property which evaluates to true and + and a different class name if it evaluates to false, you can pass a binding + like this: + + ```javascript + // Applies 'enabled' class when isEnabled is true and 'disabled' when isEnabled is false + Ember.View.create({ + classNameBindings: ['isEnabled:enabled:disabled'] + isEnabled: true + }); + ``` + + Will result in view instances with an HTML representation of: + + ```html +
    + ``` + + When isEnabled is `false`, the resulting HTML reprensentation looks like + this: + + ```html +
    + ``` + + This syntax offers the convenience to add a class if a property is `false`: + + ```javascript + // Applies no class when isEnabled is true and class 'disabled' when isEnabled is false + Ember.View.create({ + classNameBindings: ['isEnabled::disabled'] + isEnabled: true + }); + ``` + + Will result in view instances with an HTML representation of: + + ```html +
    + ``` + + When the `isEnabled` property on the view is set to `false`, it will result + in view instances with an HTML representation of: + + ```html +
    + ``` + + Updates to the the value of a class name binding will result in automatic + update of the HTML `class` attribute in the view's rendered HTML + representation. If the value becomes `false` or `undefined` the class name + will be removed. + + Both `classNames` and `classNameBindings` are concatenated properties. See + `Ember.Object` documentation for more information about concatenated + properties. + + ## HTML Attributes + + The HTML attribute section of a view's tag can be set by providing an + `attributeBindings` property set to an array of property names on the view. + The return value of these properties will be used as the value of the view's + HTML associated attribute: + + ```javascript + AnchorView = Ember.View.extend({ + tagName: 'a', + attributeBindings: ['href'], + href: 'http://google.com' + }); + ``` + + Will result in view instances with an HTML representation of: + + ```html + + ``` + + If the return value of an `attributeBindings` monitored property is a boolean + the property will follow HTML's pattern of repeating the attribute's name as + its value: + + ```javascript + MyTextInput = Ember.View.extend({ + tagName: 'input', + attributeBindings: ['disabled'], + disabled: true + }); + ``` + + Will result in view instances with an HTML representation of: + + ```html + + ``` + + `attributeBindings` can refer to computed properties: + + ```javascript + MyTextInput = Ember.View.extend({ + tagName: 'input', + attributeBindings: ['disabled'], + disabled: function(){ + if (someLogic) { + return true; + } else { + return false; + } + }.property() + }); + ``` + + Updates to the the property of an attribute binding will result in automatic + update of the HTML attribute in the view's rendered HTML representation. + + `attributeBindings` is a concatenated property. See `Ember.Object` + documentation for more information about concatenated properties. + + ## Templates + + The HTML contents of a view's rendered representation are determined by its + template. Templates can be any function that accepts an optional context + parameter and returns a string of HTML that will be inserted within the + view's tag. Most typically in Ember this function will be a compiled + `Ember.Handlebars` template. + + ```javascript + AView = Ember.View.extend({ + template: Ember.Handlebars.compile('I am the template') + }); + ``` + + Will result in view instances with an HTML representation of: + + ```html +
    I am the template
    + ``` + + Within an Ember application is more common to define a Handlebars templates as + part of a page: + + ```html + + ``` + + And associate it by name using a view's `templateName` property: + + ```javascript + AView = Ember.View.extend({ + templateName: 'some-template' + }); + ``` + + Using a value for `templateName` that does not have a Handlebars template + with a matching `data-template-name` attribute will throw an error. + + Assigning a value to both `template` and `templateName` properties will throw + an error. + + For views classes that may have a template later defined (e.g. as the block + portion of a `{{view}}` Handlebars helper call in another template or in + a subclass), you can provide a `defaultTemplate` property set to compiled + template function. If a template is not later provided for the view instance + the `defaultTemplate` value will be used: + + ```javascript + AView = Ember.View.extend({ + defaultTemplate: Ember.Handlebars.compile('I was the default'), + template: null, + templateName: null + }); + ``` + + Will result in instances with an HTML representation of: + + ```html +
    I was the default
    + ``` + + If a `template` or `templateName` is provided it will take precedence over + `defaultTemplate`: + + ```javascript + AView = Ember.View.extend({ + defaultTemplate: Ember.Handlebars.compile('I was the default') + }); + + aView = AView.create({ + template: Ember.Handlebars.compile('I was the template, not default') + }); + ``` + + Will result in the following HTML representation when rendered: + + ```html +
    I was the template, not default
    + ``` + + ## View Context + + The default context of the compiled template is the view's controller: + + ```javascript + AView = Ember.View.extend({ + template: Ember.Handlebars.compile('Hello {{excitedGreeting}}') + }); + + aController = Ember.Object.create({ + firstName: 'Barry', + excitedGreeting: function(){ + return this.get("content.firstName") + "!!!" + }.property() + }); + + aView = AView.create({ + controller: aController, + }); + ``` + + Will result in an HTML representation of: + + ```html +
    Hello Barry!!!
    + ``` + + A context can also be explicitly supplied through the view's `context` + property. If the view has neither `context` nor `controller` properties, the + `parentView`'s context will be used. + + ## Layouts + + Views can have a secondary template that wraps their main template. Like + primary templates, layouts can be any function that accepts an optional + context parameter and returns a string of HTML that will be inserted inside + view's tag. Views whose HTML element is self closing (e.g. ``) + cannot have a layout and this property will be ignored. + + Most typically in Ember a layout will be a compiled `Ember.Handlebars` + template. + + A view's layout can be set directly with the `layout` property or reference + an existing Handlebars template by name with the `layoutName` property. + + A template used as a layout must contain a single use of the Handlebars + `{{yield}}` helper. The HTML contents of a view's rendered `template` will be + inserted at this location: + + ```javascript + AViewWithLayout = Ember.View.extend({ + layout: Ember.Handlebars.compile("
    {{yield}}
    ") + template: Ember.Handlebars.compile("I got wrapped"), + }); + ``` + + Will result in view instances with an HTML representation of: + + ```html +
    +
    + I got wrapped +
    +
    + ``` + + See `Handlebars.helpers.yield` for more information. + + ## Responding to Browser Events + + Views can respond to user-initiated events in one of three ways: method + implementation, through an event manager, and through `{{action}}` helper use + in their template or layout. + + ### Method Implementation + + Views can respond to user-initiated events by implementing a method that + matches the event name. A `jQuery.Event` object will be passed as the + argument to this method. + + ```javascript + AView = Ember.View.extend({ + click: function(event){ + // will be called when when an instance's + // rendered element is clicked + } + }); + ``` + + ### Event Managers + + Views can define an object as their `eventManager` property. This object can + then implement methods that match the desired event names. Matching events + that occur on the view's rendered HTML or the rendered HTML of any of its DOM + descendants will trigger this method. A `jQuery.Event` object will be passed + as the first argument to the method and an `Ember.View` object as the + second. The `Ember.View` will be the view whose rendered HTML was interacted + with. This may be the view with the `eventManager` property or one of its + descendent views. + + ```javascript + AView = Ember.View.extend({ + eventManager: Ember.Object.create({ + doubleClick: function(event, view){ + // will be called when when an instance's + // rendered element or any rendering + // of this views's descendent + // elements is clicked + } + }) + }); + ``` + + An event defined for an event manager takes precedence over events of the + same name handled through methods on the view. + + ```javascript + AView = Ember.View.extend({ + mouseEnter: function(event){ + // will never trigger. + }, + eventManager: Ember.Object.create({ + mouseEnter: function(event, view){ + // takes presedence over AView#mouseEnter + } + }) + }); + ``` + + Similarly a view's event manager will take precedence for events of any views + rendered as a descendent. A method name that matches an event name will not + be called if the view instance was rendered inside the HTML representation of + a view that has an `eventManager` property defined that handles events of the + name. Events not handled by the event manager will still trigger method calls + on the descendent. + + ```javascript + OuterView = Ember.View.extend({ + template: Ember.Handlebars.compile("outer {{#view InnerView}}inner{{/view}} outer"), + eventManager: Ember.Object.create({ + mouseEnter: function(event, view){ + // view might be instance of either + // OuterView or InnerView depending on + // where on the page the user interaction occured + } + }) + }); + + InnerView = Ember.View.extend({ + click: function(event){ + // will be called if rendered inside + // an OuterView because OuterView's + // eventManager doesn't handle click events + }, + mouseEnter: function(event){ + // will never be called if rendered inside + // an OuterView. + } + }); + ``` + + ### Handlebars `{{action}}` Helper + + See `Handlebars.helpers.action`. + + ### Event Names + + All of the event handling approaches described above respond to the same set + of events. The names of the built-in events are listed below. (The hash of + built-in events exists in `Ember.EventDispatcher`.) Additional, custom events + can be registered by using `Ember.Application.customEvents`. + + Touch events: + + * `touchStart` + * `touchMove` + * `touchEnd` + * `touchCancel` + + Keyboard events + + * `keyDown` + * `keyUp` + * `keyPress` + + Mouse events + + * `mouseDown` + * `mouseUp` + * `contextMenu` + * `click` + * `doubleClick` + * `mouseMove` + * `focusIn` + * `focusOut` + * `mouseEnter` + * `mouseLeave` + + Form events: + + * `submit` + * `change` + * `focusIn` + * `focusOut` + * `input` + + HTML5 drag and drop events: + + * `dragStart` + * `drag` + * `dragEnter` + * `dragLeave` + * `drop` + * `dragEnd` + + ## Handlebars `{{view}}` Helper + + Other `Ember.View` instances can be included as part of a view's template by + using the `{{view}}` Handlebars helper. See `Handlebars.helpers.view` for + additional information. + + @class View + @namespace Ember + @extends Ember.CoreView +*/ +Ember.View = Ember.CoreView.extend( +/** @scope Ember.View.prototype */ { + + concatenatedProperties: ['classNames', 'classNameBindings', 'attributeBindings'], + + /** + @property isView + @type Boolean + @default true + @final + */ + isView: true, + + // .......................................................... + // TEMPLATE SUPPORT + // + + /** + The name of the template to lookup if no template is provided. + + `Ember.View` will look for a template with this name in this view's + `templates` object. By default, this will be a global object + shared in `Ember.TEMPLATES`. + + @property templateName + @type String + @default null + */ + templateName: null, + + /** + The name of the layout to lookup if no layout is provided. + + `Ember.View` will look for a template with this name in this view's + `templates` object. By default, this will be a global object + shared in `Ember.TEMPLATES`. + + @property layoutName + @type String + @default null + */ + layoutName: null, + + /** + The hash in which to look for `templateName`. + + @property templates + @type Ember.Object + @default Ember.TEMPLATES + */ + templates: Ember.TEMPLATES, + + /** + The template used to render the view. This should be a function that + accepts an optional context parameter and returns a string of HTML that + will be inserted into the DOM relative to its parent view. + + In general, you should set the `templateName` property instead of setting + the template yourself. + + @property template + @type Function + */ + template: Ember.computed(function(key, value) { + if (value !== undefined) { return value; } + + var templateName = get(this, 'templateName'), + template = this.templateForName(templateName, 'template'); + + Ember.assert("You specified the templateName " + templateName + " for " + this + ", but it did not exist.", !templateName || template); + + return template || get(this, 'defaultTemplate'); + }).property('templateName'), + + /** + The controller managing this view. If this property is set, it will be + made available for use by the template. + + @property controller + @type Object + */ + controller: Ember.computed(function(key) { + var parentView = get(this, '_parentView'); + return parentView ? get(parentView, 'controller') : null; + }).property('_parentView'), + + /** + A view may contain a layout. A layout is a regular template but + supersedes the `template` property during rendering. It is the + responsibility of the layout template to retrieve the `template` + property from the view (or alternatively, call `Handlebars.helpers.yield`, + `{{yield}}`) to render it in the correct location. + + This is useful for a view that has a shared wrapper, but which delegates + the rendering of the contents of the wrapper to the `template` property + on a subclass. + + @property layout + @type Function + */ + layout: Ember.computed(function(key) { + var layoutName = get(this, 'layoutName'), + layout = this.templateForName(layoutName, 'layout'); + + Ember.assert("You specified the layoutName " + layoutName + " for " + this + ", but it did not exist.", !layoutName || layout); + + return layout || get(this, 'defaultLayout'); + }).property('layoutName'), + + templateForName: function(name, type) { + if (!name) { return; } + Ember.assert("templateNames are not allowed to contain periods: "+name, name.indexOf('.') === -1); + + // the defaultContainer is deprecated + var container = this.container || (Ember.Container && Ember.Container.defaultContainer); + return container && container.lookup('template:' + name); + }, + + /** + The object from which templates should access properties. + + This object will be passed to the template function each time the render + method is called, but it is up to the individual function to decide what + to do with it. + + By default, this will be the view's controller. + + @property context + @type Object + */ + context: Ember.computed(function(key, value) { + if (arguments.length === 2) { + set(this, '_context', value); + return value; + } else { + return get(this, '_context'); + } + }).volatile(), + + /** + @private + + Private copy of the view's template context. This can be set directly + by Handlebars without triggering the observer that causes the view + to be re-rendered. + + The context of a view is looked up as follows: + + 1. Supplied context (usually by Handlebars) + 2. Specified controller + 3. `parentView`'s context (for a child of a ContainerView) + + The code in Handlebars that overrides the `_context` property first + checks to see whether the view has a specified controller. This is + something of a hack and should be revisited. + + @property _context + */ + _context: Ember.computed(function(key) { + var parentView, controller; + + if (controller = get(this, 'controller')) { + return controller; + } + + parentView = this._parentView; + if (parentView) { + return get(parentView, '_context'); + } + + return null; + }), + + /** + @private + + If a value that affects template rendering changes, the view should be + re-rendered to reflect the new value. + + @method _contextDidChange + */ + _contextDidChange: Ember.observer(function() { + this.rerender(); + }, 'context'), + + /** + If `false`, the view will appear hidden in DOM. + + @property isVisible + @type Boolean + @default null + */ + isVisible: true, + + /** + @private + + Array of child views. You should never edit this array directly. + Instead, use `appendChild` and `removeFromParent`. + + @property childViews + @type Array + @default [] + */ + childViews: childViewsProperty, + + _childViews: EMPTY_ARRAY, + + // When it's a virtual view, we need to notify the parent that their + // childViews will change. + _childViewsWillChange: Ember.beforeObserver(function() { + if (this.isVirtual) { + var parentView = get(this, 'parentView'); + if (parentView) { Ember.propertyWillChange(parentView, 'childViews'); } + } + }, 'childViews'), + + // When it's a virtual view, we need to notify the parent that their + // childViews did change. + _childViewsDidChange: Ember.observer(function() { + if (this.isVirtual) { + var parentView = get(this, 'parentView'); + if (parentView) { Ember.propertyDidChange(parentView, 'childViews'); } + } + }, 'childViews'), + + /** + Return the nearest ancestor that is an instance of the provided + class. + + @property nearestInstanceOf + @param {Class} klass Subclass of Ember.View (or Ember.View itself) + @return Ember.View + @deprecated + */ + nearestInstanceOf: function(klass) { + Ember.deprecate("nearestInstanceOf is deprecated and will be removed from future releases. Use nearestOfType."); + var view = get(this, 'parentView'); + + while (view) { + if(view instanceof klass) { return view; } + view = get(view, 'parentView'); + } + }, + + /** + Return the nearest ancestor that is an instance of the provided + class or mixin. + + @property nearestOfType + @param {Class,Mixin} klass Subclass of Ember.View (or Ember.View itself), + or an instance of Ember.Mixin. + @return Ember.View + */ + nearestOfType: function(klass) { + var view = get(this, 'parentView'), + isOfType = klass instanceof Ember.Mixin ? + function(view) { return klass.detect(view); } : + function(view) { return klass.detect(view.constructor); }; + + while (view) { + if( isOfType(view) ) { return view; } + view = get(view, 'parentView'); + } + }, + + /** + Return the nearest ancestor that has a given property. + + @property nearestWithProperty + @param {String} property A property name + @return Ember.View + */ + nearestWithProperty: function(property) { + var view = get(this, 'parentView'); + + while (view) { + if (property in view) { return view; } + view = get(view, 'parentView'); + } + }, + + /** + Return the nearest ancestor whose parent is an instance of + `klass`. + + @property nearestChildOf + @param {Class} klass Subclass of Ember.View (or Ember.View itself) + @return Ember.View + */ + nearestChildOf: function(klass) { + var view = get(this, 'parentView'); + + while (view) { + if(get(view, 'parentView') instanceof klass) { return view; } + view = get(view, 'parentView'); + } + }, + + /** + @private + + When the parent view changes, recursively invalidate `controller` + + @method _parentViewDidChange + */ + _parentViewDidChange: Ember.observer(function() { + if (this.isDestroying) { return; } + + this.trigger('parentViewDidChange'); + + if (get(this, 'parentView.controller') && !get(this, 'controller')) { + this.notifyPropertyChange('controller'); + } + }, '_parentView'), + + _controllerDidChange: Ember.observer(function() { + if (this.isDestroying) { return; } + + this.rerender(); + + this.forEachChildView(function(view) { + view.propertyDidChange('controller'); + }); + }, 'controller'), + + cloneKeywords: function() { + var templateData = get(this, 'templateData'); + + var keywords = templateData ? Ember.copy(templateData.keywords) : {}; + set(keywords, 'view', get(this, 'concreteView')); + set(keywords, '_view', this); + set(keywords, 'controller', get(this, 'controller')); + + return keywords; + }, + + /** + Called on your view when it should push strings of HTML into a + `Ember.RenderBuffer`. Most users will want to override the `template` + or `templateName` properties instead of this method. + + By default, `Ember.View` will look for a function in the `template` + property and invoke it with the value of `context`. The value of + `context` will be the view's controller unless you override it. + + @method render + @param {Ember.RenderBuffer} buffer The render buffer + */ + render: function(buffer) { + // If this view has a layout, it is the responsibility of the + // the layout to render the view's template. Otherwise, render the template + // directly. + var template = get(this, 'layout') || get(this, 'template'); + + if (template) { + var context = get(this, 'context'); + var keywords = this.cloneKeywords(); + var output; + + var data = { + view: this, + buffer: buffer, + isRenderData: true, + keywords: keywords, + insideGroup: get(this, 'templateData.insideGroup') + }; + + // Invoke the template with the provided template context, which + // is the view's controller by default. A hash of data is also passed that provides + // the template with access to the view and render buffer. + + Ember.assert('template must be a function. Did you mean to call Ember.Handlebars.compile("...") or specify templateName instead?', typeof template === 'function'); + // The template should write directly to the render buffer instead + // of returning a string. + output = template(context, { data: data }); + + // If the template returned a string instead of writing to the buffer, + // push the string onto the buffer. + if (output !== undefined) { buffer.push(output); } + } + }, + + /** + Renders the view again. This will work regardless of whether the + view is already in the DOM or not. If the view is in the DOM, the + rendering process will be deferred to give bindings a chance + to synchronize. + + If children were added during the rendering process using `appendChild`, + `rerender` will remove them, because they will be added again + if needed by the next `render`. + + In general, if the display of your view changes, you should modify + the DOM element directly instead of manually calling `rerender`, which can + be slow. + + @method rerender + */ + rerender: function() { + return this.currentState.rerender(this); + }, + + clearRenderedChildren: function() { + var lengthBefore = this.lengthBeforeRender, + lengthAfter = this.lengthAfterRender; + + // If there were child views created during the last call to render(), + // remove them under the assumption that they will be re-created when + // we re-render. + + // VIEW-TODO: Unit test this path. + var childViews = this._childViews; + for (var i=lengthAfter-1; i>=lengthBefore; i--) { + if (childViews[i]) { childViews[i].destroy(); } + } + }, + + /** + @private + + Iterates over the view's `classNameBindings` array, inserts the value + of the specified property into the `classNames` array, then creates an + observer to update the view's element if the bound property ever changes + in the future. + + @method _applyClassNameBindings + */ + _applyClassNameBindings: function(classBindings) { + var classNames = this.classNames, + elem, newClass, dasherizedClass; + + // Loop through all of the configured bindings. These will be either + // property names ('isUrgent') or property paths relative to the view + // ('content.isUrgent') + a_forEach(classBindings, function(binding) { + + // Variable in which the old class value is saved. The observer function + // closes over this variable, so it knows which string to remove when + // the property changes. + var oldClass; + // Extract just the property name from bindings like 'foo:bar' + var parsedPath = Ember.View._parsePropertyPath(binding); + + // Set up an observer on the context. If the property changes, toggle the + // class name. + var observer = function() { + // Get the current value of the property + newClass = this._classStringForProperty(binding); + elem = this.$(); + + // If we had previously added a class to the element, remove it. + if (oldClass) { + elem.removeClass(oldClass); + // Also remove from classNames so that if the view gets rerendered, + // the class doesn't get added back to the DOM. + classNames.removeObject(oldClass); + } + + // If necessary, add a new class. Make sure we keep track of it so + // it can be removed in the future. + if (newClass) { + elem.addClass(newClass); + oldClass = newClass; + } else { + oldClass = null; + } + }; + + // Get the class name for the property at its current value + dasherizedClass = this._classStringForProperty(binding); + + if (dasherizedClass) { + // Ensure that it gets into the classNames array + // so it is displayed when we render. + a_addObject(classNames, dasherizedClass); + + // Save a reference to the class name so we can remove it + // if the observer fires. Remember that this variable has + // been closed over by the observer. + oldClass = dasherizedClass; + } + + this.registerObserver(this, parsedPath.path, observer); + // Remove className so when the view is rerendered, + // the className is added based on binding reevaluation + this.one('willClearRender', function() { + if (oldClass) { + classNames.removeObject(oldClass); + oldClass = null; + } + }); + + }, this); + }, + + /** + @private + + Iterates through the view's attribute bindings, sets up observers for each, + then applies the current value of the attributes to the passed render buffer. + + @method _applyAttributeBindings + @param {Ember.RenderBuffer} buffer + */ + _applyAttributeBindings: function(buffer, attributeBindings) { + var attributeValue, elem; + + a_forEach(attributeBindings, function(binding) { + var split = binding.split(':'), + property = split[0], + attributeName = split[1] || property; + + // Create an observer to add/remove/change the attribute if the + // JavaScript property changes. + var observer = function() { + elem = this.$(); + + attributeValue = get(this, property); + + Ember.View.applyAttributeBindings(elem, attributeName, attributeValue); + }; + + this.registerObserver(this, property, observer); + + // Determine the current value and add it to the render buffer + // if necessary. + attributeValue = get(this, property); + Ember.View.applyAttributeBindings(buffer, attributeName, attributeValue); + }, this); + }, + + /** + @private + + Given a property name, returns a dasherized version of that + property name if the property evaluates to a non-falsy value. + + For example, if the view has property `isUrgent` that evaluates to true, + passing `isUrgent` to this method will return `"is-urgent"`. + + @method _classStringForProperty + @param property + */ + _classStringForProperty: function(property) { + var parsedPath = Ember.View._parsePropertyPath(property); + var path = parsedPath.path; + + var val = get(this, path); + if (val === undefined && Ember.isGlobalPath(path)) { + val = get(Ember.lookup, path); + } + + return Ember.View._classStringForValue(path, val, parsedPath.className, parsedPath.falsyClassName); + }, + + // .......................................................... + // ELEMENT SUPPORT + // + + /** + Returns the current DOM element for the view. + + @property element + @type DOMElement + */ + element: Ember.computed(function(key, value) { + if (value !== undefined) { + return this.currentState.setElement(this, value); + } else { + return this.currentState.getElement(this); + } + }).property('_parentView'), + + /** + Returns a jQuery object for this view's element. If you pass in a selector + string, this method will return a jQuery object, using the current element + as its buffer. + + For example, calling `view.$('li')` will return a jQuery object containing + all of the `li` elements inside the DOM element of this view. + + @method $ + @param {String} [selector] a jQuery-compatible selector string + @return {jQuery} the jQuery object for the DOM node + */ + $: function(sel) { + return this.currentState.$(this, sel); + }, + + mutateChildViews: function(callback) { + var childViews = this._childViews, + idx = childViews.length, + view; + + while(--idx >= 0) { + view = childViews[idx]; + callback(this, view, idx); + } + + return this; + }, + + forEachChildView: function(callback) { + var childViews = this._childViews; + + if (!childViews) { return this; } + + var len = childViews.length, + view, idx; + + for (idx = 0; idx < len; idx++) { + view = childViews[idx]; + callback(view); + } + + return this; + }, + + /** + Appends the view's element to the specified parent element. + + If the view does not have an HTML representation yet, `createElement()` + will be called automatically. + + Note that this method just schedules the view to be appended; the DOM + element will not be appended to the given element until all bindings have + finished synchronizing. + + This is not typically a function that you will need to call directly when + building your application. You might consider using `Ember.ContainerView` + instead. If you do need to use `appendTo`, be sure that the target element + you are providing is associated with an `Ember.Application` and does not + have an ancestor element that is associated with an Ember view. + + @method appendTo + @param {String|DOMElement|jQuery} A selector, element, HTML string, or jQuery object + @return {Ember.View} receiver + */ + appendTo: function(target) { + // Schedule the DOM element to be created and appended to the given + // element after bindings have synchronized. + this._insertElementLater(function() { + Ember.assert("You cannot append to an existing Ember.View. Consider using Ember.ContainerView instead.", !Ember.$(target).is('.ember-view') && !Ember.$(target).parents().is('.ember-view')); + this.$().appendTo(target); + }); + + return this; + }, + + /** + Replaces the content of the specified parent element with this view's + element. If the view does not have an HTML representation yet, + `createElement()` will be called automatically. + + Note that this method just schedules the view to be appended; the DOM + element will not be appended to the given element until all bindings have + finished synchronizing + + @method replaceIn + @param {String|DOMElement|jQuery} A selector, element, HTML string, or jQuery object + @return {Ember.View} received + */ + replaceIn: function(target) { + Ember.assert("You cannot replace an existing Ember.View. Consider using Ember.ContainerView instead.", !Ember.$(target).is('.ember-view') && !Ember.$(target).parents().is('.ember-view')); + + this._insertElementLater(function() { + Ember.$(target).empty(); + this.$().appendTo(target); + }); + + return this; + }, + + /** + @private + + Schedules a DOM operation to occur during the next render phase. This + ensures that all bindings have finished synchronizing before the view is + rendered. + + To use, pass a function that performs a DOM operation. + + Before your function is called, this view and all child views will receive + the `willInsertElement` event. After your function is invoked, this view + and all of its child views will receive the `didInsertElement` event. + + ```javascript + view._insertElementLater(function() { + this.createElement(); + this.$().appendTo('body'); + }); + ``` + + @method _insertElementLater + @param {Function} fn the function that inserts the element into the DOM + */ + _insertElementLater: function(fn) { + this._scheduledInsert = Ember.run.scheduleOnce('render', this, '_insertElement', fn); + }, + + _insertElement: function (fn) { + this._scheduledInsert = null; + this.currentState.insertElement(this, fn); + }, + + /** + Appends the view's element to the document body. If the view does + not have an HTML representation yet, `createElement()` will be called + automatically. + + If your application uses the `rootElement` property, you must append + the view within that element. Rendering views outside of the `rootElement` + is not supported. + + Note that this method just schedules the view to be appended; the DOM + element will not be appended to the document body until all bindings have + finished synchronizing. + + @method append + @return {Ember.View} receiver + */ + append: function() { + return this.appendTo(document.body); + }, + + /** + Removes the view's element from the element to which it is attached. + + @method remove + @return {Ember.View} receiver + */ + remove: function() { + // What we should really do here is wait until the end of the run loop + // to determine if the element has been re-appended to a different + // element. + // In the interim, we will just re-render if that happens. It is more + // important than elements get garbage collected. + if (!this.removedFromDOM) { this.destroyElement(); } + this.invokeRecursively(function(view) { + if (view.clearRenderedChildren) { view.clearRenderedChildren(); } + }); + }, + + elementId: null, + + /** + Attempts to discover the element in the parent element. The default + implementation looks for an element with an ID of `elementId` (or the + view's guid if `elementId` is null). You can override this method to + provide your own form of lookup. For example, if you want to discover your + element using a CSS class name instead of an ID. + + @method findElementInParentElement + @param {DOMElement} parentElement The parent's DOM element + @return {DOMElement} The discovered element + */ + findElementInParentElement: function(parentElem) { + var id = "#" + this.elementId; + return Ember.$(id)[0] || Ember.$(id, parentElem)[0]; + }, + + /** + Creates a DOM representation of the view and all of its + child views by recursively calling the `render()` method. + + After the element has been created, `didInsertElement` will + be called on this view and all of its child views. + + @method createElement + @return {Ember.View} receiver + */ + createElement: function() { + if (get(this, 'element')) { return this; } + + var buffer = this.renderToBuffer(); + set(this, 'element', buffer.element()); + + return this; + }, + + /** + Called when a view is going to insert an element into the DOM. + + @event willInsertElement + */ + willInsertElement: Ember.K, + + /** + Called when the element of the view has been inserted into the DOM + or after the view was re-rendered. Override this function to do any + set up that requires an element in the document body. + + @event didInsertElement + */ + didInsertElement: Ember.K, + + /** + Called when the view is about to rerender, but before anything has + been torn down. This is a good opportunity to tear down any manual + observers you have installed based on the DOM state + + @event willClearRender + */ + willClearRender: Ember.K, + + /** + @private + + Run this callback on the current view (unless includeSelf is false) and recursively on child views. + + @method invokeRecursively + @param fn {Function} + @param includeSelf (optional, default true) + */ + invokeRecursively: function(fn, includeSelf) { + var childViews = (includeSelf === false) ? this._childViews : [this]; + var currentViews, view; + + while (childViews.length) { + currentViews = childViews.slice(); + childViews = []; + + for (var i=0, l=currentViews.length; i` tag for views. + + @property tagName + @type String + @default null + */ + + // We leave this null by default so we can tell the difference between + // the default case and a user-specified tag. + tagName: null, + + /** + The WAI-ARIA role of the control represented by this view. For example, a + button may have a role of type 'button', or a pane may have a role of + type 'alertdialog'. This property is used by assistive software to help + visually challenged users navigate rich web applications. + + The full list of valid WAI-ARIA roles is available at: + http://www.w3.org/TR/wai-aria/roles#roles_categorization + + @property ariaRole + @type String + @default null + */ + ariaRole: null, + + /** + Standard CSS class names to apply to the view's outer element. This + property automatically inherits any class names defined by the view's + superclasses as well. + + @property classNames + @type Array + @default ['ember-view'] + */ + classNames: ['ember-view'], + + /** + A list of properties of the view to apply as class names. If the property + is a string value, the value of that string will be applied as a class + name. + + ```javascript + // Applies the 'high' class to the view element + Ember.View.create({ + classNameBindings: ['priority'] + priority: 'high' + }); + ``` + + If the value of the property is a Boolean, the name of that property is + added as a dasherized class name. + + ```javascript + // Applies the 'is-urgent' class to the view element + Ember.View.create({ + classNameBindings: ['isUrgent'] + isUrgent: true + }); + ``` + + If you would prefer to use a custom value instead of the dasherized + property name, you can pass a binding like this: + + ```javascript + // Applies the 'urgent' class to the view element + Ember.View.create({ + classNameBindings: ['isUrgent:urgent'] + isUrgent: true + }); + ``` + + This list of properties is inherited from the view's superclasses as well. + + @property classNameBindings + @type Array + @default [] + */ + classNameBindings: EMPTY_ARRAY, + + /** + A list of properties of the view to apply as attributes. If the property is + a string value, the value of that string will be applied as the attribute. + + ```javascript + // Applies the type attribute to the element + // with the value "button", like
    + Ember.View.create({ + attributeBindings: ['type'], + type: 'button' + }); + ``` + + If the value of the property is a Boolean, the name of that property is + added as an attribute. + + ```javascript + // Renders something like
    + Ember.View.create({ + attributeBindings: ['enabled'], + enabled: true + }); + ``` + + @property attributeBindings + */ + attributeBindings: EMPTY_ARRAY, + + // ....................................................... + // CORE DISPLAY METHODS + // + + /** + @private + + Setup a view, but do not finish waking it up. + - configure `childViews` + - register the view with the global views hash, which is used for event + dispatch + + @method init + */ + init: function() { + this.elementId = this.elementId || guidFor(this); + + this._super(); + + // setup child views. be sure to clone the child views array first + this._childViews = this._childViews.slice(); + + Ember.assert("Only arrays are allowed for 'classNameBindings'", Ember.typeOf(this.classNameBindings) === 'array'); + this.classNameBindings = Ember.A(this.classNameBindings.slice()); + + Ember.assert("Only arrays are allowed for 'classNames'", Ember.typeOf(this.classNames) === 'array'); + this.classNames = Ember.A(this.classNames.slice()); + + var viewController = get(this, 'viewController'); + if (viewController) { + viewController = get(viewController); + if (viewController) { + set(viewController, 'view', this); + } + } + }, + + appendChild: function(view, options) { + return this.currentState.appendChild(this, view, options); + }, + + /** + Removes the child view from the parent view. + + @method removeChild + @param {Ember.View} view + @return {Ember.View} receiver + */ + removeChild: function(view) { + // If we're destroying, the entire subtree will be + // freed, and the DOM will be handled separately, + // so no need to mess with childViews. + if (this.isDestroying) { return; } + + // update parent node + set(view, '_parentView', null); + + // remove view from childViews array. + var childViews = this._childViews; + + Ember.EnumerableUtils.removeObject(childViews, view); + + this.propertyDidChange('childViews'); // HUH?! what happened to will change? + + return this; + }, + + /** + Removes all children from the `parentView`. + + @method removeAllChildren + @return {Ember.View} receiver + */ + removeAllChildren: function() { + return this.mutateChildViews(function(parentView, view) { + parentView.removeChild(view); + }); + }, + + destroyAllChildren: function() { + return this.mutateChildViews(function(parentView, view) { + view.destroy(); + }); + }, + + /** + Removes the view from its `parentView`, if one is found. Otherwise + does nothing. + + @method removeFromParent + @return {Ember.View} receiver + */ + removeFromParent: function() { + var parent = this._parentView; + + // Remove DOM element from parent + this.remove(); + + if (parent) { parent.removeChild(this); } + return this; + }, + + /** + You must call `destroy` on a view to destroy the view (and all of its + child views). This will remove the view from any parent node, then make + sure that the DOM element managed by the view can be released by the + memory manager. + + @method destroy + */ + destroy: function() { + var childViews = this._childViews, + // get parentView before calling super because it'll be destroyed + nonVirtualParentView = get(this, 'parentView'), + viewName = this.viewName, + childLen, i; + + if (!this._super()) { return; } + + childLen = childViews.length; + for (i=childLen-1; i>=0; i--) { + childViews[i].removedFromDOM = true; + } + + // remove from non-virtual parent view if viewName was specified + if (viewName && nonVirtualParentView) { + nonVirtualParentView.set(viewName, null); + } + + childLen = childViews.length; + for (i=childLen-1; i>=0; i--) { + childViews[i].destroy(); + } + + return this; + }, + + /** + Instantiates a view to be added to the childViews array during view + initialization. You generally will not call this method directly unless + you are overriding `createChildViews()`. Note that this method will + automatically configure the correct settings on the new view instance to + act as a child of the parent. + + @method createChildView + @param {Class} viewClass + @param {Hash} [attrs] Attributes to add + @return {Ember.View} new instance + */ + createChildView: function(view, attrs) { + if (view.isView && view._parentView === this && view.container === this.container) { + return view; + } + + attrs = attrs || {}; + attrs._parentView = this; + attrs.container = this.container; + + if (Ember.CoreView.detect(view)) { + attrs.templateData = attrs.templateData || get(this, 'templateData'); + + view = view.create(attrs); + + // don't set the property on a virtual view, as they are invisible to + // consumers of the view API + if (view.viewName) { + set(get(this, 'concreteView'), view.viewName, view); + } + } else { + Ember.assert('You must pass instance or subclass of View', view.isView); + + Ember.setProperties(view, attrs); + + if (!get(view, 'templateData')) { + set(view, 'templateData', get(this, 'templateData')); + } + } + + return view; + }, + + becameVisible: Ember.K, + becameHidden: Ember.K, + + /** + @private + + When the view's `isVisible` property changes, toggle the visibility + element of the actual DOM element. + + @method _isVisibleDidChange + */ + _isVisibleDidChange: Ember.observer(function() { + var $el = this.$(); + if (!$el) { return; } + + var isVisible = get(this, 'isVisible'); + + $el.toggle(isVisible); + + if (this._isAncestorHidden()) { return; } + + if (isVisible) { + this._notifyBecameVisible(); + } else { + this._notifyBecameHidden(); + } + }, 'isVisible'), + + _notifyBecameVisible: function() { + this.trigger('becameVisible'); + + this.forEachChildView(function(view) { + var isVisible = get(view, 'isVisible'); + + if (isVisible || isVisible === null) { + view._notifyBecameVisible(); + } + }); + }, + + _notifyBecameHidden: function() { + this.trigger('becameHidden'); + this.forEachChildView(function(view) { + var isVisible = get(view, 'isVisible'); + + if (isVisible || isVisible === null) { + view._notifyBecameHidden(); + } + }); + }, + + _isAncestorHidden: function() { + var parent = get(this, 'parentView'); + + while (parent) { + if (get(parent, 'isVisible') === false) { return true; } + + parent = get(parent, 'parentView'); + } + + return false; + }, + + clearBuffer: function() { + this.invokeRecursively(function(view) { + view.buffer = null; + }); + }, + + transitionTo: function(state, children) { + var priorState = this.currentState, + currentState = this.currentState = this.states[state]; + this.state = state; + + if (priorState && priorState.exit) { priorState.exit(this); } + if (currentState.enter) { currentState.enter(this); } + + if (children !== false) { + this.forEachChildView(function(view) { + view.transitionTo(state); + }); + } + }, + + // ....................................................... + // EVENT HANDLING + // + + /** + @private + + Handle events from `Ember.EventDispatcher` + + @method handleEvent + @param eventName {String} + @param evt {Event} + */ + handleEvent: function(eventName, evt) { + return this.currentState.handleEvent(this, eventName, evt); + }, + + registerObserver: function(root, path, target, observer) { + if (!observer && 'function' === typeof target) { + observer = target; + target = null; + } + + var view = this, + stateCheckedObserver = function(){ + view.currentState.invokeObserver(this, observer); + }, + scheduledObserver = function() { + Ember.run.scheduleOnce('render', this, stateCheckedObserver); + }; + + Ember.addObserver(root, path, target, scheduledObserver); + + this.one('willClearRender', function() { + Ember.removeObserver(root, path, target, scheduledObserver); + }); + } + +}); + +/* + Describe how the specified actions should behave in the various + states that a view can exist in. Possible states: + + * preRender: when a view is first instantiated, and after its + element was destroyed, it is in the preRender state + * inBuffer: once a view has been rendered, but before it has + been inserted into the DOM, it is in the inBuffer state + * inDOM: once a view has been inserted into the DOM it is in + the inDOM state. A view spends the vast majority of its + existence in this state. + * destroyed: once a view has been destroyed (using the destroy + method), it is in this state. No further actions can be invoked + on a destroyed view. +*/ + + // in the destroyed state, everything is illegal + + // before rendering has begun, all legal manipulations are noops. + + // inside the buffer, legal manipulations are done on the buffer + + // once the view has been inserted into the DOM, legal manipulations + // are done on the DOM element. + +function notifyMutationListeners() { + Ember.run.once(Ember.View, 'notifyMutationListeners'); +} + +var DOMManager = { + prepend: function(view, html) { + view.$().prepend(html); + notifyMutationListeners(); + }, + + after: function(view, html) { + view.$().after(html); + notifyMutationListeners(); + }, + + html: function(view, html) { + view.$().html(html); + notifyMutationListeners(); + }, + + replace: function(view) { + var element = get(view, 'element'); + + set(view, 'element', null); + + view._insertElementLater(function() { + Ember.$(element).replaceWith(get(view, 'element')); + notifyMutationListeners(); + }); + }, + + remove: function(view) { + view.$().remove(); + notifyMutationListeners(); + }, + + empty: function(view) { + view.$().empty(); + notifyMutationListeners(); + } +}; + +Ember.View.reopen({ + domManager: DOMManager +}); + +Ember.View.reopenClass({ + + /** + @private + + Parse a path and return an object which holds the parsed properties. + + For example a path like "content.isEnabled:enabled:disabled" wil return the + following object: + + ```javascript + { + path: "content.isEnabled", + className: "enabled", + falsyClassName: "disabled", + classNames: ":enabled:disabled" + } + ``` + + @method _parsePropertyPath + @static + */ + _parsePropertyPath: function(path) { + var split = path.split(':'), + propertyPath = split[0], + classNames = "", + className, + falsyClassName; + + // check if the property is defined as prop:class or prop:trueClass:falseClass + if (split.length > 1) { + className = split[1]; + if (split.length === 3) { falsyClassName = split[2]; } + + classNames = ':' + className; + if (falsyClassName) { classNames += ":" + falsyClassName; } + } + + return { + path: propertyPath, + classNames: classNames, + className: (className === '') ? undefined : className, + falsyClassName: falsyClassName + }; + }, + + /** + @private + + Get the class name for a given value, based on the path, optional + `className` and optional `falsyClassName`. + + - if a `className` or `falsyClassName` has been specified: + - if the value is truthy and `className` has been specified, + `className` is returned + - if the value is falsy and `falsyClassName` has been specified, + `falsyClassName` is returned + - otherwise `null` is returned + - if the value is `true`, the dasherized last part of the supplied path + is returned + - if the value is not `false`, `undefined` or `null`, the `value` + is returned + - if none of the above rules apply, `null` is returned + + @method _classStringForValue + @param path + @param val + @param className + @param falsyClassName + @static + */ + _classStringForValue: function(path, val, className, falsyClassName) { + // When using the colon syntax, evaluate the truthiness or falsiness + // of the value to determine which className to return + if (className || falsyClassName) { + if (className && !!val) { + return className; + + } else if (falsyClassName && !val) { + return falsyClassName; + + } else { + return null; + } + + // If value is a Boolean and true, return the dasherized property + // name. + } else if (val === true) { + // Normalize property path to be suitable for use + // as a class name. For exaple, content.foo.barBaz + // becomes bar-baz. + var parts = path.split('.'); + return Ember.String.dasherize(parts[parts.length-1]); + + // If the value is not false, undefined, or null, return the current + // value of the property. + } else if (val !== false && val != null) { + return val; + + // Nothing to display. Return null so that the old class is removed + // but no new class is added. + } else { + return null; + } + } +}); + +var mutation = Ember.Object.extend(Ember.Evented).create(); + +Ember.View.addMutationListener = function(callback) { + mutation.on('change', callback); +}; + +Ember.View.removeMutationListener = function(callback) { + mutation.off('change', callback); +}; + +Ember.View.notifyMutationListeners = function() { + mutation.trigger('change'); +}; + +/** + Global views hash + + @property views + @static + @type Hash +*/ +Ember.View.views = {}; + +// If someone overrides the child views computed property when +// defining their class, we want to be able to process the user's +// supplied childViews and then restore the original computed property +// at view initialization time. This happens in Ember.ContainerView's init +// method. +Ember.View.childViewsProperty = childViewsProperty; + +Ember.View.applyAttributeBindings = function(elem, name, value) { + var type = Ember.typeOf(value); + + // if this changes, also change the logic in ember-handlebars/lib/helpers/binding.js + if (name !== 'value' && (type === 'string' || (type === 'number' && !isNaN(value)))) { + if (value !== elem.attr(name)) { + elem.attr(name, value); + } + } else if (name === 'value' || type === 'boolean') { + // We can't set properties to undefined or null + if (!value) { value = ''; } + + if (value !== elem.prop(name)) { + // value and booleans should always be properties + elem.prop(name, value); + } + } else if (!value) { + elem.removeAttr(name); + } +}; + +Ember.View.states = states; + +})(); + + + +(function() { +/** +@module ember +@submodule ember-views +*/ + +var get = Ember.get, set = Ember.set; + +Ember.View.states._default = { + // appendChild is only legal while rendering the buffer. + appendChild: function() { + throw "You can't use appendChild outside of the rendering process"; + }, + + $: function() { + return undefined; + }, + + getElement: function() { + return null; + }, + + // Handle events from `Ember.EventDispatcher` + handleEvent: function() { + return true; // continue event propagation + }, + + destroyElement: function(view) { + set(view, 'element', null); + if (view._scheduledInsert) { + Ember.run.cancel(view._scheduledInsert); + view._scheduledInsert = null; + } + return view; + }, + + renderToBufferIfNeeded: function () { + return false; + }, + + rerender: Ember.K, + invokeObserver: Ember.K +}; + +})(); + + + +(function() { +/** +@module ember +@submodule ember-views +*/ + +var preRender = Ember.View.states.preRender = Ember.create(Ember.View.states._default); + +Ember.merge(preRender, { + // a view leaves the preRender state once its element has been + // created (createElement). + insertElement: function(view, fn) { + view.createElement(); + var viewCollection = view.viewHierarchyCollection(); + + viewCollection.trigger('willInsertElement'); + // after createElement, the view will be in the hasElement state. + fn.call(view); + viewCollection.transitionTo('inDOM', false); + viewCollection.trigger('didInsertElement'); + }, + + renderToBufferIfNeeded: function(view, buffer) { + view.renderToBuffer(buffer); + return true; + }, + + empty: Ember.K, + + setElement: function(view, value) { + if (value !== null) { + view.transitionTo('hasElement'); + } + return value; + } +}); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-views +*/ + +var get = Ember.get, set = Ember.set; + +var inBuffer = Ember.View.states.inBuffer = Ember.create(Ember.View.states._default); + +Ember.merge(inBuffer, { + $: function(view, sel) { + // if we don't have an element yet, someone calling this.$() is + // trying to update an element that isn't in the DOM. Instead, + // rerender the view to allow the render method to reflect the + // changes. + view.rerender(); + return Ember.$(); + }, + + // when a view is rendered in a buffer, rerendering it simply + // replaces the existing buffer with a new one + rerender: function(view) { + throw new Ember.Error("Something you did caused a view to re-render after it rendered but before it was inserted into the DOM."); + }, + + // when a view is rendered in a buffer, appending a child + // view will render that view and append the resulting + // buffer into its buffer. + appendChild: function(view, childView, options) { + var buffer = view.buffer, _childViews = view._childViews; + + childView = view.createChildView(childView, options); + if (!_childViews.length) { _childViews = view._childViews = _childViews.slice(); } + _childViews.push(childView); + + childView.renderToBuffer(buffer); + + view.propertyDidChange('childViews'); + + return childView; + }, + + // when a view is rendered in a buffer, destroying the + // element will simply destroy the buffer and put the + // state back into the preRender state. + destroyElement: function(view) { + view.clearBuffer(); + var viewCollection = view._notifyWillDestroyElement(); + viewCollection.transitionTo('preRender', false); + + return view; + }, + + empty: function() { + Ember.assert("Emptying a view in the inBuffer state is not allowed and should not happen under normal circumstances. Most likely there is a bug in your application. This may be due to excessive property change notifications."); + }, + + renderToBufferIfNeeded: function (view, buffer) { + return false; + }, + + // It should be impossible for a rendered view to be scheduled for + // insertion. + insertElement: function() { + throw "You can't insert an element that has already been rendered"; + }, + + setElement: function(view, value) { + if (value === null) { + view.transitionTo('preRender'); + } else { + view.clearBuffer(); + view.transitionTo('hasElement'); + } + + return value; + }, + + invokeObserver: function(target, observer) { + observer.call(target); + } +}); + + +})(); + + + +(function() { +/** +@module ember +@submodule ember-views +*/ + +var get = Ember.get, set = Ember.set; + +var hasElement = Ember.View.states.hasElement = Ember.create(Ember.View.states._default); + +Ember.merge(hasElement, { + $: function(view, sel) { + var elem = get(view, 'element'); + return sel ? Ember.$(sel, elem) : Ember.$(elem); + }, + + getElement: function(view) { + var parent = get(view, 'parentView'); + if (parent) { parent = get(parent, 'element'); } + if (parent) { return view.findElementInParentElement(parent); } + return Ember.$("#" + get(view, 'elementId'))[0]; + }, + + setElement: function(view, value) { + if (value === null) { + view.transitionTo('preRender'); + } else { + throw "You cannot set an element to a non-null value when the element is already in the DOM."; + } + + return value; + }, + + // once the view has been inserted into the DOM, rerendering is + // deferred to allow bindings to synchronize. + rerender: function(view) { + view.triggerRecursively('willClearRender'); + + view.clearRenderedChildren(); + + view.domManager.replace(view); + return view; + }, + + // once the view is already in the DOM, destroying it removes it + // from the DOM, nukes its element, and puts it back into the + // preRender state if inDOM. + + destroyElement: function(view) { + view._notifyWillDestroyElement(); + view.domManager.remove(view); + set(view, 'element', null); + if (view._scheduledInsert) { + Ember.run.cancel(view._scheduledInsert); + view._scheduledInsert = null; + } + return view; + }, + + empty: function(view) { + var _childViews = view._childViews, len, idx; + if (_childViews) { + len = _childViews.length; + for (idx = 0; idx < len; idx++) { + _childViews[idx]._notifyWillDestroyElement(); + } + } + view.domManager.empty(view); + }, + + // Handle events from `Ember.EventDispatcher` + handleEvent: function(view, eventName, evt) { + if (view.has(eventName)) { + // Handler should be able to re-dispatch events, so we don't + // preventDefault or stopPropagation. + return view.trigger(eventName, evt); + } else { + return true; // continue event propagation + } + }, + + invokeObserver: function(target, observer) { + observer.call(target); + } +}); + +var inDOM = Ember.View.states.inDOM = Ember.create(hasElement); + +Ember.merge(inDOM, { + enter: function(view) { + // Register the view for event handling. This hash is used by + // Ember.EventDispatcher to dispatch incoming events. + if (!view.isVirtual) { + Ember.assert("Attempted to register a view with an id already in use: "+view.elementId, !Ember.View.views[view.elementId]); + Ember.View.views[view.elementId] = view; + } + + view.addBeforeObserver('elementId', function() { + throw new Error("Changing a view's elementId after creation is not allowed"); + }); + }, + + exit: function(view) { + if (!this.isVirtual) delete Ember.View.views[view.elementId]; + }, + + insertElement: function(view, fn) { + throw "You can't insert an element into the DOM that has already been inserted"; + } +}); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-views +*/ + +var destroyingError = "You can't call %@ on a view being destroyed", fmt = Ember.String.fmt; + +var destroying = Ember.View.states.destroying = Ember.create(Ember.View.states._default); + +Ember.merge(destroying, { + appendChild: function() { + throw fmt(destroyingError, ['appendChild']); + }, + rerender: function() { + throw fmt(destroyingError, ['rerender']); + }, + destroyElement: function() { + throw fmt(destroyingError, ['destroyElement']); + }, + empty: function() { + throw fmt(destroyingError, ['empty']); + }, + + setElement: function() { + throw fmt(destroyingError, ["set('element', ...)"]); + }, + + renderToBufferIfNeeded: function() { + return false; + }, + + // Since element insertion is scheduled, don't do anything if + // the view has been destroyed between scheduling and execution + insertElement: Ember.K +}); + + +})(); + + + +(function() { +Ember.View.cloneStates = function(from) { + var into = {}; + + into._default = {}; + into.preRender = Ember.create(into._default); + into.destroying = Ember.create(into._default); + into.inBuffer = Ember.create(into._default); + into.hasElement = Ember.create(into._default); + into.inDOM = Ember.create(into.hasElement); + + for (var stateName in from) { + if (!from.hasOwnProperty(stateName)) { continue; } + Ember.merge(into[stateName], from[stateName]); + } + + return into; +}; + +})(); + + + +(function() { +var states = Ember.View.cloneStates(Ember.View.states); + +/** +@module ember +@submodule ember-views +*/ + +var get = Ember.get, set = Ember.set; +var forEach = Ember.EnumerableUtils.forEach; +var ViewCollection = Ember._ViewCollection; + +/** + A `ContainerView` is an `Ember.View` subclass that implements `Ember.MutableArray` + allowing programatic management of its child views. + + ## Setting Initial Child Views + + The initial array of child views can be set in one of two ways. You can + provide a `childViews` property at creation time that contains instance of + `Ember.View`: + + ```javascript + aContainer = Ember.ContainerView.create({ + childViews: [Ember.View.create(), Ember.View.create()] + }); + ``` + + You can also provide a list of property names whose values are instances of + `Ember.View`: + + ```javascript + aContainer = Ember.ContainerView.create({ + childViews: ['aView', 'bView', 'cView'], + aView: Ember.View.create(), + bView: Ember.View.create(), + cView: Ember.View.create() + }); + ``` + + The two strategies can be combined: + + ```javascript + aContainer = Ember.ContainerView.create({ + childViews: ['aView', Ember.View.create()], + aView: Ember.View.create() + }); + ``` + + Each child view's rendering will be inserted into the container's rendered + HTML in the same order as its position in the `childViews` property. + + ## Adding and Removing Child Views + + The container view implements `Ember.MutableArray` allowing programatic management of its child views. + + To remove a view, pass that view into a `removeObject` call on the container view. + + Given an empty `` the following code + + ```javascript + aContainer = Ember.ContainerView.create({ + classNames: ['the-container'], + childViews: ['aView', 'bView'], + aView: Ember.View.create({ + template: Ember.Handlebars.compile("A") + }), + bView: Ember.View.create({ + template: Ember.Handlebars.compile("B") + }) + }); + + aContainer.appendTo('body'); + ``` + + Results in the HTML + + ```html +
    +
    A
    +
    B
    +
    + ``` + + Removing a view + + ```javascript + aContainer.toArray(); // [aContainer.aView, aContainer.bView] + aContainer.removeObject(aContainer.get('bView')); + aContainer.toArray(); // [aContainer.aView] + ``` + + Will result in the following HTML + + ```html +
    +
    A
    +
    + ``` + + Similarly, adding a child view is accomplished by adding `Ember.View` instances to the + container view. + + Given an empty `` the following code + + ```javascript + aContainer = Ember.ContainerView.create({ + classNames: ['the-container'], + childViews: ['aView', 'bView'], + aView: Ember.View.create({ + template: Ember.Handlebars.compile("A") + }), + bView: Ember.View.create({ + template: Ember.Handlebars.compile("B") + }) + }); + + aContainer.appendTo('body'); + ``` + + Results in the HTML + + ```html +
    +
    A
    +
    B
    +
    + ``` + + Adding a view + + ```javascript + AnotherViewClass = Ember.View.extend({ + template: Ember.Handlebars.compile("Another view") + }); + + aContainer.toArray(); // [aContainer.aView, aContainer.bView] + aContainer.pushObject(AnotherViewClass.create()); + aContainer.toArray(); // [aContainer.aView, aContainer.bView, ] + ``` + + Will result in the following HTML + + ```html +
    +
    A
    +
    B
    +
    Another view
    +
    + ``` + + ## Templates and Layout + + A `template`, `templateName`, `defaultTemplate`, `layout`, `layoutName` or + `defaultLayout` property on a container view will not result in the template + or layout being rendered. The HTML contents of a `Ember.ContainerView`'s DOM + representation will only be the rendered HTML of its child views. + + ## Binding a View to Display + + If you would like to display a single view in your ContainerView, you can set + its `currentView` property. When the `currentView` property is set to a view + instance, it will be added to the ContainerView. If the `currentView` property + is later changed to a different view, the new view will replace the old view. + If `currentView` is set to `null`, the last `currentView` will be removed. + + This functionality is useful for cases where you want to bind the display of + a ContainerView to a controller or state manager. For example, you can bind + the `currentView` of a container to a controller like this: + + ```javascript + App.appController = Ember.Object.create({ + view: Ember.View.create({ + templateName: 'person_template' + }) + }); + ``` + + ```handlebars + {{view Ember.ContainerView currentViewBinding="App.appController.view"}} + ``` + + @class ContainerView + @namespace Ember + @extends Ember.View +*/ +Ember.ContainerView = Ember.View.extend(Ember.MutableArray, { + states: states, + + init: function() { + this._super(); + + var childViews = get(this, 'childViews'); + + // redefine view's childViews property that was obliterated + Ember.defineProperty(this, 'childViews', Ember.View.childViewsProperty); + + var _childViews = this._childViews; + + forEach(childViews, function(viewName, idx) { + var view; + + if ('string' === typeof viewName) { + view = get(this, viewName); + view = this.createChildView(view); + set(this, viewName, view); + } else { + view = this.createChildView(viewName); + } + + _childViews[idx] = view; + }, this); + + var currentView = get(this, 'currentView'); + if (currentView) { + if (!_childViews.length) { _childViews = this._childViews = this._childViews.slice(); } + _childViews.push(this.createChildView(currentView)); + } + }, + + replace: function(idx, removedCount, addedViews) { + var addedCount = addedViews ? get(addedViews, 'length') : 0; + var self = this; + Ember.assert("You can't add a child to a container that is already a child of another view", Ember.A(addedViews).every(function(item) { return !get(item, '_parentView') || get(item, '_parentView') === self; })); + + this.arrayContentWillChange(idx, removedCount, addedCount); + this.childViewsWillChange(this._childViews, idx, removedCount); + + if (addedCount === 0) { + this._childViews.splice(idx, removedCount) ; + } else { + var args = [idx, removedCount].concat(addedViews); + if (addedViews.length && !this._childViews.length) { this._childViews = this._childViews.slice(); } + this._childViews.splice.apply(this._childViews, args); + } + + this.arrayContentDidChange(idx, removedCount, addedCount); + this.childViewsDidChange(this._childViews, idx, removedCount, addedCount); + + return this; + }, + + objectAt: function(idx) { + return this._childViews[idx]; + }, + + length: Ember.computed(function () { + return this._childViews.length; + }), + + /** + @private + + Instructs each child view to render to the passed render buffer. + + @method render + @param {Ember.RenderBuffer} buffer the buffer to render to + */ + render: function(buffer) { + this.forEachChildView(function(view) { + view.renderToBuffer(buffer); + }); + }, + + instrumentName: 'container', + + /** + @private + + When a child view is removed, destroy its element so that + it is removed from the DOM. + + The array observer that triggers this action is set up in the + `renderToBuffer` method. + + @method childViewsWillChange + @param {Ember.Array} views the child views array before mutation + @param {Number} start the start position of the mutation + @param {Number} removed the number of child views removed + **/ + childViewsWillChange: function(views, start, removed) { + this.propertyWillChange('childViews'); + + if (removed > 0) { + var changedViews = views.slice(start, start+removed); + // transition to preRender before clearing parentView + this.currentState.childViewsWillChange(this, views, start, removed); + this.initializeViews(changedViews, null, null); + } + }, + + removeChild: function(child) { + this.removeObject(child); + return this; + }, + + /** + @private + + When a child view is added, make sure the DOM gets updated appropriately. + + If the view has already rendered an element, we tell the child view to + create an element and insert it into the DOM. If the enclosing container + view has already written to a buffer, but not yet converted that buffer + into an element, we insert the string representation of the child into the + appropriate place in the buffer. + + @method childViewsDidChange + @param {Ember.Array} views the array of child views afte the mutation has occurred + @param {Number} start the start position of the mutation + @param {Number} removed the number of child views removed + @param {Number} the number of child views added + */ + childViewsDidChange: function(views, start, removed, added) { + if (added > 0) { + var changedViews = views.slice(start, start+added); + this.initializeViews(changedViews, this, get(this, 'templateData')); + this.currentState.childViewsDidChange(this, views, start, added); + } + this.propertyDidChange('childViews'); + }, + + initializeViews: function(views, parentView, templateData) { + forEach(views, function(view) { + set(view, '_parentView', parentView); + set(view, 'container', parentView && parentView.container); + + if (!get(view, 'templateData')) { + set(view, 'templateData', templateData); + } + }); + }, + + currentView: null, + + _currentViewWillChange: Ember.beforeObserver(function() { + var currentView = get(this, 'currentView'); + if (currentView) { + currentView.destroy(); + } + }, 'currentView'), + + _currentViewDidChange: Ember.observer(function() { + var currentView = get(this, 'currentView'); + if (currentView) { + Ember.assert("You tried to set a current view that already has a parent. Make sure you don't have multiple outlets in the same view.", !get(currentView, '_parentView')); + this.pushObject(currentView); + } + }, 'currentView'), + + _ensureChildrenAreInDOM: function () { + this.currentState.ensureChildrenAreInDOM(this); + } +}); + +Ember.merge(states._default, { + childViewsWillChange: Ember.K, + childViewsDidChange: Ember.K, + ensureChildrenAreInDOM: Ember.K +}); + +Ember.merge(states.inBuffer, { + childViewsDidChange: function(parentView, views, start, added) { + throw new Error('You cannot modify child views while in the inBuffer state'); + } +}); + +Ember.merge(states.hasElement, { + childViewsWillChange: function(view, views, start, removed) { + for (var i=start; i` and the following code: + + ```javascript + someItemsView = Ember.CollectionView.create({ + classNames: ['a-collection'], + content: ['A','B','C'], + itemViewClass: Ember.View.extend({ + template: Ember.Handlebars.compile("the letter: {{view.content}}") + }) + }); + + someItemsView.appendTo('body'); + ``` + + Will result in the following HTML structure + + ```html +
    +
    the letter: A
    +
    the letter: B
    +
    the letter: C
    +
    + ``` + + ## Automatic matching of parent/child tagNames + + Setting the `tagName` property of a `CollectionView` to any of + "ul", "ol", "table", "thead", "tbody", "tfoot", "tr", or "select" will result + in the item views receiving an appropriately matched `tagName` property. + + Given an empty `` and the following code: + + ```javascript + anUndorderedListView = Ember.CollectionView.create({ + tagName: 'ul', + content: ['A','B','C'], + itemViewClass: Ember.View.extend({ + template: Ember.Handlebars.compile("the letter: {{view.content}}") + }) + }); + + anUndorderedListView.appendTo('body'); + ``` + + Will result in the following HTML structure + + ```html +
      +
    • the letter: A
      • +
    • the letter: B
      • +
    • the letter: C
      • +
    + ``` + + Additional `tagName` pairs can be provided by adding to + `Ember.CollectionView.CONTAINER_MAP ` + + ```javascript + Ember.CollectionView.CONTAINER_MAP['article'] = 'section' + ``` + + ## Programatic creation of child views + + For cases where additional customization beyond the use of a single + `itemViewClass` or `tagName` matching is required CollectionView's + `createChildView` method can be overidden: + + ```javascript + CustomCollectionView = Ember.CollectionView.extend({ + createChildView: function(viewClass, attrs) { + if (attrs.content.kind == 'album') { + viewClass = App.AlbumView; + } else { + viewClass = App.SongView; + } + return this._super(viewClass, attrs); + } + }); + ``` + + ## Empty View + + You can provide an `Ember.View` subclass to the `Ember.CollectionView` + instance as its `emptyView` property. If the `content` property of a + `CollectionView` is set to `null` or an empty array, an instance of this view + will be the `CollectionView`s only child. + + ```javascript + aListWithNothing = Ember.CollectionView.create({ + classNames: ['nothing'] + content: null, + emptyView: Ember.View.extend({ + template: Ember.Handlebars.compile("The collection is empty") + }) + }); + + aListWithNothing.appendTo('body'); + ``` + + Will result in the following HTML structure + + ```html +
    +
    + The collection is empty +
    +
    + ``` + + ## Adding and Removing items + + The `childViews` property of a `CollectionView` should not be directly + manipulated. Instead, add, remove, replace items from its `content` property. + This will trigger appropriate changes to its rendered HTML. + + ## Use in templates via the `{{collection}}` `Ember.Handlebars` helper + + `Ember.Handlebars` provides a helper specifically for adding + `CollectionView`s to templates. See `Ember.Handlebars.collection` for more + details + + @class CollectionView + @namespace Ember + @extends Ember.ContainerView + @since Ember 0.9 +*/ +Ember.CollectionView = Ember.ContainerView.extend(/** @scope Ember.CollectionView.prototype */ { + + /** + A list of items to be displayed by the `Ember.CollectionView`. + + @property content + @type Ember.Array + @default null + */ + content: null, + + /** + @private + + This provides metadata about what kind of empty view class this + collection would like if it is being instantiated from another + system (like Handlebars) + + @property emptyViewClass + */ + emptyViewClass: Ember.View, + + /** + An optional view to display if content is set to an empty array. + + @property emptyView + @type Ember.View + @default null + */ + emptyView: null, + + /** + @property itemViewClass + @type Ember.View + @default Ember.View + */ + itemViewClass: Ember.View, + + init: function() { + var ret = this._super(); + this._contentDidChange(); + return ret; + }, + + _contentWillChange: Ember.beforeObserver(function() { + var content = this.get('content'); + + if (content) { content.removeArrayObserver(this); } + var len = content ? get(content, 'length') : 0; + this.arrayWillChange(content, 0, len); + }, 'content'), + + /** + @private + + Check to make sure that the content has changed, and if so, + update the children directly. This is always scheduled + asynchronously, to allow the element to be created before + bindings have synchronized and vice versa. + + @method _contentDidChange + */ + _contentDidChange: Ember.observer(function() { + var content = get(this, 'content'); + + if (content) { + Ember.assert(fmt("an Ember.CollectionView's content must implement Ember.Array. You passed %@", [content]), Ember.Array.detect(content)); + content.addArrayObserver(this); + } + + var len = content ? get(content, 'length') : 0; + this.arrayDidChange(content, 0, null, len); + }, 'content'), + + destroy: function() { + if (!this._super()) { return; } + + var content = get(this, 'content'); + if (content) { content.removeArrayObserver(this); } + + if (this._createdEmptyView) { + this._createdEmptyView.destroy(); + } + + return this; + }, + + arrayWillChange: function(content, start, removedCount) { + // If the contents were empty before and this template collection has an + // empty view remove it now. + var emptyView = get(this, 'emptyView'); + if (emptyView && emptyView instanceof Ember.View) { + emptyView.removeFromParent(); + } + + // Loop through child views that correspond with the removed items. + // Note that we loop from the end of the array to the beginning because + // we are mutating it as we go. + var childViews = this._childViews, childView, idx, len; + + len = this._childViews.length; + + var removingAll = removedCount === len; + + if (removingAll) { + this.currentState.empty(this); + this.invokeRecursively(function(view) { + view.removedFromDOM = true; + }, false); + } + + for (idx = start + removedCount - 1; idx >= start; idx--) { + childView = childViews[idx]; + childView.destroy(); + } + }, + + /** + Called when a mutation to the underlying content array occurs. + + This method will replay that mutation against the views that compose the + `Ember.CollectionView`, ensuring that the view reflects the model. + + This array observer is added in `contentDidChange`. + + @method arrayDidChange + @param {Array} content the managed collection of objects + @param {Number} start the index at which the changes occurred + @param {Number} removed number of object removed from content + @param {Number} added number of object added to content + */ + arrayDidChange: function(content, start, removed, added) { + var itemViewClass = get(this, 'itemViewClass'), + addedViews = [], view, item, idx, len; + + if ('string' === typeof itemViewClass) { + itemViewClass = get(itemViewClass); + } + + Ember.assert(fmt("itemViewClass must be a subclass of Ember.View, not %@", [itemViewClass]), Ember.View.detect(itemViewClass)); + + len = content ? get(content, 'length') : 0; + if (len) { + for (idx = start; idx < start+added; idx++) { + item = content.objectAt(idx); + + view = this.createChildView(itemViewClass, { + content: item, + contentIndex: idx + }); + + addedViews.push(view); + } + } else { + var emptyView = get(this, 'emptyView'); + if (!emptyView) { return; } + + var isClass = Ember.CoreView.detect(emptyView); + + emptyView = this.createChildView(emptyView); + addedViews.push(emptyView); + set(this, 'emptyView', emptyView); + + if (isClass) { this._createdEmptyView = emptyView; } + } + this.replace(start, 0, addedViews); + }, + + createChildView: function(view, attrs) { + view = this._super(view, attrs); + + var itemTagName = get(view, 'tagName'); + var tagName = (itemTagName === null || itemTagName === undefined) ? Ember.CollectionView.CONTAINER_MAP[get(this, 'tagName')] : itemTagName; + + set(view, 'tagName', tagName); + + return view; + } +}); + +/** + A map of parent tags to their default child tags. You can add + additional parent tags if you want collection views that use + a particular parent tag to default to a child tag. + + @property CONTAINER_MAP + @type Hash + @static + @final +*/ +Ember.CollectionView.CONTAINER_MAP = { + ul: 'li', + ol: 'li', + table: 'tr', + thead: 'tr', + tbody: 'tr', + tfoot: 'tr', + tr: 'td', + select: 'option' +}; + +})(); + + + +(function() { +/** +@module ember +@submodule ember-views +*/ + +/** + An `Ember.Component` is a view that is completely + isolated. Property access in its templates go + to the view object and actions are targeted at + the view object. There is no access to the + surrounding context or outer controller; all + contextual information is passed in. + + The easiest way to create an `Ember.Component` is via + a template. If you name a template + `controls/my-foo`, you will be able to use + `{{my-foo}}` in other templates, which will make + an instance of the isolated control. + + ```html + {{app-profile person=currentUser}} + ``` + + ```html + +

    {{person.title}}

    + +

    {{person.signature}}

    + ``` + + You can also use `yield` inside a template to + include the **contents** of the custom tag: + + ```html + {{#my-profile person=currentUser}} +

    Admin mode

    + {{/my-profile}} + ``` + + ```html + + +

    {{person.title}}

    + {{yield}} + ``` + + If you want to customize the control, in order to + handle events or actions, you implement a subclass + of `Ember.Component` named after the name of the + control. + + For example, you could implement the action + `hello` for the `app-profile` control: + + ```js + App.AppProfileComponent = Ember.Component.extend({ + hello: function(name) { + console.log("Hello", name) + } + }); + ``` + + And then use it in the control's template: + + ```html + + +

    {{person.title}}

    + {{yield}} + + + ``` + + Components must have a `-` in their name to avoid + conflicts with built-in controls that wrap HTML + elements. This is consistent with the same + requirement in web components. + + @class Component + @namespace Ember + @extends Ember.View +*/ +Ember.Component = Ember.View.extend({ + init: function() { + this._super(); + this.set('context', this); + this.set('controller', this); + } +}); + +})(); + + + +(function() { + +})(); + + + +(function() { +/** +`Ember.ViewTargetActionSupport` is a mixin that can be included in a +view class to add a `triggerAction` method with semantics similar to +the Handlebars `{{action}}` helper. It provides intelligent defaults +for the action's target: the view's controller; and the context that is +sent with the action: the view's context. + +Note: In normal Ember usage, the `{{action}}` helper is usually the best +choice. This mixin is most often useful when you are doing more complex +event handling in custom View subclasses. + +For example: + +```javascript +App.SaveButtonView = Ember.View.extend(Ember.ViewTargetActionSupport, { + action: 'save', + click: function(){ + this.triggerAction(); // Sends the `save` action, along with the current context + // to the current controller + } +}); +``` + +The `action` can be provided as properties of an optional object argument +to `triggerAction` as well. + +```javascript +App.SaveButtonView = Ember.View.extend(Ember.ViewTargetActionSupport, { + click: function(){ + this.triggerAction({ + action: 'save' + }); // Sends the `save` action, along with the current context + // to the current controller + } +}); +``` + +@class ViewTargetActionSupport +@namespace Ember +@extends Ember.TargetActionSupport +*/ +Ember.ViewTargetActionSupport = Ember.Mixin.create(Ember.TargetActionSupport, { + /** + @property target + */ + target: Ember.computed.alias('controller'), + /** + @property actionContext + */ + actionContext: Ember.computed.alias('context') +}); + +})(); + + + +(function() { + +})(); + + + +(function() { +/** +Ember Views + +@module ember +@submodule ember-views +@requires ember-runtime +@main ember-views +*/ + +})(); + +(function() { +define("metamorph", + [], + function() { + "use strict"; + // ========================================================================== + // Project: metamorph + // Copyright: ©2011 My Company Inc. All rights reserved. + // ========================================================================== + + var K = function(){}, + guid = 0, + document = this.document, + + // Feature-detect the W3C range API, the extended check is for IE9 which only partially supports ranges + supportsRange = document && ('createRange' in document) && (typeof Range !== 'undefined') && Range.prototype.createContextualFragment, + + // Internet Explorer prior to 9 does not allow setting innerHTML if the first element + // is a "zero-scope" element. This problem can be worked around by making + // the first node an invisible text node. We, like Modernizr, use ­ + needsShy = document && (function(){ + var testEl = document.createElement('div'); + testEl.innerHTML = "
    "; + testEl.firstChild.innerHTML = ""; + return testEl.firstChild.innerHTML === ''; + })(), + + + // IE 8 (and likely earlier) likes to move whitespace preceeding + // a script tag to appear after it. This means that we can + // accidentally remove whitespace when updating a morph. + movesWhitespace = document && (function() { + var testEl = document.createElement('div'); + testEl.innerHTML = "Test: Value"; + return testEl.childNodes[0].nodeValue === 'Test:' && + testEl.childNodes[2].nodeValue === ' Value'; + })(); + + // Constructor that supports either Metamorph('foo') or new + // Metamorph('foo'); + // + // Takes a string of HTML as the argument. + + var Metamorph = function(html) { + var self; + + if (this instanceof Metamorph) { + self = this; + } else { + self = new K(); + } + + self.innerHTML = html; + var myGuid = 'metamorph-'+(guid++); + self.start = myGuid + '-start'; + self.end = myGuid + '-end'; + + return self; + }; + + K.prototype = Metamorph.prototype; + + var rangeFor, htmlFunc, removeFunc, outerHTMLFunc, appendToFunc, afterFunc, prependFunc, startTagFunc, endTagFunc; + + outerHTMLFunc = function() { + return this.startTag() + this.innerHTML + this.endTag(); + }; + + startTagFunc = function() { + /* + * We replace chevron by its hex code in order to prevent escaping problems. + * Check this thread for more explaination: + * http://stackoverflow.com/questions/8231048/why-use-x3c-instead-of-when-generating-html-from-javascript + */ + return "hi"; + * div.firstChild.firstChild.tagName //=> "" + * + * If our script markers are inside such a node, we need to find that + * node and use *it* as the marker. + **/ + var realNode = function(start) { + while (start.parentNode.tagName === "") { + start = start.parentNode; + } + + return start; + }; + + /** + * When automatically adding a tbody, Internet Explorer inserts the + * tbody immediately before the first . Other browsers create it + * before the first node, no matter what. + * + * This means the the following code: + * + * div = document.createElement("div"); + * div.innerHTML = "
    hi
    + * + * Generates the following DOM in IE: + * + * + div + * + table + * - script id='first' + * + tbody + * + tr + * + td + * - "hi" + * - script id='last' + * + * Which means that the two script tags, even though they were + * inserted at the same point in the hierarchy in the original + * HTML, now have different parents. + * + * This code reparents the first script tag by making it the tbody's + * first child. + **/ + var fixParentage = function(start, end) { + if (start.parentNode !== end.parentNode) { + end.parentNode.insertBefore(start, end.parentNode.firstChild); + } + }; + + htmlFunc = function(html, outerToo) { + // get the real starting node. see realNode for details. + var start = realNode(document.getElementById(this.start)); + var end = document.getElementById(this.end); + var parentNode = end.parentNode; + var node, nextSibling, last; + + // make sure that the start and end nodes share the same + // parent. If not, fix it. + fixParentage(start, end); + + // remove all of the nodes after the starting placeholder and + // before the ending placeholder. + node = start.nextSibling; + while (node) { + nextSibling = node.nextSibling; + last = node === end; + + // if this is the last node, and we want to remove it as well, + // set the `end` node to the next sibling. This is because + // for the rest of the function, we insert the new nodes + // before the end (note that insertBefore(node, null) is + // the same as appendChild(node)). + // + // if we do not want to remove it, just break. + if (last) { + if (outerToo) { end = node.nextSibling; } else { break; } + } + + node.parentNode.removeChild(node); + + // if this is the last node and we didn't break before + // (because we wanted to remove the outer nodes), break + // now. + if (last) { break; } + + node = nextSibling; + } + + // get the first node for the HTML string, even in cases like + // tables and lists where a simple innerHTML on a div would + // swallow some of the content. + node = firstNodeFor(start.parentNode, html); + + // copy the nodes for the HTML between the starting and ending + // placeholder. + while (node) { + nextSibling = node.nextSibling; + parentNode.insertBefore(node, end); + node = nextSibling; + } + }; + + // remove the nodes in the DOM representing this metamorph. + // + // this includes the starting and ending placeholders. + removeFunc = function() { + var start = realNode(document.getElementById(this.start)); + var end = document.getElementById(this.end); + + this.html(''); + start.parentNode.removeChild(start); + end.parentNode.removeChild(end); + }; + + appendToFunc = function(parentNode) { + var node = firstNodeFor(parentNode, this.outerHTML()); + var nextSibling; + + while (node) { + nextSibling = node.nextSibling; + parentNode.appendChild(node); + node = nextSibling; + } + }; + + afterFunc = function(html) { + // get the real starting node. see realNode for details. + var end = document.getElementById(this.end); + var insertBefore = end.nextSibling; + var parentNode = end.parentNode; + var nextSibling; + var node; + + // get the first node for the HTML string, even in cases like + // tables and lists where a simple innerHTML on a div would + // swallow some of the content. + node = firstNodeFor(parentNode, html); + + // copy the nodes for the HTML between the starting and ending + // placeholder. + while (node) { + nextSibling = node.nextSibling; + parentNode.insertBefore(node, insertBefore); + node = nextSibling; + } + }; + + prependFunc = function(html) { + var start = document.getElementById(this.start); + var parentNode = start.parentNode; + var nextSibling; + var node; + + node = firstNodeFor(parentNode, html); + var insertBefore = start.nextSibling; + + while (node) { + nextSibling = node.nextSibling; + parentNode.insertBefore(node, insertBefore); + node = nextSibling; + } + }; + } + + Metamorph.prototype.html = function(html) { + this.checkRemoved(); + if (html === undefined) { return this.innerHTML; } + + htmlFunc.call(this, html); + + this.innerHTML = html; + }; + + Metamorph.prototype.replaceWith = function(html) { + this.checkRemoved(); + htmlFunc.call(this, html, true); + }; + + Metamorph.prototype.remove = removeFunc; + Metamorph.prototype.outerHTML = outerHTMLFunc; + Metamorph.prototype.appendTo = appendToFunc; + Metamorph.prototype.after = afterFunc; + Metamorph.prototype.prepend = prependFunc; + Metamorph.prototype.startTag = startTagFunc; + Metamorph.prototype.endTag = endTagFunc; + + Metamorph.prototype.isRemoved = function() { + var before = document.getElementById(this.start); + var after = document.getElementById(this.end); + + return !before || !after; + }; + + Metamorph.prototype.checkRemoved = function() { + if (this.isRemoved()) { + throw new Error("Cannot perform operations on a Metamorph that is not in the DOM."); + } + }; + + return Metamorph; + }); + +})(); + +(function() { +/** +@module ember +@submodule ember-handlebars-compiler +*/ + +// Eliminate dependency on any Ember to simplify precompilation workflow +var objectCreate = Object.create || function(parent) { + function F() {} + F.prototype = parent; + return new F(); +}; + +var Handlebars = this.Handlebars || (Ember.imports && Ember.imports.Handlebars); +if(!Handlebars && typeof require === 'function') { + Handlebars = require('handlebars'); +} + +Ember.assert("Ember Handlebars requires Handlebars version 1.0.0-rc.4. Include a SCRIPT tag in the HTML HEAD linking to the Handlebars file before you link to Ember.", Handlebars) +Ember.assert("Ember Handlebars requires Handlebars version 1.0.0-rc.4, COMPILER_REVISION expected: 3, got: " + Handlebars.COMPILER_REVISION + " – Please note: Builds of master may have other COMPILER_REVISION values.", Handlebars.COMPILER_REVISION === 3); + +/** + Prepares the Handlebars templating library for use inside Ember's view + system. + + The `Ember.Handlebars` object is the standard Handlebars library, extended to + use Ember's `get()` method instead of direct property access, which allows + computed properties to be used inside templates. + + To create an `Ember.Handlebars` template, call `Ember.Handlebars.compile()`. + This will return a function that can be used by `Ember.View` for rendering. + + @class Handlebars + @namespace Ember +*/ +Ember.Handlebars = objectCreate(Handlebars); + +function makeBindings(options) { + var hash = options.hash, + hashType = options.hashTypes; + + for (var prop in hash) { + if (hashType[prop] === 'ID') { + hash[prop + 'Binding'] = hash[prop]; + hashType[prop + 'Binding'] = 'STRING'; + delete hash[prop]; + delete hashType[prop]; + } + } +} + +/** + Register a bound helper or custom view helper. + + ## Simple bound helper example + + ```javascript + Ember.Handlebars.helper('capitalize', function(value) { + return value.toUpperCase(); + }); + ``` + + The above bound helper can be used inside of templates as follows: + + ```handlebars + {{capitalize name}} + ``` + + In this case, when the `name` property of the template's context changes, + the rendered value of the helper will update to reflect this change. + + For more examples of bound helpers, see documentation for + `Ember.Handlebars.registerBoundHelper`. + + ## Custom view helper example + + Assuming a view subclass named `App.CalenderView` were defined, a helper + for rendering instances of this view could be registered as follows: + + ```javascript + Ember.Handlebars.helper('calendar', App.CalendarView): + ``` + + The above bound helper can be used inside of templates as follows: + + ```handlebars + {{calendar}} + ``` + + Which is functionally equivalent to: + + ```handlebars + {{view App.CalendarView}} + ``` + + Options in the helper will be passed to the view in exactly the same + manner as with the `view` helper. + + @method helper + @for Ember.Handlebars + @param {String} name + @param {Function|Ember.View} function or view class constructor + @param {String} dependentKeys* +*/ +Ember.Handlebars.helper = function(name, value) { + if (Ember.Component.detect(value)) { + Ember.assert("You tried to register a component named '" + name + "', but component names must include a '-'", name.match(/-/)); + + var proto = value.proto(); + if (!proto.layoutName && !proto.templateName) { + value.reopen({ + layoutName: 'components/' + name + }); + } + } + + if (Ember.View.detect(value)) { + Ember.Handlebars.registerHelper(name, function(options) { + Ember.assert("You can only pass attributes as parameters (not values) to a application-defined helper", arguments.length < 2); + makeBindings(options); + return Ember.Handlebars.helpers.view.call(this, value, options); + }); + } else { + Ember.Handlebars.registerBoundHelper.apply(null, arguments); + } +} + +/** +@class helpers +@namespace Ember.Handlebars +*/ +Ember.Handlebars.helpers = objectCreate(Handlebars.helpers); + +/** + Override the the opcode compiler and JavaScript compiler for Handlebars. + + @class Compiler + @namespace Ember.Handlebars + @private + @constructor +*/ +Ember.Handlebars.Compiler = function() {}; + +// Handlebars.Compiler doesn't exist in runtime-only +if (Handlebars.Compiler) { + Ember.Handlebars.Compiler.prototype = objectCreate(Handlebars.Compiler.prototype); +} + +Ember.Handlebars.Compiler.prototype.compiler = Ember.Handlebars.Compiler; + +/** + @class JavaScriptCompiler + @namespace Ember.Handlebars + @private + @constructor +*/ +Ember.Handlebars.JavaScriptCompiler = function() {}; + +// Handlebars.JavaScriptCompiler doesn't exist in runtime-only +if (Handlebars.JavaScriptCompiler) { + Ember.Handlebars.JavaScriptCompiler.prototype = objectCreate(Handlebars.JavaScriptCompiler.prototype); + Ember.Handlebars.JavaScriptCompiler.prototype.compiler = Ember.Handlebars.JavaScriptCompiler; +} + + +Ember.Handlebars.JavaScriptCompiler.prototype.namespace = "Ember.Handlebars"; + + +Ember.Handlebars.JavaScriptCompiler.prototype.initializeBuffer = function() { + return "''"; +}; + +/** + @private + + Override the default buffer for Ember Handlebars. By default, Handlebars + creates an empty String at the beginning of each invocation and appends to + it. Ember's Handlebars overrides this to append to a single shared buffer. + + @method appendToBuffer + @param string {String} +*/ +Ember.Handlebars.JavaScriptCompiler.prototype.appendToBuffer = function(string) { + return "data.buffer.push("+string+");"; +}; + +var prefix = "ember" + (+new Date()), incr = 1; + +/** + @private + + Rewrite simple mustaches from `{{foo}}` to `{{bind "foo"}}`. This means that + all simple mustaches in Ember's Handlebars will also set up an observer to + keep the DOM up to date when the underlying property changes. + + @method mustache + @for Ember.Handlebars.Compiler + @param mustache +*/ +Ember.Handlebars.Compiler.prototype.mustache = function(mustache) { + if (mustache.isHelper && mustache.id.string === 'control') { + mustache.hash = mustache.hash || new Handlebars.AST.HashNode([]); + mustache.hash.pairs.push(["controlID", new Handlebars.AST.StringNode(prefix + incr++)]); + } else if (mustache.params.length || mustache.hash) { + // no changes required + } else { + var id = new Handlebars.AST.IdNode(['_triageMustache']); + + // Update the mustache node to include a hash value indicating whether the original node + // was escaped. This will allow us to properly escape values when the underlying value + // changes and we need to re-render the value. + if(!mustache.escaped) { + mustache.hash = mustache.hash || new Handlebars.AST.HashNode([]); + mustache.hash.pairs.push(["unescaped", new Handlebars.AST.StringNode("true")]); + } + mustache = new Handlebars.AST.MustacheNode([id].concat([mustache.id]), mustache.hash, !mustache.escaped); + } + + return Handlebars.Compiler.prototype.mustache.call(this, mustache); +}; + +/** + Used for precompilation of Ember Handlebars templates. This will not be used + during normal app execution. + + @method precompile + @for Ember.Handlebars + @static + @param {String} string The template to precompile +*/ +Ember.Handlebars.precompile = function(string) { + var ast = Handlebars.parse(string); + + var options = { + knownHelpers: { + action: true, + unbound: true, + bindAttr: true, + template: true, + view: true, + _triageMustache: true + }, + data: true, + stringParams: true + }; + + var environment = new Ember.Handlebars.Compiler().compile(ast, options); + return new Ember.Handlebars.JavaScriptCompiler().compile(environment, options, undefined, true); +}; + +// We don't support this for Handlebars runtime-only +if (Handlebars.compile) { + /** + The entry point for Ember Handlebars. This replaces the default + `Handlebars.compile` and turns on template-local data and String + parameters. + + @method compile + @for Ember.Handlebars + @static + @param {String} string The template to compile + @return {Function} + */ + Ember.Handlebars.compile = function(string) { + var ast = Handlebars.parse(string); + var options = { data: true, stringParams: true }; + var environment = new Ember.Handlebars.Compiler().compile(ast, options); + var templateSpec = new Ember.Handlebars.JavaScriptCompiler().compile(environment, options, undefined, true); + + return Ember.Handlebars.template(templateSpec); + }; +} + + +})(); + +(function() { +var slice = Array.prototype.slice; + +/** + @private + + If a path starts with a reserved keyword, returns the root + that should be used. + + @method normalizePath + @for Ember + @param root {Object} + @param path {String} + @param data {Hash} +*/ +var normalizePath = Ember.Handlebars.normalizePath = function(root, path, data) { + var keywords = (data && data.keywords) || {}, + keyword, isKeyword; + + // Get the first segment of the path. For example, if the + // path is "foo.bar.baz", returns "foo". + keyword = path.split('.', 1)[0]; + + // Test to see if the first path is a keyword that has been + // passed along in the view's data hash. If so, we will treat + // that object as the new root. + if (keywords.hasOwnProperty(keyword)) { + // Look up the value in the template's data hash. + root = keywords[keyword]; + isKeyword = true; + + // Handle cases where the entire path is the reserved + // word. In that case, return the object itself. + if (path === keyword) { + path = ''; + } else { + // Strip the keyword from the path and look up + // the remainder from the newly found root. + path = path.substr(keyword.length+1); + } + } + + return { root: root, path: path, isKeyword: isKeyword }; +}; + + +/** + Lookup both on root and on window. If the path starts with + a keyword, the corresponding object will be looked up in the + template's data hash and used to resolve the path. + + @method get + @for Ember.Handlebars + @param {Object} root The object to look up the property on + @param {String} path The path to be lookedup + @param {Object} options The template's option hash +*/ +var handlebarsGet = Ember.Handlebars.get = function(root, path, options) { + var data = options && options.data, + normalizedPath = normalizePath(root, path, data), + value; + + // In cases where the path begins with a keyword, change the + // root to the value represented by that keyword, and ensure + // the path is relative to it. + root = normalizedPath.root; + path = normalizedPath.path; + + value = Ember.get(root, path); + + // If the path starts with a capital letter, look it up on Ember.lookup, + // which defaults to the `window` object in browsers. + if (value === undefined && root !== Ember.lookup && Ember.isGlobalPath(path)) { + value = Ember.get(Ember.lookup, path); + } + return value; +}; +Ember.Handlebars.getPath = Ember.deprecateFunc('`Ember.Handlebars.getPath` has been changed to `Ember.Handlebars.get` for consistency.', Ember.Handlebars.get); + +Ember.Handlebars.resolveParams = function(context, params, options) { + var resolvedParams = [], types = options.types, param, type; + + for (var i=0, l=params.length; i + ``` + + The above handlebars template will fill the ``'s `src` attribute will + the value of the property referenced with `"imageUrl"` and its `alt` + attribute with the value of the property referenced with `"imageTitle"`. + + If the rendering context of this template is the following object: + + ```javascript + { + imageUrl: 'http://lolcats.info/haz-a-funny', + imageTitle: 'A humorous image of a cat' + } + ``` + + The resulting HTML output will be: + + ```html + A humorous image of a cat + ``` + + `bindAttr` cannot redeclare existing DOM element attributes. The use of `src` + in the following `bindAttr` example will be ignored and the hard coded value + of `src="/failwhale.gif"` will take precedence: + + ```handlebars + imageTitle + ``` + + ### `bindAttr` and the `class` attribute + + `bindAttr` supports a special syntax for handling a number of cases unique + to the `class` DOM element attribute. The `class` attribute combines + multiple discreet values into a single attribute as a space-delimited + list of strings. Each string can be: + + * a string return value of an object's property. + * a boolean return value of an object's property + * a hard-coded value + + A string return value works identically to other uses of `bindAttr`. The + return value of the property will become the value of the attribute. For + example, the following view and template: + + ```javascript + AView = Ember.View.extend({ + someProperty: function(){ + return "aValue"; + }.property() + }) + ``` + + ```handlebars + + ``` + + A boolean return value will insert a specified class name if the property + returns `true` and remove the class name if the property returns `false`. + + A class name is provided via the syntax + `somePropertyName:class-name-if-true`. + + ```javascript + AView = Ember.View.extend({ + someBool: true + }) + ``` + + ```handlebars + + ``` + + Result in the following rendered output: + + ```html + + ``` + + An additional section of the binding can be provided if you want to + replace the existing class instead of removing it when the boolean + value changes: + + ```handlebars + + ``` + + A hard-coded value can be used by prepending `:` to the desired + class name: `:class-name-to-always-apply`. + + ```handlebars + + ``` + + Results in the following rendered output: + + ```html + + ``` + + All three strategies - string return value, boolean return value, and + hard-coded value – can be combined in a single declaration: + + ```handlebars + + ``` + + @method bindAttr + @for Ember.Handlebars.helpers + @param {Hash} options + @return {String} HTML string +*/ +EmberHandlebars.registerHelper('bindAttr', function(options) { + + var attrs = options.hash; + + Ember.assert("You must specify at least one hash argument to bindAttr", !!Ember.keys(attrs).length); + + var view = options.data.view; + var ret = []; + var ctx = this; + + // Generate a unique id for this element. This will be added as a + // data attribute to the element so it can be looked up when + // the bound property changes. + var dataId = ++Ember.uuid; + + // Handle classes differently, as we can bind multiple classes + var classBindings = attrs['class']; + if (classBindings != null) { + var classResults = EmberHandlebars.bindClasses(this, classBindings, view, dataId, options); + + ret.push('class="' + Handlebars.Utils.escapeExpression(classResults.join(' ')) + '"'); + delete attrs['class']; + } + + var attrKeys = Ember.keys(attrs); + + // For each attribute passed, create an observer and emit the + // current value of the property as an attribute. + forEach.call(attrKeys, function(attr) { + var path = attrs[attr], + normalized; + + Ember.assert(fmt("You must provide a String for a bound attribute, not %@", [path]), typeof path === 'string'); + + normalized = normalizePath(ctx, path, options.data); + + var value = (path === 'this') ? normalized.root : handlebarsGet(ctx, path, options), + type = Ember.typeOf(value); + + Ember.assert(fmt("Attributes must be numbers, strings or booleans, not %@", [value]), value === null || value === undefined || type === 'number' || type === 'string' || type === 'boolean'); + + var observer, invoker; + + observer = function observer() { + var result = handlebarsGet(ctx, path, options); + + Ember.assert(fmt("Attributes must be numbers, strings or booleans, not %@", [result]), result === null || result === undefined || typeof result === 'number' || typeof result === 'string' || typeof result === 'boolean'); + + var elem = view.$("[data-bindattr-" + dataId + "='" + dataId + "']"); + + // If we aren't able to find the element, it means the element + // to which we were bound has been removed from the view. + // In that case, we can assume the template has been re-rendered + // and we need to clean up the observer. + if (!elem || elem.length === 0) { + Ember.removeObserver(normalized.root, normalized.path, invoker); + return; + } + + Ember.View.applyAttributeBindings(elem, attr, result); + }; + + // Add an observer to the view for when the property changes. + // When the observer fires, find the element using the + // unique data id and update the attribute to the new value. + // Note: don't add observer when path is 'this' or path + // is whole keyword e.g. {{#each x in list}} ... {{bindAttr attr="x"}} + if (path !== 'this' && !(normalized.isKeyword && normalized.path === '' )) { + view.registerObserver(normalized.root, normalized.path, observer); + } + + // if this changes, also change the logic in ember-views/lib/views/view.js + if ((type === 'string' || (type === 'number' && !isNaN(value)))) { + ret.push(attr + '="' + Handlebars.Utils.escapeExpression(value) + '"'); + } else if (value && type === 'boolean') { + // The developer controls the attr name, so it should always be safe + ret.push(attr + '="' + attr + '"'); + } + }, this); + + // Add the unique identifier + // NOTE: We use all lower-case since Firefox has problems with mixed case in SVG + ret.push('data-bindattr-' + dataId + '="' + dataId + '"'); + return new EmberHandlebars.SafeString(ret.join(' ')); +}); + +/** + @private + + Helper that, given a space-separated string of property paths and a context, + returns an array of class names. Calling this method also has the side + effect of setting up observers at those property paths, such that if they + change, the correct class name will be reapplied to the DOM element. + + For example, if you pass the string "fooBar", it will first look up the + "fooBar" value of the context. If that value is true, it will add the + "foo-bar" class to the current element (i.e., the dasherized form of + "fooBar"). If the value is a string, it will add that string as the class. + Otherwise, it will not add any new class name. + + @method bindClasses + @for Ember.Handlebars + @param {Ember.Object} context The context from which to lookup properties + @param {String} classBindings A string, space-separated, of class bindings + to use + @param {Ember.View} view The view in which observers should look for the + element to update + @param {Srting} bindAttrId Optional bindAttr id used to lookup elements + @return {Array} An array of class names to add +*/ +EmberHandlebars.bindClasses = function(context, classBindings, view, bindAttrId, options) { + var ret = [], newClass, value, elem; + + // Helper method to retrieve the property from the context and + // determine which class string to return, based on whether it is + // a Boolean or not. + var classStringForPath = function(root, parsedPath, options) { + var val, + path = parsedPath.path; + + if (path === 'this') { + val = root; + } else if (path === '') { + val = true; + } else { + val = handlebarsGet(root, path, options); + } + + return Ember.View._classStringForValue(path, val, parsedPath.className, parsedPath.falsyClassName); + }; + + // For each property passed, loop through and setup + // an observer. + forEach.call(classBindings.split(' '), function(binding) { + + // Variable in which the old class value is saved. The observer function + // closes over this variable, so it knows which string to remove when + // the property changes. + var oldClass; + + var observer, invoker; + + var parsedPath = Ember.View._parsePropertyPath(binding), + path = parsedPath.path, + pathRoot = context, + normalized; + + if (path !== '' && path !== 'this') { + normalized = normalizePath(context, path, options.data); + + pathRoot = normalized.root; + path = normalized.path; + } + + // Set up an observer on the context. If the property changes, toggle the + // class name. + observer = function() { + // Get the current value of the property + newClass = classStringForPath(context, parsedPath, options); + elem = bindAttrId ? view.$("[data-bindattr-" + bindAttrId + "='" + bindAttrId + "']") : view.$(); + + // If we can't find the element anymore, a parent template has been + // re-rendered and we've been nuked. Remove the observer. + if (!elem || elem.length === 0) { + Ember.removeObserver(pathRoot, path, invoker); + } else { + // If we had previously added a class to the element, remove it. + if (oldClass) { + elem.removeClass(oldClass); + } + + // If necessary, add a new class. Make sure we keep track of it so + // it can be removed in the future. + if (newClass) { + elem.addClass(newClass); + oldClass = newClass; + } else { + oldClass = null; + } + } + }; + + if (path !== '' && path !== 'this') { + view.registerObserver(pathRoot, path, observer); + } + + // We've already setup the observer; now we just need to figure out the + // correct behavior right now on the first pass through. + value = classStringForPath(context, parsedPath, options); + + if (value) { + ret.push(value); + + // Make sure we save the current value so that it can be removed if the + // observer fires. + oldClass = value; + } + }); + + return ret; +}; + + +})(); + + + +(function() { +/*globals Handlebars */ + +// TODO: Don't require the entire module +/** +@module ember +@submodule ember-handlebars +*/ + +var get = Ember.get, set = Ember.set; +var EmberHandlebars = Ember.Handlebars; + +EmberHandlebars.ViewHelper = Ember.Object.create({ + + propertiesFromHTMLOptions: function(options, thisContext) { + var hash = options.hash, data = options.data; + var extensions = {}, + classes = hash['class'], + dup = false; + + if (hash.id) { + extensions.elementId = hash.id; + dup = true; + } + + if (hash.tag) { + extensions.tagName = hash.tag; + dup = true; + } + + if (classes) { + classes = classes.split(' '); + extensions.classNames = classes; + dup = true; + } + + if (hash.classBinding) { + extensions.classNameBindings = hash.classBinding.split(' '); + dup = true; + } + + if (hash.classNameBindings) { + if (extensions.classNameBindings === undefined) extensions.classNameBindings = []; + extensions.classNameBindings = extensions.classNameBindings.concat(hash.classNameBindings.split(' ')); + dup = true; + } + + if (hash.attributeBindings) { + Ember.assert("Setting 'attributeBindings' via Handlebars is not allowed. Please subclass Ember.View and set it there instead."); + extensions.attributeBindings = null; + dup = true; + } + + if (dup) { + hash = Ember.$.extend({}, hash); + delete hash.id; + delete hash.tag; + delete hash['class']; + delete hash.classBinding; + } + + // Set the proper context for all bindings passed to the helper. This applies to regular attribute bindings + // as well as class name bindings. If the bindings are local, make them relative to the current context + // instead of the view. + var path; + + // Evaluate the context of regular attribute bindings: + for (var prop in hash) { + if (!hash.hasOwnProperty(prop)) { continue; } + + // Test if the property ends in "Binding" + if (Ember.IS_BINDING.test(prop) && typeof hash[prop] === 'string') { + path = this.contextualizeBindingPath(hash[prop], data); + if (path) { hash[prop] = path; } + } + } + + // Evaluate the context of class name bindings: + if (extensions.classNameBindings) { + for (var b in extensions.classNameBindings) { + var full = extensions.classNameBindings[b]; + if (typeof full === 'string') { + // Contextualize the path of classNameBinding so this: + // + // classNameBinding="isGreen:green" + // + // is converted to this: + // + // classNameBinding="_parentView.context.isGreen:green" + var parsedPath = Ember.View._parsePropertyPath(full); + path = this.contextualizeBindingPath(parsedPath.path, data); + if (path) { extensions.classNameBindings[b] = path + parsedPath.classNames; } + } + } + } + + return Ember.$.extend(hash, extensions); + }, + + // Transform bindings from the current context to a context that can be evaluated within the view. + // Returns null if the path shouldn't be changed. + // + // TODO: consider the addition of a prefix that would allow this method to return `path`. + contextualizeBindingPath: function(path, data) { + var normalized = Ember.Handlebars.normalizePath(null, path, data); + if (normalized.isKeyword) { + return 'templateData.keywords.' + path; + } else if (Ember.isGlobalPath(path)) { + return null; + } else if (path === 'this') { + return '_parentView.context'; + } else { + return '_parentView.context.' + path; + } + }, + + helper: function(thisContext, path, options) { + var data = options.data, + fn = options.fn, + newView; + + if ('string' === typeof path) { + newView = EmberHandlebars.get(thisContext, path, options); + Ember.assert("Unable to find view at path '" + path + "'", !!newView); + } else { + newView = path; + } + + Ember.assert(Ember.String.fmt('You must pass a view to the #view helper, not %@ (%@)', [path, newView]), Ember.View.detect(newView) || Ember.View.detectInstance(newView)); + + var viewOptions = this.propertiesFromHTMLOptions(options, thisContext); + var currentView = data.view; + viewOptions.templateData = data; + var newViewProto = newView.proto ? newView.proto() : newView; + + if (fn) { + Ember.assert("You cannot provide a template block if you also specified a templateName", !get(viewOptions, 'templateName') && !get(newViewProto, 'templateName')); + viewOptions.template = fn; + } + + // We only want to override the `_context` computed property if there is + // no specified controller. See View#_context for more information. + if (!newViewProto.controller && !newViewProto.controllerBinding && !viewOptions.controller && !viewOptions.controllerBinding) { + viewOptions._context = thisContext; + } + + currentView.appendChild(newView, viewOptions); + } +}); + +/** + `{{view}}` inserts a new instance of `Ember.View` into a template passing its + options to the `Ember.View`'s `create` method and using the supplied block as + the view's own template. + + An empty `` and the following template: + + ```handlebars + A span: + {{#view tagName="span"}} + hello. + {{/view}} + ``` + + Will result in HTML structure: + + ```html + + + +
    + A span: + + Hello. + +
    + + ``` + + ### `parentView` setting + + The `parentView` property of the new `Ember.View` instance created through + `{{view}}` will be set to the `Ember.View` instance of the template where + `{{view}}` was called. + + ```javascript + aView = Ember.View.create({ + template: Ember.Handlebars.compile("{{#view}} my parent: {{parentView.elementId}} {{/view}}") + }); + + aView.appendTo('body'); + ``` + + Will result in HTML structure: + + ```html +
    +
    + my parent: ember1 +
    +
    + ``` + + ### Setting CSS id and class attributes + + The HTML `id` attribute can be set on the `{{view}}`'s resulting element with + the `id` option. This option will _not_ be passed to `Ember.View.create`. + + ```handlebars + {{#view tagName="span" id="a-custom-id"}} + hello. + {{/view}} + ``` + + Results in the following HTML structure: + + ```html +
    + + hello. + +
    + ``` + + The HTML `class` attribute can be set on the `{{view}}`'s resulting element + with the `class` or `classNameBindings` options. The `class` option will + directly set the CSS `class` attribute and will not be passed to + `Ember.View.create`. `classNameBindings` will be passed to `create` and use + `Ember.View`'s class name binding functionality: + + ```handlebars + {{#view tagName="span" class="a-custom-class"}} + hello. + {{/view}} + ``` + + Results in the following HTML structure: + + ```html +
    + + hello. + +
    + ``` + + ### Supplying a different view class + + `{{view}}` can take an optional first argument before its supplied options to + specify a path to a custom view class. + + ```handlebars + {{#view "MyApp.CustomView"}} + hello. + {{/view}} + ``` + + The first argument can also be a relative path accessible from the current + context. + + ```javascript + MyApp = Ember.Application.create({}); + MyApp.OuterView = Ember.View.extend({ + innerViewClass: Ember.View.extend({ + classNames: ['a-custom-view-class-as-property'] + }), + template: Ember.Handlebars.compile('{{#view "view.innerViewClass"}} hi {{/view}}') + }); + + MyApp.OuterView.create().appendTo('body'); + ``` + + Will result in the following HTML: + + ```html +
    +
    + hi +
    +
    + ``` + + ### Blockless use + + If you supply a custom `Ember.View` subclass that specifies its own template + or provide a `templateName` option to `{{view}}` it can be used without + supplying a block. Attempts to use both a `templateName` option and supply a + block will throw an error. + + ```handlebars + {{view "MyApp.ViewWithATemplateDefined"}} + ``` + + ### `viewName` property + + You can supply a `viewName` option to `{{view}}`. The `Ember.View` instance + will be referenced as a property of its parent view by this name. + + ```javascript + aView = Ember.View.create({ + template: Ember.Handlebars.compile('{{#view viewName="aChildByName"}} hi {{/view}}') + }); + + aView.appendTo('body'); + aView.get('aChildByName') // the instance of Ember.View created by {{view}} helper + ``` + + @method view + @for Ember.Handlebars.helpers + @param {String} path + @param {Hash} options + @return {String} HTML string +*/ +EmberHandlebars.registerHelper('view', function(path, options) { + Ember.assert("The view helper only takes a single argument", arguments.length <= 2); + + // If no path is provided, treat path param as options. + if (path && path.data && path.data.isRenderData) { + options = path; + path = "Ember.View"; + } + + return EmberHandlebars.ViewHelper.helper(this, path, options); +}); + + +})(); + + + +(function() { +/*globals Handlebars */ + +// TODO: Don't require all of this module +/** +@module ember +@submodule ember-handlebars +*/ + +var get = Ember.get, handlebarsGet = Ember.Handlebars.get, fmt = Ember.String.fmt; + +/** + `{{collection}}` is a `Ember.Handlebars` helper for adding instances of + `Ember.CollectionView` to a template. See `Ember.CollectionView` for + additional information on how a `CollectionView` functions. + + `{{collection}}`'s primary use is as a block helper with a `contentBinding` + option pointing towards an `Ember.Array`-compatible object. An `Ember.View` + instance will be created for each item in its `content` property. Each view + will have its own `content` property set to the appropriate item in the + collection. + + The provided block will be applied as the template for each item's view. + + Given an empty `` the following template: + + ```handlebars + {{#collection contentBinding="App.items"}} + Hi {{view.content.name}} + {{/collection}} + ``` + + And the following application code + + ```javascript + App = Ember.Application.create() + App.items = [ + Ember.Object.create({name: 'Dave'}), + Ember.Object.create({name: 'Mary'}), + Ember.Object.create({name: 'Sara'}) + ] + ``` + + Will result in the HTML structure below + + ```html +
    +
    Hi Dave
    +
    Hi Mary
    +
    Hi Sara
    +
    + ``` + + ### Blockless Use + + If you provide an `itemViewClass` option that has its own `template` you can + omit the block. + + The following template: + + ```handlebars + {{collection contentBinding="App.items" itemViewClass="App.AnItemView"}} + ``` + + And application code + + ```javascript + App = Ember.Application.create(); + App.items = [ + Ember.Object.create({name: 'Dave'}), + Ember.Object.create({name: 'Mary'}), + Ember.Object.create({name: 'Sara'}) + ]; + + App.AnItemView = Ember.View.extend({ + template: Ember.Handlebars.compile("Greetings {{view.content.name}}") + }); + ``` + + Will result in the HTML structure below + + ```html +
    +
    Greetings Dave
    +
    Greetings Mary
    +
    Greetings Sara
    +
    + ``` + + ### Specifying a CollectionView subclass + + By default the `{{collection}}` helper will create an instance of + `Ember.CollectionView`. You can supply a `Ember.CollectionView` subclass to + the helper by passing it as the first argument: + + ```handlebars + {{#collection App.MyCustomCollectionClass contentBinding="App.items"}} + Hi {{view.content.name}} + {{/collection}} + ``` + + ### Forwarded `item.*`-named Options + + As with the `{{view}}`, helper options passed to the `{{collection}}` will be + set on the resulting `Ember.CollectionView` as properties. Additionally, + options prefixed with `item` will be applied to the views rendered for each + item (note the camelcasing): + + ```handlebars + {{#collection contentBinding="App.items" + itemTagName="p" + itemClassNames="greeting"}} + Howdy {{view.content.name}} + {{/collection}} + ``` + + Will result in the following HTML structure: + + ```html +
    +

    Howdy Dave

    +

    Howdy Mary

    +

    Howdy Sara

    +
    + ``` + + @method collection + @for Ember.Handlebars.helpers + @param {String} path + @param {Hash} options + @return {String} HTML string + @deprecated Use `{{each}}` helper instead. +*/ +Ember.Handlebars.registerHelper('collection', function(path, options) { + Ember.deprecate("Using the {{collection}} helper without specifying a class has been deprecated as the {{each}} helper now supports the same functionality.", path !== 'collection'); + + // If no path is provided, treat path param as options. + if (path && path.data && path.data.isRenderData) { + options = path; + path = undefined; + Ember.assert("You cannot pass more than one argument to the collection helper", arguments.length === 1); + } else { + Ember.assert("You cannot pass more than one argument to the collection helper", arguments.length === 2); + } + + var fn = options.fn; + var data = options.data; + var inverse = options.inverse; + var view = options.data.view; + + // If passed a path string, convert that into an object. + // Otherwise, just default to the standard class. + var collectionClass; + collectionClass = path ? handlebarsGet(this, path, options) : Ember.CollectionView; + Ember.assert(fmt("%@ #collection: Could not find collection class %@", [data.view, path]), !!collectionClass); + + var hash = options.hash, itemHash = {}, match; + + // Extract item view class if provided else default to the standard class + var itemViewClass, itemViewPath = hash.itemViewClass; + var collectionPrototype = collectionClass.proto(); + delete hash.itemViewClass; + itemViewClass = itemViewPath ? handlebarsGet(collectionPrototype, itemViewPath, options) : collectionPrototype.itemViewClass; + Ember.assert(fmt("%@ #collection: Could not find itemViewClass %@", [data.view, itemViewPath]), !!itemViewClass); + + // Go through options passed to the {{collection}} helper and extract options + // that configure item views instead of the collection itself. + for (var prop in hash) { + if (hash.hasOwnProperty(prop)) { + match = prop.match(/^item(.)(.*)$/); + + if(match && prop !== 'itemController') { + // Convert itemShouldFoo -> shouldFoo + itemHash[match[1].toLowerCase() + match[2]] = hash[prop]; + // Delete from hash as this will end up getting passed to the + // {{view}} helper method. + delete hash[prop]; + } + } + } + + if (fn) { + itemHash.template = fn; + delete options.fn; + } + + var emptyViewClass; + if (inverse && inverse !== Handlebars.VM.noop) { + emptyViewClass = get(collectionPrototype, 'emptyViewClass'); + emptyViewClass = emptyViewClass.extend({ + template: inverse, + tagName: itemHash.tagName + }); + } else if (hash.emptyViewClass) { + emptyViewClass = handlebarsGet(this, hash.emptyViewClass, options); + } + if (emptyViewClass) { hash.emptyView = emptyViewClass; } + + if(!hash.keyword){ + itemHash._context = Ember.computed.alias('content'); + } + + var viewOptions = Ember.Handlebars.ViewHelper.propertiesFromHTMLOptions({ data: data, hash: itemHash }, this); + hash.itemViewClass = itemViewClass.extend(viewOptions); + + return Ember.Handlebars.helpers.view.call(this, collectionClass, options); +}); + + +})(); + + + +(function() { +/*globals Handlebars */ +/** +@module ember +@submodule ember-handlebars +*/ + +var handlebarsGet = Ember.Handlebars.get; + +/** + `unbound` allows you to output a property without binding. *Important:* The + output will not be updated if the property changes. Use with caution. + + ```handlebars +
    {{unbound somePropertyThatDoesntChange}}
    + ``` + + `unbound` can also be used in conjunction with a bound helper to + render it in its unbound form: + + ```handlebars +
    {{unbound helperName somePropertyThatDoesntChange}}
    + ``` + + @method unbound + @for Ember.Handlebars.helpers + @param {String} property + @return {String} HTML string +*/ +Ember.Handlebars.registerHelper('unbound', function(property, fn) { + var options = arguments[arguments.length - 1], helper, context, out; + + if(arguments.length > 2) { + // Unbound helper call. + options.data.isUnbound = true; + helper = Ember.Handlebars.helpers[arguments[0]] || Ember.Handlebars.helperMissing; + out = helper.apply(this, Array.prototype.slice.call(arguments, 1)); + delete options.data.isUnbound; + return out; + } + + context = (fn.contexts && fn.contexts[0]) || this; + return handlebarsGet(context, property, fn); +}); + +})(); + + + +(function() { +/*jshint debug:true*/ +/** +@module ember +@submodule ember-handlebars +*/ + +var handlebarsGet = Ember.Handlebars.get, normalizePath = Ember.Handlebars.normalizePath; + +/** + `log` allows you to output the value of a value in the current rendering + context. + + ```handlebars + {{log myVariable}} + ``` + + @method log + @for Ember.Handlebars.helpers + @param {String} property +*/ +Ember.Handlebars.registerHelper('log', function(property, options) { + var context = (options.contexts && options.contexts[0]) || this, + normalized = normalizePath(context, property, options.data), + pathRoot = normalized.root, + path = normalized.path, + value = (path === 'this') ? pathRoot : handlebarsGet(pathRoot, path, options); + Ember.Logger.log(value); +}); + +/** + Execute the `debugger` statement in the current context. + + ```handlebars + {{debugger}} + ``` + + @method debugger + @for Ember.Handlebars.helpers + @param {String} property +*/ +Ember.Handlebars.registerHelper('debugger', function() { + debugger; +}); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-handlebars +*/ + +var get = Ember.get, set = Ember.set; + +Ember.Handlebars.EachView = Ember.CollectionView.extend(Ember._Metamorph, { + init: function() { + var itemController = get(this, 'itemController'); + var binding; + + if (itemController) { + var controller = Ember.ArrayController.create(); + set(controller, 'itemController', itemController); + set(controller, 'container', get(this, 'controller.container')); + set(controller, '_eachView', this); + set(controller, 'target', get(this, 'controller')); + set(controller, 'parentController', get(this, 'controller')); + + this.disableContentObservers(function() { + set(this, 'content', controller); + binding = new Ember.Binding('content', '_eachView.dataSource').oneWay(); + binding.connect(controller); + }); + + set(this, '_arrayController', controller); + } else { + this.disableContentObservers(function() { + binding = new Ember.Binding('content', 'dataSource').oneWay(); + binding.connect(this); + }); + } + + return this._super(); + }, + + disableContentObservers: function(callback) { + Ember.removeBeforeObserver(this, 'content', null, '_contentWillChange'); + Ember.removeObserver(this, 'content', null, '_contentDidChange'); + + callback.call(this); + + Ember.addBeforeObserver(this, 'content', null, '_contentWillChange'); + Ember.addObserver(this, 'content', null, '_contentDidChange'); + }, + + itemViewClass: Ember._MetamorphView, + emptyViewClass: Ember._MetamorphView, + + createChildView: function(view, attrs) { + view = this._super(view, attrs); + + // At the moment, if a container view subclass wants + // to insert keywords, it is responsible for cloning + // the keywords hash. This will be fixed momentarily. + var keyword = get(this, 'keyword'); + var content = get(view, 'content'); + + if (keyword) { + var data = get(view, 'templateData'); + + data = Ember.copy(data); + data.keywords = view.cloneKeywords(); + set(view, 'templateData', data); + + // In this case, we do not bind, because the `content` of + // a #each item cannot change. + data.keywords[keyword] = content; + } + + // If {{#each}} is looping over an array of controllers, + // point each child view at their respective controller. + if (content && get(content, 'isController')) { + set(view, 'controller', content); + } + + return view; + }, + + destroy: function() { + if (!this._super()) { return; } + + var arrayController = get(this, '_arrayController'); + + if (arrayController) { + arrayController.destroy(); + } + + return this; + } +}); + +var GroupedEach = Ember.Handlebars.GroupedEach = function(context, path, options) { + var self = this, + normalized = Ember.Handlebars.normalizePath(context, path, options.data); + + this.context = context; + this.path = path; + this.options = options; + this.template = options.fn; + this.containingView = options.data.view; + this.normalizedRoot = normalized.root; + this.normalizedPath = normalized.path; + this.content = this.lookupContent(); + + this.addContentObservers(); + this.addArrayObservers(); + + this.containingView.on('willClearRender', function() { + self.destroy(); + }); +}; + +GroupedEach.prototype = { + contentWillChange: function() { + this.removeArrayObservers(); + }, + + contentDidChange: function() { + this.content = this.lookupContent(); + this.addArrayObservers(); + this.rerenderContainingView(); + }, + + contentArrayWillChange: Ember.K, + + contentArrayDidChange: function() { + this.rerenderContainingView(); + }, + + lookupContent: function() { + return Ember.Handlebars.get(this.normalizedRoot, this.normalizedPath, this.options); + }, + + addArrayObservers: function() { + this.content.addArrayObserver(this, { + willChange: 'contentArrayWillChange', + didChange: 'contentArrayDidChange' + }); + }, + + removeArrayObservers: function() { + this.content.removeArrayObserver(this, { + willChange: 'contentArrayWillChange', + didChange: 'contentArrayDidChange' + }); + }, + + addContentObservers: function() { + Ember.addBeforeObserver(this.normalizedRoot, this.normalizedPath, this, this.contentWillChange); + Ember.addObserver(this.normalizedRoot, this.normalizedPath, this, this.contentDidChange); + }, + + removeContentObservers: function() { + Ember.removeBeforeObserver(this.normalizedRoot, this.normalizedPath, this.contentWillChange); + Ember.removeObserver(this.normalizedRoot, this.normalizedPath, this.contentDidChange); + }, + + render: function() { + var content = this.content, + contentLength = get(content, 'length'), + data = this.options.data, + template = this.template; + + data.insideEach = true; + for (var i = 0; i < contentLength; i++) { + template(content.objectAt(i), { data: data }); + } + }, + + rerenderContainingView: function() { + Ember.run.scheduleOnce('render', this.containingView, 'rerender'); + }, + + destroy: function() { + this.removeContentObservers(); + this.removeArrayObservers(); + } +}; + +/** + The `{{#each}}` helper loops over elements in a collection, rendering its + block once for each item. It is an extension of the base Handlebars `{{#each}}` + helper: + + ```javascript + Developers = [{name: 'Yehuda'},{name: 'Tom'}, {name: 'Paul'}]; + ``` + + ```handlebars + {{#each Developers}} + {{name}} + {{/each}} + ``` + + `{{each}}` supports an alternative syntax with element naming: + + ```handlebars + {{#each person in Developers}} + {{person.name}} + {{/each}} + ``` + + When looping over objects that do not have properties, `{{this}}` can be used + to render the object: + + ```javascript + DeveloperNames = ['Yehuda', 'Tom', 'Paul'] + ``` + + ```handlebars + {{#each DeveloperNames}} + {{this}} + {{/each}} + ``` + ### {{else}} condition + `{{#each}}` can have a matching `{{else}}`. The contents of this block will render + if the collection is empty. + + ``` + {{#each person in Developers}} + {{person.name}} + {{else}} +

    Sorry, nobody is available for this task.

    + {{/each}} + ``` + ### Specifying a View class for items + If you provide an `itemViewClass` option that references a view class + with its own `template` you can omit the block. + + The following template: + + ```handlebars + {{#view App.MyView }} + {{each view.items itemViewClass="App.AnItemView"}} + {{/view}} + ``` + + And application code + + ```javascript + App = Ember.Application.create({ + MyView: Ember.View.extend({ + items: [ + Ember.Object.create({name: 'Dave'}), + Ember.Object.create({name: 'Mary'}), + Ember.Object.create({name: 'Sara'}) + ] + }) + }); + + App.AnItemView = Ember.View.extend({ + template: Ember.Handlebars.compile("Greetings {{name}}") + }); + ``` + + Will result in the HTML structure below + + ```html +
    +
    Greetings Dave
    +
    Greetings Mary
    +
    Greetings Sara
    +
    + ``` + + ### Representing each item with a Controller. + By default the controller lookup within an `{{#each}}` block will be + the controller of the template where the `{{#each}}` was used. If each + item needs to be presented by a custom controller you can provide a + `itemController` option which references a controller by lookup name. + Each item in the loop will be wrapped in an instance of this controller + and the item itself will be set to the `content` property of that controller. + + This is useful in cases where properties of model objects need transformation + or synthesis for display: + + ```javascript + App.DeveloperController = Ember.ObjectController.extend({ + isAvailableForHire: function(){ + return !this.get('content.isEmployed') && this.get('content.isSeekingWork'); + }.property('isEmployed', 'isSeekingWork') + }) + ``` + + ```handlebars + {{#each person in developers itemController="developer"}} + {{person.name}} {{#if person.isAvailableForHire}}Hire me!{{/if}} + {{/each}} + ``` + + Each itemController will receive a reference to the current controller as + a `parentController` property. + + @method each + @for Ember.Handlebars.helpers + @param [name] {String} name for item (used with `in`) + @param [path] {String} path + @param [options] {Object} Handlebars key/value pairs of options + @param [options.itemViewClass] {String} a path to a view class used for each item + @param [options.itemController] {String} name of a controller to be created for each item +*/ +Ember.Handlebars.registerHelper('each', function(path, options) { + if (arguments.length === 4) { + Ember.assert("If you pass more than one argument to the each helper, it must be in the form #each foo in bar", arguments[1] === "in"); + + var keywordName = arguments[0]; + + options = arguments[3]; + path = arguments[2]; + if (path === '') { path = "this"; } + + options.hash.keyword = keywordName; + } + + if (arguments.length === 1) { + options = path; + path = 'this'; + } + + options.hash.dataSourceBinding = path; + // Set up emptyView as a metamorph with no tag + //options.hash.emptyViewClass = Ember._MetamorphView; + + if (options.data.insideGroup && !options.hash.groupedRows && !options.hash.itemViewClass) { + new Ember.Handlebars.GroupedEach(this, path, options).render(); + } else { + return Ember.Handlebars.helpers.collection.call(this, 'Ember.Handlebars.EachView', options); + } +}); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-handlebars +*/ + +/** + `template` allows you to render a template from inside another template. + This allows you to re-use the same template in multiple places. For example: + + ```html + + ``` + + ```html + + ``` + + ```handlebars + {{#if isUser}} + {{template "user_info"}} + {{else}} + {{template "unlogged_user_info"}} + {{/if}} + ``` + + This helper looks for templates in the global `Ember.TEMPLATES` hash. If you + add ` + ``` + + The `data-template-name` attribute of a partial template + is prefixed with an underscore. + + ```html + + ``` + + @method partial + @for Ember.Handlebars.helpers + @param {String} partialName the name of the template to render minus the leading underscore +*/ + +Ember.Handlebars.registerHelper('partial', function(name, options) { + var nameParts = name.split("/"), + lastPart = nameParts[nameParts.length - 1]; + + nameParts[nameParts.length - 1] = "_" + lastPart; + + var view = options.data.view, + underscoredName = nameParts.join("/"), + template = view.templateForName(underscoredName), + deprecatedTemplate = !template && view.templateForName(name); + + Ember.deprecate("You tried to render the partial " + name + ", which should be at '" + underscoredName + "', but Ember found '" + name + "'. Please use a leading underscore in your partials", template); + Ember.assert("Unable to find partial with name '"+name+"'.", template || deprecatedTemplate); + + template = template || deprecatedTemplate; + + template(this, { data: options.data }); +}); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-handlebars +*/ + +var get = Ember.get, set = Ember.set; + +/** + When used in a Handlebars template that is assigned to an `Ember.View` + instance's `layout` property Ember will render the layout template first, + inserting the view's own rendered output at the `{{yield}}` location. + + An empty `` and the following application code: + + ```javascript + AView = Ember.View.extend({ + classNames: ['a-view-with-layout'], + layout: Ember.Handlebars.compile('
    {{yield}}
    '), + template: Ember.Handlebars.compile('I am wrapped') + }); + + aView = AView.create(); + aView.appendTo('body'); + ``` + + Will result in the following HTML output: + + ```html + +
    +
    + I am wrapped +
    +
    + + ``` + + The `yield` helper cannot be used outside of a template assigned to an + `Ember.View`'s `layout` property and will throw an error if attempted. + + ```javascript + BView = Ember.View.extend({ + classNames: ['a-view-with-layout'], + template: Ember.Handlebars.compile('{{yield}}') + }); + + bView = BView.create(); + bView.appendTo('body'); + + // throws + // Uncaught Error: assertion failed: You called yield in a template that was not a layout + ``` + + @method yield + @for Ember.Handlebars.helpers + @param {Hash} options + @return {String} HTML string +*/ +Ember.Handlebars.registerHelper('yield', function(options) { + var view = options.data.view, template; + + while (view && !get(view, 'layout')) { + view = get(view, 'parentView'); + } + + Ember.assert("You called yield in a template that was not a layout", !!view); + + template = get(view, 'template'); + + if (template) { template(this, options); } +}); + +})(); + + + +(function() { + +})(); + + + +(function() { + +})(); + + + +(function() { +/** +@module ember +@submodule ember-handlebars +*/ + +var set = Ember.set, get = Ember.get; + +/** + The `Ember.Checkbox` view class renders a checkbox + [input](https://developer.mozilla.org/en/HTML/Element/Input) element. It + allows for binding an Ember property (`checked`) to the status of the + checkbox. + + Example: + + ```handlebars + {{view Ember.Checkbox checkedBinding="receiveEmail"}} + ``` + + You can add a `label` tag yourself in the template where the `Ember.Checkbox` + is being used. + + ```handlebars + + ``` + + The `checked` attribute of an `Ember.Checkbox` object should always be set + through the Ember object or by interacting with its rendered element + representation via the mouse, keyboard, or touch. Updating the value of the + checkbox via jQuery will result in the checked value of the object and its + element losing synchronization. + + ## Layout and LayoutName properties + + Because HTML `input` elements are self closing `layout` and `layoutName` + properties will not be applied. See `Ember.View`'s layout section for more + information. + + @class Checkbox + @namespace Ember + @extends Ember.View +*/ +Ember.Checkbox = Ember.View.extend({ + classNames: ['ember-checkbox'], + + tagName: 'input', + + attributeBindings: ['type', 'checked', 'disabled', 'tabindex', 'name'], + + type: "checkbox", + checked: false, + disabled: false, + + init: function() { + this._super(); + this.on("change", this, this._updateElementValue); + }, + + _updateElementValue: function() { + set(this, 'checked', this.$().prop('checked')); + } +}); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-handlebars +*/ + +var get = Ember.get, set = Ember.set; + +/** + Shared mixin used by `Ember.TextField` and `Ember.TextArea`. + + @class TextSupport + @namespace Ember + @extends Ember.Mixin + @private +*/ +Ember.TextSupport = Ember.Mixin.create({ + value: "", + + attributeBindings: ['placeholder', 'disabled', 'maxlength', 'tabindex'], + placeholder: null, + disabled: false, + maxlength: null, + + insertNewline: Ember.K, + cancel: Ember.K, + + init: function() { + this._super(); + this.on("focusOut", this, this._elementValueDidChange); + this.on("change", this, this._elementValueDidChange); + this.on("paste", this, this._elementValueDidChange); + this.on("cut", this, this._elementValueDidChange); + this.on("input", this, this._elementValueDidChange); + this.on("keyUp", this, this.interpretKeyEvents); + }, + + interpretKeyEvents: function(event) { + var map = Ember.TextSupport.KEY_EVENTS; + var method = map[event.keyCode]; + + this._elementValueDidChange(); + if (method) { return this[method](event); } + }, + + _elementValueDidChange: function() { + set(this, 'value', this.$().val()); + } + +}); + +Ember.TextSupport.KEY_EVENTS = { + 13: 'insertNewline', + 27: 'cancel' +}; + +})(); + + + +(function() { +/** +@module ember +@submodule ember-handlebars +*/ + +var get = Ember.get, set = Ember.set; + +/** + The `Ember.TextField` view class renders a text + [input](https://developer.mozilla.org/en/HTML/Element/Input) element. It + allows for binding Ember properties to the text field contents (`value`), + live-updating as the user inputs text. + + Example: + + ```handlebars + {{view Ember.TextField valueBinding="firstName"}} + ``` + + ## Layout and LayoutName properties + + Because HTML `input` elements are self closing `layout` and `layoutName` + properties will not be applied. See `Ember.View`'s layout section for more + information. + + ## HTML Attributes + + By default `Ember.TextField` provides support for `type`, `value`, `size`, + `pattern`, `placeholder`, `disabled`, `maxlength` and `tabindex` attributes + on a text field. If you need to support more attributes have a look at the + `attributeBindings` property in `Ember.View`'s HTML Attributes section. + + To globally add support for additional attributes you can reopen + `Ember.TextField` or `Ember.TextSupport`. + + ```javascript + Ember.TextSupport.reopen({ + attributeBindings: ["required"] + }) + ``` + + @class TextField + @namespace Ember + @extends Ember.View + @uses Ember.TextSupport +*/ +Ember.TextField = Ember.View.extend(Ember.TextSupport, + /** @scope Ember.TextField.prototype */ { + + classNames: ['ember-text-field'], + tagName: "input", + attributeBindings: ['type', 'value', 'size', 'pattern', 'name'], + + /** + The `value` attribute of the input element. As the user inputs text, this + property is updated live. + + @property value + @type String + @default "" + */ + value: "", + + /** + The `type` attribute of the input element. + + @property type + @type String + @default "text" + */ + type: "text", + + /** + The `size` of the text field in characters. + + @property size + @type String + @default null + */ + size: null, + + /** + The `pattern` the pattern attribute of input element. + + @property pattern + @type String + @default null + */ + pattern: null, + + /** + The action to be sent when the user presses the return key. + + This is similar to the `{{action}}` helper, but is fired when + the user presses the return key when editing a text field, and sends + the value of the field as the context. + + @property action + @type String + @default null + */ + action: null, + + /** + The event that should send the action. + + Options are: + + * `enter`: the user pressed enter + * `keypress`: the user pressed a key + + @property onEvent + @type String + @default enter + */ + onEvent: 'enter', + + /** + Whether they `keyUp` event that triggers an `action` to be sent continues + propagating to other views. + + By default, when the user presses the return key on their keyboard and + the text field has an `action` set, the action will be sent to the view's + controller and the key event will stop propagating. + + If you would like parent views to receive the `keyUp` event even after an + action has been dispatched, set `bubbles` to true. + + @property bubbles + @type Boolean + @default false + */ + bubbles: false, + + insertNewline: function(event) { + sendAction('enter', this, event); + }, + + keyPress: function(event) { + sendAction('keyPress', this, event); + } +}); + +function sendAction(eventName, view, event) { + var action = get(view, 'action'), + on = get(view, 'onEvent'); + + if (action && on === eventName) { + var controller = get(view, 'controller'), + value = get(view, 'value'), + bubbles = get(view, 'bubbles'); + + controller.send(action, value, view); + + if (!bubbles) { + event.stopPropagation(); + } + } +} +})(); + + + +(function() { +/** +@module ember +@submodule ember-handlebars +*/ + +var get = Ember.get, set = Ember.set; + +/** + @class Button + @namespace Ember + @extends Ember.View + @uses Ember.TargetActionSupport + @deprecated +*/ +Ember.Button = Ember.View.extend(Ember.TargetActionSupport, { + classNames: ['ember-button'], + classNameBindings: ['isActive'], + + tagName: 'button', + + propagateEvents: false, + + attributeBindings: ['type', 'disabled', 'href', 'tabindex'], + + /** + @private + + Overrides `TargetActionSupport`'s `targetObject` computed + property to use Handlebars-specific path resolution. + + @property targetObject + */ + targetObject: Ember.computed(function() { + var target = get(this, 'target'), + root = get(this, 'context'), + data = get(this, 'templateData'); + + if (typeof target !== 'string') { return target; } + + return Ember.Handlebars.get(root, target, { data: data }); + }).property('target'), + + // Defaults to 'button' if tagName is 'input' or 'button' + type: Ember.computed(function(key) { + var tagName = this.tagName; + if (tagName === 'input' || tagName === 'button') { return 'button'; } + }), + + disabled: false, + + // Allow 'a' tags to act like buttons + href: Ember.computed(function() { + return this.tagName === 'a' ? '#' : null; + }), + + mouseDown: function() { + if (!get(this, 'disabled')) { + set(this, 'isActive', true); + this._mouseDown = true; + this._mouseEntered = true; + } + return get(this, 'propagateEvents'); + }, + + mouseLeave: function() { + if (this._mouseDown) { + set(this, 'isActive', false); + this._mouseEntered = false; + } + }, + + mouseEnter: function() { + if (this._mouseDown) { + set(this, 'isActive', true); + this._mouseEntered = true; + } + }, + + mouseUp: function(event) { + if (get(this, 'isActive')) { + // Actually invoke the button's target and action. + // This method comes from the Ember.TargetActionSupport mixin. + this.triggerAction(); + set(this, 'isActive', false); + } + + this._mouseDown = false; + this._mouseEntered = false; + return get(this, 'propagateEvents'); + }, + + keyDown: function(event) { + // Handle space or enter + if (event.keyCode === 13 || event.keyCode === 32) { + this.mouseDown(); + } + }, + + keyUp: function(event) { + // Handle space or enter + if (event.keyCode === 13 || event.keyCode === 32) { + this.mouseUp(); + } + }, + + // TODO: Handle proper touch behavior. Including should make inactive when + // finger moves more than 20x outside of the edge of the button (vs mouse + // which goes inactive as soon as mouse goes out of edges.) + + touchStart: function(touch) { + return this.mouseDown(touch); + }, + + touchEnd: function(touch) { + return this.mouseUp(touch); + }, + + init: function() { + Ember.deprecate("Ember.Button is deprecated and will be removed from future releases. Consider using the `{{action}}` helper."); + this._super(); + } +}); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-handlebars +*/ + +var get = Ember.get, set = Ember.set; + +/** + The `Ember.TextArea` view class renders a + [textarea](https://developer.mozilla.org/en/HTML/Element/textarea) element. + It allows for binding Ember properties to the text area contents (`value`), + live-updating as the user inputs text. + + ## Layout and LayoutName properties + + Because HTML `textarea` elements do not contain inner HTML the `layout` and + `layoutName` properties will not be applied. See `Ember.View`'s layout + section for more information. + + ## HTML Attributes + + By default `Ember.TextArea` provides support for `rows`, `cols`, + `placeholder`, `disabled`, `maxlength` and `tabindex` attributes on a + textarea. If you need to support more attributes have a look at the + `attributeBindings` property in `Ember.View`'s HTML Attributes section. + + To globally add support for additional attributes you can reopen + `Ember.TextArea` or `Ember.TextSupport`. + + ```javascript + Ember.TextSupport.reopen({ + attributeBindings: ["required"] + }) + ``` + + @class TextArea + @namespace Ember + @extends Ember.View + @uses Ember.TextSupport +*/ +Ember.TextArea = Ember.View.extend(Ember.TextSupport, { + classNames: ['ember-text-area'], + + tagName: "textarea", + attributeBindings: ['rows', 'cols', 'name'], + rows: null, + cols: null, + + _updateElementValue: Ember.observer(function() { + // We do this check so cursor position doesn't get affected in IE + var value = get(this, 'value'), + $el = this.$(); + if ($el && value !== $el.val()) { + $el.val(value); + } + }, 'value'), + + init: function() { + this._super(); + this.on("didInsertElement", this, this._updateElementValue); + } + +}); + +})(); + + + +(function() { +/*jshint eqeqeq:false */ + +/** +@module ember +@submodule ember-handlebars +*/ + +var set = Ember.set, + get = Ember.get, + indexOf = Ember.EnumerableUtils.indexOf, + indexesOf = Ember.EnumerableUtils.indexesOf, + replace = Ember.EnumerableUtils.replace, + isArray = Ember.isArray, + precompileTemplate = Ember.Handlebars.compile; + +Ember.SelectOption = Ember.View.extend({ + tagName: 'option', + attributeBindings: ['value', 'selected'], + + defaultTemplate: function(context, options) { + options = { data: options.data, hash: {} }; + Ember.Handlebars.helpers.bind.call(context, "view.label", options); + }, + + init: function() { + this.labelPathDidChange(); + this.valuePathDidChange(); + + this._super(); + }, + + selected: Ember.computed(function() { + var content = get(this, 'content'), + selection = get(this, 'parentView.selection'); + if (get(this, 'parentView.multiple')) { + return selection && indexOf(selection, content.valueOf()) > -1; + } else { + // Primitives get passed through bindings as objects... since + // `new Number(4) !== 4`, we use `==` below + return content == selection; + } + }).property('content', 'parentView.selection'), + + labelPathDidChange: Ember.observer(function() { + var labelPath = get(this, 'parentView.optionLabelPath'); + + if (!labelPath) { return; } + + Ember.defineProperty(this, 'label', Ember.computed(function() { + return get(this, labelPath); + }).property(labelPath)); + }, 'parentView.optionLabelPath'), + + valuePathDidChange: Ember.observer(function() { + var valuePath = get(this, 'parentView.optionValuePath'); + + if (!valuePath) { return; } + + Ember.defineProperty(this, 'value', Ember.computed(function() { + return get(this, valuePath); + }).property(valuePath)); + }, 'parentView.optionValuePath') +}); + +/** + The `Ember.Select` view class renders a + [select](https://developer.mozilla.org/en/HTML/Element/select) HTML element, + allowing the user to choose from a list of options. + + The text and `value` property of each ` + + + ``` + + The `value` attribute of the selected `"); + return buffer; + } + +function program3(depth0,data) { + + var hashContexts, hashTypes; + hashContexts = {'contentBinding': depth0}; + hashTypes = {'contentBinding': "STRING"}; + data.buffer.push(escapeExpression(helpers.view.call(depth0, "view.optionView", {hash:{ + 'contentBinding': ("this") + },contexts:[depth0],types:["ID"],hashContexts:hashContexts,hashTypes:hashTypes,data:data}))); + } + + hashTypes = {}; + hashContexts = {}; + stack1 = helpers['if'].call(depth0, "view.prompt", {hash:{},inverse:self.noop,fn:self.program(1, program1, data),contexts:[depth0],types:["ID"],hashContexts:hashContexts,hashTypes:hashTypes,data:data}); + if(stack1 || stack1 === 0) { data.buffer.push(stack1); } + hashTypes = {}; + hashContexts = {}; + stack1 = helpers.each.call(depth0, "view.content", {hash:{},inverse:self.noop,fn:self.program(3, program3, data),contexts:[depth0],types:["ID"],hashContexts:hashContexts,hashTypes:hashTypes,data:data}); + if(stack1 || stack1 === 0) { data.buffer.push(stack1); } + return buffer; + +}), + attributeBindings: ['multiple', 'disabled', 'tabindex', 'name'], + + /** + The `multiple` attribute of the select element. Indicates whether multiple + options can be selected. + + @property multiple + @type Boolean + @default false + */ + multiple: false, + + disabled: false, + + /** + The list of options. + + If `optionLabelPath` and `optionValuePath` are not overridden, this should + be a list of strings, which will serve simultaneously as labels and values. + + Otherwise, this should be a list of objects. For instance: + + ```javascript + Ember.Select.create({ + content: Ember.A([ + { id: 1, firstName: 'Yehuda' }, + { id: 2, firstName: 'Tom' } + ]), + optionLabelPath: 'content.firstName', + optionValuePath: 'content.id' + }); + ``` + + @property content + @type Array + @default null + */ + content: null, + + /** + When `multiple` is `false`, the element of `content` that is currently + selected, if any. + + When `multiple` is `true`, an array of such elements. + + @property selection + @type Object or Array + @default null + */ + selection: null, + + /** + In single selection mode (when `multiple` is `false`), value can be used to + get the current selection's value or set the selection by it's value. + + It is not currently supported in multiple selection mode. + + @property value + @type String + @default null + */ + value: Ember.computed(function(key, value) { + if (arguments.length === 2) { return value; } + var valuePath = get(this, 'optionValuePath').replace(/^content\.?/, ''); + return valuePath ? get(this, 'selection.' + valuePath) : get(this, 'selection'); + }).property('selection'), + + /** + If given, a top-most dummy option will be rendered to serve as a user + prompt. + + @property prompt + @type String + @default null + */ + prompt: null, + + /** + The path of the option labels. See `content`. + + @property optionLabelPath + @type String + @default 'content' + */ + optionLabelPath: 'content', + + /** + The path of the option values. See `content`. + + @property optionValuePath + @type String + @default 'content' + */ + optionValuePath: 'content', + + /** + The view class for option. + + @property optionView + @type Ember.View + @default Ember.SelectOption + */ + optionView: Ember.SelectOption, + + _change: function() { + if (get(this, 'multiple')) { + this._changeMultiple(); + } else { + this._changeSingle(); + } + }, + + selectionDidChange: Ember.observer(function() { + var selection = get(this, 'selection'); + if (get(this, 'multiple')) { + if (!isArray(selection)) { + set(this, 'selection', Ember.A([selection])); + return; + } + this._selectionDidChangeMultiple(); + } else { + this._selectionDidChangeSingle(); + } + }, 'selection.@each'), + + valueDidChange: Ember.observer(function() { + var content = get(this, 'content'), + value = get(this, 'value'), + valuePath = get(this, 'optionValuePath').replace(/^content\.?/, ''), + selectedValue = (valuePath ? get(this, 'selection.' + valuePath) : get(this, 'selection')), + selection; + + if (value !== selectedValue) { + selection = content ? content.find(function(obj) { + return value === (valuePath ? get(obj, valuePath) : obj); + }) : null; + + this.set('selection', selection); + } + }, 'value'), + + + _triggerChange: function() { + var selection = get(this, 'selection'); + var value = get(this, 'value'); + + if (!Ember.isNone(selection)) { this.selectionDidChange(); } + if (!Ember.isNone(value)) { this.valueDidChange(); } + + this._change(); + }, + + _changeSingle: function() { + var selectedIndex = this.$()[0].selectedIndex, + content = get(this, 'content'), + prompt = get(this, 'prompt'); + + if (!content || !get(content, 'length')) { return; } + if (prompt && selectedIndex === 0) { set(this, 'selection', null); return; } + + if (prompt) { selectedIndex -= 1; } + set(this, 'selection', content.objectAt(selectedIndex)); + }, + + + _changeMultiple: function() { + var options = this.$('option:selected'), + prompt = get(this, 'prompt'), + offset = prompt ? 1 : 0, + content = get(this, 'content'), + selection = get(this, 'selection'); + + if (!content){ return; } + if (options) { + var selectedIndexes = options.map(function(){ + return this.index - offset; + }).toArray(); + var newSelection = content.objectsAt(selectedIndexes); + + if (isArray(selection)) { + replace(selection, 0, get(selection, 'length'), newSelection); + } else { + set(this, 'selection', newSelection); + } + } + }, + + _selectionDidChangeSingle: function() { + var el = this.get('element'); + if (!el) { return; } + + var content = get(this, 'content'), + selection = get(this, 'selection'), + selectionIndex = content ? indexOf(content, selection) : -1, + prompt = get(this, 'prompt'); + + if (prompt) { selectionIndex += 1; } + if (el) { el.selectedIndex = selectionIndex; } + }, + + _selectionDidChangeMultiple: function() { + var content = get(this, 'content'), + selection = get(this, 'selection'), + selectedIndexes = content ? indexesOf(content, selection) : [-1], + prompt = get(this, 'prompt'), + offset = prompt ? 1 : 0, + options = this.$('option'), + adjusted; + + if (options) { + options.each(function() { + adjusted = this.index > -1 ? this.index - offset : -1; + this.selected = indexOf(selectedIndexes, adjusted) > -1; + }); + } + }, + + init: function() { + this._super(); + this.on("didInsertElement", this, this._triggerChange); + this.on("change", this, this._change); + } +}); + +})(); + + + +(function() { +function normalizeHash(hash, hashTypes) { + for (var prop in hash) { + if (hashTypes[prop] === 'ID') { + hash[prop + 'Binding'] = hash[prop]; + delete hash[prop]; + } + } +} + +/** + * `{{input}}` inserts a new instance of either Ember.TextField or + * Ember.Checkbox, depending on the `type` option passed in. If no `type` + * is supplied it defaults to Ember.TextField. + * + * @method input + * @for Ember.Handlebars.helpers + * @param {Hash} options + */ +Ember.Handlebars.registerHelper('input', function(options) { + Ember.assert('You can only pass attributes to the `input` helper, not arguments', arguments.length < 2); + + var hash = options.hash, + types = options.hashTypes, + inputType = hash.type, + onEvent = hash.on; + + delete hash.type; + delete hash.on; + + normalizeHash(hash, types); + + if (inputType === 'checkbox') { + return Ember.Handlebars.helpers.view.call(this, Ember.Checkbox, options); + } else { + hash.type = inputType; + hash.onEvent = onEvent || 'enter'; + return Ember.Handlebars.helpers.view.call(this, Ember.TextField, options); + } +}); + +/** + * `{{textarea}}` inserts a new instance of Ember.TextArea into the template + * passing its options to `Ember.TextArea`'s `create` method. + * + * @method textarea + * @for Ember.Handlebars.helpers + * @param {Hash} options + */ +Ember.Handlebars.registerHelper('textarea', function(options) { + Ember.assert('You can only pass attributes to the `textarea` helper, not arguments', arguments.length < 2); + + var hash = options.hash, + types = options.hashTypes; + + normalizeHash(hash, types); + return Ember.Handlebars.helpers.view.call(this, Ember.TextArea, options); +}); + +})(); + + + +(function() { +/*globals Handlebars */ +/** +@module ember +@submodule ember-handlebars +*/ + +/** + @private + + Find templates stored in the head tag as script tags and make them available + to `Ember.CoreView` in the global `Ember.TEMPLATES` object. This will be run + as as jQuery DOM-ready callback. + + Script tags with `text/x-handlebars` will be compiled + with Ember's Handlebars and are suitable for use as a view's template. + Those with type `text/x-raw-handlebars` will be compiled with regular + Handlebars and are suitable for use in views' computed properties. + + @method bootstrap + @for Ember.Handlebars + @static + @param ctx +*/ +Ember.Handlebars.bootstrap = function(ctx) { + var selectors = 'script[type="text/x-handlebars"], script[type="text/x-raw-handlebars"]'; + + Ember.$(selectors, ctx) + .each(function() { + // Get a reference to the script tag + var script = Ember.$(this); + + var compile = (script.attr('type') === 'text/x-raw-handlebars') ? + Ember.$.proxy(Handlebars.compile, Handlebars) : + Ember.$.proxy(Ember.Handlebars.compile, Ember.Handlebars), + // Get the name of the script, used by Ember.View's templateName property. + // First look for data-template-name attribute, then fall back to its + // id if no name is found. + templateName = script.attr('data-template-name') || script.attr('id') || 'application', + template = compile(script.html()); + + // For templates which have a name, we save them and then remove them from the DOM + Ember.TEMPLATES[templateName] = template; + + // Remove script tag from DOM + script.remove(); + }); +}; + +function bootstrap() { + Ember.Handlebars.bootstrap( Ember.$(document) ); +} + +function registerComponents(container) { + var templates = Ember.TEMPLATES, match; + if (!templates) { return; } + + for (var prop in templates) { + if (match = prop.match(/^components\/(.*)$/)) { + registerComponent(container, match[1]); + } + } +} + +function registerComponent(container, name) { + Ember.assert("You provided a template named 'components/" + name + "', but custom components must include a '-'", name.match(/-/)); + + var className = name.replace(/-/g, '_'); + var Component = container.lookupFactory('component:' + className) || container.lookupFactory('component:' + name); + var View = Component || Ember.Component.extend(); + + View.reopen({ + layoutName: 'components/' + name + }); + + Ember.Handlebars.helper(name, View); +} + +/* + We tie this to application.load to ensure that we've at least + attempted to bootstrap at the point that the application is loaded. + + We also tie this to document ready since we're guaranteed that all + the inline templates are present at this point. + + There's no harm to running this twice, since we remove the templates + from the DOM after processing. +*/ + +Ember.onLoad('Ember.Application', function(Application) { + if (Application.initializer) { + Application.initializer({ + name: 'domTemplates', + initialize: bootstrap + }); + + Application.initializer({ + name: 'registerComponents', + after: 'domTemplates', + initialize: registerComponents + }); + } else { + // for ember-old-router + Ember.onLoad('application', bootstrap); + } +}); + +})(); + + + +(function() { +/** +Ember Handlebars + +@module ember +@submodule ember-handlebars +@requires ember-views +*/ + +Ember.runLoadHooks('Ember.Handlebars', Ember.Handlebars); + +})(); + +(function() { +define("route-recognizer", + [], + function() { + "use strict"; + var specials = [ + '/', '.', '*', '+', '?', '|', + '(', ')', '[', ']', '{', '}', '\\' + ]; + + var escapeRegex = new RegExp('(\\' + specials.join('|\\') + ')', 'g'); + + // A Segment represents a segment in the original route description. + // Each Segment type provides an `eachChar` and `regex` method. + // + // The `eachChar` method invokes the callback with one or more character + // specifications. A character specification consumes one or more input + // characters. + // + // The `regex` method returns a regex fragment for the segment. If the + // segment is a dynamic of star segment, the regex fragment also includes + // a capture. + // + // A character specification contains: + // + // * `validChars`: a String with a list of all valid characters, or + // * `invalidChars`: a String with a list of all invalid characters + // * `repeat`: true if the character specification can repeat + + function StaticSegment(string) { this.string = string; } + StaticSegment.prototype = { + eachChar: function(callback) { + var string = this.string, char; + + for (var i=0, l=string.length; i " + n.nextStates.map(function(s) { return s.debug() }).join(" or ") + " )"; + }).join(", ") + } + END IF **/ + + // This is a somewhat naive strategy, but should work in a lot of cases + // A better strategy would properly resolve /posts/:id/new and /posts/edit/:id + function sortSolutions(states) { + return states.sort(function(a, b) { + if (a.types.stars !== b.types.stars) { return a.types.stars - b.types.stars; } + if (a.types.dynamics !== b.types.dynamics) { return a.types.dynamics - b.types.dynamics; } + if (a.types.statics !== b.types.statics) { return a.types.statics - b.types.statics; } + + return 0; + }); + } + + function recognizeChar(states, char) { + var nextStates = []; + + for (var i=0, l=states.length; i 1 && path.charAt(pathLen - 1) === "/") { + path = path.substr(0, pathLen - 1); + } + + for (i=0, l=path.length; i=0; i--) { + handlerInfo = targetHandlerInfos[i]; + if (handlerInfo.name === handlerName) { found = true; } + + if (found) { + if (contexts.length === 0) { break; } + + if (handlerInfo.isDynamic) { + object = contexts.pop(); + if (handlerInfo.context !== object) { return false; } + } + } + } + + return contexts.length === 0 && found; + }, + + trigger: function(name) { + var args = slice.call(arguments); + trigger(this.currentHandlerInfos, false, args); + }, + + /** + Hook point for logging transition status updates. + + @param {String} message The message to log. + */ + log: null + }; + + /** + @private + + Used internally for both URL and named transition to determine + a shared pivot parent route and other data necessary to perform + a transition. + */ + function getMatchPoint(router, handlers, objects, inputParams) { + + var objectsToMatch = objects.length, + matchPoint = handlers.length, + providedModels = {}, i, + currentHandlerInfos = router.currentHandlerInfos || [], + params = {}, + oldParams = router.currentParams || {}, + activeTransition = router.activeTransition, + handlerParams = {}; + + merge(params, inputParams); + + for (i = handlers.length - 1; i >= 0; i--) { + var handlerObj = handlers[i], + handlerName = handlerObj.handler, + oldHandlerInfo = currentHandlerInfos[i], + hasChanged = false; + + // Check if handler names have changed. + if (!oldHandlerInfo || oldHandlerInfo.name !== handlerObj.handler) { hasChanged = true; } + + if (handlerObj.isDynamic) { + // URL transition. + + if (objectsToMatch > 0) { + hasChanged = true; + providedModels[handlerName] = objects[--objectsToMatch]; + } else { + handlerParams[handlerName] = {}; + for (var prop in handlerObj.params) { + if (!handlerObj.params.hasOwnProperty(prop)) { continue; } + var newParam = handlerObj.params[prop]; + if (oldParams[prop] !== newParam) { hasChanged = true; } + handlerParams[handlerName][prop] = params[prop] = newParam; + } + } + } else if (handlerObj.hasOwnProperty('names') && handlerObj.names.length) { + // Named transition. + + if (objectsToMatch > 0) { + hasChanged = true; + providedModels[handlerName] = objects[--objectsToMatch]; + } else if (activeTransition && activeTransition.providedModels[handlerName]) { + + // Use model from previous transition attempt, preferably the resolved one. + hasChanged = true; + providedModels[handlerName] = activeTransition.providedModels[handlerName] || + activeTransition.resolvedModels[handlerName]; + } else { + var names = handlerObj.names; + handlerParams[handlerName] = {}; + for (var j = 0, len = names.length; j < len; ++j) { + var name = names[j]; + handlerParams[handlerName][name] = params[name] = oldParams[name]; + } + } + } + + if (hasChanged) { matchPoint = i; } + } + + if (objectsToMatch > 0) { + throw "More context objects were passed than there are dynamic segments for the route: " + handlers[handlers.length - 1].handler; + } + + return { matchPoint: matchPoint, providedModels: providedModels, params: params, handlerParams: handlerParams }; + } + + /** + @private + + This method takes a handler name and a list of contexts and returns + a serialized parameter hash suitable to pass to `recognizer.generate()`. + + @param {Router} router + @param {String} handlerName + @param {Array[Object]} objects + @return {Object} a serialized parameter hash + */ + function paramsForHandler(router, handlerName, objects) { + + var handlers = router.recognizer.handlersFor(handlerName), + params = {}, + matchPoint = getMatchPoint(router, handlers, objects).matchPoint, + object, handlerObj, handler, names, i; + + for (i=0; i= matchPoint) { + object = objects.shift(); + // Otherwise use existing context + } else { + object = handler.context; + } + + // Serialize to generate params + merge(params, serialize(handler, object, names)); + } + } + return params; + } + + function merge(hash, other) { + for (var prop in other) { + if (other.hasOwnProperty(prop)) { hash[prop] = other[prop]; } + } + } + + /** + @private + */ + function createNamedTransition(router, args) { + var handlers = router.recognizer.handlersFor(args[0]); + + log(router, "Attempting transition to " + args[0]); + + return performTransition(router, handlers, slice.call(args, 1), router.currentParams); + } + + /** + @private + */ + function createURLTransition(router, url) { + + var results = router.recognizer.recognize(url), + currentHandlerInfos = router.currentHandlerInfos; + + log(router, "Attempting URL transition to " + url); + + if (!results) { + return errorTransition(router, new Router.UnrecognizedURLError(url)); + } + + return performTransition(router, results, [], {}); + } + + + /** + @private + + Takes an Array of `HandlerInfo`s, figures out which ones are + exiting, entering, or changing contexts, and calls the + proper handler hooks. + + For example, consider the following tree of handlers. Each handler is + followed by the URL segment it handles. + + ``` + |~index ("/") + | |~posts ("/posts") + | | |-showPost ("/:id") + | | |-newPost ("/new") + | | |-editPost ("/edit") + | |~about ("/about/:id") + ``` + + Consider the following transitions: + + 1. A URL transition to `/posts/1`. + 1. Triggers the `*model` callbacks on the + `index`, `posts`, and `showPost` handlers + 2. Triggers the `enter` callback on the same + 3. Triggers the `setup` callback on the same + 2. A direct transition to `newPost` + 1. Triggers the `exit` callback on `showPost` + 2. Triggers the `enter` callback on `newPost` + 3. Triggers the `setup` callback on `newPost` + 3. A direct transition to `about` with a specified + context object + 1. Triggers the `exit` callback on `newPost` + and `posts` + 2. Triggers the `serialize` callback on `about` + 3. Triggers the `enter` callback on `about` + 4. Triggers the `setup` callback on `about` + + @param {Transition} transition + @param {Array[HandlerInfo]} handlerInfos + */ + function setupContexts(transition, handlerInfos) { + var router = transition.router, + partition = partitionHandlers(router.currentHandlerInfos || [], handlerInfos); + + router.targetHandlerInfos = handlerInfos; + + eachHandler(partition.exited, function(handlerInfo) { + var handler = handlerInfo.handler; + delete handler.context; + if (handler.exit) { handler.exit(); } + }); + + var currentHandlerInfos = partition.unchanged.slice(); + router.currentHandlerInfos = currentHandlerInfos; + + eachHandler(partition.updatedContext, function(handlerInfo) { + handlerEnteredOrUpdated(transition, currentHandlerInfos, handlerInfo, false); + }); + + eachHandler(partition.entered, function(handlerInfo) { + handlerEnteredOrUpdated(transition, currentHandlerInfos, handlerInfo, true); + }); + + if (router.didTransition) { + router.didTransition(handlerInfos); + } + } + + /** + @private + + Helper method used by setupContexts. Handles errors or redirects + that may happen in enter/setup. + */ + function handlerEnteredOrUpdated(transition, currentHandlerInfos, handlerInfo, enter) { + var handler = handlerInfo.handler, + context = handlerInfo.context; + + try { + if (enter && handler.enter) { handler.enter(); } + checkAbort(transition); + + setContext(handler, context); + + if (handler.setup) { handler.setup(context); } + checkAbort(transition); + } catch(e) { + if (!(e instanceof Router.TransitionAborted)) { + // Trigger the `error` event starting from this failed handler. + trigger(currentHandlerInfos.concat(handlerInfo), true, ['error', e, transition]); + } + + // Propagate the error so that the transition promise will reject. + throw e; + } + + currentHandlerInfos.push(handlerInfo); + } + + + /** + @private + + Iterates over an array of `HandlerInfo`s, passing the handler + and context into the callback. + + @param {Array[HandlerInfo]} handlerInfos + @param {Function(Object, Object)} callback + */ + function eachHandler(handlerInfos, callback) { + for (var i=0, l=handlerInfos.length; i=0; i--) { + var handlerInfo = handlerInfos[i], + handler = handlerInfo.handler; + + if (handler.events && handler.events[name]) { + if (handler.events[name].apply(handler, args) === true) { + eventWasHandled = true; + } else { + return; + } + } + } + + if (!eventWasHandled && !ignoreFailure) { + throw new Error("Nothing handled the event '" + name + "'."); + } + } + + function setContext(handler, context) { + handler.context = context; + if (handler.contextDidChange) { handler.contextDidChange(); } + } + + /** + @private + + Creates, begins, and returns a Transition. + */ + function performTransition(router, recogHandlers, providedModelsArray, params, data) { + + var matchPointResults = getMatchPoint(router, recogHandlers, providedModelsArray, params), + targetName = recogHandlers[recogHandlers.length - 1].handler, + wasTransitioning = false; + + // Check if there's already a transition underway. + if (router.activeTransition) { + if (transitionsIdentical(router.activeTransition, targetName, providedModelsArray)) { + return router.activeTransition; + } + router.activeTransition.abort(); + wasTransitioning = true; + } + + var deferred = RSVP.defer(), + transition = new Transition(router, deferred.promise); + + transition.targetName = targetName; + transition.providedModels = matchPointResults.providedModels; + transition.providedModelsArray = providedModelsArray; + transition.params = matchPointResults.params; + transition.data = data || {}; + router.activeTransition = transition; + + var handlerInfos = generateHandlerInfos(router, recogHandlers); + + // Fire 'willTransition' event on current handlers, but don't fire it + // if a transition was already underway. + if (!wasTransitioning) { + trigger(router.currentHandlerInfos, true, ['willTransition', transition]); + } + + log(router, transition.sequence, "Beginning validation for transition to " + transition.targetName); + validateEntry(transition, handlerInfos, 0, matchPointResults.matchPoint, matchPointResults.handlerParams) + .then(transitionSuccess, transitionFailure); + + return transition; + + function transitionSuccess() { + checkAbort(transition); + + try { + finalizeTransition(transition, handlerInfos); + + // Resolve with the final handler. + deferred.resolve(handlerInfos[handlerInfos.length - 1].handler); + } catch(e) { + deferred.reject(e); + } + + // Don't nullify if another transition is underway (meaning + // there was a transition initiated with enter/setup). + if (!transition.isAborted) { + router.activeTransition = null; + } + } + + function transitionFailure(reason) { + deferred.reject(reason); + } + } + + /** + @private + + Accepts handlers in Recognizer format, either returned from + recognize() or handlersFor(), and returns unified + `HandlerInfo`s. + */ + function generateHandlerInfos(router, recogHandlers) { + var handlerInfos = []; + for (var i = 0, len = recogHandlers.length; i < len; ++i) { + var handlerObj = recogHandlers[i], + isDynamic = handlerObj.isDynamic || (handlerObj.names && handlerObj.names.length); + + handlerInfos.push({ + isDynamic: !!isDynamic, + name: handlerObj.handler, + handler: router.getHandler(handlerObj.handler) + }); + } + return handlerInfos; + } + + /** + @private + */ + function transitionsIdentical(oldTransition, targetName, providedModelsArray) { + + if (oldTransition.targetName !== targetName) { return false; } + + var oldModels = oldTransition.providedModelsArray; + if (oldModels.length !== providedModelsArray.length) { return false; } + + for (var i = 0, len = oldModels.length; i < len; ++i) { + if (oldModels[i] !== providedModelsArray[i]) { return false; } + } + return true; + } + + /** + @private + + Updates the URL (if necessary) and calls `setupContexts` + to update the router's array of `currentHandlerInfos`. + */ + function finalizeTransition(transition, handlerInfos) { + + var router = transition.router, + seq = transition.sequence, + handlerName = handlerInfos[handlerInfos.length - 1].name; + + log(router, seq, "Validation succeeded, finalizing transition;"); + + // Collect params for URL. + var objects = []; + for (var i = 0, len = handlerInfos.length; i < len; ++i) { + var handlerInfo = handlerInfos[i]; + if (handlerInfo.isDynamic) { + objects.push(handlerInfo.context); + } + } + + var params = paramsForHandler(router, handlerName, objects); + + transition.providedModelsArray = []; + transition.providedContexts = {}; + router.currentParams = params; + + var urlMethod = transition.urlMethod; + if (urlMethod) { + var url = router.recognizer.generate(handlerName, params); + + if (urlMethod === 'replace') { + router.replaceURL(url); + } else { + // Assume everything else is just a URL update for now. + router.updateURL(url); + } + } + + setupContexts(transition, handlerInfos); + log(router, seq, "TRANSITION COMPLETE."); + } + + /** + @private + + Internal function used to construct the chain of promises used + to validate a transition. Wraps calls to `beforeModel`, `model`, + and `afterModel` in promises, and checks for redirects/aborts + between each. + */ + function validateEntry(transition, handlerInfos, index, matchPoint, handlerParams) { + + if (index === handlerInfos.length) { + // No more contexts to resolve. + return RSVP.resolve(transition.resolvedModels); + } + + var router = transition.router, + handlerInfo = handlerInfos[index], + handler = handlerInfo.handler, + handlerName = handlerInfo.name, + seq = transition.sequence, + errorAlreadyHandled = false, + resolvedModel; + + if (index < matchPoint) { + log(router, seq, handlerName + ": using context from already-active handler"); + + // We're before the match point, so don't run any hooks, + // just use the already resolved context from the handler. + resolvedModel = handlerInfo.handler.context; + return proceed(); + } + + return RSVP.resolve().then(handleAbort) + .then(beforeModel) + .then(null, handleError) + .then(handleAbort) + .then(model) + .then(null, handleError) + .then(handleAbort) + .then(afterModel) + .then(null, handleError) + .then(handleAbort) + .then(proceed); + + function handleAbort(result) { + + if (transition.isAborted) { + log(transition.router, transition.sequence, "detected abort."); + errorAlreadyHandled = true; + return RSVP.reject(new Router.TransitionAborted()); + } + + return result; + } + + function handleError(reason) { + + if (errorAlreadyHandled) { return RSVP.reject(reason); } + errorAlreadyHandled = true; + transition.abort(); + + log(router, seq, handlerName + ": handling error: " + reason); + + // An error was thrown / promise rejected, so fire an + // `error` event from this handler info up to root. + trigger(handlerInfos.slice(0, index + 1), true, ['error', reason, transition]); + + if (handler.error) { + handler.error(reason, transition); } + + + // Propagate the original error. + return RSVP.reject(reason); + } + + function beforeModel() { + + log(router, seq, handlerName + ": calling beforeModel hook"); + + return handler.beforeModel && handler.beforeModel(transition); + } + + function model() { + log(router, seq, handlerName + ": resolving model"); + + return getModel(handlerInfo, transition, handlerParams[handlerName], index >= matchPoint); + } + + function afterModel(context) { + + log(router, seq, handlerName + ": calling afterModel hook"); + + // Pass the context and resolved parent contexts to afterModel, but we don't + // want to use the value returned from `afterModel` in any way, but rather + // always resolve with the original `context` object. + + resolvedModel = context; + return handler.afterModel && handler.afterModel(resolvedModel, transition); + } + + function proceed() { + log(router, seq, handlerName + ": validation succeeded, proceeding"); + + handlerInfo.context = transition.resolvedModels[handlerInfo.name] = resolvedModel; + return validateEntry(transition, handlerInfos, index + 1, matchPoint, handlerParams); + } + } + + /** + @private + + Throws a TransitionAborted if the provided transition has been aborted. + */ + function checkAbort(transition) { + if (transition.isAborted) { + log(transition.router, transition.sequence, "detected abort."); + throw new Router.TransitionAborted(); + } + } + + /** + @private + + Encapsulates the logic for whether to call `model` on a route, + or use one of the models provided to `transitionTo`. + */ + function getModel(handlerInfo, transition, handlerParams, needsUpdate) { + + var handler = handlerInfo.handler, + handlerName = handlerInfo.name; + + if (!needsUpdate && handler.hasOwnProperty('context')) { + return handler.context; + } + + if (handlerInfo.isDynamic && transition.providedModels.hasOwnProperty(handlerName)) { + var providedModel = transition.providedModels[handlerName]; + return typeof providedModel === 'function' ? providedModel() : providedModel; + } + + return handler.model && handler.model(handlerParams || {}, transition); + } + + /** + @private + */ + function log(router, sequence, msg) { + + if (!router.log) { return; } + + if (arguments.length === 3) { + router.log("Transition #" + sequence + ": " + msg); + } else { + msg = sequence; + router.log(msg); + } + } + + /** + @private + + Begins and returns a Transition based on the provided + arguments. Accepts arguments in the form of both URL + transitions and named transitions. + + @param {Router} router + @param {Array[Object]} args arguments passed to transitionTo, + replaceWith, or handleURL + */ + function doTransition(router, args) { + // Normalize blank transitions to root URL transitions. + var name = args[0] || '/'; + + if (name.charAt(0) === '/') { + return createURLTransition(router, name); + } else { + return createNamedTransition(router, args); + } + } + + /** + @private + + Serializes a handler using its custom `serialize` method or + by a default that looks up the expected property name from + the dynamic segment. + + @param {Object} handler a router handler + @param {Object} model the model to be serialized for this handler + @param {Array[Object]} names the names array attached to an + handler object returned from router.recognizer.handlersFor() + */ + function serialize(handler, model, names) { + + // Use custom serialize if it exists. + if (handler.serialize) { + return handler.serialize(model, names); + } + + if (names.length !== 1) { return; } + + var name = names[0], object = {}; + + if (/_id$/.test(name)) { + object[name] = model.id; + } else { + object[name] = model; + } + return object; + } + + return Router; + }); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-routing +*/ + +function DSL(name) { + this.parent = name; + this.matches = []; +} + +DSL.prototype = { + resource: function(name, options, callback) { + if (arguments.length === 2 && typeof options === 'function') { + callback = options; + options = {}; + } + + if (arguments.length === 1) { + options = {}; + } + + if (typeof options.path !== 'string') { + options.path = "/" + name; + } + + if (callback) { + var dsl = new DSL(name); + callback.call(dsl); + this.push(options.path, name, dsl.generate()); + } else { + this.push(options.path, name); + } + }, + + push: function(url, name, callback) { + var parts = name.split('.'); + if (url === "" || url === "/" || parts[parts.length-1] === "index") { this.explicitIndex = true; } + + this.matches.push([url, name, callback]); + }, + + route: function(name, options) { + Ember.assert("You must use `this.resource` to nest", typeof options !== 'function'); + + options = options || {}; + + if (typeof options.path !== 'string') { + options.path = "/" + name; + } + + if (this.parent && this.parent !== 'application') { + name = this.parent + "." + name; + } + + this.push(options.path, name); + }, + + generate: function() { + var dslMatches = this.matches; + + if (!this.explicitIndex) { + this.route("index", { path: "/" }); + } + + return function(match) { + for (var i=0, l=dslMatches.length; i " + fullName, { fullName: fullName }); + } + + return instance; +}; + +})(); + + + +(function() { +/** +@module ember +@submodule ember-routing +*/ + +var Router = requireModule("router"); +var get = Ember.get, set = Ember.set; +var defineProperty = Ember.defineProperty; + +var DefaultView = Ember._MetamorphView; +function setupLocation(router) { + var location = get(router, 'location'), + rootURL = get(router, 'rootURL'), + options = {}; + + if (typeof rootURL === 'string') { + options.rootURL = rootURL; + } + + if ('string' === typeof location) { + options.implementation = location; + location = set(router, 'location', Ember.Location.create(options)); + + } +} + +/** + The `Ember.Router` class manages the application state and URLs. Refer to + the [routing guide](http://emberjs.com/guides/routing/) for documentation. + + @class Router + @namespace Ember + @extends Ember.Object +*/ +Ember.Router = Ember.Object.extend({ + location: 'hash', + + init: function() { + this.router = this.constructor.router || this.constructor.map(Ember.K); + this._activeViews = {}; + setupLocation(this); + }, + + url: Ember.computed(function() { + return get(this, 'location').getURL(); + }), + + startRouting: function() { + this.router = this.router || this.constructor.map(Ember.K); + + var router = this.router, + location = get(this, 'location'), + container = this.container, + self = this; + + setupRouter(this, router, location); + + container.register('view:default', DefaultView); + container.register('view:toplevel', Ember.View.extend()); + + location.onUpdateURL(function(url) { + self.handleURL(url); + }); + + this.handleURL(location.getURL()); + }, + + didTransition: function(infos) { + var appController = this.container.lookup('controller:application'), + path = routePath(infos); + + if (!('currentPath' in appController)) { + defineProperty(appController, 'currentPath'); + } + set(appController, 'currentPath', path); + this.notifyPropertyChange('url'); + + if (get(this, 'namespace').LOG_TRANSITIONS) { + Ember.Logger.log("Transitioned into '" + path + "'"); + } + }, + + handleURL: function(url) { + scheduleLoadingStateEntry(this); + + var self = this; + + return this.router.handleURL(url).then(function() { + transitionCompleted(self); + }); + }, + + transitionTo: function() { + return doTransition(this, 'transitionTo', arguments); + }, + + replaceWith: function() { + return doTransition(this, 'replaceWith', arguments); + }, + + generate: function() { + var url = this.router.generate.apply(this.router, arguments); + return this.location.formatURL(url); + }, + + isActive: function(routeName) { + var router = this.router; + return router.isActive.apply(router, arguments); + }, + + send: function(name, context) { + this.router.trigger.apply(this.router, arguments); + }, + + hasRoute: function(route) { + return this.router.hasRoute(route); + }, + + /** + @private + + Resets the state of the router by clearing the current route + handlers and deactivating them. + + @method reset + */ + reset: function() { + this.router.reset(); + }, + + _lookupActiveView: function(templateName) { + var active = this._activeViews[templateName]; + return active && active[0]; + }, + + _connectActiveView: function(templateName, view) { + var existing = this._activeViews[templateName]; + + if (existing) { + existing[0].off('willDestroyElement', this, existing[1]); + } + + var disconnect = function() { + delete this._activeViews[templateName]; + }; + + this._activeViews[templateName] = [view, disconnect]; + view.one('willDestroyElement', this, disconnect); + } +}); + +function getHandlerFunction(router) { + var seen = {}, container = router.container, + DefaultRoute = container.resolve('route:basic'); + + return function(name) { + var routeName = 'route:' + name, + handler = container.lookup(routeName); + + if (seen[name]) { return handler; } + + seen[name] = true; + + if (!handler) { + if (name === 'loading') { return {}; } + + container.register(routeName, DefaultRoute.extend()); + handler = container.lookup(routeName); + + if (get(router, 'namespace.LOG_ACTIVE_GENERATION')) { + Ember.Logger.info("generated -> " + routeName, { fullName: routeName }); + } + } + + if (name === 'application') { + // Inject default `error` handler. + handler.events = handler.events || {}; + handler.events.error = handler.events.error || defaultErrorHandler; + } + + handler.routeName = name; + return handler; + }; +} + +function defaultErrorHandler(error, transition) { + Ember.Logger.error('Error while loading route:', error); + + // Using setTimeout allows us to escape from the Promise's try/catch block + setTimeout(function() { throw error; }); +} + + +function routePath(handlerInfos) { + var path = []; + + for (var i=1, l=handlerInfos.length; i 0 ? !Ember.isNone(arguments[0]) : true); + + if (typeof name === 'object' && !options) { + options = name; + name = this.routeName; + } + + name = name ? name.replace(/\//g, '.') : this.routeName; + + var container = this.container, + view = container.lookup('view:' + name), + template = container.lookup('template:' + name); + + if (!view && !template) { + if (get(this.router, 'namespace.LOG_VIEW_LOOKUPS')) { + Ember.Logger.info("Could not find \"" + name + "\" template or view. Nothing will be rendered", { fullName: 'template:' + name }); + } + return; + } + + options = normalizeOptions(this, name, template, options); + view = setupView(view, container, options); + + if (options.outlet === 'main') { this.lastRenderedTemplate = name; } + + appendView(this, view, options); + }, + + willDestroy: function() { + this.teardownViews(); + }, + + teardownViews: function() { + // Tear down the top level view + if (this.teardownTopLevelView) { this.teardownTopLevelView(); } + + // Tear down any outlets rendered with 'into' + var teardownOutletViews = this.teardownOutletViews || []; + a_forEach(teardownOutletViews, function(teardownOutletView) { + teardownOutletView(); + }); + + delete this.teardownTopLevelView; + delete this.teardownOutletViews; + delete this.lastRenderedTemplate; + } +}); + +function parentRoute(route) { + var handlerInfos = route.router.router.targetHandlerInfos; + + if (!handlerInfos) { return; } + + var parent, current; + + for (var i=0, l=handlerInfos.length; i + Great Hamster Photos + + ``` + + ### Supplying a tagName + By default `{{linkTo}}` renders an `` element. This can + be overridden for a single use of `{{linkTo}}` by supplying + a `tagName` option: + + ```handlebars + {{#linkTo photoGallery tagName="li"}} + Great Hamster Photos + {{/linkTo}} + ``` + + ```html +
  • + Great Hamster Photos +
    • + ``` + + To override this option for your entire application, see + "Overriding Application-wide Defaults". + + ### Handling `href` + `{{linkTo}}` will use your application's Router to + fill the element's `href` property with a url that + matches the path to the supplied `routeName` for your + routers's configured `Location` scheme, which defaults + to Ember.HashLocation. + + ### Handling current route + `{{linkTo}}` will apply a CSS class name of 'active' + when the application's current route matches + the supplied routeName. For example, if the application's + current route is 'photoGallery.recent' the following + use of `{{linkTo}}`: + + ```handlebars + {{#linkTo photoGallery.recent}} + Great Hamster Photos from the last week + {{/linkTo}} + ``` + + will result in + + ```html +     + Great Hamster Photos + + ``` + + The CSS class name used for active classes can be customized + for a single use of `{{linkTo}}` by passing an `activeClass` + option: + + ```handlebars + {{#linkTo photoGallery.recent activeClass="current-url"}} + Great Hamster Photos from the last week + {{/linkTo}} + ``` + + ```html + + Great Hamster Photos + + ``` + + To override this option for your entire application, see + "Overriding Application-wide Defaults". + + ### Supplying a model + An optional model argument can be used for routes whose + paths contain dynamic segments. This argument will become + the model context of the linked route: + + ```javascript + App.Router.map(function(){ + this.resource("photoGallery", {path: "hamster-photos/:photo_id"}); + }) + ``` + + ```handlebars + {{#linkTo photoGallery aPhoto}} + {{aPhoto.title}} + {{/linkTo}} + ``` + + ```html + + Tomster + + ``` + + ### Supplying multiple models + For deep-linking to route paths that contain multiple + dynamic segments, multiple model arguments can be used. + As the router transitions through the route path, each + supplied model argument will become the context for the + route with the dynamic segments: + + ```javascript + App.Router.map(function(){ + this.resource("photoGallery", {path: "hamster-photos/:photo_id"}, function(){ + this.route("comment", {path: "comments/:comment_id"}); + }); + }); + ``` + This argument will become the model context of the linked route: + + ```handlebars + {{#linkTo photoGallery.comment aPhoto comment}} + {{comment.body}} + {{/linkTo}} + ``` + + ```html + + A+++ would snuggle again. + + ``` + + ### Overriding Application-wide Defaults + ``{{linkTo}}`` creates an instance of Ember.LinkView + for rendering. To override options for your entire + application, reopen Ember.LinkView and supply the + desired values: + + ``` javascript + Ember.LinkView.reopen({ + activeClass: "is-active", + tagName: 'li' + }) + ``` + + It is also possible to override the default event in + this manner: + + ``` javascript + Ember.LinkView.reopen({ + eventName: 'customEventName' + }); + ``` + + @method linkTo + @for Ember.Handlebars.helpers + @param {String} routeName + @param {Object} [context]* + @return {String} HTML string + */ + Ember.Handlebars.registerHelper('linkTo', function(name) { + var options = [].slice.call(arguments, -1)[0]; + var params = [].slice.call(arguments, 1, -1); + + var hash = options.hash; + + hash.namedRoute = name; + hash.currentWhen = hash.currentWhen || name; + hash.disabledBinding = hash.disabledWhen; + + hash.parameters = { + context: this, + options: options, + params: params + }; + + return Ember.Handlebars.helpers.view.call(this, LinkView, options); + }); + +}); + + +})(); + + + +(function() { +/** +@module ember +@submodule ember-routing +*/ + +var get = Ember.get, set = Ember.set; +Ember.onLoad('Ember.Handlebars', function(Handlebars) { + /** + @module ember + @submodule ember-routing + */ + + Handlebars.OutletView = Ember.ContainerView.extend(Ember._Metamorph); + + /** + The `outlet` helper is a placeholder that the router will fill in with + the appropriate template based on the current state of the application. + + ``` handlebars + {{outlet}} + ``` + + By default, a template based on Ember's naming conventions will be rendered + into the `outlet` (e.g. `App.PostsRoute` will render the `posts` template). + + You can render a different template by using the `render()` method in the + route's `renderTemplate` hook. The following will render the `favoritePost` + template into the `outlet`. + + ``` javascript + App.PostsRoute = Ember.Route.extend({ + renderTemplate: function() { + this.render('favoritePost'); + } + }); + ``` + + You can create custom named outlets for more control. + + ``` handlebars + {{outlet favoritePost}} + {{outlet posts}} + ``` + + Then you can define what template is rendered into each outlet in your + route. + + + ``` javascript + App.PostsRoute = Ember.Route.extend({ + renderTemplate: function() { + this.render('favoritePost', { outlet: 'favoritePost' }); + this.render('posts', { outlet: 'posts' }); + } + }); + ``` + + You can specify the view class that the outlet uses to contain and manage the + templates rendered into it. + + ``` handlebars + {{outlet viewClass=App.SectionContainer}} + ``` + + ``` javascript + App.SectionContainer = Ember.ContainerView.extend({ + tagName: 'section', + classNames: ['special'] + }); + ``` + + @method outlet + @for Ember.Handlebars.helpers + @param {String} property the property on the controller + that holds the view for this outlet + */ + Handlebars.registerHelper('outlet', function(property, options) { + var outletSource, outletContainerClass; + + if (property && property.data && property.data.isRenderData) { + options = property; + property = 'main'; + } + + outletSource = options.data.view; + while (!(outletSource.get('template.isTop'))){ + outletSource = outletSource.get('_parentView'); + } + + outletContainerClass = options.hash.viewClass || Handlebars.OutletView; + + options.data.view.set('outletSource', outletSource); + options.hash.currentViewBinding = '_view.outletSource._outlets.' + property; + + return Handlebars.helpers.view.call(this, outletContainerClass, options); + }); +}); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-routing +*/ + +var get = Ember.get, set = Ember.set; +Ember.onLoad('Ember.Handlebars', function(Handlebars) { + + /** + Renders the named template in the current context with the same-named + controller. + + If a view class with the same name exists, the view class will be used. + + The optional second argument is a property path that will be bound + to the `model` property of the controller. + + If a `model` property path is specified, then a new instance of the + controller will be created. + + If no `model` property path is provided, then the helper will use the + singleton instance of the controller. A given controller may only be used + one time in your app in this manner. + + The default target for `{{action}}`s in the rendered template is the + controller. + + @method render + @for Ember.Handlebars.helpers + @param {String} name + @param {Object?} contextString + @param {Hash} options + */ + Ember.Handlebars.registerHelper('render', function(name, contextString, options) { + Ember.assert("You must pass a template to render", arguments.length >= 2); + var container, router, controller, view, context, lookupOptions; + + if (arguments.length === 2) { + options = contextString; + contextString = undefined; + } + + if (typeof contextString === 'string') { + context = Ember.Handlebars.get(options.contexts[1], contextString, options); + lookupOptions = { singleton: false }; + } + + name = name.replace(/\//g, '.'); + container = options.data.keywords.controller.container; + router = container.lookup('router:main'); + + Ember.assert("You can only use the {{render}} helper once without a model object as its second argument, as in {{render \"post\" post}}.", context || !router || !router._lookupActiveView(name)); + + view = container.lookup('view:' + name) || container.lookup('view:default'); + + var controllerName = options.hash.controller; + + // Look up the controller by name, if provided. + if (controllerName) { + controller = container.lookup('controller:' + controllerName, lookupOptions); + Ember.assert("The controller name you supplied '" + controllerName + "' did not resolve to a controller.", !!controller); + } else { + controller = Ember.controllerFor(container, name, context, lookupOptions); + } + + if (controller && context) { + controller.set('model', context); + } + + var root = options.contexts[1]; + + if (root) { + view.registerObserver(root, contextString, function() { + controller.set('model', Ember.Handlebars.get(root, contextString, options)); + }); + } + + controller.set('target', options.data.keywords.controller); + + options.hash.viewName = Ember.String.camelize(name); + options.hash.template = container.lookup('template:' + name); + options.hash.controller = controller; + + if (router && !context) { + router._connectActiveView(name, view); + } + + Ember.Handlebars.helpers.view.call(this, view, options); + }); + +}); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-routing +*/ +Ember.onLoad('Ember.Handlebars', function(Handlebars) { + + var resolveParams = Ember.Router.resolveParams, + isSimpleClick = Ember.ViewUtils.isSimpleClick; + + var EmberHandlebars = Ember.Handlebars, + handlebarsGet = EmberHandlebars.get, + SafeString = EmberHandlebars.SafeString, + forEach = Ember.ArrayPolyfills.forEach, + get = Ember.get, + a_slice = Array.prototype.slice; + + function args(options, actionName) { + var ret = []; + if (actionName) { ret.push(actionName); } + + var types = options.options.types.slice(1), + data = options.options.data; + + return ret.concat(resolveParams(options.context, options.params, { types: types, data: data })); + } + + var ActionHelper = EmberHandlebars.ActionHelper = { + registeredActions: {} + }; + + var keys = ["alt", "shift", "meta", "ctrl"]; + + var isAllowedClick = function(event, allowedKeys) { + if (typeof allowedKeys === "undefined") { + return isSimpleClick(event); + } + + var allowed = true; + + forEach.call(keys, function(key) { + if (event[key + "Key"] && allowedKeys.indexOf(key) === -1) { + allowed = false; + } + }); + + return allowed; + }; + + ActionHelper.registerAction = function(actionName, options, allowedKeys) { + var actionId = (++Ember.uuid).toString(); + + ActionHelper.registeredActions[actionId] = { + eventName: options.eventName, + handler: function(event) { + if (!isAllowedClick(event, allowedKeys)) { return true; } + + event.preventDefault(); + + if (options.bubbles === false) { + event.stopPropagation(); + } + + var target = options.target; + + if (target.target) { + target = handlebarsGet(target.root, target.target, target.options); + } else { + target = target.root; + } + + Ember.run(function() { + if (target.send) { + target.send.apply(target, args(options.parameters, actionName)); + } else { + Ember.assert("The action '" + actionName + "' did not exist on " + target, typeof target[actionName] === 'function'); + target[actionName].apply(target, args(options.parameters)); + } + }); + } + }; + + options.view.on('willClearRender', function() { + delete ActionHelper.registeredActions[actionId]; + }); + + return actionId; + }; + + /** + The `{{action}}` helper registers an HTML element within a template for DOM + event handling and forwards that interaction to the view's controller + or supplied `target` option (see 'Specifying a Target'). + + If the view's controller does not implement the event, the event is sent + to the current route, and it bubbles up the route hierarchy from there. + + User interaction with that element will invoke the supplied action name on + the appropriate target. + + Given the following Handlebars template on the page + + ```handlebars + + ``` + + And application code + + ```javascript + AController = Ember.Controller.extend({ + anActionName: function() {} + }); + + AView = Ember.View.extend({ + controller: AController.create(), + templateName: 'a-template' + }); + + aView = AView.create(); + aView.appendTo('body'); + ``` + + Will result in the following rendered HTML + + ```html +
    +
    + click me +
    +
    + ``` + + Clicking "click me" will trigger the `anActionName` method of the + `AController`. In this case, no additional parameters will be passed. + + If you provide additional parameters to the helper: + + ```handlebars + + ``` + + Those parameters will be passed along as arguments to the JavaScript + function implementing the action. + + ### Event Propagation + + Events triggered through the action helper will automatically have + `.preventDefault()` called on them. You do not need to do so in your event + handlers. + + To also disable bubbling, pass `bubbles=false` to the helper: + + ```handlebars + + ``` + + If you need the default handler to trigger you should either register your + own event handler, or use event methods on your view class. See `Ember.View` + 'Responding to Browser Events' for more information. + + ### Specifying DOM event type + + By default the `{{action}}` helper registers for DOM `click` events. You can + supply an `on` option to the helper to specify a different DOM event name: + + ```handlebars + + ``` + + See `Ember.View` 'Responding to Browser Events' for a list of + acceptable DOM event names. + + NOTE: Because `{{action}}` depends on Ember's event dispatch system it will + only function if an `Ember.EventDispatcher` instance is available. An + `Ember.EventDispatcher` instance will be created when a new `Ember.Application` + is created. Having an instance of `Ember.Application` will satisfy this + requirement. + + ### Specifying whitelisted modifier keys + + By default the `{{action}}` helper will ignore click event with pressed modifier + keys. You can supply an `allowedKeys` option to specify which keys should not be ignored. + + ```handlebars + + ``` + + This way the `{{action}}` will fire when clicking with the alt key pressed down. + + ### Specifying a Target + + There are several possible target objects for `{{action}}` helpers: + + In a typical Ember application, where views are managed through use of the + `{{outlet}}` helper, actions will bubble to the current controller, then + to the current route, and then up the route hierarchy. + + Alternatively, a `target` option can be provided to the helper to change + which object will receive the method call. This option must be a path + to an object, accessible in the current context: + + ```handlebars + + ``` + + Clicking "click me" in the rendered HTML of the above template will trigger + the `anActionName` method of the object at `MyApplication.someObject`. + + If an action's target does not implement a method that matches the supplied + action name an error will be thrown. + + ```handlebars + + ``` + + With the following application code + + ```javascript + AView = Ember.View.extend({ + templateName; 'a-template', + // note: no method 'aMethodNameThatIsMissing' + anActionName: function(event) {} + }); + + aView = AView.create(); + aView.appendTo('body'); + ``` + + Will throw `Uncaught TypeError: Cannot call method 'call' of undefined` when + "click me" is clicked. + + ### Additional Parameters + + You may specify additional parameters to the `{{action}}` helper. These + parameters are passed along as the arguments to the JavaScript function + implementing the action. + + ```handlebars + + ``` + + Clicking "click me" will trigger the `edit` method on the current view's + controller with the current person as a parameter. + + @method action + @for Ember.Handlebars.helpers + @param {String} actionName + @param {Object} [context]* + @param {Hash} options + */ + EmberHandlebars.registerHelper('action', function(actionName) { + var options = arguments[arguments.length - 1], + contexts = a_slice.call(arguments, 1, -1); + + var hash = options.hash, + controller; + + // create a hash to pass along to registerAction + var action = { + eventName: hash.on || "click" + }; + + action.parameters = { + context: this, + options: options, + params: contexts + }; + + action.view = options.data.view; + + var root, target; + + if (hash.target) { + root = this; + target = hash.target; + } else if (controller = options.data.keywords.controller) { + root = controller; + } + + action.target = { root: root, target: target, options: options }; + action.bubbles = hash.bubbles; + + var actionId = ActionHelper.registerAction(actionName, action, hash.allowedKeys); + return new SafeString('data-ember-action="' + actionId + '"'); + }); + +}); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-routing +*/ + +if (Ember.ENV.EXPERIMENTAL_CONTROL_HELPER) { + var get = Ember.get, set = Ember.set; + + /** + The control helper is currently under development and is considered experimental. + To enable it, set `ENV.EXPERIMENTAL_CONTROL_HELPER = true` before requiring Ember. + + @method control + @for Ember.Handlebars.helpers + @param {String} path + @param {String} modelPath + @param {Hash} options + @return {String} HTML string + */ + Ember.Handlebars.registerHelper('control', function(path, modelPath, options) { + if (arguments.length === 2) { + options = modelPath; + modelPath = undefined; + } + + var model; + + if (modelPath) { + model = Ember.Handlebars.get(this, modelPath, options); + } + + var controller = options.data.keywords.controller, + view = options.data.keywords.view, + children = get(controller, '_childContainers'), + controlID = options.hash.controlID, + container, subContainer; + + if (children.hasOwnProperty(controlID)) { + subContainer = children[controlID]; + } else { + container = get(controller, 'container'), + subContainer = container.child(); + children[controlID] = subContainer; + } + + var normalizedPath = path.replace(/\//g, '.'); + + var childView = subContainer.lookup('view:' + normalizedPath) || subContainer.lookup('view:default'), + childController = subContainer.lookup('controller:' + normalizedPath), + childTemplate = subContainer.lookup('template:' + path); + + Ember.assert("Could not find controller for path: " + normalizedPath, childController); + Ember.assert("Could not find view for path: " + normalizedPath, childView); + + set(childController, 'target', controller); + set(childController, 'model', model); + + options.hash.template = childTemplate; + options.hash.controller = childController; + + function observer() { + var model = Ember.Handlebars.get(this, modelPath, options); + set(childController, 'model', model); + childView.rerender(); + } + + if (modelPath) { + Ember.addObserver(this, modelPath, observer); + childView.one('willDestroyElement', this, function() { + Ember.removeObserver(this, modelPath, observer); + }); + } + + Ember.Handlebars.helpers.view.call(this, childView, options); + }); +} + +})(); + + + +(function() { + +})(); + + + +(function() { +/** +@module ember +@submodule ember-routing +*/ + +var get = Ember.get, set = Ember.set; + +Ember.ControllerMixin.reopen({ + /** + Transition the application into another route. The route may + be either a single route or route path: + + ```javascript + aController.transitionToRoute('blogPosts'); + aController.transitionToRoute('blogPosts.recentEntries'); + ``` + + Optionally supply a model for the route in question. The model + will be serialized into the URL using the `serialize` hook of + the route: + + ```javascript + aController.transitionToRoute('blogPost', aPost); + ``` + + @param {String} name the name of the route + @param {...Object} models the + @for Ember.ControllerMixin + @method transitionToRoute + */ + transitionToRoute: function() { + // target may be either another controller or a router + var target = get(this, 'target'), + method = target.transitionToRoute || target.transitionTo; + return method.apply(target, arguments); + }, + + /** + @deprecated + @for Ember.ControllerMixin + @method transitionTo + */ + transitionTo: function() { + Ember.deprecate("transitionTo is deprecated. Please use transitionToRoute."); + return this.transitionToRoute.apply(this, arguments); + }, + + replaceRoute: function() { + // target may be either another controller or a router + var target = get(this, 'target'), + method = target.replaceRoute || target.replaceWith; + return method.apply(target, arguments); + }, + + /** + @deprecated + @for Ember.ControllerMixin + @method replaceWith + */ + replaceWith: function() { + Ember.deprecate("replaceWith is deprecated. Please use replaceRoute."); + return this.replaceRoute.apply(this, arguments); + } +}); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-routing +*/ + +var get = Ember.get, set = Ember.set; + +Ember.View.reopen({ + init: function() { + set(this, '_outlets', {}); + this._super(); + }, + + connectOutlet: function(outletName, view) { + if (this._pendingDisconnections) { + delete this._pendingDisconnections[outletName]; + } + + if (this._hasEquivalentView(outletName, view)) { + view.destroy(); + return; + } + + var outlets = get(this, '_outlets'), + container = get(this, 'container'), + router = container && container.lookup('router:main'), + renderedName = get(view, 'renderedName'); + + set(outlets, outletName, view); + + if (router && renderedName) { + router._connectActiveView(renderedName, view); + } + }, + + _hasEquivalentView: function(outletName, view) { + var existingView = get(this, '_outlets.'+outletName); + return existingView && + existingView.constructor === view.constructor && + existingView.get('template') === view.get('template') && + existingView.get('context') === view.get('context'); + }, + + disconnectOutlet: function(outletName) { + if (!this._pendingDisconnections) { + this._pendingDisconnections = {}; + } + this._pendingDisconnections[outletName] = true; + Ember.run.once(this, '_finishDisconnections'); + }, + + _finishDisconnections: function() { + var outlets = get(this, '_outlets'); + var pendingDisconnections = this._pendingDisconnections; + this._pendingDisconnections = null; + + for (var outletName in pendingDisconnections) { + set(outlets, outletName, null); + } + } +}); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-views +*/ + +// Add a new named queue after the 'actions' queue (where RSVP promises +// resolve), which is used in router transitions to prevent unnecessary +// loading state entry if all context promises resolve on the +// 'actions' queue first. + +var queues = Ember.run.queues, + indexOf = Ember.ArrayPolyfills.indexOf; +queues.splice(indexOf.call(queues, 'actions') + 1, 0, 'routerTransitions'); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-routing +*/ + +var get = Ember.get, set = Ember.set; + +/* + This file implements the `location` API used by Ember's router. + + That API is: + + getURL: returns the current URL + setURL(path): sets the current URL + replaceURL(path): replace the current URL (optional) + onUpdateURL(callback): triggers the callback when the URL changes + formatURL(url): formats `url` to be placed into `href` attribute + + Calling setURL or replaceURL will not trigger onUpdateURL callbacks. + + TODO: This should perhaps be moved so that it's visible in the doc output. +*/ + +/** + Ember.Location returns an instance of the correct implementation of + the `location` API. + + You can pass it a `implementation` ('hash', 'history', 'none') to force a + particular implementation. + + @class Location + @namespace Ember + @static +*/ +Ember.Location = { + create: function(options) { + var implementation = options && options.implementation; + Ember.assert("Ember.Location.create: you must specify a 'implementation' option", !!implementation); + + var implementationClass = this.implementations[implementation]; + Ember.assert("Ember.Location.create: " + implementation + " is not a valid implementation", !!implementationClass); + + return implementationClass.create.apply(implementationClass, arguments); + }, + + registerImplementation: function(name, implementation) { + this.implementations[name] = implementation; + }, + + implementations: {} +}; + +})(); + + + +(function() { +/** +@module ember +@submodule ember-routing +*/ + +var get = Ember.get, set = Ember.set; + +/** + Ember.NoneLocation does not interact with the browser. It is useful for + testing, or when you need to manage state with your Router, but temporarily + don't want it to muck with the URL (for example when you embed your + application in a larger page). + + @class NoneLocation + @namespace Ember + @extends Ember.Object +*/ +Ember.NoneLocation = Ember.Object.extend({ + path: '', + + getURL: function() { + return get(this, 'path'); + }, + + setURL: function(path) { + set(this, 'path', path); + }, + + onUpdateURL: function(callback) { + this.updateCallback = callback; + }, + + handleURL: function(url) { + set(this, 'path', url); + this.updateCallback(url); + }, + + formatURL: function(url) { + // The return value is not overly meaningful, but we do not want to throw + // errors when test code renders templates containing {{action href=true}} + // helpers. + return url; + } +}); + +Ember.Location.registerImplementation('none', Ember.NoneLocation); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-routing +*/ + +var get = Ember.get, set = Ember.set; + +/** + Ember.HashLocation implements the location API using the browser's + hash. At present, it relies on a hashchange event existing in the + browser. + + @class HashLocation + @namespace Ember + @extends Ember.Object +*/ +Ember.HashLocation = Ember.Object.extend({ + + init: function() { + set(this, 'location', get(this, 'location') || window.location); + }, + + /** + @private + + Returns the current `location.hash`, minus the '#' at the front. + + @method getURL + */ + getURL: function() { + return get(this, 'location').hash.substr(1); + }, + + /** + @private + + Set the `location.hash` and remembers what was set. This prevents + `onUpdateURL` callbacks from triggering when the hash was set by + `HashLocation`. + + @method setURL + @param path {String} + */ + setURL: function(path) { + get(this, 'location').hash = path; + set(this, 'lastSetURL', path); + }, + + /** + @private + + Register a callback to be invoked when the hash changes. These + callbacks will execute when the user presses the back or forward + button, but not after `setURL` is invoked. + + @method onUpdateURL + @param callback {Function} + */ + onUpdateURL: function(callback) { + var self = this; + var guid = Ember.guidFor(this); + + Ember.$(window).on('hashchange.ember-location-'+guid, function() { + Ember.run(function() { + var path = location.hash.substr(1); + if (get(self, 'lastSetURL') === path) { return; } + + set(self, 'lastSetURL', null); + + callback(path); + }); + }); + }, + + /** + @private + + Given a URL, formats it to be placed into the page as part + of an element's `href` attribute. + + This is used, for example, when using the {{action}} helper + to generate a URL based on an event. + + @method formatURL + @param url {String} + */ + formatURL: function(url) { + return '#'+url; + }, + + willDestroy: function() { + var guid = Ember.guidFor(this); + + Ember.$(window).unbind('hashchange.ember-location-'+guid); + } +}); + +Ember.Location.registerImplementation('hash', Ember.HashLocation); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-routing +*/ + +var get = Ember.get, set = Ember.set; +var popstateFired = false; + +/** + Ember.HistoryLocation implements the location API using the browser's + history.pushState API. + + @class HistoryLocation + @namespace Ember + @extends Ember.Object +*/ +Ember.HistoryLocation = Ember.Object.extend({ + + init: function() { + set(this, 'location', get(this, 'location') || window.location); + this.initState(); + }, + + /** + @private + + Used to set state on first call to setURL + + @method initState + */ + initState: function() { + set(this, 'history', get(this, 'history') || window.history); + this.replaceState(this.formatURL(this.getURL())); + }, + + /** + Will be pre-pended to path upon state change + + @property rootURL + @default '/' + */ + rootURL: '/', + + /** + @private + + Returns the current `location.pathname` without rootURL + + @method getURL + */ + getURL: function() { + var rootURL = get(this, 'rootURL'), + url = get(this, 'location').pathname; + + rootURL = rootURL.replace(/\/$/, ''); + url = url.replace(rootURL, ''); + + return url; + }, + + /** + @private + + Uses `history.pushState` to update the url without a page reload. + + @method setURL + @param path {String} + */ + setURL: function(path) { + path = this.formatURL(path); + + if (this.getState() && this.getState().path !== path) { + this.pushState(path); + } + }, + + /** + @private + + Uses `history.replaceState` to update the url without a page reload + or history modification. + + @method replaceURL + @param path {String} + */ + replaceURL: function(path) { + path = this.formatURL(path); + + if (this.getState() && this.getState().path !== path) { + this.replaceState(path); + } + }, + + /** + @private + + Get the current `history.state` + + @method getState + */ + getState: function() { + return get(this, 'history').state; + }, + + /** + @private + + Pushes a new state + + @method pushState + @param path {String} + */ + pushState: function(path) { + get(this, 'history').pushState({ path: path }, null, path); + // used for webkit workaround + this._previousURL = this.getURL(); + }, + + /** + @private + + Replaces the current state + + @method replaceState + @param path {String} + */ + replaceState: function(path) { + get(this, 'history').replaceState({ path: path }, null, path); + // used for webkit workaround + this._previousURL = this.getURL(); + }, + + /** + @private + + Register a callback to be invoked whenever the browser + history changes, including using forward and back buttons. + + @method onUpdateURL + @param callback {Function} + */ + onUpdateURL: function(callback) { + var guid = Ember.guidFor(this), + self = this; + + Ember.$(window).on('popstate.ember-location-'+guid, function(e) { + // Ignore initial page load popstate event in Chrome + if(!popstateFired) { + popstateFired = true; + if (self.getURL() === self._previousURL) { return; } + } + callback(self.getURL()); + }); + }, + + /** + @private + + Used when using `{{action}}` helper. The url is always appended to the rootURL. + + @method formatURL + @param url {String} + */ + formatURL: function(url) { + var rootURL = get(this, 'rootURL'); + + if (url !== '') { + rootURL = rootURL.replace(/\/$/, ''); + } + + return rootURL + url; + }, + + willDestroy: function() { + var guid = Ember.guidFor(this); + + Ember.$(window).unbind('popstate.ember-location-'+guid); + } +}); + +Ember.Location.registerImplementation('history', Ember.HistoryLocation); + +})(); + + + +(function() { + +})(); + + + +(function() { +/** +Ember Routing + +@module ember +@submodule ember-routing +@requires ember-states +@requires ember-views +*/ + +})(); + +(function() { +function visit(vertex, fn, visited, path) { + var name = vertex.name, + vertices = vertex.incoming, + names = vertex.incomingNames, + len = names.length, + i; + if (!visited) { + visited = {}; + } + if (!path) { + path = []; + } + if (visited.hasOwnProperty(name)) { + return; + } + path.push(name); + visited[name] = true; + for (i = 0; i < len; i++) { + visit(vertices[names[i]], fn, visited, path); + } + fn(vertex, path); + path.pop(); +} + +function DAG() { + this.names = []; + this.vertices = {}; +} + +DAG.prototype.add = function(name) { + if (!name) { return; } + if (this.vertices.hasOwnProperty(name)) { + return this.vertices[name]; + } + var vertex = { + name: name, incoming: {}, incomingNames: [], hasOutgoing: false, value: null + }; + this.vertices[name] = vertex; + this.names.push(name); + return vertex; +}; + +DAG.prototype.map = function(name, value) { + this.add(name).value = value; +}; + +DAG.prototype.addEdge = function(fromName, toName) { + if (!fromName || !toName || fromName === toName) { + return; + } + var from = this.add(fromName), to = this.add(toName); + if (to.incoming.hasOwnProperty(fromName)) { + return; + } + function checkCycle(vertex, path) { + if (vertex.name === toName) { + throw new Error("cycle detected: " + toName + " <- " + path.join(" <- ")); + } + } + visit(from, checkCycle); + from.hasOutgoing = true; + to.incoming[fromName] = from; + to.incomingNames.push(fromName); +}; + +DAG.prototype.topsort = function(fn) { + var visited = {}, + vertices = this.vertices, + names = this.names, + len = names.length, + i, vertex; + for (i = 0; i < len; i++) { + vertex = vertices[names[i]]; + if (!vertex.hasOutgoing) { + visit(vertex, fn, visited); + } + } +}; + +DAG.prototype.addEdges = function(name, value, before, after) { + var i; + this.map(name, value); + if (before) { + if (typeof before === 'string') { + this.addEdge(name, before); + } else { + for (i = 0; i < before.length; i++) { + this.addEdge(name, before[i]); + } + } + } + if (after) { + if (typeof after === 'string') { + this.addEdge(after, name); + } else { + for (i = 0; i < after.length; i++) { + this.addEdge(after[i], name); + } + } + } +}; + +Ember.DAG = DAG; + +})(); + + + +(function() { +/** +@module ember +@submodule ember-application +*/ + +var get = Ember.get, + classify = Ember.String.classify, + capitalize = Ember.String.capitalize, + decamelize = Ember.String.decamelize; + +/** + The DefaultResolver defines the default lookup rules to resolve + container lookups before consulting the container for registered + items: + + * templates are looked up on `Ember.TEMPLATES` + * other names are looked up on the application after converting + the name. For example, `controller:post` looks up + `App.PostController` by default. + * there are some nuances (see examples below) + + ### How Resolving Works + + The container calls this object's `resolve` method with the + `fullName` argument. + + It first parses the fullName into an object using `parseName`. + + Then it checks for the presence of a type-specific instance + method of the form `resolve[Type]` and calls it if it exists. + For example if it was resolving 'template:post', it would call + the `resolveTemplate` method. + + Its last resort is to call the `resolveOther` method. + + The methods of this object are designed to be easy to override + in a subclass. For example, you could enhance how a template + is resolved like so: + + ```javascript + App = Ember.Application.create({ + resolver: Ember.DefaultResolver.extend({ + resolveTemplate: function(parsedName) { + var resolvedTemplate = this._super(parsedName); + if (resolvedTemplate) { return resolvedTemplate; } + return Ember.TEMPLATES['not_found']; + } + }) + }); + ``` + + Some examples of how names are resolved: + + ``` + 'template:post' //=> Ember.TEMPLATES['post'] + 'template:posts/byline' //=> Ember.TEMPLATES['posts/byline'] + 'template:posts.byline' //=> Ember.TEMPLATES['posts/byline'] + 'template:blogPost' //=> Ember.TEMPLATES['blogPost'] + // OR + // Ember.TEMPLATES['blog_post'] + 'controller:post' //=> App.PostController + 'controller:posts.index' //=> App.PostsIndexController + 'controller:blog/post' //=> Blog.PostController + 'controller:basic' //=> Ember.Controller + 'route:post' //=> App.PostRoute + 'route:posts.index' //=> App.PostsIndexRoute + 'route:blog/post' //=> Blog.PostRoute + 'route:basic' //=> Ember.Route + 'view:post' //=> App.PostView + 'view:posts.index' //=> App.PostsIndexView + 'view:blog/post' //=> Blog.PostView + 'view:basic' //=> Ember.View + 'foo:post' //=> App.PostFoo + ``` + + @class DefaultResolver + @namespace Ember + @extends Ember.Object +*/ +Ember.DefaultResolver = Ember.Object.extend({ + /** + This will be set to the Application instance when it is + created. + + @property namespace + */ + namespace: null, + /** + This method is called via the container's resolver method. + It parses the provided `fullName` and then looks up and + returns the appropriate template or class. + + @method resolve + @param {String} fullName the lookup string + @return {Object} the resolved factory + */ + resolve: function(fullName) { + var parsedName = this.parseName(fullName), + typeSpecificResolveMethod = this[parsedName.resolveMethodName]; + if (typeSpecificResolveMethod) { + var resolved = typeSpecificResolveMethod.call(this, parsedName); + if (resolved) { return resolved; } + } + return this.resolveOther(parsedName); + }, + /** + Convert the string name of the form "type:name" to + a Javascript object with the parsed aspects of the name + broken out. + + @protected + @method parseName + */ + parseName: function(fullName) { + var nameParts = fullName.split(":"), + type = nameParts[0], fullNameWithoutType = nameParts[1], + name = fullNameWithoutType, + namespace = get(this, 'namespace'), + root = namespace; + + if (type !== 'template' && name.indexOf('/') !== -1) { + var parts = name.split('/'); + name = parts[parts.length - 1]; + var namespaceName = capitalize(parts.slice(0, -1).join('.')); + root = Ember.Namespace.byName(namespaceName); + + Ember.assert('You are looking for a ' + name + ' ' + type + ' in the ' + namespaceName + ' namespace, but the namespace could not be found', root); + } + + return { + fullName: fullName, + type: type, + fullNameWithoutType: fullNameWithoutType, + name: name, + root: root, + resolveMethodName: "resolve" + classify(type) + }; + }, + /** + Look up the template in Ember.TEMPLATES + + @protected + @method resolveTemplate + */ + resolveTemplate: function(parsedName) { + var templateName = parsedName.fullNameWithoutType.replace(/\./g, '/'); + + if (Ember.TEMPLATES[templateName]) { + return Ember.TEMPLATES[templateName]; + } + + templateName = decamelize(templateName); + if (Ember.TEMPLATES[templateName]) { + return Ember.TEMPLATES[templateName]; + } + }, + /** + Given a parseName object (output from `parseName`), apply + the conventions expected by `Ember.Router` + + @protected + @method useRouterNaming + */ + useRouterNaming: function(parsedName) { + parsedName.name = parsedName.name.replace(/\./g, '_'); + if (parsedName.name === 'basic') { + parsedName.name = ''; + } + }, + /** + @protected + @method resolveController + */ + resolveController: function(parsedName) { + this.useRouterNaming(parsedName); + return this.resolveOther(parsedName); + }, + /** + @protected + @method resolveRoute + */ + resolveRoute: function(parsedName) { + this.useRouterNaming(parsedName); + return this.resolveOther(parsedName); + }, + /** + @protected + @method resolveView + */ + resolveView: function(parsedName) { + this.useRouterNaming(parsedName); + return this.resolveOther(parsedName); + }, + /** + Look up the specified object (from parsedName) on the appropriate + namespace (usually on the Application) + + @protected + @method resolveOther + */ + resolveOther: function(parsedName) { + var className = classify(parsedName.name) + classify(parsedName.type), + factory = get(parsedName.root, className); + if (factory) { return factory; } + } +}); + +})(); + + + +(function() { +/** +@module ember +@submodule ember-application +*/ + +var get = Ember.get, set = Ember.set; + +function DeprecatedContainer(container) { + this._container = container; +} + +DeprecatedContainer.deprecate = function(method) { + return function() { + var container = this._container; + + Ember.deprecate('Using the defaultContainer is no longer supported. [defaultContainer#' + method + '] see: http://git.io/EKPpnA', false); + return container[method].apply(container, arguments); + }; +}; + +DeprecatedContainer.prototype = { + _container: null, + lookup: DeprecatedContainer.deprecate('lookup'), + resolve: DeprecatedContainer.deprecate('resolve'), + register: DeprecatedContainer.deprecate('register') +}; + +/** + An instance of `Ember.Application` is the starting point for every Ember + application. It helps to instantiate, initialize and coordinate the many + objects that make up your app. + + Each Ember app has one and only one `Ember.Application` object. In fact, the + very first thing you should do in your application is create the instance: + + ```javascript + window.App = Ember.Application.create(); + ``` + + Typically, the application object is the only global variable. All other + classes in your app should be properties on the `Ember.Application` instance, + which highlights its first role: a global namespace. + + For example, if you define a view class, it might look like this: + + ```javascript + App.MyView = Ember.View.extend(); + ``` + + By default, calling `Ember.Application.create()` will automatically initialize + your application by calling the `Ember.Application.initialize()` method. If + you need to delay initialization, you can call your app's `deferReadiness()` + method. When you are ready for your app to be initialized, call its + `advanceReadiness()` method. + + You can define a `ready` method on the `Ember.Application` instance, which + will be run by Ember when the application is initialized. + + Because `Ember.Application` inherits from `Ember.Namespace`, any classes + you create will have useful string representations when calling `toString()`. + See the `Ember.Namespace` documentation for more information. + + While you can think of your `Ember.Application` as a container that holds the + other classes in your application, there are several other responsibilities + going on under-the-hood that you may want to understand. + + ### Event Delegation + + Ember uses a technique called _event delegation_. This allows the framework + to set up a global, shared event listener instead of requiring each view to + do it manually. For example, instead of each view registering its own + `mousedown` listener on its associated element, Ember sets up a `mousedown` + listener on the `body`. + + If a `mousedown` event occurs, Ember will look at the target of the event and + start walking up the DOM node tree, finding corresponding views and invoking + their `mouseDown` method as it goes. + + `Ember.Application` has a number of default events that it listens for, as + well as a mapping from lowercase events to camel-cased view method names. For + example, the `keypress` event causes the `keyPress` method on the view to be + called, the `dblclick` event causes `doubleClick` to be called, and so on. + + If there is a browser event that Ember does not listen for by default, you + can specify custom events and their corresponding view method names by + setting the application's `customEvents` property: + + ```javascript + App = Ember.Application.create({ + customEvents: { + // add support for the loadedmetadata media + // player event + 'loadedmetadata': "loadedMetadata" + } + }); + ``` + + By default, the application sets up these event listeners on the document + body. However, in cases where you are embedding an Ember application inside + an existing page, you may want it to set up the listeners on an element + inside the body. + + For example, if only events inside a DOM element with the ID of `ember-app` + should be delegated, set your application's `rootElement` property: + + ```javascript + window.App = Ember.Application.create({ + rootElement: '#ember-app' + }); + ``` + + The `rootElement` can be either a DOM element or a jQuery-compatible selector + string. Note that *views appended to the DOM outside the root element will + not receive events.* If you specify a custom root element, make sure you only + append views inside it! + + To learn more about the advantages of event delegation and the Ember view + layer, and a list of the event listeners that are setup by default, visit the + [Ember View Layer guide](http://emberjs.com/guides/understanding-ember/the-view-layer/#toc_event-delegation). + + ### Initializers + + Libraries on top of Ember can register additional initializers, like so: + + ```javascript + Ember.Application.initializer({ + name: "store", + + initialize: function(container, application) { + container.register('store:main', application.Store); + } + }); + ``` + + ### Routing + + In addition to creating your application's router, `Ember.Application` is + also responsible for telling the router when to start routing. Transitions + between routes can be logged with the LOG_TRANSITIONS flag, and more + detailed intra-transition logging can be logged with + the LOG_TRANSITIONS_INTERNAL flag: + + ```javascript + window.App = Ember.Application.create({ + LOG_TRANSITIONS: true, // basic logging of successful transitions + LOG_TRANSITIONS_INTERNAL: true // detailed logging of all routing steps + }); + ``` + + By default, the router will begin trying to translate the current URL into + application state once the browser emits the `DOMContentReady` event. If you + need to defer routing, you can call the application's `deferReadiness()` + method. Once routing can begin, call the `advanceReadiness()` method. + + If there is any setup required before routing begins, you can implement a + `ready()` method on your app that will be invoked immediately before routing + begins. + ``` + + @class Application + @namespace Ember + @extends Ember.Namespace +*/ + +var Application = Ember.Application = Ember.Namespace.extend(Ember.DeferredMixin, { + + /** + The root DOM element of the Application. This can be specified as an + element or a + [jQuery-compatible selector string](http://api.jquery.com/category/selectors/). + + This is the element that will be passed to the Application's, + `eventDispatcher`, which sets up the listeners for event delegation. Every + view in your application should be a child of the element you specify here. + + @property rootElement + @type DOMElement + @default 'body' + */ + rootElement: 'body', + + /** + The `Ember.EventDispatcher` responsible for delegating events to this + application's views. + + The event dispatcher is created by the application at initialization time + and sets up event listeners on the DOM element described by the + application's `rootElement` property. + + See the documentation for `Ember.EventDispatcher` for more information. + + @property eventDispatcher + @type Ember.EventDispatcher + @default null + */ + eventDispatcher: null, + + /** + The DOM events for which the event dispatcher should listen. + + By default, the application's `Ember.EventDispatcher` listens + for a set of standard DOM events, such as `mousedown` and + `keyup`, and delegates them to your application's `Ember.View` + instances. + + If you would like additional events to be delegated to your + views, set your `Ember.Application`'s `customEvents` property + to a hash containing the DOM event name as the key and the + corresponding view method name as the value. For example: + + ```javascript + App = Ember.Application.create({ + customEvents: { + // add support for the loadedmetadata media + // player event + 'loadedmetadata': "loadedMetadata" + } + }); + ``` + + @property customEvents + @type Object + @default null + */ + customEvents: null, + + // Start off the number of deferrals at 1. This will be + // decremented by the Application's own `initialize` method. + _readinessDeferrals: 1, + + init: function() { + if (!this.$) { this.$ = Ember.$; } + this.__container__ = this.buildContainer(); + + this.Router = this.Router || this.defaultRouter(); + if (this.Router) { this.Router.namespace = this; } + + this._super(); + + this.scheduleInitialize(); + + if ( Ember.LOG_VERSION ) { + Ember.LOG_VERSION = false; // we only need to see this once per Application#init + Ember.debug('-------------------------------'); + Ember.debug('Ember.VERSION : ' + Ember.VERSION); + Ember.debug('Handlebars.VERSION : ' + Ember.Handlebars.VERSION); + Ember.debug('jQuery.VERSION : ' + Ember.$().jquery); + Ember.debug('-------------------------------'); + } + }, + + /** + @private + + Build the container for the current application. + + Also register a default application view in case the application + itself does not. + + @method buildContainer + @return {Ember.Container} the configured container + */ + buildContainer: function() { + var container = this.__container__ = Application.buildContainer(this); + + return container; + }, + + /** + @private + + If the application has not opted out of routing and has not explicitly + defined a router, supply a default router for the application author + to configure. + + This allows application developers to do: + + ```javascript + var App = Ember.Application.create(); + + App.Router.map(function() { + this.resource('posts'); + }); + ``` + + @method defaultRouter + @return {Ember.Router} the default router + */ + defaultRouter: function() { + // Create a default App.Router if one was not supplied to make + // it possible to do App.Router.map(...) without explicitly + // creating a router first. + if (this.router === undefined) { + return Ember.Router.extend(); + } + }, + + /** + @private + + Automatically initialize the application once the DOM has + become ready. + + The initialization itself is scheduled on the actions queue + which ensures that application loading finishes before + booting. + + If you are asynchronously loading code, you should call + `deferReadiness()` to defer booting, and then call + `advanceReadiness()` once all of your code has finished + loading. + + @method scheduleInitialize + */ + scheduleInitialize: function() { + var self = this; + + if (!this.$ || this.$.isReady) { + Ember.run.schedule('actions', self, '_initialize'); + } else { + this.$().ready(function(){ + Ember.run(self, '_initialize'); + }); + } + }, + + /** + Use this to defer readiness until some condition is true. + + Example: + + ```javascript + App = Ember.Application.create(); + App.deferReadiness(); + + jQuery.getJSON("/auth-token", function(token) { + App.token = token; + App.advanceReadiness(); + }); + ``` + + This allows you to perform asynchronous setup logic and defer + booting your application until the setup has finished. + + However, if the setup requires a loading UI, it might be better + to use the router for this purpose. + + @method deferReadiness + */ + deferReadiness: function() { + Ember.assert("You cannot defer readiness since the `ready()` hook has already been called.", this._readinessDeferrals > 0); + this._readinessDeferrals++; + }, + + /** + @method advanceReadiness + @see {Ember.Application#deferReadiness} + */ + advanceReadiness: function() { + this._readinessDeferrals--; + + if (this._readinessDeferrals === 0) { + Ember.run.once(this, this.didBecomeReady); + } + }, + + /** + registers a factory for later injection + + Example: + + ```javascript + App = Ember.Application.create(); + + App.Person = Ember.Object.extend({}); + App.Orange = Ember.Object.extend({}); + App.Email = Ember.Object.extend({}); + + App.register('model:user', App.Person, {singleton: false }); + App.register('fruit:favorite', App.Orange); + App.register('communication:main', App.Email, {singleton: false}); + ``` + + @method register + @param type {String} + @param name {String} + @param factory {String} + @param options {String} (optional) + **/ + register: function() { + var container = this.__container__; + container.register.apply(container, arguments); + }, + /** + defines an injection or typeInjection + + Example: + + ```javascript + App.inject(, , ) + App.inject('model:user', 'email', 'model:email') + App.inject('model', 'source', 'source:main') + ``` + + @method inject + @param factoryNameOrType {String} + @param property {String} + @param injectionName {String} + **/ + inject: function(){ + var container = this.__container__; + container.injection.apply(container, arguments); + }, + + /** + @private + @deprecated + + Calling initialize manually is not supported. + + Please see Ember.Application#advanceReadiness and + Ember.Application#deferReadiness. + + @method initialize + **/ + initialize: function(){ + Ember.deprecate('Calling initialize manually is not supported. Please see Ember.Application#advanceReadiness and Ember.Application#deferReadiness'); + }, + /** + @private + + Initialize the application. This happens automatically. + + Run any initializers and run the application load hook. These hooks may + choose to defer readiness. For example, an authentication hook might want + to defer readiness until the auth token has been retrieved. + + @method _initialize + */ + _initialize: function() { + if (this.isDestroyed) { return; } + + // At this point, the App.Router must already be assigned + this.register('router:main', this.Router); + + this.runInitializers(); + Ember.runLoadHooks('application', this); + + // At this point, any initializers or load hooks that would have wanted + // to defer readiness have fired. In general, advancing readiness here + // will proceed to didBecomeReady. + this.advanceReadiness(); + + return this; + }, + + /** + Reset the application. This is typically used only in tests. It cleans up + the application in the following order: + + 1. Deactivate existing routes + 2. Destroy all objects in the container + 3. Create a new application container + 4. Re-route to the existing url + + Typical Example: + + ```javascript + + var App; + + Ember.run(function(){ + App = Ember.Application.create(); + }); + + module("acceptance test", { + setup: function() { + App.reset(); + } + }); + + test("first test", function(){ + // App is freshly reset + }); + + test("first test", function(){ + // App is again freshly reset + }); + ``` + + Advanced Example: + + Occasionally you may want to prevent the app from initializing during + setup. This could enable extra configuration, or enable asserting prior + to the app becoming ready. + + ```javascript + + var App; + + Ember.run(function(){ + App = Ember.Application.create(); + }); + + module("acceptance test", { + setup: function() { + Ember.run(function() { + App.reset(); + App.deferReadiness(); + }); + } + }); + + test("first test", function(){ + ok(true, 'something before app is initialized'); + + Ember.run(function(){ + App.advanceReadiness(); + }); + ok(true, 'something after app is initialized'); + }); + ``` + + @method reset + **/ + reset: function() { + this._readinessDeferrals = 1; + + function handleReset() { + var router = this.__container__.lookup('router:main'); + router.reset(); + + Ember.run(this.__container__, 'destroy'); + + this.buildContainer(); + + Ember.run.schedule('actions', this, function(){ + this._initialize(); + this.startRouting(); + }); + } + + Ember.run.join(this, handleReset); + }, + + /** + @private + @method runInitializers + */ + runInitializers: function() { + var initializers = get(this.constructor, 'initializers'), + container = this.__container__, + graph = new Ember.DAG(), + namespace = this, + i, initializer; + + for (i=0; i -1) { + result = result.replace(/\.(.)/g, function(m) { return m.charAt(1).toUpperCase(); }); + } + + if (name.indexOf('_') > -1) { + result = result.replace(/_(.)/g, function(m) { return m.charAt(1).toUpperCase(); }); + } + + return type + ':' + result; + } else { + return fullName; + } +} + +Ember.runLoadHooks('Ember.Application', Ember.Application); + +})(); + + + +(function() { + +})(); + + + +(function() { +/** +@module ember +@submodule ember-application +*/ + +var get = Ember.get, set = Ember.set; +var ControllersProxy = Ember.Object.extend({ + controller: null, + + unknownProperty: function(controllerName) { + var controller = get(this, 'controller'), + needs = get(controller, 'needs'), + container = controller.get('container'), + dependency; + + for (var i=0, l=needs.length; i` state will be added to the list of enter and exit + // states because its context has changed. + + while (contexts.length > 0) { + if (stateIdx >= 0) { + state = this.enterStates[stateIdx--]; + } else { + if (this.enterStates.length) { + state = get(this.enterStates[0], 'parentState'); + if (!state) { throw "Cannot match all contexts to states"; } + } else { + // If re-entering the current state with a context, the resolve + // state will be the current state. + state = this.resolveState; + } + + this.enterStates.unshift(state); + this.exitStates.unshift(state); + } + + // in routers, only states with dynamic segments have a context + if (get(state, 'hasContext')) { + context = contexts.pop(); + } else { + context = null; + } + + matchedContexts.unshift(context); + } + + this.contexts = matchedContexts; + }, + + /** + Add any `initialState`s to the list of enter states. + + @method addInitialStates + */ + addInitialStates: function() { + var finalState = this.finalState, initialState; + + while(true) { + initialState = get(finalState, 'initialState') || 'start'; + finalState = get(finalState, 'states.' + initialState); + + if (!finalState) { break; } + + this.finalState = finalState; + this.enterStates.push(finalState); + this.contexts.push(undefined); + } + }, + + /** + Remove any states that were added because the number of contexts + exceeded the number of explicit enter states, but the context has + not changed since the last time the state was entered. + + @method removeUnchangedContexts + @param {Ember.StateManager} manager passed in to look up the last + context for a states + */ + removeUnchangedContexts: function(manager) { + // Start from the beginning of the enter states. If the state was added + // to the list during the context matching phase, make sure the context + // has actually changed since the last time the state was entered. + while (this.enterStates.length > 0) { + if (this.enterStates[0] !== this.exitStates[0]) { break; } + + if (this.enterStates.length === this.contexts.length) { + if (manager.getStateMeta(this.enterStates[0], 'context') !== this.contexts[0]) { break; } + this.contexts.shift(); + } + + this.resolveState = this.enterStates.shift(); + this.exitStates.shift(); + } + } +}; + +var sendRecursively = function(event, currentState, isUnhandledPass) { + var log = this.enableLogging, + eventName = isUnhandledPass ? 'unhandledEvent' : event, + action = currentState[eventName], + contexts, sendRecursiveArguments, actionArguments; + + contexts = [].slice.call(arguments, 3); + + // Test to see if the action is a method that + // can be invoked. Don't blindly check just for + // existence, because it is possible the state + // manager has a child state of the given name, + // and we should still raise an exception in that + // case. + if (typeof action === 'function') { + if (log) { + if (isUnhandledPass) { + Ember.Logger.log(fmt("STATEMANAGER: Unhandled event '%@' being sent to state %@.", [event, get(currentState, 'path')])); + } else { + Ember.Logger.log(fmt("STATEMANAGER: Sending event '%@' to state %@.", [event, get(currentState, 'path')])); + } + } + + actionArguments = contexts; + if (isUnhandledPass) { + actionArguments.unshift(event); + } + actionArguments.unshift(this); + + return action.apply(currentState, actionArguments); + } else { + var parentState = get(currentState, 'parentState'); + if (parentState) { + + sendRecursiveArguments = contexts; + sendRecursiveArguments.unshift(event, parentState, isUnhandledPass); + + return sendRecursively.apply(this, sendRecursiveArguments); + } else if (!isUnhandledPass) { + return sendEvent.call(this, event, contexts, true); + } + } +}; + +var sendEvent = function(eventName, sendRecursiveArguments, isUnhandledPass) { + sendRecursiveArguments.unshift(eventName, get(this, 'currentState'), isUnhandledPass); + return sendRecursively.apply(this, sendRecursiveArguments); +}; + +/** + StateManager is part of Ember's implementation of a finite state machine. A + StateManager instance manages a number of properties that are instances of + `Ember.State`, + tracks the current active state, and triggers callbacks when states have changed. + + ## Defining States + + The states of StateManager can be declared in one of two ways. First, you can + define a `states` property that contains all the states: + + ```javascript + managerA = Ember.StateManager.create({ + states: { + stateOne: Ember.State.create(), + stateTwo: Ember.State.create() + } + }) + + managerA.get('states') + // { + // stateOne: Ember.State.create(), + // stateTwo: Ember.State.create() + // } + ``` + + You can also add instances of `Ember.State` (or an `Ember.State` subclass) + directly as properties of a StateManager. These states will be collected into + the `states` property for you. + + ```javascript + managerA = Ember.StateManager.create({ + stateOne: Ember.State.create(), + stateTwo: Ember.State.create() + }) + + managerA.get('states') + // { + // stateOne: Ember.State.create(), + // stateTwo: Ember.State.create() + // } + ``` + + ## The Initial State + + When created a StateManager instance will immediately enter into the state + defined as its `start` property or the state referenced by name in its + `initialState` property: + + ```javascript + managerA = Ember.StateManager.create({ + start: Ember.State.create({}) + }) + + managerA.get('currentState.name') // 'start' + + managerB = Ember.StateManager.create({ + initialState: 'beginHere', + beginHere: Ember.State.create({}) + }) + + managerB.get('currentState.name') // 'beginHere' + ``` + + Because it is a property you may also provide a computed function if you wish + to derive an `initialState` programmatically: + + ```javascript + managerC = Ember.StateManager.create({ + initialState: function(){ + if (someLogic) { + return 'active'; + } else { + return 'passive'; + } + }.property(), + active: Ember.State.create({}), + passive: Ember.State.create({}) + }) + ``` + + ## Moving Between States + + A StateManager can have any number of `Ember.State` objects as properties + and can have a single one of these states as its current state. + + Calling `transitionTo` transitions between states: + + ```javascript + robotManager = Ember.StateManager.create({ + initialState: 'poweredDown', + poweredDown: Ember.State.create({}), + poweredUp: Ember.State.create({}) + }) + + robotManager.get('currentState.name') // 'poweredDown' + robotManager.transitionTo('poweredUp') + robotManager.get('currentState.name') // 'poweredUp' + ``` + + Before transitioning into a new state the existing `currentState` will have + its `exit` method called with the StateManager instance as its first argument + and an object representing the transition as its second argument. + + After transitioning into a new state the new `currentState` will have its + `enter` method called with the StateManager instance as its first argument + and an object representing the transition as its second argument. + + ```javascript + robotManager = Ember.StateManager.create({ + initialState: 'poweredDown', + poweredDown: Ember.State.create({ + exit: function(stateManager){ + console.log("exiting the poweredDown state") + } + }), + poweredUp: Ember.State.create({ + enter: function(stateManager){ + console.log("entering the poweredUp state. Destroy all humans.") + } + }) + }) + + robotManager.get('currentState.name') // 'poweredDown' + robotManager.transitionTo('poweredUp') + + // will log + // 'exiting the poweredDown state' + // 'entering the poweredUp state. Destroy all humans.' + ``` + + Once a StateManager is already in a state, subsequent attempts to enter that + state will not trigger enter or exit method calls. Attempts to transition + into a state that the manager does not have will result in no changes in the + StateManager's current state: + + ```javascript + robotManager = Ember.StateManager.create({ + initialState: 'poweredDown', + poweredDown: Ember.State.create({ + exit: function(stateManager){ + console.log("exiting the poweredDown state") + } + }), + poweredUp: Ember.State.create({ + enter: function(stateManager){ + console.log("entering the poweredUp state. Destroy all humans.") + } + }) + }) + + robotManager.get('currentState.name') // 'poweredDown' + robotManager.transitionTo('poweredUp') + // will log + // 'exiting the poweredDown state' + // 'entering the poweredUp state. Destroy all humans.' + robotManager.transitionTo('poweredUp') // no logging, no state change + + robotManager.transitionTo('someUnknownState') // silently fails + robotManager.get('currentState.name') // 'poweredUp' + ``` + + Each state property may itself contain properties that are instances of + `Ember.State`. The StateManager can transition to specific sub-states in a + series of transitionTo method calls or via a single transitionTo with the + full path to the specific state. The StateManager will also keep track of the + full path to its currentState + + ```javascript + robotManager = Ember.StateManager.create({ + initialState: 'poweredDown', + poweredDown: Ember.State.create({ + charging: Ember.State.create(), + charged: Ember.State.create() + }), + poweredUp: Ember.State.create({ + mobile: Ember.State.create(), + stationary: Ember.State.create() + }) + }) + + robotManager.get('currentState.name') // 'poweredDown' + + robotManager.transitionTo('poweredUp') + robotManager.get('currentState.name') // 'poweredUp' + + robotManager.transitionTo('mobile') + robotManager.get('currentState.name') // 'mobile' + + // transition via a state path + robotManager.transitionTo('poweredDown.charging') + robotManager.get('currentState.name') // 'charging' + + robotManager.get('currentState.path') // 'poweredDown.charging' + ``` + + Enter transition methods will be called for each state and nested child state + in their hierarchical order. Exit methods will be called for each state and + its nested states in reverse hierarchical order. + + Exit transitions for a parent state are not called when entering into one of + its child states, only when transitioning to a new section of possible states + in the hierarchy. + + ```javascript + robotManager = Ember.StateManager.create({ + initialState: 'poweredDown', + poweredDown: Ember.State.create({ + enter: function(){}, + exit: function(){ + console.log("exited poweredDown state") + }, + charging: Ember.State.create({ + enter: function(){}, + exit: function(){} + }), + charged: Ember.State.create({ + enter: function(){ + console.log("entered charged state") + }, + exit: function(){ + console.log("exited charged state") + } + }) + }), + poweredUp: Ember.State.create({ + enter: function(){ + console.log("entered poweredUp state") + }, + exit: function(){}, + mobile: Ember.State.create({ + enter: function(){ + console.log("entered mobile state") + }, + exit: function(){} + }), + stationary: Ember.State.create({ + enter: function(){}, + exit: function(){} + }) + }) + }) + + + robotManager.get('currentState.path') // 'poweredDown' + robotManager.transitionTo('charged') + // logs 'entered charged state' + // but does *not* log 'exited poweredDown state' + robotManager.get('currentState.name') // 'charged + + robotManager.transitionTo('poweredUp.mobile') + // logs + // 'exited charged state' + // 'exited poweredDown state' + // 'entered poweredUp state' + // 'entered mobile state' + ``` + + During development you can set a StateManager's `enableLogging` property to + `true` to receive console messages of state transitions. + + ```javascript + robotManager = Ember.StateManager.create({ + enableLogging: true + }) + ``` + + ## Managing currentState with Actions + + To control which transitions are possible for a given state, and + appropriately handle external events, the StateManager can receive and + route action messages to its states via the `send` method. Calling to + `send` with an action name will begin searching for a method with the same + name starting at the current state and moving up through the parent states + in a state hierarchy until an appropriate method is found or the StateManager + instance itself is reached. + + If an appropriately named method is found it will be called with the state + manager as the first argument and an optional `context` object as the second + argument. + + ```javascript + managerA = Ember.StateManager.create({ + initialState: 'stateOne.substateOne.subsubstateOne', + stateOne: Ember.State.create({ + substateOne: Ember.State.create({ + anAction: function(manager, context){ + console.log("an action was called") + }, + subsubstateOne: Ember.State.create({}) + }) + }) + }) + + managerA.get('currentState.name') // 'subsubstateOne' + managerA.send('anAction') + // 'stateOne.substateOne.subsubstateOne' has no anAction method + // so the 'anAction' method of 'stateOne.substateOne' is called + // and logs "an action was called" + // with managerA as the first argument + // and no second argument + + someObject = {} + managerA.send('anAction', someObject) + // the 'anAction' method of 'stateOne.substateOne' is called again + // with managerA as the first argument and + // someObject as the second argument. + ``` + + If the StateManager attempts to send an action but does not find an appropriately named + method in the current state or while moving upwards through the state hierarchy, it will + repeat the process looking for a `unhandledEvent` method. If an `unhandledEvent` method is + found, it will be called with the original event name as the second argument. If an + `unhandledEvent` method is not found, the StateManager will throw a new Ember.Error. + + ```javascript + managerB = Ember.StateManager.create({ + initialState: 'stateOne.substateOne.subsubstateOne', + stateOne: Ember.State.create({ + substateOne: Ember.State.create({ + subsubstateOne: Ember.State.create({}), + unhandledEvent: function(manager, eventName, context) { + console.log("got an unhandledEvent with name " + eventName); + } + }) + }) + }) + + managerB.get('currentState.name') // 'subsubstateOne' + managerB.send('anAction') + // neither `stateOne.substateOne.subsubstateOne` nor any of it's + // parent states have a handler for `anAction`. `subsubstateOne` + // also does not have a `unhandledEvent` method, but its parent + // state, `substateOne`, does, and it gets fired. It will log + // "got an unhandledEvent with name anAction" + ``` + + Action detection only moves upwards through the state hierarchy from the current state. + It does not search in other portions of the hierarchy. + + ```javascript + managerC = Ember.StateManager.create({ + initialState: 'stateOne.substateOne.subsubstateOne', + stateOne: Ember.State.create({ + substateOne: Ember.State.create({ + subsubstateOne: Ember.State.create({}) + }) + }), + stateTwo: Ember.State.create({ + anAction: function(manager, context){ + // will not be called below because it is + // not a parent of the current state + } + }) + }) + + managerC.get('currentState.name') // 'subsubstateOne' + managerC.send('anAction') + // Error: could not + // respond to event anAction in state stateOne.substateOne.subsubstateOne. + ``` + + Inside of an action method the given state should delegate `transitionTo` calls on its + StateManager. + + ```javascript + robotManager = Ember.StateManager.create({ + initialState: 'poweredDown.charging', + poweredDown: Ember.State.create({ + charging: Ember.State.create({ + chargeComplete: function(manager, context){ + manager.transitionTo('charged') + } + }), + charged: Ember.State.create({ + boot: function(manager, context){ + manager.transitionTo('poweredUp') + } + }) + }), + poweredUp: Ember.State.create({ + beginExtermination: function(manager, context){ + manager.transitionTo('rampaging') + }, + rampaging: Ember.State.create() + }) + }) + + robotManager.get('currentState.name') // 'charging' + robotManager.send('boot') // throws error, no boot action + // in current hierarchy + robotManager.get('currentState.name') // remains 'charging' + + robotManager.send('beginExtermination') // throws error, no beginExtermination + // action in current hierarchy + robotManager.get('currentState.name') // remains 'charging' + + robotManager.send('chargeComplete') + robotManager.get('currentState.name') // 'charged' + + robotManager.send('boot') + robotManager.get('currentState.name') // 'poweredUp' + + robotManager.send('beginExtermination', allHumans) + robotManager.get('currentState.name') // 'rampaging' + ``` + + Transition actions can also be created using the `transitionTo` method of the `Ember.State` class. The + following example StateManagers are equivalent: + + ```javascript + aManager = Ember.StateManager.create({ + stateOne: Ember.State.create({ + changeToStateTwo: Ember.State.transitionTo('stateTwo') + }), + stateTwo: Ember.State.create({}) + }) + + bManager = Ember.StateManager.create({ + stateOne: Ember.State.create({ + changeToStateTwo: function(manager, context){ + manager.transitionTo('stateTwo', context) + } + }), + stateTwo: Ember.State.create({}) + }) + ``` + + @class StateManager + @namespace Ember + @extends Ember.State +**/ +Ember.StateManager = Ember.State.extend({ + /** + @private + + When creating a new statemanager, look for a default state to transition + into. This state can either be named `start`, or can be specified using the + `initialState` property. + + @method init + */ + init: function() { + this._super(); + + set(this, 'stateMeta', Ember.Map.create()); + + var initialState = get(this, 'initialState'); + + if (!initialState && get(this, 'states.start')) { + initialState = 'start'; + } + + if (initialState) { + this.transitionTo(initialState); + Ember.assert('Failed to transition to initial state "' + initialState + '"', !!get(this, 'currentState')); + } + }, + + stateMetaFor: function(state) { + var meta = get(this, 'stateMeta'), + stateMeta = meta.get(state); + + if (!stateMeta) { + stateMeta = {}; + meta.set(state, stateMeta); + } + + return stateMeta; + }, + + setStateMeta: function(state, key, value) { + return set(this.stateMetaFor(state), key, value); + }, + + getStateMeta: function(state, key) { + return get(this.stateMetaFor(state), key); + }, + + /** + The current state from among the manager's possible states. This property should + not be set directly. Use `transitionTo` to move between states by name. + + @property currentState + @type Ember.State + */ + currentState: null, + + /** + The path of the current state. Returns a string representation of the current + state. + + @property currentPath + @type String + */ + currentPath: Ember.computed.alias('currentState.path'), + + /** + The name of transitionEvent that this stateManager will dispatch + + @property transitionEvent + @type String + @default 'setup' + */ + transitionEvent: 'setup', + + /** + If set to true, `errorOnUnhandledEvents` will cause an exception to be + raised if you attempt to send an event to a state manager that is not + handled by the current state or any of its parent states. + + @property errorOnUnhandledEvents + @type Boolean + @default true + */ + errorOnUnhandledEvent: true, + + send: function(event) { + var contexts = [].slice.call(arguments, 1); + Ember.assert('Cannot send event "' + event + '" while currentState is ' + get(this, 'currentState'), get(this, 'currentState')); + return sendEvent.call(this, event, contexts, false); + }, + unhandledEvent: function(manager, event) { + if (get(this, 'errorOnUnhandledEvent')) { + throw new Ember.Error(this.toString() + " could not respond to event " + event + " in state " + get(this, 'currentState.path') + "."); + } + }, + + /** + Finds a state by its state path. + + Example: + + ```javascript + manager = Ember.StateManager.create({ + root: Ember.State.create({ + dashboard: Ember.State.create() + }) + }); + + manager.getStateByPath(manager, "root.dashboard") + + // returns the dashboard state + ``` + + @method getStateByPath + @param {Ember.State} root the state to start searching from + @param {String} path the state path to follow + @return {Ember.State} the state at the end of the path + */ + getStateByPath: function(root, path) { + var parts = path.split('.'), + state = root; + + for (var i=0, len=parts.length; i`, an attempt to + // transition to `comments.show` will match ``. + // + // First, this code will look for root.posts.show.comments.show. + // Next, it will look for root.posts.comments.show. Finally, + // it will look for `root.comments.show`, and find the state. + // + // After this process, the following variables will exist: + // + // * resolveState: a common parent state between the current + // and target state. In the above example, `` is the + // `resolveState`. + // * enterStates: a list of all of the states represented + // by the path from the `resolveState`. For example, for + // the path `root.comments.show`, `enterStates` would have + // `[, ]` + // * exitStates: a list of all of the states from the + // `resolveState` to the `currentState`. In the above + // example, `exitStates` would have + // `[`, `]`. + while (resolveState && !enterStates) { + exitStates.unshift(resolveState); + + resolveState = get(resolveState, 'parentState'); + if (!resolveState) { + enterStates = this.getStatesInPath(this, path); + if (!enterStates) { + Ember.assert('Could not find state for path: "'+path+'"'); + return; + } + } + enterStates = this.getStatesInPath(resolveState, path); + } + + // If the path contains some states that are parents of both the + // current state and the target state, remove them. + // + // For example, in the following hierarchy: + // + // |- root + // | |- post + // | | |- index (* current) + // | | |- show + // + // If the `path` is `root.post.show`, the three variables will + // be: + // + // * resolveState: `` + // * enterStates: `[, , ]` + // * exitStates: `[, , ]` + // + // The goal of this code is to remove the common states, so we + // have: + // + // * resolveState: `` + // * enterStates: `[]` + // * exitStates: `[]` + // + // This avoid unnecessary calls to the enter and exit transitions. + while (enterStates.length > 0 && enterStates[0] === exitStates[0]) { + resolveState = enterStates.shift(); + exitStates.shift(); + } + + // Cache the enterStates, exitStates, and resolveState for the + // current state and the `path`. + var transitions = { + exitStates: exitStates, + enterStates: enterStates, + resolveState: resolveState + }; + + currentState.setPathsCache(this, path, transitions); + + return transitions; + }, + + triggerSetupContext: function(transitions) { + var contexts = transitions.contexts, + offset = transitions.enterStates.length - contexts.length, + enterStates = transitions.enterStates, + transitionEvent = get(this, 'transitionEvent'); + + Ember.assert("More contexts provided than states", offset >= 0); + + arrayForEach.call(enterStates, function(state, idx) { + state.trigger(transitionEvent, this, contexts[idx-offset]); + }, this); + }, + + getState: function(name) { + var state = get(this, name), + parentState = get(this, 'parentState'); + + if (state) { + return state; + } else if (parentState) { + return parentState.getState(name); + } + }, + + enterState: function(transition) { + var log = this.enableLogging; + + var exitStates = transition.exitStates.slice(0).reverse(); + arrayForEach.call(exitStates, function(state) { + state.trigger('exit', this); + }, this); + + arrayForEach.call(transition.enterStates, function(state) { + if (log) { Ember.Logger.log("STATEMANAGER: Entering " + get(state, 'path')); } + state.trigger('enter', this); + }, this); + + set(this, 'currentState', transition.finalState); + } +}); + +})(); + + + +(function() { +/** +Ember States + +@module ember +@submodule ember-states +@requires ember-runtime +*/ + +})(); + +(function() { +var slice = [].slice, + helpers = {}, + originalMethods = {}, + injectHelpersCallbacks = []; + +/** + @class Test + @namespace Ember +*/ +Ember.Test = { + + /** + @public + + `registerHelper` is used to register a + test helper that will be injected when + `App.injectTestHelpers` is called. + + The helper method will always be called + with the current Application as the first + parameter. + + For example: + ```javascript + Ember.Test.registerHelper('boot', function(app)) { + Ember.run(app, app.deferReadiness); + } + ``` + + This helper can later be called without arguments + because it will be called with `app` as the + first parameter. + + ```javascript + App = Ember.Application.create(); + App.injectTestHelpers(); + boot(); + ``` + + Whenever you register a helper that + performs async operations, + make sure you `return wait();` at the + end of the helper. + + If an async helper also needs to return a value, + pass it to the `wait` helper as a first argument: + `return wait(val);` + + @method registerHelper + @param name {String} + @param helperMethod {Function} + */ + registerHelper: function(name, helperMethod) { + helpers[name] = helperMethod; + }, + /** + @public + @method unregisterHelper + @param name {String} + */ + unregisterHelper: function(name) { + delete helpers[name]; + if (originalMethods[name]) { + window[name] = originalMethods[name]; + } + delete originalMethods[name]; + }, + + /** + @public + + Used to register callbacks to be fired + whenever `App.injectTestHelpers` is called + + The callback will receive the current application + as an argument. + + @method unregisterHelper + @param name {String} + */ + onInjectHelpers: function(callback) { + injectHelpersCallbacks.push(callback); + }, + + /** + @public + + This returns a thenable tailored + for testing. It catches failed + `onSuccess` callbacks and invokes + the `Ember.Test.adapter.exception` + callback in the last chained then. + + This method should be returned + by async helpers such as `wait`. + + @method promise + @param resolver {Function} + */ + promise: function(resolver) { + var promise = new Ember.RSVP.Promise(resolver); + var thenable = { + chained: false + }; + thenable.then = function(onSuccess, onFailure) { + var thenPromise, nextPromise; + thenable.chained = true; + thenPromise = promise.then(onSuccess, onFailure); + // this is to ensure all downstream fulfillment + // handlers are wrapped in the error handling + nextPromise = Ember.Test.promise(function(resolve) { + resolve(thenPromise); + }); + thenPromise.then(null, function(reason) { + // ensure this is the last promise in the chain + // if not, ignore and the exception will propagate + // this prevents the same error from being fired multiple times + if (!nextPromise.chained) { + Ember.Test.adapter.exception(reason); + } + }); + return nextPromise; + }; + return thenable; + }, + + /** + @public + + Used to allow ember-testing + to communicate with a specific + testing framework. + + You can manually set it before calling + `App.setupForTesting()`. + + Example: + 'Ember.Test.adapter = MyCustomAdapter.create()' + + If you do not set it, ember-testing + will default to `Ember.Test.QUnitAdapter`. + */ + adapter: null +}; + +function curry(app, fn) { + return function() { + var args = slice.call(arguments); + args.unshift(app); + return fn.apply(app, args); + }; +} + +Ember.Application.reopen({ + testHelpers: {}, + + setupForTesting: function() { + this.deferReadiness(); + + this.Router.reopen({ + location: 'none' + }); + + // if adapter is not manually set + // default to QUnit + if (!Ember.Test.adapter) { + Ember.Test.adapter = Ember.Test.QUnitAdapter.create(); + } + }, + + injectTestHelpers: function() { + this.testHelpers = {}; + for (var name in helpers) { + originalMethods[name] = window[name]; + this.testHelpers[name] = window[name] = curry(this, helpers[name]); + } + + for(var i = 0, l = injectHelpersCallbacks.length; i < l; i++) { + injectHelpersCallbacks[i](this); + } + }, + + removeTestHelpers: function() { + for (var name in helpers) { + window[name] = originalMethods[name]; + delete this.testHelpers[name]; + delete originalMethods[name]; + } + } +}); + +})(); + + + +(function() { +var Test = Ember.Test; + +/** + @class Adapter + @namespace Ember.Test +*/ +Test.Adapter = Ember.Object.extend({ + /** + @public + + This callback will be called + whenever an async operation + is about to start. + + Override this to call your + framework's methods + that handle async operations + + @method asyncStart + */ + asyncStart: Ember.K, + + /** + @public + + This callback will be called + whenever an async operation + has completed. + + @method asyncEnd + */ + asyncEnd: Ember.K, + + /** + @public + + Override this method with your + testing framework's false assertion + This function is called whenever + an exception occurs causing the testing + promise to fail. + + QUnit example: + + ```javascript + exception: function(error) { + ok(false, error); + } + ``` + + @method exception + @param reason {String} + */ + exception: function(error) { + setTimeout(function() { + throw error; + }); + } +}); + +/** + @class QUnitAdapter + @namespace Ember.Test +*/ +Test.QUnitAdapter = Test.Adapter.extend({ + asyncStart: function() { + stop(); + }, + asyncEnd: function() { + start(); + }, + exception: function(error) { + ok(false, error); + } +}); + +})(); + + + +(function() { +var get = Ember.get, + Test = Ember.Test, + helper = Test.registerHelper, + countAsync = 0; + +Test.pendingAjaxRequests = 0; + +Test.onInjectHelpers(function() { + Ember.$(document).ajaxStart(function() { + Test.pendingAjaxRequests++; + }); + + Ember.$(document).ajaxStop(function() { + Test.pendingAjaxRequests--; + }); +}); + + +function visit(app, url) { + app.__container__.lookup('router:main').location.setURL(url); + Ember.run(app, app.handleURL, url); + return wait(app); +} + +function click(app, selector, context) { + var $el = findWithAssert(app, selector, context); + Ember.run($el, 'click'); + return wait(app); +} + +function fillIn(app, selector, context, text) { + var $el; + if (typeof text === 'undefined') { + text = context; + context = null; + } + $el = findWithAssert(app, selector, context); + Ember.run(function() { + $el.val(text).change(); + }); + return wait(app); +} + +function findWithAssert(app, selector, context) { + var $el = find(app, selector, context); + if ($el.length === 0) { + throw("Element " + selector + " not found."); + } + return $el; +} + +function find(app, selector, context) { + var $el; + context = context || get(app, 'rootElement'); + $el = app.$(selector, context); + + return $el; +} + +function wait(app, value) { + var promise; + + promise = Test.promise(function(resolve) { + if (++countAsync === 1) { + Test.adapter.asyncStart(); + } + var watcher = setInterval(function() { + var routerIsLoading = app.__container__.lookup('router:main').router.isLoading; + if (routerIsLoading) { return; } + if (Test.pendingAjaxRequests) { return; } + if (Ember.run.hasScheduledTimers() || Ember.run.currentRunLoop) { return; } + + clearInterval(watcher); + + if (--countAsync === 0) { + Test.adapter.asyncEnd(); + } + + Ember.run(null, resolve, value); + }, 10); + }); + + return buildChainObject(app, promise); +} + +/** + Builds an object that contains + all helper methods. This object will be + returned by helpers and then-promises. + + This allows us to chain helpers: + + ```javascript + visit('posts/new') + .click('.add-btn') + .fillIn('.title', 'Post') + .click('.submit') + .then(function() { + equal('.post-title', 'Post'); + }) + .visit('comments') + .then(function() { + equal(find('.comments'),length, 0); + }); + ``` +*/ +function buildChainObject(app, promise) { + var helperName, obj = {}; + for(helperName in app.testHelpers) { + obj[helperName] = chain(app, promise, app.testHelpers[helperName]); + } + obj.then = function(fn) { + var thenPromise = promise.then(fn); + return buildChainObject(app, thenPromise); + }; + return obj; +} + +function chain(app, promise, fn) { + return function() { + var args = arguments, chainedPromise; + chainedPromise = promise.then(function() { + return fn.apply(null, args); + }); + return buildChainObject(app, chainedPromise); + }; +} + +// expose these methods as test helpers +helper('visit', visit); +helper('click', click); +helper('fillIn', fillIn); +helper('find', find); +helper('findWithAssert', findWithAssert); +helper('wait', wait); + +})(); + + + +(function() { + +})(); + +(function() { +/** +Ember + +@module ember +*/ + +})(); + + +})(); diff --git a/web/external/jquery-ui/jquery-ui-1.10.2.js b/web/external/jquery-ui/jquery-ui-1.10.2.js new file mode 100644 index 0000000..6eccbfe --- /dev/null +++ b/web/external/jquery-ui/jquery-ui-1.10.2.js @@ -0,0 +1,14987 @@ +/*! jQuery UI - v1.10.2 - 2013-03-14 +* http://jqueryui.com +* Includes: jquery.ui.core.js, jquery.ui.widget.js, jquery.ui.mouse.js, jquery.ui.draggable.js, jquery.ui.droppable.js, jquery.ui.resizable.js, jquery.ui.selectable.js, jquery.ui.sortable.js, jquery.ui.effect.js, jquery.ui.accordion.js, jquery.ui.autocomplete.js, jquery.ui.button.js, jquery.ui.datepicker.js, jquery.ui.dialog.js, jquery.ui.effect-blind.js, jquery.ui.effect-bounce.js, jquery.ui.effect-clip.js, jquery.ui.effect-drop.js, jquery.ui.effect-explode.js, jquery.ui.effect-fade.js, jquery.ui.effect-fold.js, jquery.ui.effect-highlight.js, jquery.ui.effect-pulsate.js, jquery.ui.effect-scale.js, jquery.ui.effect-shake.js, jquery.ui.effect-slide.js, jquery.ui.effect-transfer.js, jquery.ui.menu.js, jquery.ui.position.js, jquery.ui.progressbar.js, jquery.ui.slider.js, jquery.ui.spinner.js, jquery.ui.tabs.js, jquery.ui.tooltip.js +* Copyright 2013 jQuery Foundation and other contributors; Licensed MIT */ +(function( $, undefined ) { + +var uuid = 0, + runiqueId = /^ui-id-\d+$/; + +// $.ui might exist from components with no dependencies, e.g., $.ui.position +$.ui = $.ui || {}; + +$.extend( $.ui, { + version: "1.10.2", + + keyCode: { + BACKSPACE: 8, + COMMA: 188, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + LEFT: 37, + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SPACE: 32, + TAB: 9, + UP: 38 + } +}); + +// plugins +$.fn.extend({ + focus: (function( orig ) { + return function( delay, fn ) { + return typeof delay === "number" ? + this.each(function() { + var elem = this; + setTimeout(function() { + $( elem ).focus(); + if ( fn ) { + fn.call( elem ); + } + }, delay ); + }) : + orig.apply( this, arguments ); + }; + })( $.fn.focus ), + + scrollParent: function() { + var scrollParent; + if (($.ui.ie && (/(static|relative)/).test(this.css("position"))) || (/absolute/).test(this.css("position"))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.css(this,"position")) && (/(auto|scroll)/).test($.css(this,"overflow")+$.css(this,"overflow-y")+$.css(this,"overflow-x")); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.css(this,"overflow")+$.css(this,"overflow-y")+$.css(this,"overflow-x")); + }).eq(0); + } + + return (/fixed/).test(this.css("position")) || !scrollParent.length ? $(document) : scrollParent; + }, + + zIndex: function( zIndex ) { + if ( zIndex !== undefined ) { + return this.css( "zIndex", zIndex ); + } + + if ( this.length ) { + var elem = $( this[ 0 ] ), position, value; + while ( elem.length && elem[ 0 ] !== document ) { + // Ignore z-index if position is set to a value where z-index is ignored by the browser + // This makes behavior of this function consistent across browsers + // WebKit always returns auto if the element is positioned + position = elem.css( "position" ); + if ( position === "absolute" || position === "relative" || position === "fixed" ) { + // IE returns 0 when zIndex is not specified + // other browsers return a string + // we ignore the case of nested elements with an explicit value of 0 + //
    + value = parseInt( elem.css( "zIndex" ), 10 ); + if ( !isNaN( value ) && value !== 0 ) { + return value; + } + } + elem = elem.parent(); + } + } + + return 0; + }, + + uniqueId: function() { + return this.each(function() { + if ( !this.id ) { + this.id = "ui-id-" + (++uuid); + } + }); + }, + + removeUniqueId: function() { + return this.each(function() { + if ( runiqueId.test( this.id ) ) { + $( this ).removeAttr( "id" ); + } + }); + } +}); + +// selectors +function focusable( element, isTabIndexNotNaN ) { + var map, mapName, img, + nodeName = element.nodeName.toLowerCase(); + if ( "area" === nodeName ) { + map = element.parentNode; + mapName = map.name; + if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) { + return false; + } + img = $( "img[usemap=#" + mapName + "]" )[0]; + return !!img && visible( img ); + } + return ( /input|select|textarea|button|object/.test( nodeName ) ? + !element.disabled : + "a" === nodeName ? + element.href || isTabIndexNotNaN : + isTabIndexNotNaN) && + // the element and all of its ancestors must be visible + visible( element ); +} + +function visible( element ) { + return $.expr.filters.visible( element ) && + !$( element ).parents().addBack().filter(function() { + return $.css( this, "visibility" ) === "hidden"; + }).length; +} + +$.extend( $.expr[ ":" ], { + data: $.expr.createPseudo ? + $.expr.createPseudo(function( dataName ) { + return function( elem ) { + return !!$.data( elem, dataName ); + }; + }) : + // support: jQuery <1.8 + function( elem, i, match ) { + return !!$.data( elem, match[ 3 ] ); + }, + + focusable: function( element ) { + return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) ); + }, + + tabbable: function( element ) { + var tabIndex = $.attr( element, "tabindex" ), + isTabIndexNaN = isNaN( tabIndex ); + return ( isTabIndexNaN || tabIndex >= 0 ) && focusable( element, !isTabIndexNaN ); + } +}); + +// support: jQuery <1.8 +if ( !$( "" ).outerWidth( 1 ).jquery ) { + $.each( [ "Width", "Height" ], function( i, name ) { + var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], + type = name.toLowerCase(), + orig = { + innerWidth: $.fn.innerWidth, + innerHeight: $.fn.innerHeight, + outerWidth: $.fn.outerWidth, + outerHeight: $.fn.outerHeight + }; + + function reduce( elem, size, border, margin ) { + $.each( side, function() { + size -= parseFloat( $.css( elem, "padding" + this ) ) || 0; + if ( border ) { + size -= parseFloat( $.css( elem, "border" + this + "Width" ) ) || 0; + } + if ( margin ) { + size -= parseFloat( $.css( elem, "margin" + this ) ) || 0; + } + }); + return size; + } + + $.fn[ "inner" + name ] = function( size ) { + if ( size === undefined ) { + return orig[ "inner" + name ].call( this ); + } + + return this.each(function() { + $( this ).css( type, reduce( this, size ) + "px" ); + }); + }; + + $.fn[ "outer" + name] = function( size, margin ) { + if ( typeof size !== "number" ) { + return orig[ "outer" + name ].call( this, size ); + } + + return this.each(function() { + $( this).css( type, reduce( this, size, true, margin ) + "px" ); + }); + }; + }); +} + +// support: jQuery <1.8 +if ( !$.fn.addBack ) { + $.fn.addBack = function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter( selector ) + ); + }; +} + +// support: jQuery 1.6.1, 1.6.2 (http://bugs.jquery.com/ticket/9413) +if ( $( "" ).data( "a-b", "a" ).removeData( "a-b" ).data( "a-b" ) ) { + $.fn.removeData = (function( removeData ) { + return function( key ) { + if ( arguments.length ) { + return removeData.call( this, $.camelCase( key ) ); + } else { + return removeData.call( this ); + } + }; + })( $.fn.removeData ); +} + + + + + +// deprecated +$.ui.ie = !!/msie [\w.]+/.exec( navigator.userAgent.toLowerCase() ); + +$.support.selectstart = "onselectstart" in document.createElement( "div" ); +$.fn.extend({ + disableSelection: function() { + return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) + + ".ui-disableSelection", function( event ) { + event.preventDefault(); + }); + }, + + enableSelection: function() { + return this.unbind( ".ui-disableSelection" ); + } +}); + +$.extend( $.ui, { + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function( module, option, set ) { + var i, + proto = $.ui[ module ].prototype; + for ( i in set ) { + proto.plugins[ i ] = proto.plugins[ i ] || []; + proto.plugins[ i ].push( [ option, set[ i ] ] ); + } + }, + call: function( instance, name, args ) { + var i, + set = instance.plugins[ name ]; + if ( !set || !instance.element[ 0 ].parentNode || instance.element[ 0 ].parentNode.nodeType === 11 ) { + return; + } + + for ( i = 0; i < set.length; i++ ) { + if ( instance.options[ set[ i ][ 0 ] ] ) { + set[ i ][ 1 ].apply( instance.element, args ); + } + } + } + }, + + // only used by resizable + hasScroll: function( el, a ) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ( $( el ).css( "overflow" ) === "hidden") { + return false; + } + + var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop", + has = false; + + if ( el[ scroll ] > 0 ) { + return true; + } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[ scroll ] = 1; + has = ( el[ scroll ] > 0 ); + el[ scroll ] = 0; + return has; + } +}); + +})( jQuery ); + +(function( $, undefined ) { + +var uuid = 0, + slice = Array.prototype.slice, + _cleanData = $.cleanData; +$.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + try { + $( elem ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + } + _cleanData( elems ); +}; + +$.widget = function( name, base, prototype ) { + var fullName, existingConstructor, constructor, basePrototype, + // proxiedPrototype allows the provided prototype to remain unmodified + // so that it can be used as a mixin for multiple widgets (#8876) + proxiedPrototype = {}, + namespace = name.split( "." )[ 0 ]; + + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName.toLowerCase() ] = function( elem ) { + return !!$.data( elem, fullName ); + }; + + $[ namespace ] = $[ namespace ] || {}; + existingConstructor = $[ namespace ][ name ]; + constructor = $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without "new" keyword + if ( !this._createWidget ) { + return new constructor( options, element ); + } + + // allow instantiation without initializing for simple inheritance + // must use "new" keyword (the code above always passes args) + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + // extend with the existing constructor to carry over any static properties + $.extend( constructor, existingConstructor, { + version: prototype.version, + // copy the object used to create the prototype in case we need to + // redefine the widget later + _proto: $.extend( {}, prototype ), + // track widgets that inherit from this widget in case this widget is + // redefined after a widget inherits from it + _childConstructors: [] + }); + + basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from + basePrototype.options = $.widget.extend( {}, basePrototype.options ); + $.each( prototype, function( prop, value ) { + if ( !$.isFunction( value ) ) { + proxiedPrototype[ prop ] = value; + return; + } + proxiedPrototype[ prop ] = (function() { + var _super = function() { + return base.prototype[ prop ].apply( this, arguments ); + }, + _superApply = function( args ) { + return base.prototype[ prop ].apply( this, args ); + }; + return function() { + var __super = this._super, + __superApply = this._superApply, + returnValue; + + this._super = _super; + this._superApply = _superApply; + + returnValue = value.apply( this, arguments ); + + this._super = __super; + this._superApply = __superApply; + + return returnValue; + }; + })(); + }); + constructor.prototype = $.widget.extend( basePrototype, { + // TODO: remove support for widgetEventPrefix + // always use the name + a colon as the prefix, e.g., draggable:start + // don't prefix for widgets that aren't DOM-based + widgetEventPrefix: existingConstructor ? basePrototype.widgetEventPrefix : name + }, proxiedPrototype, { + constructor: constructor, + namespace: namespace, + widgetName: name, + widgetFullName: fullName + }); + + // If this widget is being redefined then we need to find all widgets that + // are inheriting from it and redefine all of them so that they inherit from + // the new version of this widget. We're essentially trying to replace one + // level in the prototype chain. + if ( existingConstructor ) { + $.each( existingConstructor._childConstructors, function( i, child ) { + var childPrototype = child.prototype; + + // redefine the child widget using the same prototype that was + // originally used, but inherit from the new version of the base + $.widget( childPrototype.namespace + "." + childPrototype.widgetName, constructor, child._proto ); + }); + // remove the list of existing child constructors from the old constructor + // so the old child constructors can be garbage collected + delete existingConstructor._childConstructors; + } else { + base._childConstructors.push( constructor ); + } + + $.widget.bridge( name, constructor ); +}; + +$.widget.extend = function( target ) { + var input = slice.call( arguments, 1 ), + inputIndex = 0, + inputLength = input.length, + key, + value; + for ( ; inputIndex < inputLength; inputIndex++ ) { + for ( key in input[ inputIndex ] ) { + value = input[ inputIndex ][ key ]; + if ( input[ inputIndex ].hasOwnProperty( key ) && value !== undefined ) { + // Clone objects + if ( $.isPlainObject( value ) ) { + target[ key ] = $.isPlainObject( target[ key ] ) ? + $.widget.extend( {}, target[ key ], value ) : + // Don't extend strings, arrays, etc. with objects + $.widget.extend( {}, value ); + // Copy everything else by reference + } else { + target[ key ] = value; + } + } + } + } + return target; +}; + +$.widget.bridge = function( name, object ) { + var fullName = object.prototype.widgetFullName || name; + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.widget.extend.apply( null, [ options ].concat(args) ) : + options; + + if ( isMethodCall ) { + this.each(function() { + var methodValue, + instance = $.data( this, fullName ); + if ( !instance ) { + return $.error( "cannot call methods on " + name + " prior to initialization; " + + "attempted to call method '" + options + "'" ); + } + if ( !$.isFunction( instance[options] ) || options.charAt( 0 ) === "_" ) { + return $.error( "no such method '" + options + "' for " + name + " widget instance" ); + } + methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue && methodValue.jquery ? + returnValue.pushStack( methodValue.get() ) : + methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, fullName ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + $.data( this, fullName, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( /* options, element */ ) {}; +$.Widget._childConstructors = []; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + defaultElement: "
    ", + options: { + disabled: false, + + // callbacks + create: null + }, + _createWidget: function( options, element ) { + element = $( element || this.defaultElement || this )[ 0 ]; + this.element = $( element ); + this.uuid = uuid++; + this.eventNamespace = "." + this.widgetName + this.uuid; + this.options = $.widget.extend( {}, + this.options, + this._getCreateOptions(), + options ); + + this.bindings = $(); + this.hoverable = $(); + this.focusable = $(); + + if ( element !== this ) { + $.data( element, this.widgetFullName, this ); + this._on( true, this.element, { + remove: function( event ) { + if ( event.target === element ) { + this.destroy(); + } + } + }); + this.document = $( element.style ? + // element within the document + element.ownerDocument : + // element is window or document + element.document || element ); + this.window = $( this.document[0].defaultView || this.document[0].parentWindow ); + } + + this._create(); + this._trigger( "create", null, this._getCreateEventData() ); + this._init(); + }, + _getCreateOptions: $.noop, + _getCreateEventData: $.noop, + _create: $.noop, + _init: $.noop, + + destroy: function() { + this._destroy(); + // we can probably remove the unbind calls in 2.0 + // all event bindings should go through this._on() + this.element + .unbind( this.eventNamespace ) + // 1.9 BC for #7810 + // TODO remove dual storage + .removeData( this.widgetName ) + .removeData( this.widgetFullName ) + // support: jquery <1.6.3 + // http://bugs.jquery.com/ticket/9413 + .removeData( $.camelCase( this.widgetFullName ) ); + this.widget() + .unbind( this.eventNamespace ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetFullName + "-disabled " + + "ui-state-disabled" ); + + // clean up events and states + this.bindings.unbind( this.eventNamespace ); + this.hoverable.removeClass( "ui-state-hover" ); + this.focusable.removeClass( "ui-state-focus" ); + }, + _destroy: $.noop, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key, + parts, + curOption, + i; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.widget.extend( {}, this.options ); + } + + if ( typeof key === "string" ) { + // handle nested keys, e.g., "foo.bar" => { foo: { bar: ___ } } + options = {}; + parts = key.split( "." ); + key = parts.shift(); + if ( parts.length ) { + curOption = options[ key ] = $.widget.extend( {}, this.options[ key ] ); + for ( i = 0; i < parts.length - 1; i++ ) { + curOption[ parts[ i ] ] = curOption[ parts[ i ] ] || {}; + curOption = curOption[ parts[ i ] ]; + } + key = parts.pop(); + if ( value === undefined ) { + return curOption[ key ] === undefined ? null : curOption[ key ]; + } + curOption[ key ] = value; + } else { + if ( value === undefined ) { + return this.options[ key ] === undefined ? null : this.options[ key ]; + } + options[ key ] = value; + } + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var key; + + for ( key in options ) { + this._setOption( key, options[ key ] ); + } + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + .toggleClass( this.widgetFullName + "-disabled ui-state-disabled", !!value ) + .attr( "aria-disabled", value ); + this.hoverable.removeClass( "ui-state-hover" ); + this.focusable.removeClass( "ui-state-focus" ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _on: function( suppressDisabledCheck, element, handlers ) { + var delegateElement, + instance = this; + + // no suppressDisabledCheck flag, shuffle arguments + if ( typeof suppressDisabledCheck !== "boolean" ) { + handlers = element; + element = suppressDisabledCheck; + suppressDisabledCheck = false; + } + + // no element argument, shuffle and use this.element + if ( !handlers ) { + handlers = element; + element = this.element; + delegateElement = this.widget(); + } else { + // accept selectors, DOM elements + element = delegateElement = $( element ); + this.bindings = this.bindings.add( element ); + } + + $.each( handlers, function( event, handler ) { + function handlerProxy() { + // allow widgets to customize the disabled handling + // - disabled as an array instead of boolean + // - disabled class as method for disabling individual parts + if ( !suppressDisabledCheck && + ( instance.options.disabled === true || + $( this ).hasClass( "ui-state-disabled" ) ) ) { + return; + } + return ( typeof handler === "string" ? instance[ handler ] : handler ) + .apply( instance, arguments ); + } + + // copy the guid so direct unbinding works + if ( typeof handler !== "string" ) { + handlerProxy.guid = handler.guid = + handler.guid || handlerProxy.guid || $.guid++; + } + + var match = event.match( /^(\w+)\s*(.*)$/ ), + eventName = match[1] + instance.eventNamespace, + selector = match[2]; + if ( selector ) { + delegateElement.delegate( selector, eventName, handlerProxy ); + } else { + element.bind( eventName, handlerProxy ); + } + }); + }, + + _off: function( element, eventName ) { + eventName = (eventName || "").split( " " ).join( this.eventNamespace + " " ) + this.eventNamespace; + element.unbind( eventName ).undelegate( eventName ); + }, + + _delay: function( handler, delay ) { + function handlerProxy() { + return ( typeof handler === "string" ? instance[ handler ] : handler ) + .apply( instance, arguments ); + } + var instance = this; + return setTimeout( handlerProxy, delay || 0 ); + }, + + _hoverable: function( element ) { + this.hoverable = this.hoverable.add( element ); + this._on( element, { + mouseenter: function( event ) { + $( event.currentTarget ).addClass( "ui-state-hover" ); + }, + mouseleave: function( event ) { + $( event.currentTarget ).removeClass( "ui-state-hover" ); + } + }); + }, + + _focusable: function( element ) { + this.focusable = this.focusable.add( element ); + this._on( element, { + focusin: function( event ) { + $( event.currentTarget ).addClass( "ui-state-focus" ); + }, + focusout: function( event ) { + $( event.currentTarget ).removeClass( "ui-state-focus" ); + } + }); + }, + + _trigger: function( type, event, data ) { + var prop, orig, + callback = this.options[ type ]; + + data = data || {}; + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + // the original event may come from any element + // so we need to reset the target on the new event + event.target = this.element[ 0 ]; + + // copy original event properties over to the new event + orig = event.originalEvent; + if ( orig ) { + for ( prop in orig ) { + if ( !( prop in event ) ) { + event[ prop ] = orig[ prop ]; + } + } + } + + this.element.trigger( event, data ); + return !( $.isFunction( callback ) && + callback.apply( this.element[0], [ event ].concat( data ) ) === false || + event.isDefaultPrevented() ); + } +}; + +$.each( { show: "fadeIn", hide: "fadeOut" }, function( method, defaultEffect ) { + $.Widget.prototype[ "_" + method ] = function( element, options, callback ) { + if ( typeof options === "string" ) { + options = { effect: options }; + } + var hasOptions, + effectName = !options ? + method : + options === true || typeof options === "number" ? + defaultEffect : + options.effect || defaultEffect; + options = options || {}; + if ( typeof options === "number" ) { + options = { duration: options }; + } + hasOptions = !$.isEmptyObject( options ); + options.complete = callback; + if ( options.delay ) { + element.delay( options.delay ); + } + if ( hasOptions && $.effects && $.effects.effect[ effectName ] ) { + element[ method ]( options ); + } else if ( effectName !== method && element[ effectName ] ) { + element[ effectName ]( options.duration, options.easing, callback ); + } else { + element.queue(function( next ) { + $( this )[ method ](); + if ( callback ) { + callback.call( element[ 0 ] ); + } + next(); + }); + } + }; +}); + +})( jQuery ); + +(function( $, undefined ) { + +var mouseHandled = false; +$( document ).mouseup( function() { + mouseHandled = false; +}); + +$.widget("ui.mouse", { + version: "1.10.2", + options: { + cancel: "input,textarea,button,select,option", + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var that = this; + + this.element + .bind("mousedown."+this.widgetName, function(event) { + return that._mouseDown(event); + }) + .bind("click."+this.widgetName, function(event) { + if (true === $.data(event.target, that.widgetName + ".preventClickEvent")) { + $.removeData(event.target, that.widgetName + ".preventClickEvent"); + event.stopImmediatePropagation(); + return false; + } + }); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind("."+this.widgetName); + if ( this._mouseMoveDelegate ) { + $(document) + .unbind("mousemove."+this.widgetName, this._mouseMoveDelegate) + .unbind("mouseup."+this.widgetName, this._mouseUpDelegate); + } + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + if( mouseHandled ) { return; } + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var that = this, + btnIsLeft = (event.which === 1), + // event.target.nodeName works around a bug in IE 8 with + // disabled inputs (#7620) + elIsCancel = (typeof this.options.cancel === "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + that.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // Click event may never have fired (Gecko & Opera) + if (true === $.data(event.target, this.widgetName + ".preventClickEvent")) { + $.removeData(event.target, this.widgetName + ".preventClickEvent"); + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return that._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return that._mouseUp(event); + }; + $(document) + .bind("mousemove."+this.widgetName, this._mouseMoveDelegate) + .bind("mouseup."+this.widgetName, this._mouseUpDelegate); + + event.preventDefault(); + + mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.ui.ie && ( !document.documentMode || document.documentMode < 9 ) && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind("mousemove."+this.widgetName, this._mouseMoveDelegate) + .unbind("mouseup."+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + + if (event.target === this._mouseDownEvent.target) { + $.data(event.target, this.widgetName + ".preventClickEvent", true); + } + + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(/* event */) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(/* event */) {}, + _mouseDrag: function(/* event */) {}, + _mouseStop: function(/* event */) {}, + _mouseCapture: function(/* event */) { return true; } +}); + +})(jQuery); + +(function( $, undefined ) { + +$.widget("ui.draggable", $.ui.mouse, { + version: "1.10.2", + widgetEventPrefix: "drag", + options: { + addClasses: true, + appendTo: "parent", + axis: false, + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false, + + // callbacks + drag: null, + start: null, + stop: null + }, + _create: function() { + + if (this.options.helper === "original" && !(/^(?:r|a|f)/).test(this.element.css("position"))) { + this.element[0].style.position = "relative"; + } + if (this.options.addClasses){ + this.element.addClass("ui-draggable"); + } + if (this.options.disabled){ + this.element.addClass("ui-draggable-disabled"); + } + + this._mouseInit(); + + }, + + _destroy: function() { + this.element.removeClass( "ui-draggable ui-draggable-dragging ui-draggable-disabled" ); + this._mouseDestroy(); + }, + + _mouseCapture: function(event) { + + var o = this.options; + + // among others, prevent a drag on a resizable-handle + if (this.helper || o.disabled || $(event.target).closest(".ui-resizable-handle").length > 0) { + return false; + } + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) { + return false; + } + + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $("
    ") + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + + return true; + + }, + + _mouseStart: function(event) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper(event); + + this.helper.addClass("ui-draggable-dragging"); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) { + $.ui.ddmanager.current = this; + } + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css("position"); + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.positionAbs = this.element.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this.position = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if "cursorAt" is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Set a containment if given in the options + if(o.containment) { + this._setContainment(); + } + + //Trigger event + callbacks + if(this._trigger("start", event) === false) { + this._clear(); + return false; + } + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) { + $.ui.ddmanager.prepareOffsets(this, event); + } + + + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + + //If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003) + if ( $.ui.ddmanager ) { + $.ui.ddmanager.dragStart(this, event); + } + + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + if(this._trigger("drag", event, ui) === false) { + this._mouseUp({}); + return false; + } + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis !== "y") { + this.helper[0].style.left = this.position.left+"px"; + } + if(!this.options.axis || this.options.axis !== "x") { + this.helper[0].style.top = this.position.top+"px"; + } + if($.ui.ddmanager) { + $.ui.ddmanager.drag(this, event); + } + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var element, + that = this, + elementInDom = false, + dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) { + dropped = $.ui.ddmanager.drop(this, event); + } + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + //if the original element is no longer in the DOM don't bother to continue (see #8269) + element = this.element[0]; + while ( element && (element = element.parentNode) ) { + if (element === document ) { + elementInDom = true; + } + } + if ( !elementInDom && this.options.helper === "original" ) { + return false; + } + + if((this.options.revert === "invalid" && !dropped) || (this.options.revert === "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + if(that._trigger("stop", event) !== false) { + that._clear(); + } + }); + } else { + if(this._trigger("stop", event) !== false) { + this._clear(); + } + } + + return false; + }, + + _mouseUp: function(event) { + //Remove frame helpers + $("div.ui-draggable-iframeFix").each(function() { + this.parentNode.removeChild(this); + }); + + //If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003) + if( $.ui.ddmanager ) { + $.ui.ddmanager.dragStop(this, event); + } + + return $.ui.mouse.prototype._mouseUp.call(this, event); + }, + + cancel: function() { + + if(this.helper.is(".ui-draggable-dragging")) { + this._mouseUp({}); + } else { + this._clear(); + } + + return this; + + }, + + _getHandle: function(event) { + return this.options.handle ? + !!$( event.target ).closest( this.element.find( this.options.handle ) ).length : + true; + }, + + _createHelper: function(event) { + + var o = this.options, + helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper === "clone" ? this.element.clone().removeAttr("id") : this.element); + + if(!helper.parents("body").length) { + helper.appendTo((o.appendTo === "parent" ? this.element[0].parentNode : o.appendTo)); + } + + if(helper[0] !== this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) { + helper.css("position", "absolute"); + } + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj === "string") { + obj = obj.split(" "); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ("left" in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ("right" in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ("top" in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ("bottom" in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition === "absolute" && this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + //This needs to be actually done for all browsers, since pageX/pageY includes this information + //Ugly IE fix + if((this.offsetParent[0] === document.body) || + (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() === "html" && $.ui.ie)) { + po = { top: 0, left: 0 }; + } + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition === "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0), + right: (parseInt(this.element.css("marginRight"),10) || 0), + bottom: (parseInt(this.element.css("marginBottom"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var over, c, ce, + o = this.options; + + if(o.containment === "parent") { + o.containment = this.helper[0].parentNode; + } + if(o.containment === "document" || o.containment === "window") { + this.containment = [ + o.containment === "document" ? 0 : $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left, + o.containment === "document" ? 0 : $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top, + (o.containment === "document" ? 0 : $(window).scrollLeft()) + $(o.containment === "document" ? document : window).width() - this.helperProportions.width - this.margins.left, + (o.containment === "document" ? 0 : $(window).scrollTop()) + ($(o.containment === "document" ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + } + + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor !== Array) { + c = $(o.containment); + ce = c[0]; + + if(!ce) { + return; + } + + over = ($(ce).css("overflow") !== "hidden"); + + this.containment = [ + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0), + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0), + (over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderRightWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right, + (over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderBottomWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom + ]; + this.relative_container = c; + + } else if(o.containment.constructor === Array) { + this.containment = o.containment; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) { + pos = this.position; + } + + var mod = d === "absolute" ? 1 : -1, + scroll = this.cssPosition === "absolute" && !(this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top + // The absolute mouse position + this.offset.relative.top * mod + // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.parent.top * mod - // The offsetParent's offset without borders (offset + border) + ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left + // The absolute mouse position + this.offset.relative.left * mod + // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.parent.left * mod - // The offsetParent's offset without borders (offset + border) + ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var containment, co, top, left, + o = this.options, + scroll = this.cssPosition === "absolute" && !(this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, + scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName), + pageX = event.pageX, + pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + if(this.containment) { + if (this.relative_container){ + co = this.relative_container.offset(); + containment = [ this.containment[0] + co.left, + this.containment[1] + co.top, + this.containment[2] + co.left, + this.containment[3] + co.top ]; + } + else { + containment = this.containment; + } + + if(event.pageX - this.offset.click.left < containment[0]) { + pageX = containment[0] + this.offset.click.left; + } + if(event.pageY - this.offset.click.top < containment[1]) { + pageY = containment[1] + this.offset.click.top; + } + if(event.pageX - this.offset.click.left > containment[2]) { + pageX = containment[2] + this.offset.click.left; + } + if(event.pageY - this.offset.click.top > containment[3]) { + pageY = containment[3] + this.offset.click.top; + } + } + + if(o.grid) { + //Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950) + top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY; + pageY = containment ? ((top - this.offset.click.top >= containment[1] || top - this.offset.click.top > containment[3]) ? top : ((top - this.offset.click.top >= containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX; + pageX = containment ? ((left - this.offset.click.left >= containment[0] || left - this.offset.click.left > containment[2]) ? left : ((left - this.offset.click.left >= containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY - // The absolute mouse position + this.offset.click.top - // Click offset (relative to the element) + this.offset.relative.top - // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.parent.top + // The offsetParent's offset without borders (offset + border) + ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX - // The absolute mouse position + this.offset.click.left - // Click offset (relative to the element) + this.offset.relative.left - // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.parent.left + // The offsetParent's offset without borders (offset + border) + ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _clear: function() { + this.helper.removeClass("ui-draggable-dragging"); + if(this.helper[0] !== this.element[0] && !this.cancelHelperRemoval) { + this.helper.remove(); + } + this.helper = null; + this.cancelHelperRemoval = false; + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + //The absolute position has to be recalculated after plugins + if(type === "drag") { + this.positionAbs = this._convertPositionTo("absolute"); + } + return $.Widget.prototype._trigger.call(this, type, event, ui); + }, + + plugins: {}, + + _uiHash: function() { + return { + helper: this.helper, + position: this.position, + originalPosition: this.originalPosition, + offset: this.positionAbs + }; + } + +}); + +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { + + var inst = $(this).data("ui-draggable"), o = inst.options, + uiSortable = $.extend({}, ui, { item: inst.element }); + inst.sortables = []; + $(o.connectToSortable).each(function() { + var sortable = $.data(this, "ui-sortable"); + if (sortable && !sortable.options.disabled) { + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable.refreshPositions(); // Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page). + sortable._trigger("activate", event, uiSortable); + } + }); + + }, + stop: function(event, ui) { + + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("ui-draggable"), + uiSortable = $.extend({}, ui, { item: inst.element }); + + $.each(inst.sortables, function() { + if(this.instance.isOver) { + + this.instance.isOver = 0; + + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: "valid/invalid" + if(this.shouldRevert) { + this.instance.options.revert = this.shouldRevert; + } + + //Trigger the stop of the sortable + this.instance._mouseStop(event); + + this.instance.options.helper = this.instance.options._helper; + + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper === "original") { + this.instance.currentItem.css({ top: "auto", left: "auto" }); + } + + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, uiSortable); + } + + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("ui-draggable"), that = this; + + $.each(inst.sortables, function() { + + var innermostIntersecting = false, + thisSortable = this; + + //Copy over some variables to allow calling the sortable's native _intersectsWith + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + + if(this.instance._intersectsWith(this.instance.containerCache)) { + innermostIntersecting = true; + $.each(inst.sortables, function () { + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + if (this !== thisSortable && + this.instance._intersectsWith(this.instance.containerCache) && + $.contains(thisSortable.instance.element[0], this.instance.element[0]) + ) { + innermostIntersecting = false; + } + return innermostIntersecting; + }); + } + + + if(innermostIntersecting) { + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { + + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(that).clone().removeAttr("id").appendTo(this.instance.element).data("ui-sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; + + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); + + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + //hack so receive/update callbacks work (mostly) + inst.currentItem = inst.element; + this.instance.fromOutside = inst; + + } + + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) { + this.instance._mouseDrag(event); + } + + } else { + + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { + + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; + + //Prevent reverting on this forced stop + this.instance.options.revert = false; + + // The out event needs to be triggered independently + this.instance._trigger("out", event, this.instance._uiHash(this.instance)); + + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; + + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) { + this.instance.placeholder.remove(); + } + + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } + + } + + }); + + } +}); + +$.ui.plugin.add("draggable", "cursor", { + start: function() { + var t = $("body"), o = $(this).data("ui-draggable").options; + if (t.css("cursor")) { + o._cursor = t.css("cursor"); + } + t.css("cursor", o.cursor); + }, + stop: function() { + var o = $(this).data("ui-draggable").options; + if (o._cursor) { + $("body").css("cursor", o._cursor); + } + } +}); + +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("ui-draggable").options; + if(t.css("opacity")) { + o._opacity = t.css("opacity"); + } + t.css("opacity", o.opacity); + }, + stop: function(event, ui) { + var o = $(this).data("ui-draggable").options; + if(o._opacity) { + $(ui.helper).css("opacity", o._opacity); + } + } +}); + +$.ui.plugin.add("draggable", "scroll", { + start: function() { + var i = $(this).data("ui-draggable"); + if(i.scrollParent[0] !== document && i.scrollParent[0].tagName !== "HTML") { + i.overflowOffset = i.scrollParent.offset(); + } + }, + drag: function( event ) { + + var i = $(this).data("ui-draggable"), o = i.options, scrolled = false; + + if(i.scrollParent[0] !== document && i.scrollParent[0].tagName !== "HTML") { + + if(!o.axis || o.axis !== "x") { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) { + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + } else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) { + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } + } + + if(!o.axis || o.axis !== "y") { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) { + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + } else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) { + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } + } + + } else { + + if(!o.axis || o.axis !== "x") { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) { + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + } else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) { + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + } + + if(!o.axis || o.axis !== "y") { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) { + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + } else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) { + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) { + $.ui.ddmanager.prepareOffsets(i, event); + } + + } +}); + +$.ui.plugin.add("draggable", "snap", { + start: function() { + + var i = $(this).data("ui-draggable"), + o = i.options; + + i.snapElements = []; + + $(o.snap.constructor !== String ? ( o.snap.items || ":data(ui-draggable)" ) : o.snap).each(function() { + var $t = $(this), + $o = $t.offset(); + if(this !== i.element[0]) { + i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + } + }); + + }, + drag: function(event, ui) { + + var ts, bs, ls, rs, l, r, t, b, i, first, + inst = $(this).data("ui-draggable"), + o = inst.options, + d = o.snapTolerance, + x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for (i = inst.snapElements.length - 1; i >= 0; i--){ + + l = inst.snapElements[i].left; + r = l + inst.snapElements[i].width; + t = inst.snapElements[i].top; + b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) { + (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + } + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode !== "inner") { + ts = Math.abs(t - y2) <= d; + bs = Math.abs(b - y1) <= d; + ls = Math.abs(l - x2) <= d; + rs = Math.abs(r - x1) <= d; + if(ts) { + ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + } + if(bs) { + ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + } + if(ls) { + ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + } + if(rs) { + ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + } + + first = (ts || bs || ls || rs); + + if(o.snapMode !== "outer") { + ts = Math.abs(t - y1) <= d; + bs = Math.abs(b - y2) <= d; + ls = Math.abs(l - x1) <= d; + rs = Math.abs(r - x2) <= d; + if(ts) { + ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + } + if(bs) { + ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + } + if(ls) { + ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + } + if(rs) { + ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) { + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + } + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + } + + } +}); + +$.ui.plugin.add("draggable", "stack", { + start: function() { + var min, + o = this.data("ui-draggable").options, + group = $.makeArray($(o.stack)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0); + }); + + if (!group.length) { return; } + + min = parseInt($(group[0]).css("zIndex"), 10) || 0; + $(group).each(function(i) { + $(this).css("zIndex", min + i); + }); + this.css("zIndex", (min + group.length)); + } +}); + +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("ui-draggable").options; + if(t.css("zIndex")) { + o._zIndex = t.css("zIndex"); + } + t.css("zIndex", o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("ui-draggable").options; + if(o._zIndex) { + $(ui.helper).css("zIndex", o._zIndex); + } + } +}); + +})(jQuery); + +(function( $, undefined ) { + +function isOverAxis( x, reference, size ) { + return ( x > reference ) && ( x < ( reference + size ) ); +} + +$.widget("ui.droppable", { + version: "1.10.2", + widgetEventPrefix: "drop", + options: { + accept: "*", + activeClass: false, + addClasses: true, + greedy: false, + hoverClass: false, + scope: "default", + tolerance: "intersect", + + // callbacks + activate: null, + deactivate: null, + drop: null, + out: null, + over: null + }, + _create: function() { + + var o = this.options, + accept = o.accept; + + this.isover = false; + this.isout = true; + + this.accept = $.isFunction(accept) ? accept : function(d) { + return d.is(accept); + }; + + //Store the droppable's proportions + this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; + + // Add the reference and positions to the manager + $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || []; + $.ui.ddmanager.droppables[o.scope].push(this); + + (o.addClasses && this.element.addClass("ui-droppable")); + + }, + + _destroy: function() { + var i = 0, + drop = $.ui.ddmanager.droppables[this.options.scope]; + + for ( ; i < drop.length; i++ ) { + if ( drop[i] === this ) { + drop.splice(i, 1); + } + } + + this.element.removeClass("ui-droppable ui-droppable-disabled"); + }, + + _setOption: function(key, value) { + + if(key === "accept") { + this.accept = $.isFunction(value) ? value : function(d) { + return d.is(value); + }; + } + $.Widget.prototype._setOption.apply(this, arguments); + }, + + _activate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) { + this.element.addClass(this.options.activeClass); + } + if(draggable){ + this._trigger("activate", event, this.ui(draggable)); + } + }, + + _deactivate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) { + this.element.removeClass(this.options.activeClass); + } + if(draggable){ + this._trigger("deactivate", event, this.ui(draggable)); + } + }, + + _over: function(event) { + + var draggable = $.ui.ddmanager.current; + + // Bail if draggable and droppable are same element + if (!draggable || (draggable.currentItem || draggable.element)[0] === this.element[0]) { + return; + } + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) { + this.element.addClass(this.options.hoverClass); + } + this._trigger("over", event, this.ui(draggable)); + } + + }, + + _out: function(event) { + + var draggable = $.ui.ddmanager.current; + + // Bail if draggable and droppable are same element + if (!draggable || (draggable.currentItem || draggable.element)[0] === this.element[0]) { + return; + } + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) { + this.element.removeClass(this.options.hoverClass); + } + this._trigger("out", event, this.ui(draggable)); + } + + }, + + _drop: function(event,custom) { + + var draggable = custom || $.ui.ddmanager.current, + childrenIntersection = false; + + // Bail if draggable and droppable are same element + if (!draggable || (draggable.currentItem || draggable.element)[0] === this.element[0]) { + return false; + } + + this.element.find(":data(ui-droppable)").not(".ui-draggable-dragging").each(function() { + var inst = $.data(this, "ui-droppable"); + if( + inst.options.greedy && + !inst.options.disabled && + inst.options.scope === draggable.options.scope && + inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element)) && + $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance) + ) { childrenIntersection = true; return false; } + }); + if(childrenIntersection) { + return false; + } + + if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.activeClass) { + this.element.removeClass(this.options.activeClass); + } + if(this.options.hoverClass) { + this.element.removeClass(this.options.hoverClass); + } + this._trigger("drop", event, this.ui(draggable)); + return this.element; + } + + return false; + + }, + + ui: function(c) { + return { + draggable: (c.currentItem || c.element), + helper: c.helper, + position: c.position, + offset: c.positionAbs + }; + } + +}); + +$.ui.intersect = function(draggable, droppable, toleranceMode) { + + if (!droppable.offset) { + return false; + } + + var draggableLeft, draggableTop, + x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width, + y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height, + l = droppable.offset.left, r = l + droppable.proportions.width, + t = droppable.offset.top, b = t + droppable.proportions.height; + + switch (toleranceMode) { + case "fit": + return (l <= x1 && x2 <= r && t <= y1 && y2 <= b); + case "intersect": + return (l < x1 + (draggable.helperProportions.width / 2) && // Right Half + x2 - (draggable.helperProportions.width / 2) < r && // Left Half + t < y1 + (draggable.helperProportions.height / 2) && // Bottom Half + y2 - (draggable.helperProportions.height / 2) < b ); // Top Half + case "pointer": + draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left); + draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top); + return isOverAxis( draggableTop, t, droppable.proportions.height ) && isOverAxis( draggableLeft, l, droppable.proportions.width ); + case "touch": + return ( + (y1 >= t && y1 <= b) || // Top edge touching + (y2 >= t && y2 <= b) || // Bottom edge touching + (y1 < t && y2 > b) // Surrounded vertically + ) && ( + (x1 >= l && x1 <= r) || // Left edge touching + (x2 >= l && x2 <= r) || // Right edge touching + (x1 < l && x2 > r) // Surrounded horizontally + ); + default: + return false; + } + +}; + +/* + This manager tracks offsets of draggables and droppables +*/ +$.ui.ddmanager = { + current: null, + droppables: { "default": [] }, + prepareOffsets: function(t, event) { + + var i, j, + m = $.ui.ddmanager.droppables[t.options.scope] || [], + type = event ? event.type : null, // workaround for #2317 + list = (t.currentItem || t.element).find(":data(ui-droppable)").addBack(); + + droppablesLoop: for (i = 0; i < m.length; i++) { + + //No disabled and non-accepted + if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) { + continue; + } + + // Filter out elements in the current dragged item + for (j=0; j < list.length; j++) { + if(list[j] === m[i].element[0]) { + m[i].proportions.height = 0; + continue droppablesLoop; + } + } + + m[i].visible = m[i].element.css("display") !== "none"; + if(!m[i].visible) { + continue; + } + + //Activate the droppable if used directly from draggables + if(type === "mousedown") { + m[i]._activate.call(m[i], event); + } + + m[i].offset = m[i].element.offset(); + m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight }; + + } + + }, + drop: function(draggable, event) { + + var dropped = false; + // Create a copy of the droppables in case the list changes during the drop (#9116) + $.each(($.ui.ddmanager.droppables[draggable.options.scope] || []).slice(), function() { + + if(!this.options) { + return; + } + if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) { + dropped = this._drop.call(this, event) || dropped; + } + + if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + this.isout = true; + this.isover = false; + this._deactivate.call(this, event); + } + + }); + return dropped; + + }, + dragStart: function( draggable, event ) { + //Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003) + draggable.element.parentsUntil( "body" ).bind( "scroll.droppable", function() { + if( !draggable.options.refreshPositions ) { + $.ui.ddmanager.prepareOffsets( draggable, event ); + } + }); + }, + drag: function(draggable, event) { + + //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse. + if(draggable.options.refreshPositions) { + $.ui.ddmanager.prepareOffsets(draggable, event); + } + + //Run through all droppables and check their positions based on specific tolerance options + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(this.options.disabled || this.greedyChild || !this.visible) { + return; + } + + var parentInstance, scope, parent, + intersects = $.ui.intersect(draggable, this, this.options.tolerance), + c = !intersects && this.isover ? "isout" : (intersects && !this.isover ? "isover" : null); + if(!c) { + return; + } + + if (this.options.greedy) { + // find droppable parents with same scope + scope = this.options.scope; + parent = this.element.parents(":data(ui-droppable)").filter(function () { + return $.data(this, "ui-droppable").options.scope === scope; + }); + + if (parent.length) { + parentInstance = $.data(parent[0], "ui-droppable"); + parentInstance.greedyChild = (c === "isover"); + } + } + + // we just moved into a greedy child + if (parentInstance && c === "isover") { + parentInstance.isover = false; + parentInstance.isout = true; + parentInstance._out.call(parentInstance, event); + } + + this[c] = true; + this[c === "isout" ? "isover" : "isout"] = false; + this[c === "isover" ? "_over" : "_out"].call(this, event); + + // we just moved out of a greedy child + if (parentInstance && c === "isout") { + parentInstance.isout = false; + parentInstance.isover = true; + parentInstance._over.call(parentInstance, event); + } + }); + + }, + dragStop: function( draggable, event ) { + draggable.element.parentsUntil( "body" ).unbind( "scroll.droppable" ); + //Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003) + if( !draggable.options.refreshPositions ) { + $.ui.ddmanager.prepareOffsets( draggable, event ); + } + } +}; + +})(jQuery); + +(function( $, undefined ) { + +function num(v) { + return parseInt(v, 10) || 0; +} + +function isNumber(value) { + return !isNaN(parseInt(value, 10)); +} + +$.widget("ui.resizable", $.ui.mouse, { + version: "1.10.2", + widgetEventPrefix: "resize", + options: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + containment: false, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + // See #7960 + zIndex: 90, + + // callbacks + resize: null, + start: null, + stop: null + }, + _create: function() { + + var n, i, handle, axis, hname, + that = this, + o = this.options; + this.element.addClass("ui-resizable"); + + $.extend(this, { + _aspectRatio: !!(o.aspectRatio), + aspectRatio: o.aspectRatio, + originalElement: this.element, + _proportionallyResizeElements: [], + _helper: o.helper || o.ghost || o.animate ? o.helper || "ui-resizable-helper" : null + }); + + //Wrap the element if it cannot hold child nodes + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { + + //Create a wrapper element and set the wrapper to the new current internal element + this.element.wrap( + $("
    ").css({ + position: this.element.css("position"), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css("top"), + left: this.element.css("left") + }) + ); + + //Overwrite the original this.element + this.element = this.element.parent().data( + "ui-resizable", this.element.data("ui-resizable") + ); + + this.elementIsWrapper = true; + + //Move margins to the wrapper + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); + + //Prevent Safari textarea resize + this.originalResizeStyle = this.originalElement.css("resize"); + this.originalElement.css("resize", "none"); + + //Push the actual element to our proportionallyResize internal array + this._proportionallyResizeElements.push(this.originalElement.css({ position: "static", zoom: 1, display: "block" })); + + // avoid IE jump (hard set the margin) + this.originalElement.css({ margin: this.originalElement.css("margin") }); + + // fix handlers offset + this._proportionallyResize(); + + } + + this.handles = o.handles || (!$(".ui-resizable-handle", this.element).length ? "e,s,se" : { n: ".ui-resizable-n", e: ".ui-resizable-e", s: ".ui-resizable-s", w: ".ui-resizable-w", se: ".ui-resizable-se", sw: ".ui-resizable-sw", ne: ".ui-resizable-ne", nw: ".ui-resizable-nw" }); + if(this.handles.constructor === String) { + + if ( this.handles === "all") { + this.handles = "n,e,s,w,se,sw,ne,nw"; + } + + n = this.handles.split(","); + this.handles = {}; + + for(i = 0; i < n.length; i++) { + + handle = $.trim(n[i]); + hname = "ui-resizable-"+handle; + axis = $("
    "); + + // Apply zIndex to all handles - see #7960 + axis.css({ zIndex: o.zIndex }); + + //TODO : What's going on here? + if ("se" === handle) { + axis.addClass("ui-icon ui-icon-gripsmall-diagonal-se"); + } + + //Insert into internal handles object and append to element + this.handles[handle] = ".ui-resizable-"+handle; + this.element.append(axis); + } + + } + + this._renderAxis = function(target) { + + var i, axis, padPos, padWrapper; + + target = target || this.element; + + for(i in this.handles) { + + if(this.handles[i].constructor === String) { + this.handles[i] = $(this.handles[i], this.element).show(); + } + + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { + + axis = $(this.handles[i], this.element); + + //Checking the correct pad and border + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); + + //The padding type i have to apply... + padPos = [ "padding", + /ne|nw|n/.test(i) ? "Top" : + /se|sw|s/.test(i) ? "Bottom" : + /^e$/.test(i) ? "Right" : "Left" ].join(""); + + target.css(padPos, padWrapper); + + this._proportionallyResize(); + + } + + //TODO: What's that good for? There's not anything to be executed left + if(!$(this.handles[i]).length) { + continue; + } + } + }; + + //TODO: make renderAxis a prototype function + this._renderAxis(this.element); + + this._handles = $(".ui-resizable-handle", this.element) + .disableSelection(); + + //Matching axis name + this._handles.mouseover(function() { + if (!that.resizing) { + if (this.className) { + axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); + } + //Axis, default = se + that.axis = axis && axis[1] ? axis[1] : "se"; + } + }); + + //If we want to auto hide the elements + if (o.autoHide) { + this._handles.hide(); + $(this.element) + .addClass("ui-resizable-autohide") + .mouseenter(function() { + if (o.disabled) { + return; + } + $(this).removeClass("ui-resizable-autohide"); + that._handles.show(); + }) + .mouseleave(function(){ + if (o.disabled) { + return; + } + if (!that.resizing) { + $(this).addClass("ui-resizable-autohide"); + that._handles.hide(); + } + }); + } + + //Initialize the mouse interaction + this._mouseInit(); + + }, + + _destroy: function() { + + this._mouseDestroy(); + + var wrapper, + _destroy = function(exp) { + $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") + .removeData("resizable").removeData("ui-resizable").unbind(".resizable").find(".ui-resizable-handle").remove(); + }; + + //TODO: Unwrap at same DOM position + if (this.elementIsWrapper) { + _destroy(this.element); + wrapper = this.element; + this.originalElement.css({ + position: wrapper.css("position"), + width: wrapper.outerWidth(), + height: wrapper.outerHeight(), + top: wrapper.css("top"), + left: wrapper.css("left") + }).insertAfter( wrapper ); + wrapper.remove(); + } + + this.originalElement.css("resize", this.originalResizeStyle); + _destroy(this.originalElement); + + return this; + }, + + _mouseCapture: function(event) { + var i, handle, + capture = false; + + for (i in this.handles) { + handle = $(this.handles[i])[0]; + if (handle === event.target || $.contains(handle, event.target)) { + capture = true; + } + } + + return !this.options.disabled && capture; + }, + + _mouseStart: function(event) { + + var curleft, curtop, cursor, + o = this.options, + iniPos = this.element.position(), + el = this.element; + + this.resizing = true; + + // bugfix for http://dev.jquery.com/ticket/1749 + if ( (/absolute/).test( el.css("position") ) ) { + el.css({ position: "absolute", top: el.css("top"), left: el.css("left") }); + } else if (el.is(".ui-draggable")) { + el.css({ position: "absolute", top: iniPos.top, left: iniPos.left }); + } + + this._renderProxy(); + + curleft = num(this.helper.css("left")); + curtop = num(this.helper.css("top")); + + if (o.containment) { + curleft += $(o.containment).scrollLeft() || 0; + curtop += $(o.containment).scrollTop() || 0; + } + + //Store needed variables + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalPosition = { left: curleft, top: curtop }; + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; + + //Aspect Ratio + this.aspectRatio = (typeof o.aspectRatio === "number") ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); + + cursor = $(".ui-resizable-" + this.axis).css("cursor"); + $("body").css("cursor", cursor === "auto" ? this.axis + "-resize" : cursor); + + el.addClass("ui-resizable-resizing"); + this._propagate("start", event); + return true; + }, + + _mouseDrag: function(event) { + + //Increase performance, avoid regex + var data, + el = this.helper, props = {}, + smp = this.originalMousePosition, + a = this.axis, + prevTop = this.position.top, + prevLeft = this.position.left, + prevWidth = this.size.width, + prevHeight = this.size.height, + dx = (event.pageX-smp.left)||0, + dy = (event.pageY-smp.top)||0, + trigger = this._change[a]; + + if (!trigger) { + return false; + } + + // Calculate the attrs that will be change + data = trigger.apply(this, [event, dx, dy]); + + // Put this in the mouseDrag handler since the user can start pressing shift while resizing + this._updateVirtualBoundaries(event.shiftKey); + if (this._aspectRatio || event.shiftKey) { + data = this._updateRatio(data, event); + } + + data = this._respectSize(data, event); + + this._updateCache(data); + + // plugins callbacks need to be called first + this._propagate("resize", event); + + if (this.position.top !== prevTop) { + props.top = this.position.top + "px"; + } + if (this.position.left !== prevLeft) { + props.left = this.position.left + "px"; + } + if (this.size.width !== prevWidth) { + props.width = this.size.width + "px"; + } + if (this.size.height !== prevHeight) { + props.height = this.size.height + "px"; + } + el.css(props); + + if (!this._helper && this._proportionallyResizeElements.length) { + this._proportionallyResize(); + } + + // Call the user callback if the element was resized + if ( ! $.isEmptyObject(props) ) { + this._trigger("resize", event, this.ui()); + } + + return false; + }, + + _mouseStop: function(event) { + + this.resizing = false; + var pr, ista, soffseth, soffsetw, s, left, top, + o = this.options, that = this; + + if(this._helper) { + + pr = this._proportionallyResizeElements; + ista = pr.length && (/textarea/i).test(pr[0].nodeName); + soffseth = ista && $.ui.hasScroll(pr[0], "left") /* TODO - jump height */ ? 0 : that.sizeDiff.height; + soffsetw = ista ? 0 : that.sizeDiff.width; + + s = { width: (that.helper.width() - soffsetw), height: (that.helper.height() - soffseth) }; + left = (parseInt(that.element.css("left"), 10) + (that.position.left - that.originalPosition.left)) || null; + top = (parseInt(that.element.css("top"), 10) + (that.position.top - that.originalPosition.top)) || null; + + if (!o.animate) { + this.element.css($.extend(s, { top: top, left: left })); + } + + that.helper.height(that.size.height); + that.helper.width(that.size.width); + + if (this._helper && !o.animate) { + this._proportionallyResize(); + } + } + + $("body").css("cursor", "auto"); + + this.element.removeClass("ui-resizable-resizing"); + + this._propagate("stop", event); + + if (this._helper) { + this.helper.remove(); + } + + return false; + + }, + + _updateVirtualBoundaries: function(forceAspectRatio) { + var pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b, + o = this.options; + + b = { + minWidth: isNumber(o.minWidth) ? o.minWidth : 0, + maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity, + minHeight: isNumber(o.minHeight) ? o.minHeight : 0, + maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity + }; + + if(this._aspectRatio || forceAspectRatio) { + // We want to create an enclosing box whose aspect ration is the requested one + // First, compute the "projected" size for each dimension based on the aspect ratio and other dimension + pMinWidth = b.minHeight * this.aspectRatio; + pMinHeight = b.minWidth / this.aspectRatio; + pMaxWidth = b.maxHeight * this.aspectRatio; + pMaxHeight = b.maxWidth / this.aspectRatio; + + if(pMinWidth > b.minWidth) { + b.minWidth = pMinWidth; + } + if(pMinHeight > b.minHeight) { + b.minHeight = pMinHeight; + } + if(pMaxWidth < b.maxWidth) { + b.maxWidth = pMaxWidth; + } + if(pMaxHeight < b.maxHeight) { + b.maxHeight = pMaxHeight; + } + } + this._vBoundaries = b; + }, + + _updateCache: function(data) { + this.offset = this.helper.offset(); + if (isNumber(data.left)) { + this.position.left = data.left; + } + if (isNumber(data.top)) { + this.position.top = data.top; + } + if (isNumber(data.height)) { + this.size.height = data.height; + } + if (isNumber(data.width)) { + this.size.width = data.width; + } + }, + + _updateRatio: function( data ) { + + var cpos = this.position, + csize = this.size, + a = this.axis; + + if (isNumber(data.height)) { + data.width = (data.height * this.aspectRatio); + } else if (isNumber(data.width)) { + data.height = (data.width / this.aspectRatio); + } + + if (a === "sw") { + data.left = cpos.left + (csize.width - data.width); + data.top = null; + } + if (a === "nw") { + data.top = cpos.top + (csize.height - data.height); + data.left = cpos.left + (csize.width - data.width); + } + + return data; + }, + + _respectSize: function( data ) { + + var o = this._vBoundaries, + a = this.axis, + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height), + dw = this.originalPosition.left + this.originalSize.width, + dh = this.position.top + this.size.height, + cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); + if (isminw) { + data.width = o.minWidth; + } + if (isminh) { + data.height = o.minHeight; + } + if (ismaxw) { + data.width = o.maxWidth; + } + if (ismaxh) { + data.height = o.maxHeight; + } + + if (isminw && cw) { + data.left = dw - o.minWidth; + } + if (ismaxw && cw) { + data.left = dw - o.maxWidth; + } + if (isminh && ch) { + data.top = dh - o.minHeight; + } + if (ismaxh && ch) { + data.top = dh - o.maxHeight; + } + + // fixing jump error on top/left - bug #2330 + if (!data.width && !data.height && !data.left && data.top) { + data.top = null; + } else if (!data.width && !data.height && !data.top && data.left) { + data.left = null; + } + + return data; + }, + + _proportionallyResize: function() { + + if (!this._proportionallyResizeElements.length) { + return; + } + + var i, j, borders, paddings, prel, + element = this.helper || this.element; + + for ( i=0; i < this._proportionallyResizeElements.length; i++) { + + prel = this._proportionallyResizeElements[i]; + + if (!this.borderDif) { + this.borderDif = []; + borders = [prel.css("borderTopWidth"), prel.css("borderRightWidth"), prel.css("borderBottomWidth"), prel.css("borderLeftWidth")]; + paddings = [prel.css("paddingTop"), prel.css("paddingRight"), prel.css("paddingBottom"), prel.css("paddingLeft")]; + + for ( j = 0; j < borders.length; j++ ) { + this.borderDif[ j ] = ( parseInt( borders[ j ], 10 ) || 0 ) + ( parseInt( paddings[ j ], 10 ) || 0 ); + } + } + + prel.css({ + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 + }); + + } + + }, + + _renderProxy: function() { + + var el = this.element, o = this.options; + this.elementOffset = el.offset(); + + if(this._helper) { + + this.helper = this.helper || $("
    "); + + this.helper.addClass(this._helper).css({ + width: this.element.outerWidth() - 1, + height: this.element.outerHeight() - 1, + position: "absolute", + left: this.elementOffset.left +"px", + top: this.elementOffset.top +"px", + zIndex: ++o.zIndex //TODO: Don't modify option + }); + + this.helper + .appendTo("body") + .disableSelection(); + + } else { + this.helper = this.element; + } + + }, + + _change: { + e: function(event, dx) { + return { width: this.originalSize.width + dx }; + }, + w: function(event, dx) { + var cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function(event, dx, dy) { + var cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function(event, dx, dy) { + return { height: this.originalSize.height + dy }; + }, + se: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + sw: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + }, + ne: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + nw: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + } + }, + + _propagate: function(n, event) { + $.ui.plugin.call(this, n, [event, this.ui()]); + (n !== "resize" && this._trigger(n, event, this.ui())); + }, + + plugins: {}, + + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } + +}); + +/* + * Resizable Extensions + */ + +$.ui.plugin.add("resizable", "animate", { + + stop: function( event ) { + var that = $(this).data("ui-resizable"), + o = that.options, + pr = that._proportionallyResizeElements, + ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], "left") /* TODO - jump height */ ? 0 : that.sizeDiff.height, + soffsetw = ista ? 0 : that.sizeDiff.width, + style = { width: (that.size.width - soffsetw), height: (that.size.height - soffseth) }, + left = (parseInt(that.element.css("left"), 10) + (that.position.left - that.originalPosition.left)) || null, + top = (parseInt(that.element.css("top"), 10) + (that.position.top - that.originalPosition.top)) || null; + + that.element.animate( + $.extend(style, top && left ? { top: top, left: left } : {}), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseInt(that.element.css("width"), 10), + height: parseInt(that.element.css("height"), 10), + top: parseInt(that.element.css("top"), 10), + left: parseInt(that.element.css("left"), 10) + }; + + if (pr && pr.length) { + $(pr[0]).css({ width: data.width, height: data.height }); + } + + // propagating resize, and updating values for each animation step + that._updateCache(data); + that._propagate("resize", event); + + } + } + ); + } + +}); + +$.ui.plugin.add("resizable", "containment", { + + start: function() { + var element, p, co, ch, cw, width, height, + that = $(this).data("ui-resizable"), + o = that.options, + el = that.element, + oc = o.containment, + ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; + + if (!ce) { + return; + } + + that.containerElement = $(ce); + + if (/document/.test(oc) || oc === document) { + that.containerOffset = { left: 0, top: 0 }; + that.containerPosition = { left: 0, top: 0 }; + + that.parentData = { + element: $(document), left: 0, top: 0, + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight + }; + } + + // i'm a node, so compute top, left, right, bottom + else { + element = $(ce); + p = []; + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); + + that.containerOffset = element.offset(); + that.containerPosition = element.position(); + that.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; + + co = that.containerOffset; + ch = that.containerSize.height; + cw = that.containerSize.width; + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ); + height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); + + that.parentData = { + element: ce, left: co.left, top: co.top, width: width, height: height + }; + } + }, + + resize: function( event ) { + var woset, hoset, isParent, isOffsetRelative, + that = $(this).data("ui-resizable"), + o = that.options, + co = that.containerOffset, cp = that.position, + pRatio = that._aspectRatio || event.shiftKey, + cop = { top:0, left:0 }, ce = that.containerElement; + + if (ce[0] !== document && (/static/).test(ce.css("position"))) { + cop = co; + } + + if (cp.left < (that._helper ? co.left : 0)) { + that.size.width = that.size.width + (that._helper ? (that.position.left - co.left) : (that.position.left - cop.left)); + if (pRatio) { + that.size.height = that.size.width / that.aspectRatio; + } + that.position.left = o.helper ? co.left : 0; + } + + if (cp.top < (that._helper ? co.top : 0)) { + that.size.height = that.size.height + (that._helper ? (that.position.top - co.top) : that.position.top); + if (pRatio) { + that.size.width = that.size.height * that.aspectRatio; + } + that.position.top = that._helper ? co.top : 0; + } + + that.offset.left = that.parentData.left+that.position.left; + that.offset.top = that.parentData.top+that.position.top; + + woset = Math.abs( (that._helper ? that.offset.left - cop.left : (that.offset.left - cop.left)) + that.sizeDiff.width ); + hoset = Math.abs( (that._helper ? that.offset.top - cop.top : (that.offset.top - co.top)) + that.sizeDiff.height ); + + isParent = that.containerElement.get(0) === that.element.parent().get(0); + isOffsetRelative = /relative|absolute/.test(that.containerElement.css("position")); + + if(isParent && isOffsetRelative) { + woset -= that.parentData.left; + } + + if (woset + that.size.width >= that.parentData.width) { + that.size.width = that.parentData.width - woset; + if (pRatio) { + that.size.height = that.size.width / that.aspectRatio; + } + } + + if (hoset + that.size.height >= that.parentData.height) { + that.size.height = that.parentData.height - hoset; + if (pRatio) { + that.size.width = that.size.height * that.aspectRatio; + } + } + }, + + stop: function(){ + var that = $(this).data("ui-resizable"), + o = that.options, + co = that.containerOffset, + cop = that.containerPosition, + ce = that.containerElement, + helper = $(that.helper), + ho = helper.offset(), + w = helper.outerWidth() - that.sizeDiff.width, + h = helper.outerHeight() - that.sizeDiff.height; + + if (that._helper && !o.animate && (/relative/).test(ce.css("position"))) { + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + } + + if (that._helper && !o.animate && (/static/).test(ce.css("position"))) { + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + } + + } +}); + +$.ui.plugin.add("resizable", "alsoResize", { + + start: function () { + var that = $(this).data("ui-resizable"), + o = that.options, + _store = function (exp) { + $(exp).each(function() { + var el = $(this); + el.data("ui-resizable-alsoresize", { + width: parseInt(el.width(), 10), height: parseInt(el.height(), 10), + left: parseInt(el.css("left"), 10), top: parseInt(el.css("top"), 10) + }); + }); + }; + + if (typeof(o.alsoResize) === "object" && !o.alsoResize.parentNode) { + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } + else { $.each(o.alsoResize, function (exp) { _store(exp); }); } + }else{ + _store(o.alsoResize); + } + }, + + resize: function (event, ui) { + var that = $(this).data("ui-resizable"), + o = that.options, + os = that.originalSize, + op = that.originalPosition, + delta = { + height: (that.size.height - os.height) || 0, width: (that.size.width - os.width) || 0, + top: (that.position.top - op.top) || 0, left: (that.position.left - op.left) || 0 + }, + + _alsoResize = function (exp, c) { + $(exp).each(function() { + var el = $(this), start = $(this).data("ui-resizable-alsoresize"), style = {}, + css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ["width", "height"] : ["width", "height", "top", "left"]; + + $.each(css, function (i, prop) { + var sum = (start[prop]||0) + (delta[prop]||0); + if (sum && sum >= 0) { + style[prop] = sum || null; + } + }); + + el.css(style); + }); + }; + + if (typeof(o.alsoResize) === "object" && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); }); + }else{ + _alsoResize(o.alsoResize); + } + }, + + stop: function () { + $(this).removeData("resizable-alsoresize"); + } +}); + +$.ui.plugin.add("resizable", "ghost", { + + start: function() { + + var that = $(this).data("ui-resizable"), o = that.options, cs = that.size; + + that.ghost = that.originalElement.clone(); + that.ghost + .css({ opacity: 0.25, display: "block", position: "relative", height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) + .addClass("ui-resizable-ghost") + .addClass(typeof o.ghost === "string" ? o.ghost : ""); + + that.ghost.appendTo(that.helper); + + }, + + resize: function(){ + var that = $(this).data("ui-resizable"); + if (that.ghost) { + that.ghost.css({ position: "relative", height: that.size.height, width: that.size.width }); + } + }, + + stop: function() { + var that = $(this).data("ui-resizable"); + if (that.ghost && that.helper) { + that.helper.get(0).removeChild(that.ghost.get(0)); + } + } + +}); + +$.ui.plugin.add("resizable", "grid", { + + resize: function() { + var that = $(this).data("ui-resizable"), + o = that.options, + cs = that.size, + os = that.originalSize, + op = that.originalPosition, + a = that.axis, + grid = typeof o.grid === "number" ? [o.grid, o.grid] : o.grid, + gridX = (grid[0]||1), + gridY = (grid[1]||1), + ox = Math.round((cs.width - os.width) / gridX) * gridX, + oy = Math.round((cs.height - os.height) / gridY) * gridY, + newWidth = os.width + ox, + newHeight = os.height + oy, + isMaxWidth = o.maxWidth && (o.maxWidth < newWidth), + isMaxHeight = o.maxHeight && (o.maxHeight < newHeight), + isMinWidth = o.minWidth && (o.minWidth > newWidth), + isMinHeight = o.minHeight && (o.minHeight > newHeight); + + o.grid = grid; + + if (isMinWidth) { + newWidth = newWidth + gridX; + } + if (isMinHeight) { + newHeight = newHeight + gridY; + } + if (isMaxWidth) { + newWidth = newWidth - gridX; + } + if (isMaxHeight) { + newHeight = newHeight - gridY; + } + + if (/^(se|s|e)$/.test(a)) { + that.size.width = newWidth; + that.size.height = newHeight; + } else if (/^(ne)$/.test(a)) { + that.size.width = newWidth; + that.size.height = newHeight; + that.position.top = op.top - oy; + } else if (/^(sw)$/.test(a)) { + that.size.width = newWidth; + that.size.height = newHeight; + that.position.left = op.left - ox; + } else { + that.size.width = newWidth; + that.size.height = newHeight; + that.position.top = op.top - oy; + that.position.left = op.left - ox; + } + } + +}); + +})(jQuery); + +(function( $, undefined ) { + +$.widget("ui.selectable", $.ui.mouse, { + version: "1.10.2", + options: { + appendTo: "body", + autoRefresh: true, + distance: 0, + filter: "*", + tolerance: "touch", + + // callbacks + selected: null, + selecting: null, + start: null, + stop: null, + unselected: null, + unselecting: null + }, + _create: function() { + var selectees, + that = this; + + this.element.addClass("ui-selectable"); + + this.dragged = false; + + // cache selectee children based on filter + this.refresh = function() { + selectees = $(that.options.filter, that.element[0]); + selectees.addClass("ui-selectee"); + selectees.each(function() { + var $this = $(this), + pos = $this.offset(); + $.data(this, "selectable-item", { + element: this, + $element: $this, + left: pos.left, + top: pos.top, + right: pos.left + $this.outerWidth(), + bottom: pos.top + $this.outerHeight(), + startselected: false, + selected: $this.hasClass("ui-selected"), + selecting: $this.hasClass("ui-selecting"), + unselecting: $this.hasClass("ui-unselecting") + }); + }); + }; + this.refresh(); + + this.selectees = selectees.addClass("ui-selectee"); + + this._mouseInit(); + + this.helper = $("
    "); + }, + + _destroy: function() { + this.selectees + .removeClass("ui-selectee") + .removeData("selectable-item"); + this.element + .removeClass("ui-selectable ui-selectable-disabled"); + this._mouseDestroy(); + }, + + _mouseStart: function(event) { + var that = this, + options = this.options; + + this.opos = [event.pageX, event.pageY]; + + if (this.options.disabled) { + return; + } + + this.selectees = $(options.filter, this.element[0]); + + this._trigger("start", event); + + $(options.appendTo).append(this.helper); + // position helper (lasso) + this.helper.css({ + "left": event.pageX, + "top": event.pageY, + "width": 0, + "height": 0 + }); + + if (options.autoRefresh) { + this.refresh(); + } + + this.selectees.filter(".ui-selected").each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.startselected = true; + if (!event.metaKey && !event.ctrlKey) { + selectee.$element.removeClass("ui-selected"); + selectee.selected = false; + selectee.$element.addClass("ui-unselecting"); + selectee.unselecting = true; + // selectable UNSELECTING callback + that._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + }); + + $(event.target).parents().addBack().each(function() { + var doSelect, + selectee = $.data(this, "selectable-item"); + if (selectee) { + doSelect = (!event.metaKey && !event.ctrlKey) || !selectee.$element.hasClass("ui-selected"); + selectee.$element + .removeClass(doSelect ? "ui-unselecting" : "ui-selected") + .addClass(doSelect ? "ui-selecting" : "ui-unselecting"); + selectee.unselecting = !doSelect; + selectee.selecting = doSelect; + selectee.selected = doSelect; + // selectable (UN)SELECTING callback + if (doSelect) { + that._trigger("selecting", event, { + selecting: selectee.element + }); + } else { + that._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + return false; + } + }); + + }, + + _mouseDrag: function(event) { + + this.dragged = true; + + if (this.options.disabled) { + return; + } + + var tmp, + that = this, + options = this.options, + x1 = this.opos[0], + y1 = this.opos[1], + x2 = event.pageX, + y2 = event.pageY; + + if (x1 > x2) { tmp = x2; x2 = x1; x1 = tmp; } + if (y1 > y2) { tmp = y2; y2 = y1; y1 = tmp; } + this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1}); + + this.selectees.each(function() { + var selectee = $.data(this, "selectable-item"), + hit = false; + + //prevent helper from being selected if appendTo: selectable + if (!selectee || selectee.element === that.element[0]) { + return; + } + + if (options.tolerance === "touch") { + hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) ); + } else if (options.tolerance === "fit") { + hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2); + } + + if (hit) { + // SELECT + if (selectee.selected) { + selectee.$element.removeClass("ui-selected"); + selectee.selected = false; + } + if (selectee.unselecting) { + selectee.$element.removeClass("ui-unselecting"); + selectee.unselecting = false; + } + if (!selectee.selecting) { + selectee.$element.addClass("ui-selecting"); + selectee.selecting = true; + // selectable SELECTING callback + that._trigger("selecting", event, { + selecting: selectee.element + }); + } + } else { + // UNSELECT + if (selectee.selecting) { + if ((event.metaKey || event.ctrlKey) && selectee.startselected) { + selectee.$element.removeClass("ui-selecting"); + selectee.selecting = false; + selectee.$element.addClass("ui-selected"); + selectee.selected = true; + } else { + selectee.$element.removeClass("ui-selecting"); + selectee.selecting = false; + if (selectee.startselected) { + selectee.$element.addClass("ui-unselecting"); + selectee.unselecting = true; + } + // selectable UNSELECTING callback + that._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + if (selectee.selected) { + if (!event.metaKey && !event.ctrlKey && !selectee.startselected) { + selectee.$element.removeClass("ui-selected"); + selectee.selected = false; + + selectee.$element.addClass("ui-unselecting"); + selectee.unselecting = true; + // selectable UNSELECTING callback + that._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + } + }); + + return false; + }, + + _mouseStop: function(event) { + var that = this; + + this.dragged = false; + + $(".ui-unselecting", this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass("ui-unselecting"); + selectee.unselecting = false; + selectee.startselected = false; + that._trigger("unselected", event, { + unselected: selectee.element + }); + }); + $(".ui-selecting", this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass("ui-selecting").addClass("ui-selected"); + selectee.selecting = false; + selectee.selected = true; + selectee.startselected = true; + that._trigger("selected", event, { + selected: selectee.element + }); + }); + this._trigger("stop", event); + + this.helper.remove(); + + return false; + } + +}); + +})(jQuery); + +(function( $, undefined ) { + +/*jshint loopfunc: true */ + +function isOverAxis( x, reference, size ) { + return ( x > reference ) && ( x < ( reference + size ) ); +} + +function isFloating(item) { + return (/left|right/).test(item.css("float")) || (/inline|table-cell/).test(item.css("display")); +} + +$.widget("ui.sortable", $.ui.mouse, { + version: "1.10.2", + widgetEventPrefix: "sort", + ready: false, + options: { + appendTo: "parent", + axis: false, + connectWith: false, + containment: false, + cursor: "auto", + cursorAt: false, + dropOnEmpty: true, + forcePlaceholderSize: false, + forceHelperSize: false, + grid: false, + handle: false, + helper: "original", + items: "> *", + opacity: false, + placeholder: false, + revert: false, + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + scope: "default", + tolerance: "intersect", + zIndex: 1000, + + // callbacks + activate: null, + beforeStop: null, + change: null, + deactivate: null, + out: null, + over: null, + receive: null, + remove: null, + sort: null, + start: null, + stop: null, + update: null + }, + _create: function() { + + var o = this.options; + this.containerCache = {}; + this.element.addClass("ui-sortable"); + + //Get the items + this.refresh(); + + //Let's determine if the items are being displayed horizontally + this.floating = this.items.length ? o.axis === "x" || isFloating(this.items[0].item) : false; + + //Let's determine the parent's offset + this.offset = this.element.offset(); + + //Initialize mouse events for interaction + this._mouseInit(); + + //We're ready to go + this.ready = true; + + }, + + _destroy: function() { + this.element + .removeClass("ui-sortable ui-sortable-disabled"); + this._mouseDestroy(); + + for ( var i = this.items.length - 1; i >= 0; i-- ) { + this.items[i].item.removeData(this.widgetName + "-item"); + } + + return this; + }, + + _setOption: function(key, value){ + if ( key === "disabled" ) { + this.options[ key ] = value; + + this.widget().toggleClass( "ui-sortable-disabled", !!value ); + } else { + // Don't call widget base _setOption for disable as it adds ui-state-disabled class + $.Widget.prototype._setOption.apply(this, arguments); + } + }, + + _mouseCapture: function(event, overrideHandle) { + var currentItem = null, + validHandle = false, + that = this; + + if (this.reverting) { + return false; + } + + if(this.options.disabled || this.options.type === "static") { + return false; + } + + //We have to refresh the items data once first + this._refreshItems(event); + + //Find out if the clicked node (or one of its parents) is a actual item in this.items + $(event.target).parents().each(function() { + if($.data(this, that.widgetName + "-item") === that) { + currentItem = $(this); + return false; + } + }); + if($.data(event.target, that.widgetName + "-item") === that) { + currentItem = $(event.target); + } + + if(!currentItem) { + return false; + } + if(this.options.handle && !overrideHandle) { + $(this.options.handle, currentItem).find("*").addBack().each(function() { + if(this === event.target) { + validHandle = true; + } + }); + if(!validHandle) { + return false; + } + } + + this.currentItem = currentItem; + this._removeCurrentsFromItems(); + return true; + + }, + + _mouseStart: function(event, overrideHandle, noActivation) { + + var i, body, + o = this.options; + + this.currentContainer = this; + + //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture + this.refreshPositions(); + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Get the next scrolling parent + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.currentItem.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + // Only after we got the offset, we can change the helper's position to absolute + // TODO: Still need to figure out a way to make relative sorting possible + this.helper.css("position", "absolute"); + this.cssPosition = this.helper.css("position"); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if "cursorAt" is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Cache the former DOM position + this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; + + //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way + if(this.helper[0] !== this.currentItem[0]) { + this.currentItem.hide(); + } + + //Create the placeholder + this._createPlaceholder(); + + //Set a containment if given in the options + if(o.containment) { + this._setContainment(); + } + + if( o.cursor && o.cursor !== "auto" ) { // cursor option + body = this.document.find( "body" ); + + // support: IE + this.storedCursor = body.css( "cursor" ); + body.css( "cursor", o.cursor ); + + this.storedStylesheet = $( "" ).appendTo( body ); + } + + if(o.opacity) { // opacity option + if (this.helper.css("opacity")) { + this._storedOpacity = this.helper.css("opacity"); + } + this.helper.css("opacity", o.opacity); + } + + if(o.zIndex) { // zIndex option + if (this.helper.css("zIndex")) { + this._storedZIndex = this.helper.css("zIndex"); + } + this.helper.css("zIndex", o.zIndex); + } + + //Prepare scrolling + if(this.scrollParent[0] !== document && this.scrollParent[0].tagName !== "HTML") { + this.overflowOffset = this.scrollParent.offset(); + } + + //Call callbacks + this._trigger("start", event, this._uiHash()); + + //Recache the helper size + if(!this._preserveHelperProportions) { + this._cacheHelperProportions(); + } + + + //Post "activate" events to possible containers + if( !noActivation ) { + for ( i = this.containers.length - 1; i >= 0; i-- ) { + this.containers[ i ]._trigger( "activate", event, this._uiHash( this ) ); + } + } + + //Prepare possible droppables + if($.ui.ddmanager) { + $.ui.ddmanager.current = this; + } + + if ($.ui.ddmanager && !o.dropBehaviour) { + $.ui.ddmanager.prepareOffsets(this, event); + } + + this.dragging = true; + + this.helper.addClass("ui-sortable-helper"); + this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + + }, + + _mouseDrag: function(event) { + var i, item, itemElement, intersection, + o = this.options, + scrolled = false; + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + if (!this.lastPositionAbs) { + this.lastPositionAbs = this.positionAbs; + } + + //Do scrolling + if(this.options.scroll) { + if(this.scrollParent[0] !== document && this.scrollParent[0].tagName !== "HTML") { + + if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) { + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed; + } else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) { + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed; + } + + if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) { + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed; + } else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) { + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed; + } + + } else { + + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) { + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + } else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) { + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) { + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + } else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) { + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) { + $.ui.ddmanager.prepareOffsets(this, event); + } + } + + //Regenerate the absolute position used for position checks + this.positionAbs = this._convertPositionTo("absolute"); + + //Set the helper position + if(!this.options.axis || this.options.axis !== "y") { + this.helper[0].style.left = this.position.left+"px"; + } + if(!this.options.axis || this.options.axis !== "x") { + this.helper[0].style.top = this.position.top+"px"; + } + + //Rearrange + for (i = this.items.length - 1; i >= 0; i--) { + + //Cache variables and intersection, continue if no intersection + item = this.items[i]; + itemElement = item.item[0]; + intersection = this._intersectsWithPointer(item); + if (!intersection) { + continue; + } + + // Only put the placeholder inside the current Container, skip all + // items form other containers. This works because when moving + // an item from one container to another the + // currentContainer is switched before the placeholder is moved. + // + // Without this moving items in "sub-sortables" can cause the placeholder to jitter + // beetween the outer and inner container. + if (item.instance !== this.currentContainer) { + continue; + } + + // cannot intersect with itself + // no useless actions that have been done before + // no action if the item moved is the parent of the item checked + if (itemElement !== this.currentItem[0] && + this.placeholder[intersection === 1 ? "next" : "prev"]()[0] !== itemElement && + !$.contains(this.placeholder[0], itemElement) && + (this.options.type === "semi-dynamic" ? !$.contains(this.element[0], itemElement) : true) + ) { + + this.direction = intersection === 1 ? "down" : "up"; + + if (this.options.tolerance === "pointer" || this._intersectsWithSides(item)) { + this._rearrange(event, item); + } else { + break; + } + + this._trigger("change", event, this._uiHash()); + break; + } + } + + //Post events to containers + this._contactContainers(event); + + //Interconnect with droppables + if($.ui.ddmanager) { + $.ui.ddmanager.drag(this, event); + } + + //Call callbacks + this._trigger("sort", event, this._uiHash()); + + this.lastPositionAbs = this.positionAbs; + return false; + + }, + + _mouseStop: function(event, noPropagation) { + + if(!event) { + return; + } + + //If we are using droppables, inform the manager about the drop + if ($.ui.ddmanager && !this.options.dropBehaviour) { + $.ui.ddmanager.drop(this, event); + } + + if(this.options.revert) { + var that = this, + cur = this.placeholder.offset(), + axis = this.options.axis, + animation = {}; + + if ( !axis || axis === "x" ) { + animation.left = cur.left - this.offset.parent.left - this.margins.left + (this.offsetParent[0] === document.body ? 0 : this.offsetParent[0].scrollLeft); + } + if ( !axis || axis === "y" ) { + animation.top = cur.top - this.offset.parent.top - this.margins.top + (this.offsetParent[0] === document.body ? 0 : this.offsetParent[0].scrollTop); + } + this.reverting = true; + $(this.helper).animate( animation, parseInt(this.options.revert, 10) || 500, function() { + that._clear(event); + }); + } else { + this._clear(event, noPropagation); + } + + return false; + + }, + + cancel: function() { + + if(this.dragging) { + + this._mouseUp({ target: null }); + + if(this.options.helper === "original") { + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + } else { + this.currentItem.show(); + } + + //Post deactivating events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + this.containers[i]._trigger("deactivate", null, this._uiHash(this)); + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", null, this._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + if (this.placeholder) { + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + if(this.placeholder[0].parentNode) { + this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + } + if(this.options.helper !== "original" && this.helper && this.helper[0].parentNode) { + this.helper.remove(); + } + + $.extend(this, { + helper: null, + dragging: false, + reverting: false, + _noFinalSort: null + }); + + if(this.domPosition.prev) { + $(this.domPosition.prev).after(this.currentItem); + } else { + $(this.domPosition.parent).prepend(this.currentItem); + } + } + + return this; + + }, + + serialize: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected), + str = []; + o = o || {}; + + $(items).each(function() { + var res = ($(o.item || this).attr(o.attribute || "id") || "").match(o.expression || (/(.+)[\-=_](.+)/)); + if (res) { + str.push((o.key || res[1]+"[]")+"="+(o.key && o.expression ? res[1] : res[2])); + } + }); + + if(!str.length && o.key) { + str.push(o.key + "="); + } + + return str.join("&"); + + }, + + toArray: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected), + ret = []; + + o = o || {}; + + items.each(function() { ret.push($(o.item || this).attr(o.attribute || "id") || ""); }); + return ret; + + }, + + /* Be careful with the following core functions */ + _intersectsWith: function(item) { + + var x1 = this.positionAbs.left, + x2 = x1 + this.helperProportions.width, + y1 = this.positionAbs.top, + y2 = y1 + this.helperProportions.height, + l = item.left, + r = l + item.width, + t = item.top, + b = t + item.height, + dyClick = this.offset.click.top, + dxClick = this.offset.click.left, + isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; + + if ( this.options.tolerance === "pointer" || + this.options.forcePointerForContainers || + (this.options.tolerance !== "pointer" && this.helperProportions[this.floating ? "width" : "height"] > item[this.floating ? "width" : "height"]) + ) { + return isOverElement; + } else { + + return (l < x1 + (this.helperProportions.width / 2) && // Right Half + x2 - (this.helperProportions.width / 2) < r && // Left Half + t < y1 + (this.helperProportions.height / 2) && // Bottom Half + y2 - (this.helperProportions.height / 2) < b ); // Top Half + + } + }, + + _intersectsWithPointer: function(item) { + + var isOverElementHeight = (this.options.axis === "x") || isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height), + isOverElementWidth = (this.options.axis === "y") || isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width), + isOverElement = isOverElementHeight && isOverElementWidth, + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (!isOverElement) { + return false; + } + + return this.floating ? + ( ((horizontalDirection && horizontalDirection === "right") || verticalDirection === "down") ? 2 : 1 ) + : ( verticalDirection && (verticalDirection === "down" ? 2 : 1) ); + + }, + + _intersectsWithSides: function(item) { + + var isOverBottomHalf = isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height), + isOverRightHalf = isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width), + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (this.floating && horizontalDirection) { + return ((horizontalDirection === "right" && isOverRightHalf) || (horizontalDirection === "left" && !isOverRightHalf)); + } else { + return verticalDirection && ((verticalDirection === "down" && isOverBottomHalf) || (verticalDirection === "up" && !isOverBottomHalf)); + } + + }, + + _getDragVerticalDirection: function() { + var delta = this.positionAbs.top - this.lastPositionAbs.top; + return delta !== 0 && (delta > 0 ? "down" : "up"); + }, + + _getDragHorizontalDirection: function() { + var delta = this.positionAbs.left - this.lastPositionAbs.left; + return delta !== 0 && (delta > 0 ? "right" : "left"); + }, + + refresh: function(event) { + this._refreshItems(event); + this.refreshPositions(); + return this; + }, + + _connectWith: function() { + var options = this.options; + return options.connectWith.constructor === String ? [options.connectWith] : options.connectWith; + }, + + _getItemsAsjQuery: function(connected) { + + var i, j, cur, inst, + items = [], + queries = [], + connectWith = this._connectWith(); + + if(connectWith && connected) { + for (i = connectWith.length - 1; i >= 0; i--){ + cur = $(connectWith[i]); + for ( j = cur.length - 1; j >= 0; j--){ + inst = $.data(cur[j], this.widgetFullName); + if(inst && inst !== this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), inst]); + } + } + } + } + + queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), this]); + + for (i = queries.length - 1; i >= 0; i--){ + queries[i][0].each(function() { + items.push(this); + }); + } + + return $(items); + + }, + + _removeCurrentsFromItems: function() { + + var list = this.currentItem.find(":data(" + this.widgetName + "-item)"); + + this.items = $.grep(this.items, function (item) { + for (var j=0; j < list.length; j++) { + if(list[j] === item.item[0]) { + return false; + } + } + return true; + }); + + }, + + _refreshItems: function(event) { + + this.items = []; + this.containers = [this]; + + var i, j, cur, inst, targetData, _queries, item, queriesLength, + items = this.items, + queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]], + connectWith = this._connectWith(); + + if(connectWith && this.ready) { //Shouldn't be run the first time through due to massive slow-down + for (i = connectWith.length - 1; i >= 0; i--){ + cur = $(connectWith[i]); + for (j = cur.length - 1; j >= 0; j--){ + inst = $.data(cur[j], this.widgetFullName); + if(inst && inst !== this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]); + this.containers.push(inst); + } + } + } + } + + for (i = queries.length - 1; i >= 0; i--) { + targetData = queries[i][1]; + _queries = queries[i][0]; + + for (j=0, queriesLength = _queries.length; j < queriesLength; j++) { + item = $(_queries[j]); + + item.data(this.widgetName + "-item", targetData); // Data for target checking (mouse manager) + + items.push({ + item: item, + instance: targetData, + width: 0, height: 0, + left: 0, top: 0 + }); + } + } + + }, + + refreshPositions: function(fast) { + + //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change + if(this.offsetParent && this.helper) { + this.offset.parent = this._getParentOffset(); + } + + var i, item, t, p; + + for (i = this.items.length - 1; i >= 0; i--){ + item = this.items[i]; + + //We ignore calculating positions of all connected containers when we're not over them + if(item.instance !== this.currentContainer && this.currentContainer && item.item[0] !== this.currentItem[0]) { + continue; + } + + t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item; + + if (!fast) { + item.width = t.outerWidth(); + item.height = t.outerHeight(); + } + + p = t.offset(); + item.left = p.left; + item.top = p.top; + } + + if(this.options.custom && this.options.custom.refreshContainers) { + this.options.custom.refreshContainers.call(this); + } else { + for (i = this.containers.length - 1; i >= 0; i--){ + p = this.containers[i].element.offset(); + this.containers[i].containerCache.left = p.left; + this.containers[i].containerCache.top = p.top; + this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); + this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); + } + } + + return this; + }, + + _createPlaceholder: function(that) { + that = that || this; + var className, + o = that.options; + + if(!o.placeholder || o.placeholder.constructor === String) { + className = o.placeholder; + o.placeholder = { + element: function() { + + var nodeName = that.currentItem[0].nodeName.toLowerCase(), + element = $( that.document[0].createElement( nodeName ) ) + .addClass(className || that.currentItem[0].className+" ui-sortable-placeholder") + .removeClass("ui-sortable-helper"); + + if ( nodeName === "tr" ) { + // Use a high colspan to force the td to expand the full + // width of the table (browsers are smart enough to + // handle this properly) + element.append( " " ); + } else if ( nodeName === "img" ) { + element.attr( "src", that.currentItem.attr( "src" ) ); + } + + if ( !className ) { + element.css( "visibility", "hidden" ); + } + + return element; + }, + update: function(container, p) { + + // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that + // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified + if(className && !o.forcePlaceholderSize) { + return; + } + + //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item + if(!p.height()) { p.height(that.currentItem.innerHeight() - parseInt(that.currentItem.css("paddingTop")||0, 10) - parseInt(that.currentItem.css("paddingBottom")||0, 10)); } + if(!p.width()) { p.width(that.currentItem.innerWidth() - parseInt(that.currentItem.css("paddingLeft")||0, 10) - parseInt(that.currentItem.css("paddingRight")||0, 10)); } + } + }; + } + + //Create the placeholder + that.placeholder = $(o.placeholder.element.call(that.element, that.currentItem)); + + //Append it after the actual current item + that.currentItem.after(that.placeholder); + + //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) + o.placeholder.update(that, that.placeholder); + + }, + + _contactContainers: function(event) { + var i, j, dist, itemWithLeastDistance, posProperty, sizeProperty, base, cur, nearBottom, floating, + innermostContainer = null, + innermostIndex = null; + + // get innermost container that intersects with item + for (i = this.containers.length - 1; i >= 0; i--) { + + // never consider a container that's located within the item itself + if($.contains(this.currentItem[0], this.containers[i].element[0])) { + continue; + } + + if(this._intersectsWith(this.containers[i].containerCache)) { + + // if we've already found a container and it's more "inner" than this, then continue + if(innermostContainer && $.contains(this.containers[i].element[0], innermostContainer.element[0])) { + continue; + } + + innermostContainer = this.containers[i]; + innermostIndex = i; + + } else { + // container doesn't intersect. trigger "out" event if necessary + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", event, this._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + // if no intersecting containers found, return + if(!innermostContainer) { + return; + } + + // move the item into the container if it's not there already + if(this.containers.length === 1) { + if (!this.containers[innermostIndex].containerCache.over) { + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } + } else { + + //When entering a new container, we will find the item with the least distance and append our item near it + dist = 10000; + itemWithLeastDistance = null; + floating = innermostContainer.floating || isFloating(this.currentItem); + posProperty = floating ? "left" : "top"; + sizeProperty = floating ? "width" : "height"; + base = this.positionAbs[posProperty] + this.offset.click[posProperty]; + for (j = this.items.length - 1; j >= 0; j--) { + if(!$.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) { + continue; + } + if(this.items[j].item[0] === this.currentItem[0]) { + continue; + } + if (floating && !isOverAxis(this.positionAbs.top + this.offset.click.top, this.items[j].top, this.items[j].height)) { + continue; + } + cur = this.items[j].item.offset()[posProperty]; + nearBottom = false; + if(Math.abs(cur - base) > Math.abs(cur + this.items[j][sizeProperty] - base)){ + nearBottom = true; + cur += this.items[j][sizeProperty]; + } + + if(Math.abs(cur - base) < dist) { + dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; + this.direction = nearBottom ? "up": "down"; + } + } + + //Check if dropOnEmpty is enabled + if(!itemWithLeastDistance && !this.options.dropOnEmpty) { + return; + } + + if(this.currentContainer === this.containers[innermostIndex]) { + return; + } + + itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); + this._trigger("change", event, this._uiHash()); + this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); + this.currentContainer = this.containers[innermostIndex]; + + //Update the placeholder + this.options.placeholder.update(this.currentContainer, this.placeholder); + + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } + + + }, + + _createHelper: function(event) { + + var o = this.options, + helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper === "clone" ? this.currentItem.clone() : this.currentItem); + + //Add the helper to the DOM if that didn't happen already + if(!helper.parents("body").length) { + $(o.appendTo !== "parent" ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); + } + + if(helper[0] === this.currentItem[0]) { + this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") }; + } + + if(!helper[0].style.width || o.forceHelperSize) { + helper.width(this.currentItem.width()); + } + if(!helper[0].style.height || o.forceHelperSize) { + helper.height(this.currentItem.height()); + } + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj === "string") { + obj = obj.split(" "); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ("left" in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ("right" in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ("top" in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ("bottom" in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition === "absolute" && this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + // This needs to be actually done for all browsers, since pageX/pageY includes this information + // with an ugly IE fix + if( this.offsetParent[0] === document.body || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() === "html" && $.ui.ie)) { + po = { top: 0, left: 0 }; + } + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition === "relative") { + var p = this.currentItem.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.currentItem.css("marginLeft"),10) || 0), + top: (parseInt(this.currentItem.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var ce, co, over, + o = this.options; + if(o.containment === "parent") { + o.containment = this.helper[0].parentNode; + } + if(o.containment === "document" || o.containment === "window") { + this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment === "document" ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment === "document" ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + } + + if(!(/^(document|window|parent)$/).test(o.containment)) { + ce = $(o.containment)[0]; + co = $(o.containment).offset(); + over = ($(ce).css("overflow") !== "hidden"); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) { + pos = this.position; + } + var mod = d === "absolute" ? 1 : -1, + scroll = this.cssPosition === "absolute" && !(this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, + scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top + // The absolute mouse position + this.offset.relative.top * mod + // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.parent.top * mod - // The offsetParent's offset without borders (offset + border) + ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left + // The absolute mouse position + this.offset.relative.left * mod + // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.parent.left * mod - // The offsetParent's offset without borders (offset + border) + ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var top, left, + o = this.options, + pageX = event.pageX, + pageY = event.pageY, + scroll = this.cssPosition === "absolute" && !(this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition === "relative" && !(this.scrollParent[0] !== document && this.scrollParent[0] !== this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) { + pageX = this.containment[0] + this.offset.click.left; + } + if(event.pageY - this.offset.click.top < this.containment[1]) { + pageY = this.containment[1] + this.offset.click.top; + } + if(event.pageX - this.offset.click.left > this.containment[2]) { + pageX = this.containment[2] + this.offset.click.left; + } + if(event.pageY - this.offset.click.top > this.containment[3]) { + pageY = this.containment[3] + this.offset.click.top; + } + } + + if(o.grid) { + top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? ( (top - this.offset.click.top >= this.containment[1] && top - this.offset.click.top <= this.containment[3]) ? top : ((top - this.offset.click.top >= this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? ( (left - this.offset.click.left >= this.containment[0] && left - this.offset.click.left <= this.containment[2]) ? left : ((left - this.offset.click.left >= this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY - // The absolute mouse position + this.offset.click.top - // Click offset (relative to the element) + this.offset.relative.top - // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.parent.top + // The offsetParent's offset without borders (offset + border) + ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX - // The absolute mouse position + this.offset.click.left - // Click offset (relative to the element) + this.offset.relative.left - // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.parent.left + // The offsetParent's offset without borders (offset + border) + ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _rearrange: function(event, i, a, hardRefresh) { + + a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction === "down" ? i.item[0] : i.item[0].nextSibling)); + + //Various things done here to improve the performance: + // 1. we create a setTimeout, that calls refreshPositions + // 2. on the instance, we have a counter variable, that get's higher after every append + // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same + // 4. this lets only the last addition to the timeout stack through + this.counter = this.counter ? ++this.counter : 1; + var counter = this.counter; + + this._delay(function() { + if(counter === this.counter) { + this.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove + } + }); + + }, + + _clear: function(event, noPropagation) { + + this.reverting = false; + // We delay all events that have to be triggered to after the point where the placeholder has been removed and + // everything else normalized again + var i, + delayedTriggers = []; + + // We first have to update the dom position of the actual currentItem + // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088) + if(!this._noFinalSort && this.currentItem.parent().length) { + this.placeholder.before(this.currentItem); + } + this._noFinalSort = null; + + if(this.helper[0] === this.currentItem[0]) { + for(i in this._storedCSS) { + if(this._storedCSS[i] === "auto" || this._storedCSS[i] === "static") { + this._storedCSS[i] = ""; + } + } + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + } else { + this.currentItem.show(); + } + + if(this.fromOutside && !noPropagation) { + delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); }); + } + if((this.fromOutside || this.domPosition.prev !== this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent !== this.currentItem.parent()[0]) && !noPropagation) { + delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed + } + + // Check if the items Container has Changed and trigger appropriate + // events. + if (this !== this.currentContainer) { + if(!noPropagation) { + delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); }); + delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.currentContainer)); + delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.currentContainer)); + } + } + + + //Post events to containers + for (i = this.containers.length - 1; i >= 0; i--){ + if(!noPropagation) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + } + if(this.containers[i].containerCache.over) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + this.containers[i].containerCache.over = 0; + } + } + + //Do what was originally in plugins + if ( this.storedCursor ) { + this.document.find( "body" ).css( "cursor", this.storedCursor ); + this.storedStylesheet.remove(); + } + if(this._storedOpacity) { + this.helper.css("opacity", this._storedOpacity); + } + if(this._storedZIndex) { + this.helper.css("zIndex", this._storedZIndex === "auto" ? "" : this._storedZIndex); + } + + this.dragging = false; + if(this.cancelHelperRemoval) { + if(!noPropagation) { + this._trigger("beforeStop", event, this._uiHash()); + for (i=0; i < delayedTriggers.length; i++) { + delayedTriggers[i].call(this, event); + } //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return false; + } + + if(!noPropagation) { + this._trigger("beforeStop", event, this._uiHash()); + } + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + + if(this.helper[0] !== this.currentItem[0]) { + this.helper.remove(); + } + this.helper = null; + + if(!noPropagation) { + for (i=0; i < delayedTriggers.length; i++) { + delayedTriggers[i].call(this, event); + } //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return true; + + }, + + _trigger: function() { + if ($.Widget.prototype._trigger.apply(this, arguments) === false) { + this.cancel(); + } + }, + + _uiHash: function(_inst) { + var inst = _inst || this; + return { + helper: inst.helper, + placeholder: inst.placeholder || $([]), + position: inst.position, + originalPosition: inst.originalPosition, + offset: inst.positionAbs, + item: inst.currentItem, + sender: _inst ? _inst.element : null + }; + } + +}); + +})(jQuery); + +(function($, undefined) { + +var dataSpace = "ui-effects-"; + +$.effects = { + effect: {} +}; + +/*! + * jQuery Color Animations v2.1.2 + * https://github.com/jquery/jquery-color + * + * Copyright 2013 jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + * + * Date: Wed Jan 16 08:47:09 2013 -0600 + */ +(function( jQuery, undefined ) { + + var stepHooks = "backgroundColor borderBottomColor borderLeftColor borderRightColor borderTopColor color columnRuleColor outlineColor textDecorationColor textEmphasisColor", + + // plusequals test for += 100 -= 100 + rplusequals = /^([\-+])=\s*(\d+\.?\d*)/, + // a set of RE's that can match strings and generate color tuples. + stringParsers = [{ + re: /rgba?\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/, + parse: function( execResult ) { + return [ + execResult[ 1 ], + execResult[ 2 ], + execResult[ 3 ], + execResult[ 4 ] + ]; + } + }, { + re: /rgba?\(\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/, + parse: function( execResult ) { + return [ + execResult[ 1 ] * 2.55, + execResult[ 2 ] * 2.55, + execResult[ 3 ] * 2.55, + execResult[ 4 ] + ]; + } + }, { + // this regex ignores A-F because it's compared against an already lowercased string + re: /#([a-f0-9]{2})([a-f0-9]{2})([a-f0-9]{2})/, + parse: function( execResult ) { + return [ + parseInt( execResult[ 1 ], 16 ), + parseInt( execResult[ 2 ], 16 ), + parseInt( execResult[ 3 ], 16 ) + ]; + } + }, { + // this regex ignores A-F because it's compared against an already lowercased string + re: /#([a-f0-9])([a-f0-9])([a-f0-9])/, + parse: function( execResult ) { + return [ + parseInt( execResult[ 1 ] + execResult[ 1 ], 16 ), + parseInt( execResult[ 2 ] + execResult[ 2 ], 16 ), + parseInt( execResult[ 3 ] + execResult[ 3 ], 16 ) + ]; + } + }, { + re: /hsla?\(\s*(\d+(?:\.\d+)?)\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/, + space: "hsla", + parse: function( execResult ) { + return [ + execResult[ 1 ], + execResult[ 2 ] / 100, + execResult[ 3 ] / 100, + execResult[ 4 ] + ]; + } + }], + + // jQuery.Color( ) + color = jQuery.Color = function( color, green, blue, alpha ) { + return new jQuery.Color.fn.parse( color, green, blue, alpha ); + }, + spaces = { + rgba: { + props: { + red: { + idx: 0, + type: "byte" + }, + green: { + idx: 1, + type: "byte" + }, + blue: { + idx: 2, + type: "byte" + } + } + }, + + hsla: { + props: { + hue: { + idx: 0, + type: "degrees" + }, + saturation: { + idx: 1, + type: "percent" + }, + lightness: { + idx: 2, + type: "percent" + } + } + } + }, + propTypes = { + "byte": { + floor: true, + max: 255 + }, + "percent": { + max: 1 + }, + "degrees": { + mod: 360, + floor: true + } + }, + support = color.support = {}, + + // element for support tests + supportElem = jQuery( "

    " )[ 0 ], + + // colors = jQuery.Color.names + colors, + + // local aliases of functions called often + each = jQuery.each; + +// determine rgba support immediately +supportElem.style.cssText = "background-color:rgba(1,1,1,.5)"; +support.rgba = supportElem.style.backgroundColor.indexOf( "rgba" ) > -1; + +// define cache name and alpha properties +// for rgba and hsla spaces +each( spaces, function( spaceName, space ) { + space.cache = "_" + spaceName; + space.props.alpha = { + idx: 3, + type: "percent", + def: 1 + }; +}); + +function clamp( value, prop, allowEmpty ) { + var type = propTypes[ prop.type ] || {}; + + if ( value == null ) { + return (allowEmpty || !prop.def) ? null : prop.def; + } + + // ~~ is an short way of doing floor for positive numbers + value = type.floor ? ~~value : parseFloat( value ); + + // IE will pass in empty strings as value for alpha, + // which will hit this case + if ( isNaN( value ) ) { + return prop.def; + } + + if ( type.mod ) { + // we add mod before modding to make sure that negatives values + // get converted properly: -10 -> 350 + return (value + type.mod) % type.mod; + } + + // for now all property types without mod have min and max + return 0 > value ? 0 : type.max < value ? type.max : value; +} + +function stringParse( string ) { + var inst = color(), + rgba = inst._rgba = []; + + string = string.toLowerCase(); + + each( stringParsers, function( i, parser ) { + var parsed, + match = parser.re.exec( string ), + values = match && parser.parse( match ), + spaceName = parser.space || "rgba"; + + if ( values ) { + parsed = inst[ spaceName ]( values ); + + // if this was an rgba parse the assignment might happen twice + // oh well.... + inst[ spaces[ spaceName ].cache ] = parsed[ spaces[ spaceName ].cache ]; + rgba = inst._rgba = parsed._rgba; + + // exit each( stringParsers ) here because we matched + return false; + } + }); + + // Found a stringParser that handled it + if ( rgba.length ) { + + // if this came from a parsed string, force "transparent" when alpha is 0 + // chrome, (and maybe others) return "transparent" as rgba(0,0,0,0) + if ( rgba.join() === "0,0,0,0" ) { + jQuery.extend( rgba, colors.transparent ); + } + return inst; + } + + // named colors + return colors[ string ]; +} + +color.fn = jQuery.extend( color.prototype, { + parse: function( red, green, blue, alpha ) { + if ( red === undefined ) { + this._rgba = [ null, null, null, null ]; + return this; + } + if ( red.jquery || red.nodeType ) { + red = jQuery( red ).css( green ); + green = undefined; + } + + var inst = this, + type = jQuery.type( red ), + rgba = this._rgba = []; + + // more than 1 argument specified - assume ( red, green, blue, alpha ) + if ( green !== undefined ) { + red = [ red, green, blue, alpha ]; + type = "array"; + } + + if ( type === "string" ) { + return this.parse( stringParse( red ) || colors._default ); + } + + if ( type === "array" ) { + each( spaces.rgba.props, function( key, prop ) { + rgba[ prop.idx ] = clamp( red[ prop.idx ], prop ); + }); + return this; + } + + if ( type === "object" ) { + if ( red instanceof color ) { + each( spaces, function( spaceName, space ) { + if ( red[ space.cache ] ) { + inst[ space.cache ] = red[ space.cache ].slice(); + } + }); + } else { + each( spaces, function( spaceName, space ) { + var cache = space.cache; + each( space.props, function( key, prop ) { + + // if the cache doesn't exist, and we know how to convert + if ( !inst[ cache ] && space.to ) { + + // if the value was null, we don't need to copy it + // if the key was alpha, we don't need to copy it either + if ( key === "alpha" || red[ key ] == null ) { + return; + } + inst[ cache ] = space.to( inst._rgba ); + } + + // this is the only case where we allow nulls for ALL properties. + // call clamp with alwaysAllowEmpty + inst[ cache ][ prop.idx ] = clamp( red[ key ], prop, true ); + }); + + // everything defined but alpha? + if ( inst[ cache ] && jQuery.inArray( null, inst[ cache ].slice( 0, 3 ) ) < 0 ) { + // use the default of 1 + inst[ cache ][ 3 ] = 1; + if ( space.from ) { + inst._rgba = space.from( inst[ cache ] ); + } + } + }); + } + return this; + } + }, + is: function( compare ) { + var is = color( compare ), + same = true, + inst = this; + + each( spaces, function( _, space ) { + var localCache, + isCache = is[ space.cache ]; + if (isCache) { + localCache = inst[ space.cache ] || space.to && space.to( inst._rgba ) || []; + each( space.props, function( _, prop ) { + if ( isCache[ prop.idx ] != null ) { + same = ( isCache[ prop.idx ] === localCache[ prop.idx ] ); + return same; + } + }); + } + return same; + }); + return same; + }, + _space: function() { + var used = [], + inst = this; + each( spaces, function( spaceName, space ) { + if ( inst[ space.cache ] ) { + used.push( spaceName ); + } + }); + return used.pop(); + }, + transition: function( other, distance ) { + var end = color( other ), + spaceName = end._space(), + space = spaces[ spaceName ], + startColor = this.alpha() === 0 ? color( "transparent" ) : this, + start = startColor[ space.cache ] || space.to( startColor._rgba ), + result = start.slice(); + + end = end[ space.cache ]; + each( space.props, function( key, prop ) { + var index = prop.idx, + startValue = start[ index ], + endValue = end[ index ], + type = propTypes[ prop.type ] || {}; + + // if null, don't override start value + if ( endValue === null ) { + return; + } + // if null - use end + if ( startValue === null ) { + result[ index ] = endValue; + } else { + if ( type.mod ) { + if ( endValue - startValue > type.mod / 2 ) { + startValue += type.mod; + } else if ( startValue - endValue > type.mod / 2 ) { + startValue -= type.mod; + } + } + result[ index ] = clamp( ( endValue - startValue ) * distance + startValue, prop ); + } + }); + return this[ spaceName ]( result ); + }, + blend: function( opaque ) { + // if we are already opaque - return ourself + if ( this._rgba[ 3 ] === 1 ) { + return this; + } + + var rgb = this._rgba.slice(), + a = rgb.pop(), + blend = color( opaque )._rgba; + + return color( jQuery.map( rgb, function( v, i ) { + return ( 1 - a ) * blend[ i ] + a * v; + })); + }, + toRgbaString: function() { + var prefix = "rgba(", + rgba = jQuery.map( this._rgba, function( v, i ) { + return v == null ? ( i > 2 ? 1 : 0 ) : v; + }); + + if ( rgba[ 3 ] === 1 ) { + rgba.pop(); + prefix = "rgb("; + } + + return prefix + rgba.join() + ")"; + }, + toHslaString: function() { + var prefix = "hsla(", + hsla = jQuery.map( this.hsla(), function( v, i ) { + if ( v == null ) { + v = i > 2 ? 1 : 0; + } + + // catch 1 and 2 + if ( i && i < 3 ) { + v = Math.round( v * 100 ) + "%"; + } + return v; + }); + + if ( hsla[ 3 ] === 1 ) { + hsla.pop(); + prefix = "hsl("; + } + return prefix + hsla.join() + ")"; + }, + toHexString: function( includeAlpha ) { + var rgba = this._rgba.slice(), + alpha = rgba.pop(); + + if ( includeAlpha ) { + rgba.push( ~~( alpha * 255 ) ); + } + + return "#" + jQuery.map( rgba, function( v ) { + + // default to 0 when nulls exist + v = ( v || 0 ).toString( 16 ); + return v.length === 1 ? "0" + v : v; + }).join(""); + }, + toString: function() { + return this._rgba[ 3 ] === 0 ? "transparent" : this.toRgbaString(); + } +}); +color.fn.parse.prototype = color.fn; + +// hsla conversions adapted from: +// https://code.google.com/p/maashaack/source/browse/packages/graphics/trunk/src/graphics/colors/HUE2RGB.as?r=5021 + +function hue2rgb( p, q, h ) { + h = ( h + 1 ) % 1; + if ( h * 6 < 1 ) { + return p + (q - p) * h * 6; + } + if ( h * 2 < 1) { + return q; + } + if ( h * 3 < 2 ) { + return p + (q - p) * ((2/3) - h) * 6; + } + return p; +} + +spaces.hsla.to = function ( rgba ) { + if ( rgba[ 0 ] == null || rgba[ 1 ] == null || rgba[ 2 ] == null ) { + return [ null, null, null, rgba[ 3 ] ]; + } + var r = rgba[ 0 ] / 255, + g = rgba[ 1 ] / 255, + b = rgba[ 2 ] / 255, + a = rgba[ 3 ], + max = Math.max( r, g, b ), + min = Math.min( r, g, b ), + diff = max - min, + add = max + min, + l = add * 0.5, + h, s; + + if ( min === max ) { + h = 0; + } else if ( r === max ) { + h = ( 60 * ( g - b ) / diff ) + 360; + } else if ( g === max ) { + h = ( 60 * ( b - r ) / diff ) + 120; + } else { + h = ( 60 * ( r - g ) / diff ) + 240; + } + + // chroma (diff) == 0 means greyscale which, by definition, saturation = 0% + // otherwise, saturation is based on the ratio of chroma (diff) to lightness (add) + if ( diff === 0 ) { + s = 0; + } else if ( l <= 0.5 ) { + s = diff / add; + } else { + s = diff / ( 2 - add ); + } + return [ Math.round(h) % 360, s, l, a == null ? 1 : a ]; +}; + +spaces.hsla.from = function ( hsla ) { + if ( hsla[ 0 ] == null || hsla[ 1 ] == null || hsla[ 2 ] == null ) { + return [ null, null, null, hsla[ 3 ] ]; + } + var h = hsla[ 0 ] / 360, + s = hsla[ 1 ], + l = hsla[ 2 ], + a = hsla[ 3 ], + q = l <= 0.5 ? l * ( 1 + s ) : l + s - l * s, + p = 2 * l - q; + + return [ + Math.round( hue2rgb( p, q, h + ( 1 / 3 ) ) * 255 ), + Math.round( hue2rgb( p, q, h ) * 255 ), + Math.round( hue2rgb( p, q, h - ( 1 / 3 ) ) * 255 ), + a + ]; +}; + + +each( spaces, function( spaceName, space ) { + var props = space.props, + cache = space.cache, + to = space.to, + from = space.from; + + // makes rgba() and hsla() + color.fn[ spaceName ] = function( value ) { + + // generate a cache for this space if it doesn't exist + if ( to && !this[ cache ] ) { + this[ cache ] = to( this._rgba ); + } + if ( value === undefined ) { + return this[ cache ].slice(); + } + + var ret, + type = jQuery.type( value ), + arr = ( type === "array" || type === "object" ) ? value : arguments, + local = this[ cache ].slice(); + + each( props, function( key, prop ) { + var val = arr[ type === "object" ? key : prop.idx ]; + if ( val == null ) { + val = local[ prop.idx ]; + } + local[ prop.idx ] = clamp( val, prop ); + }); + + if ( from ) { + ret = color( from( local ) ); + ret[ cache ] = local; + return ret; + } else { + return color( local ); + } + }; + + // makes red() green() blue() alpha() hue() saturation() lightness() + each( props, function( key, prop ) { + // alpha is included in more than one space + if ( color.fn[ key ] ) { + return; + } + color.fn[ key ] = function( value ) { + var vtype = jQuery.type( value ), + fn = ( key === "alpha" ? ( this._hsla ? "hsla" : "rgba" ) : spaceName ), + local = this[ fn ](), + cur = local[ prop.idx ], + match; + + if ( vtype === "undefined" ) { + return cur; + } + + if ( vtype === "function" ) { + value = value.call( this, cur ); + vtype = jQuery.type( value ); + } + if ( value == null && prop.empty ) { + return this; + } + if ( vtype === "string" ) { + match = rplusequals.exec( value ); + if ( match ) { + value = cur + parseFloat( match[ 2 ] ) * ( match[ 1 ] === "+" ? 1 : -1 ); + } + } + local[ prop.idx ] = value; + return this[ fn ]( local ); + }; + }); +}); + +// add cssHook and .fx.step function for each named hook. +// accept a space separated string of properties +color.hook = function( hook ) { + var hooks = hook.split( " " ); + each( hooks, function( i, hook ) { + jQuery.cssHooks[ hook ] = { + set: function( elem, value ) { + var parsed, curElem, + backgroundColor = ""; + + if ( value !== "transparent" && ( jQuery.type( value ) !== "string" || ( parsed = stringParse( value ) ) ) ) { + value = color( parsed || value ); + if ( !support.rgba && value._rgba[ 3 ] !== 1 ) { + curElem = hook === "backgroundColor" ? elem.parentNode : elem; + while ( + (backgroundColor === "" || backgroundColor === "transparent") && + curElem && curElem.style + ) { + try { + backgroundColor = jQuery.css( curElem, "backgroundColor" ); + curElem = curElem.parentNode; + } catch ( e ) { + } + } + + value = value.blend( backgroundColor && backgroundColor !== "transparent" ? + backgroundColor : + "_default" ); + } + + value = value.toRgbaString(); + } + try { + elem.style[ hook ] = value; + } catch( e ) { + // wrapped to prevent IE from throwing errors on "invalid" values like 'auto' or 'inherit' + } + } + }; + jQuery.fx.step[ hook ] = function( fx ) { + if ( !fx.colorInit ) { + fx.start = color( fx.elem, hook ); + fx.end = color( fx.end ); + fx.colorInit = true; + } + jQuery.cssHooks[ hook ].set( fx.elem, fx.start.transition( fx.end, fx.pos ) ); + }; + }); + +}; + +color.hook( stepHooks ); + +jQuery.cssHooks.borderColor = { + expand: function( value ) { + var expanded = {}; + + each( [ "Top", "Right", "Bottom", "Left" ], function( i, part ) { + expanded[ "border" + part + "Color" ] = value; + }); + return expanded; + } +}; + +// Basic color names only. +// Usage of any of the other color names requires adding yourself or including +// jquery.color.svg-names.js. +colors = jQuery.Color.names = { + // 4.1. Basic color keywords + aqua: "#00ffff", + black: "#000000", + blue: "#0000ff", + fuchsia: "#ff00ff", + gray: "#808080", + green: "#008000", + lime: "#00ff00", + maroon: "#800000", + navy: "#000080", + olive: "#808000", + purple: "#800080", + red: "#ff0000", + silver: "#c0c0c0", + teal: "#008080", + white: "#ffffff", + yellow: "#ffff00", + + // 4.2.3. "transparent" color keyword + transparent: [ null, null, null, 0 ], + + _default: "#ffffff" +}; + +})( jQuery ); + + +/******************************************************************************/ +/****************************** CLASS ANIMATIONS ******************************/ +/******************************************************************************/ +(function() { + +var classAnimationActions = [ "add", "remove", "toggle" ], + shorthandStyles = { + border: 1, + borderBottom: 1, + borderColor: 1, + borderLeft: 1, + borderRight: 1, + borderTop: 1, + borderWidth: 1, + margin: 1, + padding: 1 + }; + +$.each([ "borderLeftStyle", "borderRightStyle", "borderBottomStyle", "borderTopStyle" ], function( _, prop ) { + $.fx.step[ prop ] = function( fx ) { + if ( fx.end !== "none" && !fx.setAttr || fx.pos === 1 && !fx.setAttr ) { + jQuery.style( fx.elem, prop, fx.end ); + fx.setAttr = true; + } + }; +}); + +function getElementStyles( elem ) { + var key, len, + style = elem.ownerDocument.defaultView ? + elem.ownerDocument.defaultView.getComputedStyle( elem, null ) : + elem.currentStyle, + styles = {}; + + if ( style && style.length && style[ 0 ] && style[ style[ 0 ] ] ) { + len = style.length; + while ( len-- ) { + key = style[ len ]; + if ( typeof style[ key ] === "string" ) { + styles[ $.camelCase( key ) ] = style[ key ]; + } + } + // support: Opera, IE <9 + } else { + for ( key in style ) { + if ( typeof style[ key ] === "string" ) { + styles[ key ] = style[ key ]; + } + } + } + + return styles; +} + + +function styleDifference( oldStyle, newStyle ) { + var diff = {}, + name, value; + + for ( name in newStyle ) { + value = newStyle[ name ]; + if ( oldStyle[ name ] !== value ) { + if ( !shorthandStyles[ name ] ) { + if ( $.fx.step[ name ] || !isNaN( parseFloat( value ) ) ) { + diff[ name ] = value; + } + } + } + } + + return diff; +} + +// support: jQuery <1.8 +if ( !$.fn.addBack ) { + $.fn.addBack = function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter( selector ) + ); + }; +} + +$.effects.animateClass = function( value, duration, easing, callback ) { + var o = $.speed( duration, easing, callback ); + + return this.queue( function() { + var animated = $( this ), + baseClass = animated.attr( "class" ) || "", + applyClassChange, + allAnimations = o.children ? animated.find( "*" ).addBack() : animated; + + // map the animated objects to store the original styles. + allAnimations = allAnimations.map(function() { + var el = $( this ); + return { + el: el, + start: getElementStyles( this ) + }; + }); + + // apply class change + applyClassChange = function() { + $.each( classAnimationActions, function(i, action) { + if ( value[ action ] ) { + animated[ action + "Class" ]( value[ action ] ); + } + }); + }; + applyClassChange(); + + // map all animated objects again - calculate new styles and diff + allAnimations = allAnimations.map(function() { + this.end = getElementStyles( this.el[ 0 ] ); + this.diff = styleDifference( this.start, this.end ); + return this; + }); + + // apply original class + animated.attr( "class", baseClass ); + + // map all animated objects again - this time collecting a promise + allAnimations = allAnimations.map(function() { + var styleInfo = this, + dfd = $.Deferred(), + opts = $.extend({}, o, { + queue: false, + complete: function() { + dfd.resolve( styleInfo ); + } + }); + + this.el.animate( this.diff, opts ); + return dfd.promise(); + }); + + // once all animations have completed: + $.when.apply( $, allAnimations.get() ).done(function() { + + // set the final class + applyClassChange(); + + // for each animated element, + // clear all css properties that were animated + $.each( arguments, function() { + var el = this.el; + $.each( this.diff, function(key) { + el.css( key, "" ); + }); + }); + + // this is guarnteed to be there if you use jQuery.speed() + // it also handles dequeuing the next anim... + o.complete.call( animated[ 0 ] ); + }); + }); +}; + +$.fn.extend({ + addClass: (function( orig ) { + return function( classNames, speed, easing, callback ) { + return speed ? + $.effects.animateClass.call( this, + { add: classNames }, speed, easing, callback ) : + orig.apply( this, arguments ); + }; + })( $.fn.addClass ), + + removeClass: (function( orig ) { + return function( classNames, speed, easing, callback ) { + return arguments.length > 1 ? + $.effects.animateClass.call( this, + { remove: classNames }, speed, easing, callback ) : + orig.apply( this, arguments ); + }; + })( $.fn.removeClass ), + + toggleClass: (function( orig ) { + return function( classNames, force, speed, easing, callback ) { + if ( typeof force === "boolean" || force === undefined ) { + if ( !speed ) { + // without speed parameter + return orig.apply( this, arguments ); + } else { + return $.effects.animateClass.call( this, + (force ? { add: classNames } : { remove: classNames }), + speed, easing, callback ); + } + } else { + // without force parameter + return $.effects.animateClass.call( this, + { toggle: classNames }, force, speed, easing ); + } + }; + })( $.fn.toggleClass ), + + switchClass: function( remove, add, speed, easing, callback) { + return $.effects.animateClass.call( this, { + add: add, + remove: remove + }, speed, easing, callback ); + } +}); + +})(); + +/******************************************************************************/ +/*********************************** EFFECTS **********************************/ +/******************************************************************************/ + +(function() { + +$.extend( $.effects, { + version: "1.10.2", + + // Saves a set of properties in a data storage + save: function( element, set ) { + for( var i=0; i < set.length; i++ ) { + if ( set[ i ] !== null ) { + element.data( dataSpace + set[ i ], element[ 0 ].style[ set[ i ] ] ); + } + } + }, + + // Restores a set of previously saved properties from a data storage + restore: function( element, set ) { + var val, i; + for( i=0; i < set.length; i++ ) { + if ( set[ i ] !== null ) { + val = element.data( dataSpace + set[ i ] ); + // support: jQuery 1.6.2 + // http://bugs.jquery.com/ticket/9917 + // jQuery 1.6.2 incorrectly returns undefined for any falsy value. + // We can't differentiate between "" and 0 here, so we just assume + // empty string since it's likely to be a more common value... + if ( val === undefined ) { + val = ""; + } + element.css( set[ i ], val ); + } + } + }, + + setMode: function( el, mode ) { + if (mode === "toggle") { + mode = el.is( ":hidden" ) ? "show" : "hide"; + } + return mode; + }, + + // Translates a [top,left] array into a baseline value + // this should be a little more flexible in the future to handle a string & hash + getBaseline: function( origin, original ) { + var y, x; + switch ( origin[ 0 ] ) { + case "top": y = 0; break; + case "middle": y = 0.5; break; + case "bottom": y = 1; break; + default: y = origin[ 0 ] / original.height; + } + switch ( origin[ 1 ] ) { + case "left": x = 0; break; + case "center": x = 0.5; break; + case "right": x = 1; break; + default: x = origin[ 1 ] / original.width; + } + return { + x: x, + y: y + }; + }, + + // Wraps the element around a wrapper that copies position properties + createWrapper: function( element ) { + + // if the element is already wrapped, return it + if ( element.parent().is( ".ui-effects-wrapper" )) { + return element.parent(); + } + + // wrap the element + var props = { + width: element.outerWidth(true), + height: element.outerHeight(true), + "float": element.css( "float" ) + }, + wrapper = $( "

    " ) + .addClass( "ui-effects-wrapper" ) + .css({ + fontSize: "100%", + background: "transparent", + border: "none", + margin: 0, + padding: 0 + }), + // Store the size in case width/height are defined in % - Fixes #5245 + size = { + width: element.width(), + height: element.height() + }, + active = document.activeElement; + + // support: Firefox + // Firefox incorrectly exposes anonymous content + // https://bugzilla.mozilla.org/show_bug.cgi?id=561664 + try { + active.id; + } catch( e ) { + active = document.body; + } + + element.wrap( wrapper ); + + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).focus(); + } + + wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually lose the reference to the wrapped element + + // transfer positioning properties to the wrapper + if ( element.css( "position" ) === "static" ) { + wrapper.css({ position: "relative" }); + element.css({ position: "relative" }); + } else { + $.extend( props, { + position: element.css( "position" ), + zIndex: element.css( "z-index" ) + }); + $.each([ "top", "left", "bottom", "right" ], function(i, pos) { + props[ pos ] = element.css( pos ); + if ( isNaN( parseInt( props[ pos ], 10 ) ) ) { + props[ pos ] = "auto"; + } + }); + element.css({ + position: "relative", + top: 0, + left: 0, + right: "auto", + bottom: "auto" + }); + } + element.css(size); + + return wrapper.css( props ).show(); + }, + + removeWrapper: function( element ) { + var active = document.activeElement; + + if ( element.parent().is( ".ui-effects-wrapper" ) ) { + element.parent().replaceWith( element ); + + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).focus(); + } + } + + + return element; + }, + + setTransition: function( element, list, factor, value ) { + value = value || {}; + $.each( list, function( i, x ) { + var unit = element.cssUnit( x ); + if ( unit[ 0 ] > 0 ) { + value[ x ] = unit[ 0 ] * factor + unit[ 1 ]; + } + }); + return value; + } +}); + +// return an effect options object for the given parameters: +function _normalizeArguments( effect, options, speed, callback ) { + + // allow passing all options as the first parameter + if ( $.isPlainObject( effect ) ) { + options = effect; + effect = effect.effect; + } + + // convert to an object + effect = { effect: effect }; + + // catch (effect, null, ...) + if ( options == null ) { + options = {}; + } + + // catch (effect, callback) + if ( $.isFunction( options ) ) { + callback = options; + speed = null; + options = {}; + } + + // catch (effect, speed, ?) + if ( typeof options === "number" || $.fx.speeds[ options ] ) { + callback = speed; + speed = options; + options = {}; + } + + // catch (effect, options, callback) + if ( $.isFunction( speed ) ) { + callback = speed; + speed = null; + } + + // add options to effect + if ( options ) { + $.extend( effect, options ); + } + + speed = speed || options.duration; + effect.duration = $.fx.off ? 0 : + typeof speed === "number" ? speed : + speed in $.fx.speeds ? $.fx.speeds[ speed ] : + $.fx.speeds._default; + + effect.complete = callback || options.complete; + + return effect; +} + +function standardAnimationOption( option ) { + // Valid standard speeds (nothing, number, named speed) + if ( !option || typeof option === "number" || $.fx.speeds[ option ] ) { + return true; + } + + // Invalid strings - treat as "normal" speed + if ( typeof option === "string" && !$.effects.effect[ option ] ) { + return true; + } + + // Complete callback + if ( $.isFunction( option ) ) { + return true; + } + + // Options hash (but not naming an effect) + if ( typeof option === "object" && !option.effect ) { + return true; + } + + // Didn't match any standard API + return false; +} + +$.fn.extend({ + effect: function( /* effect, options, speed, callback */ ) { + var args = _normalizeArguments.apply( this, arguments ), + mode = args.mode, + queue = args.queue, + effectMethod = $.effects.effect[ args.effect ]; + + if ( $.fx.off || !effectMethod ) { + // delegate to the original method (e.g., .show()) if possible + if ( mode ) { + return this[ mode ]( args.duration, args.complete ); + } else { + return this.each( function() { + if ( args.complete ) { + args.complete.call( this ); + } + }); + } + } + + function run( next ) { + var elem = $( this ), + complete = args.complete, + mode = args.mode; + + function done() { + if ( $.isFunction( complete ) ) { + complete.call( elem[0] ); + } + if ( $.isFunction( next ) ) { + next(); + } + } + + // If the element already has the correct final state, delegate to + // the core methods so the internal tracking of "olddisplay" works. + if ( elem.is( ":hidden" ) ? mode === "hide" : mode === "show" ) { + elem[ mode ](); + done(); + } else { + effectMethod.call( elem[0], args, done ); + } + } + + return queue === false ? this.each( run ) : this.queue( queue || "fx", run ); + }, + + show: (function( orig ) { + return function( option ) { + if ( standardAnimationOption( option ) ) { + return orig.apply( this, arguments ); + } else { + var args = _normalizeArguments.apply( this, arguments ); + args.mode = "show"; + return this.effect.call( this, args ); + } + }; + })( $.fn.show ), + + hide: (function( orig ) { + return function( option ) { + if ( standardAnimationOption( option ) ) { + return orig.apply( this, arguments ); + } else { + var args = _normalizeArguments.apply( this, arguments ); + args.mode = "hide"; + return this.effect.call( this, args ); + } + }; + })( $.fn.hide ), + + toggle: (function( orig ) { + return function( option ) { + if ( standardAnimationOption( option ) || typeof option === "boolean" ) { + return orig.apply( this, arguments ); + } else { + var args = _normalizeArguments.apply( this, arguments ); + args.mode = "toggle"; + return this.effect.call( this, args ); + } + }; + })( $.fn.toggle ), + + // helper functions + cssUnit: function(key) { + var style = this.css( key ), + val = []; + + $.each( [ "em", "px", "%", "pt" ], function( i, unit ) { + if ( style.indexOf( unit ) > 0 ) { + val = [ parseFloat( style ), unit ]; + } + }); + return val; + } +}); + +})(); + +/******************************************************************************/ +/*********************************** EASING ***********************************/ +/******************************************************************************/ + +(function() { + +// based on easing equations from Robert Penner (http://www.robertpenner.com/easing) + +var baseEasings = {}; + +$.each( [ "Quad", "Cubic", "Quart", "Quint", "Expo" ], function( i, name ) { + baseEasings[ name ] = function( p ) { + return Math.pow( p, i + 2 ); + }; +}); + +$.extend( baseEasings, { + Sine: function ( p ) { + return 1 - Math.cos( p * Math.PI / 2 ); + }, + Circ: function ( p ) { + return 1 - Math.sqrt( 1 - p * p ); + }, + Elastic: function( p ) { + return p === 0 || p === 1 ? p : + -Math.pow( 2, 8 * (p - 1) ) * Math.sin( ( (p - 1) * 80 - 7.5 ) * Math.PI / 15 ); + }, + Back: function( p ) { + return p * p * ( 3 * p - 2 ); + }, + Bounce: function ( p ) { + var pow2, + bounce = 4; + + while ( p < ( ( pow2 = Math.pow( 2, --bounce ) ) - 1 ) / 11 ) {} + return 1 / Math.pow( 4, 3 - bounce ) - 7.5625 * Math.pow( ( pow2 * 3 - 2 ) / 22 - p, 2 ); + } +}); + +$.each( baseEasings, function( name, easeIn ) { + $.easing[ "easeIn" + name ] = easeIn; + $.easing[ "easeOut" + name ] = function( p ) { + return 1 - easeIn( 1 - p ); + }; + $.easing[ "easeInOut" + name ] = function( p ) { + return p < 0.5 ? + easeIn( p * 2 ) / 2 : + 1 - easeIn( p * -2 + 2 ) / 2; + }; +}); + +})(); + +})(jQuery); + +(function( $, undefined ) { + +var uid = 0, + hideProps = {}, + showProps = {}; + +hideProps.height = hideProps.paddingTop = hideProps.paddingBottom = + hideProps.borderTopWidth = hideProps.borderBottomWidth = "hide"; +showProps.height = showProps.paddingTop = showProps.paddingBottom = + showProps.borderTopWidth = showProps.borderBottomWidth = "show"; + +$.widget( "ui.accordion", { + version: "1.10.2", + options: { + active: 0, + animate: {}, + collapsible: false, + event: "click", + header: "> li > :first-child,> :not(li):even", + heightStyle: "auto", + icons: { + activeHeader: "ui-icon-triangle-1-s", + header: "ui-icon-triangle-1-e" + }, + + // callbacks + activate: null, + beforeActivate: null + }, + + _create: function() { + var options = this.options; + this.prevShow = this.prevHide = $(); + this.element.addClass( "ui-accordion ui-widget ui-helper-reset" ) + // ARIA + .attr( "role", "tablist" ); + + // don't allow collapsible: false and active: false / null + if ( !options.collapsible && (options.active === false || options.active == null) ) { + options.active = 0; + } + + this._processPanels(); + // handle negative values + if ( options.active < 0 ) { + options.active += this.headers.length; + } + this._refresh(); + }, + + _getCreateEventData: function() { + return { + header: this.active, + panel: !this.active.length ? $() : this.active.next(), + content: !this.active.length ? $() : this.active.next() + }; + }, + + _createIcons: function() { + var icons = this.options.icons; + if ( icons ) { + $( "" ) + .addClass( "ui-accordion-header-icon ui-icon " + icons.header ) + .prependTo( this.headers ); + this.active.children( ".ui-accordion-header-icon" ) + .removeClass( icons.header ) + .addClass( icons.activeHeader ); + this.headers.addClass( "ui-accordion-icons" ); + } + }, + + _destroyIcons: function() { + this.headers + .removeClass( "ui-accordion-icons" ) + .children( ".ui-accordion-header-icon" ) + .remove(); + }, + + _destroy: function() { + var contents; + + // clean up main element + this.element + .removeClass( "ui-accordion ui-widget ui-helper-reset" ) + .removeAttr( "role" ); + + // clean up headers + this.headers + .removeClass( "ui-accordion-header ui-accordion-header-active ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" ) + .removeAttr( "role" ) + .removeAttr( "aria-selected" ) + .removeAttr( "aria-controls" ) + .removeAttr( "tabIndex" ) + .each(function() { + if ( /^ui-accordion/.test( this.id ) ) { + this.removeAttribute( "id" ); + } + }); + this._destroyIcons(); + + // clean up content panels + contents = this.headers.next() + .css( "display", "" ) + .removeAttr( "role" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "aria-hidden" ) + .removeAttr( "aria-labelledby" ) + .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-state-disabled" ) + .each(function() { + if ( /^ui-accordion/.test( this.id ) ) { + this.removeAttribute( "id" ); + } + }); + if ( this.options.heightStyle !== "content" ) { + contents.css( "height", "" ); + } + }, + + _setOption: function( key, value ) { + if ( key === "active" ) { + // _activate() will handle invalid values and update this.options + this._activate( value ); + return; + } + + if ( key === "event" ) { + if ( this.options.event ) { + this._off( this.headers, this.options.event ); + } + this._setupEvents( value ); + } + + this._super( key, value ); + + // setting collapsible: false while collapsed; open first panel + if ( key === "collapsible" && !value && this.options.active === false ) { + this._activate( 0 ); + } + + if ( key === "icons" ) { + this._destroyIcons(); + if ( value ) { + this._createIcons(); + } + } + + // #5332 - opacity doesn't cascade to positioned elements in IE + // so we need to add the disabled class to the headers and panels + if ( key === "disabled" ) { + this.headers.add( this.headers.next() ) + .toggleClass( "ui-state-disabled", !!value ); + } + }, + + _keydown: function( event ) { + /*jshint maxcomplexity:15*/ + if ( event.altKey || event.ctrlKey ) { + return; + } + + var keyCode = $.ui.keyCode, + length = this.headers.length, + currentIndex = this.headers.index( event.target ), + toFocus = false; + + switch ( event.keyCode ) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[ ( currentIndex + 1 ) % length ]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[ ( currentIndex - 1 + length ) % length ]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + this._eventHandler( event ); + break; + case keyCode.HOME: + toFocus = this.headers[ 0 ]; + break; + case keyCode.END: + toFocus = this.headers[ length - 1 ]; + break; + } + + if ( toFocus ) { + $( event.target ).attr( "tabIndex", -1 ); + $( toFocus ).attr( "tabIndex", 0 ); + toFocus.focus(); + event.preventDefault(); + } + }, + + _panelKeyDown : function( event ) { + if ( event.keyCode === $.ui.keyCode.UP && event.ctrlKey ) { + $( event.currentTarget ).prev().focus(); + } + }, + + refresh: function() { + var options = this.options; + this._processPanels(); + + // was collapsed or no panel + if ( ( options.active === false && options.collapsible === true ) || !this.headers.length ) { + options.active = false; + this.active = $(); + // active false only when collapsible is true + } if ( options.active === false ) { + this._activate( 0 ); + // was active, but active panel is gone + } else if ( this.active.length && !$.contains( this.element[ 0 ], this.active[ 0 ] ) ) { + // all remaining panel are disabled + if ( this.headers.length === this.headers.find(".ui-state-disabled").length ) { + options.active = false; + this.active = $(); + // activate previous panel + } else { + this._activate( Math.max( 0, options.active - 1 ) ); + } + // was active, active panel still exists + } else { + // make sure active index is correct + options.active = this.headers.index( this.active ); + } + + this._destroyIcons(); + + this._refresh(); + }, + + _processPanels: function() { + this.headers = this.element.find( this.options.header ) + .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" ); + + this.headers.next() + .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" ) + .filter(":not(.ui-accordion-content-active)") + .hide(); + }, + + _refresh: function() { + var maxHeight, + options = this.options, + heightStyle = options.heightStyle, + parent = this.element.parent(), + accordionId = this.accordionId = "ui-accordion-" + + (this.element.attr( "id" ) || ++uid); + + this.active = this._findActive( options.active ) + .addClass( "ui-accordion-header-active ui-state-active ui-corner-top" ) + .removeClass( "ui-corner-all" ); + this.active.next() + .addClass( "ui-accordion-content-active" ) + .show(); + + this.headers + .attr( "role", "tab" ) + .each(function( i ) { + var header = $( this ), + headerId = header.attr( "id" ), + panel = header.next(), + panelId = panel.attr( "id" ); + if ( !headerId ) { + headerId = accordionId + "-header-" + i; + header.attr( "id", headerId ); + } + if ( !panelId ) { + panelId = accordionId + "-panel-" + i; + panel.attr( "id", panelId ); + } + header.attr( "aria-controls", panelId ); + panel.attr( "aria-labelledby", headerId ); + }) + .next() + .attr( "role", "tabpanel" ); + + this.headers + .not( this.active ) + .attr({ + "aria-selected": "false", + tabIndex: -1 + }) + .next() + .attr({ + "aria-expanded": "false", + "aria-hidden": "true" + }) + .hide(); + + // make sure at least one header is in the tab order + if ( !this.active.length ) { + this.headers.eq( 0 ).attr( "tabIndex", 0 ); + } else { + this.active.attr({ + "aria-selected": "true", + tabIndex: 0 + }) + .next() + .attr({ + "aria-expanded": "true", + "aria-hidden": "false" + }); + } + + this._createIcons(); + + this._setupEvents( options.event ); + + if ( heightStyle === "fill" ) { + maxHeight = parent.height(); + this.element.siblings( ":visible" ).each(function() { + var elem = $( this ), + position = elem.css( "position" ); + + if ( position === "absolute" || position === "fixed" ) { + return; + } + maxHeight -= elem.outerHeight( true ); + }); + + this.headers.each(function() { + maxHeight -= $( this ).outerHeight( true ); + }); + + this.headers.next() + .each(function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + }) + .css( "overflow", "auto" ); + } else if ( heightStyle === "auto" ) { + maxHeight = 0; + this.headers.next() + .each(function() { + maxHeight = Math.max( maxHeight, $( this ).css( "height", "" ).height() ); + }) + .height( maxHeight ); + } + }, + + _activate: function( index ) { + var active = this._findActive( index )[ 0 ]; + + // trying to activate the already active panel + if ( active === this.active[ 0 ] ) { + return; + } + + // trying to collapse, simulate a click on the currently active header + active = active || this.active[ 0 ]; + + this._eventHandler({ + target: active, + currentTarget: active, + preventDefault: $.noop + }); + }, + + _findActive: function( selector ) { + return typeof selector === "number" ? this.headers.eq( selector ) : $(); + }, + + _setupEvents: function( event ) { + var events = { + keydown: "_keydown" + }; + if ( event ) { + $.each( event.split(" "), function( index, eventName ) { + events[ eventName ] = "_eventHandler"; + }); + } + + this._off( this.headers.add( this.headers.next() ) ); + this._on( this.headers, events ); + this._on( this.headers.next(), { keydown: "_panelKeyDown" }); + this._hoverable( this.headers ); + this._focusable( this.headers ); + }, + + _eventHandler: function( event ) { + var options = this.options, + active = this.active, + clicked = $( event.currentTarget ), + clickedIsActive = clicked[ 0 ] === active[ 0 ], + collapsing = clickedIsActive && options.collapsible, + toShow = collapsing ? $() : clicked.next(), + toHide = active.next(), + eventData = { + oldHeader: active, + oldPanel: toHide, + newHeader: collapsing ? $() : clicked, + newPanel: toShow + }; + + event.preventDefault(); + + if ( + // click on active header, but not collapsible + ( clickedIsActive && !options.collapsible ) || + // allow canceling activation + ( this._trigger( "beforeActivate", event, eventData ) === false ) ) { + return; + } + + options.active = collapsing ? false : this.headers.index( clicked ); + + // when the call to ._toggle() comes after the class changes + // it causes a very odd bug in IE 8 (see #6720) + this.active = clickedIsActive ? $() : clicked; + this._toggle( eventData ); + + // switch classes + // corner classes on the previously active header stay after the animation + active.removeClass( "ui-accordion-header-active ui-state-active" ); + if ( options.icons ) { + active.children( ".ui-accordion-header-icon" ) + .removeClass( options.icons.activeHeader ) + .addClass( options.icons.header ); + } + + if ( !clickedIsActive ) { + clicked + .removeClass( "ui-corner-all" ) + .addClass( "ui-accordion-header-active ui-state-active ui-corner-top" ); + if ( options.icons ) { + clicked.children( ".ui-accordion-header-icon" ) + .removeClass( options.icons.header ) + .addClass( options.icons.activeHeader ); + } + + clicked + .next() + .addClass( "ui-accordion-content-active" ); + } + }, + + _toggle: function( data ) { + var toShow = data.newPanel, + toHide = this.prevShow.length ? this.prevShow : data.oldPanel; + + // handle activating a panel during the animation for another activation + this.prevShow.add( this.prevHide ).stop( true, true ); + this.prevShow = toShow; + this.prevHide = toHide; + + if ( this.options.animate ) { + this._animate( toShow, toHide, data ); + } else { + toHide.hide(); + toShow.show(); + this._toggleComplete( data ); + } + + toHide.attr({ + "aria-expanded": "false", + "aria-hidden": "true" + }); + toHide.prev().attr( "aria-selected", "false" ); + // if we're switching panels, remove the old header from the tab order + // if we're opening from collapsed state, remove the previous header from the tab order + // if we're collapsing, then keep the collapsing header in the tab order + if ( toShow.length && toHide.length ) { + toHide.prev().attr( "tabIndex", -1 ); + } else if ( toShow.length ) { + this.headers.filter(function() { + return $( this ).attr( "tabIndex" ) === 0; + }) + .attr( "tabIndex", -1 ); + } + + toShow + .attr({ + "aria-expanded": "true", + "aria-hidden": "false" + }) + .prev() + .attr({ + "aria-selected": "true", + tabIndex: 0 + }); + }, + + _animate: function( toShow, toHide, data ) { + var total, easing, duration, + that = this, + adjust = 0, + down = toShow.length && + ( !toHide.length || ( toShow.index() < toHide.index() ) ), + animate = this.options.animate || {}, + options = down && animate.down || animate, + complete = function() { + that._toggleComplete( data ); + }; + + if ( typeof options === "number" ) { + duration = options; + } + if ( typeof options === "string" ) { + easing = options; + } + // fall back from options to animation in case of partial down settings + easing = easing || options.easing || animate.easing; + duration = duration || options.duration || animate.duration; + + if ( !toHide.length ) { + return toShow.animate( showProps, duration, easing, complete ); + } + if ( !toShow.length ) { + return toHide.animate( hideProps, duration, easing, complete ); + } + + total = toShow.show().outerHeight(); + toHide.animate( hideProps, { + duration: duration, + easing: easing, + step: function( now, fx ) { + fx.now = Math.round( now ); + } + }); + toShow + .hide() + .animate( showProps, { + duration: duration, + easing: easing, + complete: complete, + step: function( now, fx ) { + fx.now = Math.round( now ); + if ( fx.prop !== "height" ) { + adjust += fx.now; + } else if ( that.options.heightStyle !== "content" ) { + fx.now = Math.round( total - toHide.outerHeight() - adjust ); + adjust = 0; + } + } + }); + }, + + _toggleComplete: function( data ) { + var toHide = data.oldPanel; + + toHide + .removeClass( "ui-accordion-content-active" ) + .prev() + .removeClass( "ui-corner-top" ) + .addClass( "ui-corner-all" ); + + // Work around for rendering bug in IE (#5421) + if ( toHide.length ) { + toHide.parent()[0].className = toHide.parent()[0].className; + } + + this._trigger( "activate", null, data ); + } +}); + +})( jQuery ); + +(function( $, undefined ) { + +// used to prevent race conditions with remote data sources +var requestIndex = 0; + +$.widget( "ui.autocomplete", { + version: "1.10.2", + defaultElement: "", + options: { + appendTo: null, + autoFocus: false, + delay: 300, + minLength: 1, + position: { + my: "left top", + at: "left bottom", + collision: "none" + }, + source: null, + + // callbacks + change: null, + close: null, + focus: null, + open: null, + response: null, + search: null, + select: null + }, + + pending: 0, + + _create: function() { + // Some browsers only repeat keydown events, not keypress events, + // so we use the suppressKeyPress flag to determine if we've already + // handled the keydown event. #7269 + // Unfortunately the code for & in keypress is the same as the up arrow, + // so we use the suppressKeyPressRepeat flag to avoid handling keypress + // events when we know the keydown event was used to modify the + // search term. #7799 + var suppressKeyPress, suppressKeyPressRepeat, suppressInput, + nodeName = this.element[0].nodeName.toLowerCase(), + isTextarea = nodeName === "textarea", + isInput = nodeName === "input"; + + this.isMultiLine = + // Textareas are always multi-line + isTextarea ? true : + // Inputs are always single-line, even if inside a contentEditable element + // IE also treats inputs as contentEditable + isInput ? false : + // All other element types are determined by whether or not they're contentEditable + this.element.prop( "isContentEditable" ); + + this.valueMethod = this.element[ isTextarea || isInput ? "val" : "text" ]; + this.isNewMenu = true; + + this.element + .addClass( "ui-autocomplete-input" ) + .attr( "autocomplete", "off" ); + + this._on( this.element, { + keydown: function( event ) { + /*jshint maxcomplexity:15*/ + if ( this.element.prop( "readOnly" ) ) { + suppressKeyPress = true; + suppressInput = true; + suppressKeyPressRepeat = true; + return; + } + + suppressKeyPress = false; + suppressInput = false; + suppressKeyPressRepeat = false; + var keyCode = $.ui.keyCode; + switch( event.keyCode ) { + case keyCode.PAGE_UP: + suppressKeyPress = true; + this._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + suppressKeyPress = true; + this._move( "nextPage", event ); + break; + case keyCode.UP: + suppressKeyPress = true; + this._keyEvent( "previous", event ); + break; + case keyCode.DOWN: + suppressKeyPress = true; + this._keyEvent( "next", event ); + break; + case keyCode.ENTER: + case keyCode.NUMPAD_ENTER: + // when menu is open and has focus + if ( this.menu.active ) { + // #6055 - Opera still allows the keypress to occur + // which causes forms to submit + suppressKeyPress = true; + event.preventDefault(); + this.menu.select( event ); + } + break; + case keyCode.TAB: + if ( this.menu.active ) { + this.menu.select( event ); + } + break; + case keyCode.ESCAPE: + if ( this.menu.element.is( ":visible" ) ) { + this._value( this.term ); + this.close( event ); + // Different browsers have different default behavior for escape + // Single press can mean undo or clear + // Double press in IE means clear the whole form + event.preventDefault(); + } + break; + default: + suppressKeyPressRepeat = true; + // search timeout should be triggered before the input value is changed + this._searchTimeout( event ); + break; + } + }, + keypress: function( event ) { + if ( suppressKeyPress ) { + suppressKeyPress = false; + event.preventDefault(); + return; + } + if ( suppressKeyPressRepeat ) { + return; + } + + // replicate some key handlers to allow them to repeat in Firefox and Opera + var keyCode = $.ui.keyCode; + switch( event.keyCode ) { + case keyCode.PAGE_UP: + this._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + this._move( "nextPage", event ); + break; + case keyCode.UP: + this._keyEvent( "previous", event ); + break; + case keyCode.DOWN: + this._keyEvent( "next", event ); + break; + } + }, + input: function( event ) { + if ( suppressInput ) { + suppressInput = false; + event.preventDefault(); + return; + } + this._searchTimeout( event ); + }, + focus: function() { + this.selectedItem = null; + this.previous = this._value(); + }, + blur: function( event ) { + if ( this.cancelBlur ) { + delete this.cancelBlur; + return; + } + + clearTimeout( this.searching ); + this.close( event ); + this._change( event ); + } + }); + + this._initSource(); + this.menu = $( "
      " ) + .addClass( "ui-autocomplete ui-front" ) + .appendTo( this._appendTo() ) + .menu({ + // custom key handling for now + input: $(), + // disable ARIA support, the live region takes care of that + role: null + }) + .hide() + .data( "ui-menu" ); + + this._on( this.menu.element, { + mousedown: function( event ) { + // prevent moving focus out of the text field + event.preventDefault(); + + // IE doesn't prevent moving focus even with event.preventDefault() + // so we set a flag to know when we should ignore the blur event + this.cancelBlur = true; + this._delay(function() { + delete this.cancelBlur; + }); + + // clicking on the scrollbar causes focus to shift to the body + // but we can't detect a mouseup or a click immediately afterward + // so we have to track the next mousedown and close the menu if + // the user clicks somewhere outside of the autocomplete + var menuElement = this.menu.element[ 0 ]; + if ( !$( event.target ).closest( ".ui-menu-item" ).length ) { + this._delay(function() { + var that = this; + this.document.one( "mousedown", function( event ) { + if ( event.target !== that.element[ 0 ] && + event.target !== menuElement && + !$.contains( menuElement, event.target ) ) { + that.close(); + } + }); + }); + } + }, + menufocus: function( event, ui ) { + // support: Firefox + // Prevent accidental activation of menu items in Firefox (#7024 #9118) + if ( this.isNewMenu ) { + this.isNewMenu = false; + if ( event.originalEvent && /^mouse/.test( event.originalEvent.type ) ) { + this.menu.blur(); + + this.document.one( "mousemove", function() { + $( event.target ).trigger( event.originalEvent ); + }); + + return; + } + } + + var item = ui.item.data( "ui-autocomplete-item" ); + if ( false !== this._trigger( "focus", event, { item: item } ) ) { + // use value to match what will end up in the input, if it was a key event + if ( event.originalEvent && /^key/.test( event.originalEvent.type ) ) { + this._value( item.value ); + } + } else { + // Normally the input is populated with the item's value as the + // menu is navigated, causing screen readers to notice a change and + // announce the item. Since the focus event was canceled, this doesn't + // happen, so we update the live region so that screen readers can + // still notice the change and announce it. + this.liveRegion.text( item.value ); + } + }, + menuselect: function( event, ui ) { + var item = ui.item.data( "ui-autocomplete-item" ), + previous = this.previous; + + // only trigger when focus was lost (click on menu) + if ( this.element[0] !== this.document[0].activeElement ) { + this.element.focus(); + this.previous = previous; + // #6109 - IE triggers two focus events and the second + // is asynchronous, so we need to reset the previous + // term synchronously and asynchronously :-( + this._delay(function() { + this.previous = previous; + this.selectedItem = item; + }); + } + + if ( false !== this._trigger( "select", event, { item: item } ) ) { + this._value( item.value ); + } + // reset the term after the select event + // this allows custom select handling to work properly + this.term = this._value(); + + this.close( event ); + this.selectedItem = item; + } + }); + + this.liveRegion = $( "", { + role: "status", + "aria-live": "polite" + }) + .addClass( "ui-helper-hidden-accessible" ) + .insertAfter( this.element ); + + // turning off autocomplete prevents the browser from remembering the + // value when navigating through history, so we re-enable autocomplete + // if the page is unloaded before the widget is destroyed. #7790 + this._on( this.window, { + beforeunload: function() { + this.element.removeAttr( "autocomplete" ); + } + }); + }, + + _destroy: function() { + clearTimeout( this.searching ); + this.element + .removeClass( "ui-autocomplete-input" ) + .removeAttr( "autocomplete" ); + this.menu.element.remove(); + this.liveRegion.remove(); + }, + + _setOption: function( key, value ) { + this._super( key, value ); + if ( key === "source" ) { + this._initSource(); + } + if ( key === "appendTo" ) { + this.menu.element.appendTo( this._appendTo() ); + } + if ( key === "disabled" && value && this.xhr ) { + this.xhr.abort(); + } + }, + + _appendTo: function() { + var element = this.options.appendTo; + + if ( element ) { + element = element.jquery || element.nodeType ? + $( element ) : + this.document.find( element ).eq( 0 ); + } + + if ( !element ) { + element = this.element.closest( ".ui-front" ); + } + + if ( !element.length ) { + element = this.document[0].body; + } + + return element; + }, + + _initSource: function() { + var array, url, + that = this; + if ( $.isArray(this.options.source) ) { + array = this.options.source; + this.source = function( request, response ) { + response( $.ui.autocomplete.filter( array, request.term ) ); + }; + } else if ( typeof this.options.source === "string" ) { + url = this.options.source; + this.source = function( request, response ) { + if ( that.xhr ) { + that.xhr.abort(); + } + that.xhr = $.ajax({ + url: url, + data: request, + dataType: "json", + success: function( data ) { + response( data ); + }, + error: function() { + response( [] ); + } + }); + }; + } else { + this.source = this.options.source; + } + }, + + _searchTimeout: function( event ) { + clearTimeout( this.searching ); + this.searching = this._delay(function() { + // only search if the value has changed + if ( this.term !== this._value() ) { + this.selectedItem = null; + this.search( null, event ); + } + }, this.options.delay ); + }, + + search: function( value, event ) { + value = value != null ? value : this._value(); + + // always save the actual value, not the one passed as an argument + this.term = this._value(); + + if ( value.length < this.options.minLength ) { + return this.close( event ); + } + + if ( this._trigger( "search", event ) === false ) { + return; + } + + return this._search( value ); + }, + + _search: function( value ) { + this.pending++; + this.element.addClass( "ui-autocomplete-loading" ); + this.cancelSearch = false; + + this.source( { term: value }, this._response() ); + }, + + _response: function() { + var that = this, + index = ++requestIndex; + + return function( content ) { + if ( index === requestIndex ) { + that.__response( content ); + } + + that.pending--; + if ( !that.pending ) { + that.element.removeClass( "ui-autocomplete-loading" ); + } + }; + }, + + __response: function( content ) { + if ( content ) { + content = this._normalize( content ); + } + this._trigger( "response", null, { content: content } ); + if ( !this.options.disabled && content && content.length && !this.cancelSearch ) { + this._suggest( content ); + this._trigger( "open" ); + } else { + // use ._close() instead of .close() so we don't cancel future searches + this._close(); + } + }, + + close: function( event ) { + this.cancelSearch = true; + this._close( event ); + }, + + _close: function( event ) { + if ( this.menu.element.is( ":visible" ) ) { + this.menu.element.hide(); + this.menu.blur(); + this.isNewMenu = true; + this._trigger( "close", event ); + } + }, + + _change: function( event ) { + if ( this.previous !== this._value() ) { + this._trigger( "change", event, { item: this.selectedItem } ); + } + }, + + _normalize: function( items ) { + // assume all items have the right format when the first item is complete + if ( items.length && items[0].label && items[0].value ) { + return items; + } + return $.map( items, function( item ) { + if ( typeof item === "string" ) { + return { + label: item, + value: item + }; + } + return $.extend({ + label: item.label || item.value, + value: item.value || item.label + }, item ); + }); + }, + + _suggest: function( items ) { + var ul = this.menu.element.empty(); + this._renderMenu( ul, items ); + this.isNewMenu = true; + this.menu.refresh(); + + // size and position menu + ul.show(); + this._resizeMenu(); + ul.position( $.extend({ + of: this.element + }, this.options.position )); + + if ( this.options.autoFocus ) { + this.menu.next(); + } + }, + + _resizeMenu: function() { + var ul = this.menu.element; + ul.outerWidth( Math.max( + // Firefox wraps long text (possibly a rounding bug) + // so we add 1px to avoid the wrapping (#7513) + ul.width( "" ).outerWidth() + 1, + this.element.outerWidth() + ) ); + }, + + _renderMenu: function( ul, items ) { + var that = this; + $.each( items, function( index, item ) { + that._renderItemData( ul, item ); + }); + }, + + _renderItemData: function( ul, item ) { + return this._renderItem( ul, item ).data( "ui-autocomplete-item", item ); + }, + + _renderItem: function( ul, item ) { + return $( "
    • " ) + .append( $( "" ).text( item.label ) ) + .appendTo( ul ); + }, + + _move: function( direction, event ) { + if ( !this.menu.element.is( ":visible" ) ) { + this.search( null, event ); + return; + } + if ( this.menu.isFirstItem() && /^previous/.test( direction ) || + this.menu.isLastItem() && /^next/.test( direction ) ) { + this._value( this.term ); + this.menu.blur(); + return; + } + this.menu[ direction ]( event ); + }, + + widget: function() { + return this.menu.element; + }, + + _value: function() { + return this.valueMethod.apply( this.element, arguments ); + }, + + _keyEvent: function( keyEvent, event ) { + if ( !this.isMultiLine || this.menu.element.is( ":visible" ) ) { + this._move( keyEvent, event ); + + // prevents moving cursor to beginning/end of the text field in some browsers + event.preventDefault(); + } + } +}); + +$.extend( $.ui.autocomplete, { + escapeRegex: function( value ) { + return value.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&"); + }, + filter: function(array, term) { + var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" ); + return $.grep( array, function(value) { + return matcher.test( value.label || value.value || value ); + }); + } +}); + + +// live region extension, adding a `messages` option +// NOTE: This is an experimental API. We are still investigating +// a full solution for string manipulation and internationalization. +$.widget( "ui.autocomplete", $.ui.autocomplete, { + options: { + messages: { + noResults: "No search results.", + results: function( amount ) { + return amount + ( amount > 1 ? " results are" : " result is" ) + + " available, use up and down arrow keys to navigate."; + } + } + }, + + __response: function( content ) { + var message; + this._superApply( arguments ); + if ( this.options.disabled || this.cancelSearch ) { + return; + } + if ( content && content.length ) { + message = this.options.messages.results( content.length ); + } else { + message = this.options.messages.noResults; + } + this.liveRegion.text( message ); + } +}); + +}( jQuery )); + +(function( $, undefined ) { + +var lastActive, startXPos, startYPos, clickDragged, + baseClasses = "ui-button ui-widget ui-state-default ui-corner-all", + stateClasses = "ui-state-hover ui-state-active ", + typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only", + formResetHandler = function() { + var buttons = $( this ).find( ":ui-button" ); + setTimeout(function() { + buttons.button( "refresh" ); + }, 1 ); + }, + radioGroup = function( radio ) { + var name = radio.name, + form = radio.form, + radios = $( [] ); + if ( name ) { + name = name.replace( /'/g, "\\'" ); + if ( form ) { + radios = $( form ).find( "[name='" + name + "']" ); + } else { + radios = $( "[name='" + name + "']", radio.ownerDocument ) + .filter(function() { + return !this.form; + }); + } + } + return radios; + }; + +$.widget( "ui.button", { + version: "1.10.2", + defaultElement: "").addClass(this._triggerClass). + html(!buttonImage ? buttonText : $("").attr( + { src:buttonImage, alt:buttonText, title:buttonText }))); + input[isRTL ? "before" : "after"](inst.trigger); + inst.trigger.click(function() { + if ($.datepicker._datepickerShowing && $.datepicker._lastInput === input[0]) { + $.datepicker._hideDatepicker(); + } else if ($.datepicker._datepickerShowing && $.datepicker._lastInput !== input[0]) { + $.datepicker._hideDatepicker(); + $.datepicker._showDatepicker(input[0]); + } else { + $.datepicker._showDatepicker(input[0]); + } + return false; + }); + } + }, + + /* Apply the maximum length for the date format. */ + _autoSize: function(inst) { + if (this._get(inst, "autoSize") && !inst.inline) { + var findMax, max, maxI, i, + date = new Date(2009, 12 - 1, 20), // Ensure double digits + dateFormat = this._get(inst, "dateFormat"); + + if (dateFormat.match(/[DM]/)) { + findMax = function(names) { + max = 0; + maxI = 0; + for (i = 0; i < names.length; i++) { + if (names[i].length > max) { + max = names[i].length; + maxI = i; + } + } + return maxI; + }; + date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ? + "monthNames" : "monthNamesShort")))); + date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ? + "dayNames" : "dayNamesShort"))) + 20 - date.getDay()); + } + inst.input.attr("size", this._formatDate(inst, date).length); + } + }, + + /* Attach an inline date picker to a div. */ + _inlineDatepicker: function(target, inst) { + var divSpan = $(target); + if (divSpan.hasClass(this.markerClassName)) { + return; + } + divSpan.addClass(this.markerClassName).append(inst.dpDiv); + $.data(target, PROP_NAME, inst); + this._setDate(inst, this._getDefaultDate(inst), true); + this._updateDatepicker(inst); + this._updateAlternate(inst); + //If disabled option is true, disable the datepicker before showing it (see ticket #5665) + if( inst.settings.disabled ) { + this._disableDatepicker( target ); + } + // Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements + // http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height + inst.dpDiv.css( "display", "block" ); + }, + + /* Pop-up the date picker in a "dialog" box. + * @param input element - ignored + * @param date string or Date - the initial date to display + * @param onSelect function - the function to call when a date is selected + * @param settings object - update the dialog date picker instance's settings (anonymous object) + * @param pos int[2] - coordinates for the dialog's position within the screen or + * event - with x/y coordinates or + * leave empty for default (screen centre) + * @return the manager object + */ + _dialogDatepicker: function(input, date, onSelect, settings, pos) { + var id, browserWidth, browserHeight, scrollX, scrollY, + inst = this._dialogInst; // internal instance + + if (!inst) { + this.uuid += 1; + id = "dp" + this.uuid; + this._dialogInput = $(""); + this._dialogInput.keydown(this._doKeyDown); + $("body").append(this._dialogInput); + inst = this._dialogInst = this._newInst(this._dialogInput, false); + inst.settings = {}; + $.data(this._dialogInput[0], PROP_NAME, inst); + } + extendRemove(inst.settings, settings || {}); + date = (date && date.constructor === Date ? this._formatDate(inst, date) : date); + this._dialogInput.val(date); + + this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); + if (!this._pos) { + browserWidth = document.documentElement.clientWidth; + browserHeight = document.documentElement.clientHeight; + scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; + scrollY = document.documentElement.scrollTop || document.body.scrollTop; + this._pos = // should use actual width/height below + [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + } + + // move input on screen for focus, but hidden behind dialog + this._dialogInput.css("left", (this._pos[0] + 20) + "px").css("top", this._pos[1] + "px"); + inst.settings.onSelect = onSelect; + this._inDialog = true; + this.dpDiv.addClass(this._dialogClass); + this._showDatepicker(this._dialogInput[0]); + if ($.blockUI) { + $.blockUI(this.dpDiv); + } + $.data(this._dialogInput[0], PROP_NAME, inst); + return this; + }, + + /* Detach a datepicker from its control. + * @param target element - the target input field or division or span + */ + _destroyDatepicker: function(target) { + var nodeName, + $target = $(target), + inst = $.data(target, PROP_NAME); + + if (!$target.hasClass(this.markerClassName)) { + return; + } + + nodeName = target.nodeName.toLowerCase(); + $.removeData(target, PROP_NAME); + if (nodeName === "input") { + inst.append.remove(); + inst.trigger.remove(); + $target.removeClass(this.markerClassName). + unbind("focus", this._showDatepicker). + unbind("keydown", this._doKeyDown). + unbind("keypress", this._doKeyPress). + unbind("keyup", this._doKeyUp); + } else if (nodeName === "div" || nodeName === "span") { + $target.removeClass(this.markerClassName).empty(); + } + }, + + /* Enable the date picker to a jQuery selection. + * @param target element - the target input field or division or span + */ + _enableDatepicker: function(target) { + var nodeName, inline, + $target = $(target), + inst = $.data(target, PROP_NAME); + + if (!$target.hasClass(this.markerClassName)) { + return; + } + + nodeName = target.nodeName.toLowerCase(); + if (nodeName === "input") { + target.disabled = false; + inst.trigger.filter("button"). + each(function() { this.disabled = false; }).end(). + filter("img").css({opacity: "1.0", cursor: ""}); + } else if (nodeName === "div" || nodeName === "span") { + inline = $target.children("." + this._inlineClass); + inline.children().removeClass("ui-state-disabled"); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + prop("disabled", false); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value === target ? null : value); }); // delete entry + }, + + /* Disable the date picker to a jQuery selection. + * @param target element - the target input field or division or span + */ + _disableDatepicker: function(target) { + var nodeName, inline, + $target = $(target), + inst = $.data(target, PROP_NAME); + + if (!$target.hasClass(this.markerClassName)) { + return; + } + + nodeName = target.nodeName.toLowerCase(); + if (nodeName === "input") { + target.disabled = true; + inst.trigger.filter("button"). + each(function() { this.disabled = true; }).end(). + filter("img").css({opacity: "0.5", cursor: "default"}); + } else if (nodeName === "div" || nodeName === "span") { + inline = $target.children("." + this._inlineClass); + inline.children().addClass("ui-state-disabled"); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + prop("disabled", true); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value === target ? null : value); }); // delete entry + this._disabledInputs[this._disabledInputs.length] = target; + }, + + /* Is the first field in a jQuery collection disabled as a datepicker? + * @param target element - the target input field or division or span + * @return boolean - true if disabled, false if enabled + */ + _isDisabledDatepicker: function(target) { + if (!target) { + return false; + } + for (var i = 0; i < this._disabledInputs.length; i++) { + if (this._disabledInputs[i] === target) { + return true; + } + } + return false; + }, + + /* Retrieve the instance data for the target control. + * @param target element - the target input field or division or span + * @return object - the associated instance data + * @throws error if a jQuery problem getting data + */ + _getInst: function(target) { + try { + return $.data(target, PROP_NAME); + } + catch (err) { + throw "Missing instance data for this datepicker"; + } + }, + + /* Update or retrieve the settings for a date picker attached to an input field or division. + * @param target element - the target input field or division or span + * @param name object - the new settings to update or + * string - the name of the setting to change or retrieve, + * when retrieving also "all" for all instance settings or + * "defaults" for all global defaults + * @param value any - the new value for the setting + * (omit if above is an object or to retrieve a value) + */ + _optionDatepicker: function(target, name, value) { + var settings, date, minDate, maxDate, + inst = this._getInst(target); + + if (arguments.length === 2 && typeof name === "string") { + return (name === "defaults" ? $.extend({}, $.datepicker._defaults) : + (inst ? (name === "all" ? $.extend({}, inst.settings) : + this._get(inst, name)) : null)); + } + + settings = name || {}; + if (typeof name === "string") { + settings = {}; + settings[name] = value; + } + + if (inst) { + if (this._curInst === inst) { + this._hideDatepicker(); + } + + date = this._getDateDatepicker(target, true); + minDate = this._getMinMaxDate(inst, "min"); + maxDate = this._getMinMaxDate(inst, "max"); + extendRemove(inst.settings, settings); + // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided + if (minDate !== null && settings.dateFormat !== undefined && settings.minDate === undefined) { + inst.settings.minDate = this._formatDate(inst, minDate); + } + if (maxDate !== null && settings.dateFormat !== undefined && settings.maxDate === undefined) { + inst.settings.maxDate = this._formatDate(inst, maxDate); + } + if ( "disabled" in settings ) { + if ( settings.disabled ) { + this._disableDatepicker(target); + } else { + this._enableDatepicker(target); + } + } + this._attachments($(target), inst); + this._autoSize(inst); + this._setDate(inst, date); + this._updateAlternate(inst); + this._updateDatepicker(inst); + } + }, + + // change method deprecated + _changeDatepicker: function(target, name, value) { + this._optionDatepicker(target, name, value); + }, + + /* Redraw the date picker attached to an input field or division. + * @param target element - the target input field or division or span + */ + _refreshDatepicker: function(target) { + var inst = this._getInst(target); + if (inst) { + this._updateDatepicker(inst); + } + }, + + /* Set the dates for a jQuery selection. + * @param target element - the target input field or division or span + * @param date Date - the new date + */ + _setDateDatepicker: function(target, date) { + var inst = this._getInst(target); + if (inst) { + this._setDate(inst, date); + this._updateDatepicker(inst); + this._updateAlternate(inst); + } + }, + + /* Get the date(s) for the first entry in a jQuery selection. + * @param target element - the target input field or division or span + * @param noDefault boolean - true if no default date is to be used + * @return Date - the current date + */ + _getDateDatepicker: function(target, noDefault) { + var inst = this._getInst(target); + if (inst && !inst.inline) { + this._setDateFromField(inst, noDefault); + } + return (inst ? this._getDate(inst) : null); + }, + + /* Handle keystrokes. */ + _doKeyDown: function(event) { + var onSelect, dateStr, sel, + inst = $.datepicker._getInst(event.target), + handled = true, + isRTL = inst.dpDiv.is(".ui-datepicker-rtl"); + + inst._keyEvent = true; + if ($.datepicker._datepickerShowing) { + switch (event.keyCode) { + case 9: $.datepicker._hideDatepicker(); + handled = false; + break; // hide on tab out + case 13: sel = $("td." + $.datepicker._dayOverClass + ":not(." + + $.datepicker._currentClass + ")", inst.dpDiv); + if (sel[0]) { + $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); + } + + onSelect = $.datepicker._get(inst, "onSelect"); + if (onSelect) { + dateStr = $.datepicker._formatDate(inst); + + // trigger custom callback + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); + } else { + $.datepicker._hideDatepicker(); + } + + return false; // don't submit the form + case 27: $.datepicker._hideDatepicker(); + break; // hide on escape + case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, "stepBigMonths") : + -$.datepicker._get(inst, "stepMonths")), "M"); + break; // previous month/year on page up/+ ctrl + case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, "stepBigMonths") : + +$.datepicker._get(inst, "stepMonths")), "M"); + break; // next month/year on page down/+ ctrl + case 35: if (event.ctrlKey || event.metaKey) { + $.datepicker._clearDate(event.target); + } + handled = event.ctrlKey || event.metaKey; + break; // clear on ctrl or command +end + case 36: if (event.ctrlKey || event.metaKey) { + $.datepicker._gotoToday(event.target); + } + handled = event.ctrlKey || event.metaKey; + break; // current on ctrl or command +home + case 37: if (event.ctrlKey || event.metaKey) { + $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), "D"); + } + handled = event.ctrlKey || event.metaKey; + // -1 day on ctrl or command +left + if (event.originalEvent.altKey) { + $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, "stepBigMonths") : + -$.datepicker._get(inst, "stepMonths")), "M"); + } + // next month/year on alt +left on Mac + break; + case 38: if (event.ctrlKey || event.metaKey) { + $.datepicker._adjustDate(event.target, -7, "D"); + } + handled = event.ctrlKey || event.metaKey; + break; // -1 week on ctrl or command +up + case 39: if (event.ctrlKey || event.metaKey) { + $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), "D"); + } + handled = event.ctrlKey || event.metaKey; + // +1 day on ctrl or command +right + if (event.originalEvent.altKey) { + $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, "stepBigMonths") : + +$.datepicker._get(inst, "stepMonths")), "M"); + } + // next month/year on alt +right + break; + case 40: if (event.ctrlKey || event.metaKey) { + $.datepicker._adjustDate(event.target, +7, "D"); + } + handled = event.ctrlKey || event.metaKey; + break; // +1 week on ctrl or command +down + default: handled = false; + } + } else if (event.keyCode === 36 && event.ctrlKey) { // display the date picker on ctrl+home + $.datepicker._showDatepicker(this); + } else { + handled = false; + } + + if (handled) { + event.preventDefault(); + event.stopPropagation(); + } + }, + + /* Filter entered characters - based on date format. */ + _doKeyPress: function(event) { + var chars, chr, + inst = $.datepicker._getInst(event.target); + + if ($.datepicker._get(inst, "constrainInput")) { + chars = $.datepicker._possibleChars($.datepicker._get(inst, "dateFormat")); + chr = String.fromCharCode(event.charCode == null ? event.keyCode : event.charCode); + return event.ctrlKey || event.metaKey || (chr < " " || !chars || chars.indexOf(chr) > -1); + } + }, + + /* Synchronise manual entry and field/alternate field. */ + _doKeyUp: function(event) { + var date, + inst = $.datepicker._getInst(event.target); + + if (inst.input.val() !== inst.lastVal) { + try { + date = $.datepicker.parseDate($.datepicker._get(inst, "dateFormat"), + (inst.input ? inst.input.val() : null), + $.datepicker._getFormatConfig(inst)); + + if (date) { // only if valid + $.datepicker._setDateFromField(inst); + $.datepicker._updateAlternate(inst); + $.datepicker._updateDatepicker(inst); + } + } + catch (err) { + } + } + return true; + }, + + /* Pop-up the date picker for a given input field. + * If false returned from beforeShow event handler do not show. + * @param input element - the input field attached to the date picker or + * event - if triggered by focus + */ + _showDatepicker: function(input) { + input = input.target || input; + if (input.nodeName.toLowerCase() !== "input") { // find from button/image trigger + input = $("input", input.parentNode)[0]; + } + + if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput === input) { // already here + return; + } + + var inst, beforeShow, beforeShowSettings, isFixed, + offset, showAnim, duration; + + inst = $.datepicker._getInst(input); + if ($.datepicker._curInst && $.datepicker._curInst !== inst) { + $.datepicker._curInst.dpDiv.stop(true, true); + if ( inst && $.datepicker._datepickerShowing ) { + $.datepicker._hideDatepicker( $.datepicker._curInst.input[0] ); + } + } + + beforeShow = $.datepicker._get(inst, "beforeShow"); + beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {}; + if(beforeShowSettings === false){ + return; + } + extendRemove(inst.settings, beforeShowSettings); + + inst.lastVal = null; + $.datepicker._lastInput = input; + $.datepicker._setDateFromField(inst); + + if ($.datepicker._inDialog) { // hide cursor + input.value = ""; + } + if (!$.datepicker._pos) { // position below input + $.datepicker._pos = $.datepicker._findPos(input); + $.datepicker._pos[1] += input.offsetHeight; // add the height + } + + isFixed = false; + $(input).parents().each(function() { + isFixed |= $(this).css("position") === "fixed"; + return !isFixed; + }); + + offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; + $.datepicker._pos = null; + //to avoid flashes on Firefox + inst.dpDiv.empty(); + // determine sizing offscreen + inst.dpDiv.css({position: "absolute", display: "block", top: "-1000px"}); + $.datepicker._updateDatepicker(inst); + // fix width for dynamic number of date pickers + // and adjust position before showing + offset = $.datepicker._checkOffset(inst, offset, isFixed); + inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? + "static" : (isFixed ? "fixed" : "absolute")), display: "none", + left: offset.left + "px", top: offset.top + "px"}); + + if (!inst.inline) { + showAnim = $.datepicker._get(inst, "showAnim"); + duration = $.datepicker._get(inst, "duration"); + inst.dpDiv.zIndex($(input).zIndex()+1); + $.datepicker._datepickerShowing = true; + + if ( $.effects && $.effects.effect[ showAnim ] ) { + inst.dpDiv.show(showAnim, $.datepicker._get(inst, "showOptions"), duration); + } else { + inst.dpDiv[showAnim || "show"](showAnim ? duration : null); + } + + if (inst.input.is(":visible") && !inst.input.is(":disabled")) { + inst.input.focus(); + } + $.datepicker._curInst = inst; + } + }, + + /* Generate the date picker content. */ + _updateDatepicker: function(inst) { + this.maxRows = 4; //Reset the max number of rows being displayed (see #7043) + instActive = inst; // for delegate hover events + inst.dpDiv.empty().append(this._generateHTML(inst)); + this._attachHandlers(inst); + inst.dpDiv.find("." + this._dayOverClass + " a").mouseover(); + + var origyearshtml, + numMonths = this._getNumberOfMonths(inst), + cols = numMonths[1], + width = 17; + + inst.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width(""); + if (cols > 1) { + inst.dpDiv.addClass("ui-datepicker-multi-" + cols).css("width", (width * cols) + "em"); + } + inst.dpDiv[(numMonths[0] !== 1 || numMonths[1] !== 1 ? "add" : "remove") + + "Class"]("ui-datepicker-multi"); + inst.dpDiv[(this._get(inst, "isRTL") ? "add" : "remove") + + "Class"]("ui-datepicker-rtl"); + + // #6694 - don't focus the input if it's already focused + // this breaks the change event in IE + if (inst === $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input && + inst.input.is(":visible") && !inst.input.is(":disabled") && inst.input[0] !== document.activeElement) { + inst.input.focus(); + } + + // deffered render of the years select (to avoid flashes on Firefox) + if( inst.yearshtml ){ + origyearshtml = inst.yearshtml; + setTimeout(function(){ + //assure that inst.yearshtml didn't change. + if( origyearshtml === inst.yearshtml && inst.yearshtml ){ + inst.dpDiv.find("select.ui-datepicker-year:first").replaceWith(inst.yearshtml); + } + origyearshtml = inst.yearshtml = null; + }, 0); + } + }, + + /* Retrieve the size of left and top borders for an element. + * @param elem (jQuery object) the element of interest + * @return (number[2]) the left and top borders + */ + _getBorders: function(elem) { + var convert = function(value) { + return {thin: 1, medium: 2, thick: 3}[value] || value; + }; + return [parseFloat(convert(elem.css("border-left-width"))), + parseFloat(convert(elem.css("border-top-width")))]; + }, + + /* Check positioning to remain on screen. */ + _checkOffset: function(inst, offset, isFixed) { + var dpWidth = inst.dpDiv.outerWidth(), + dpHeight = inst.dpDiv.outerHeight(), + inputWidth = inst.input ? inst.input.outerWidth() : 0, + inputHeight = inst.input ? inst.input.outerHeight() : 0, + viewWidth = document.documentElement.clientWidth + (isFixed ? 0 : $(document).scrollLeft()), + viewHeight = document.documentElement.clientHeight + (isFixed ? 0 : $(document).scrollTop()); + + offset.left -= (this._get(inst, "isRTL") ? (dpWidth - inputWidth) : 0); + offset.left -= (isFixed && offset.left === inst.input.offset().left) ? $(document).scrollLeft() : 0; + offset.top -= (isFixed && offset.top === (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; + + // now check if datepicker is showing outside window viewport - move to a better place if so. + offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? + Math.abs(offset.left + dpWidth - viewWidth) : 0); + offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? + Math.abs(dpHeight + inputHeight) : 0); + + return offset; + }, + + /* Find an object's position on the screen. */ + _findPos: function(obj) { + var position, + inst = this._getInst(obj), + isRTL = this._get(inst, "isRTL"); + + while (obj && (obj.type === "hidden" || obj.nodeType !== 1 || $.expr.filters.hidden(obj))) { + obj = obj[isRTL ? "previousSibling" : "nextSibling"]; + } + + position = $(obj).offset(); + return [position.left, position.top]; + }, + + /* Hide the date picker from view. + * @param input element - the input field attached to the date picker + */ + _hideDatepicker: function(input) { + var showAnim, duration, postProcess, onClose, + inst = this._curInst; + + if (!inst || (input && inst !== $.data(input, PROP_NAME))) { + return; + } + + if (this._datepickerShowing) { + showAnim = this._get(inst, "showAnim"); + duration = this._get(inst, "duration"); + postProcess = function() { + $.datepicker._tidyDialog(inst); + }; + + // DEPRECATED: after BC for 1.8.x $.effects[ showAnim ] is not needed + if ( $.effects && ( $.effects.effect[ showAnim ] || $.effects[ showAnim ] ) ) { + inst.dpDiv.hide(showAnim, $.datepicker._get(inst, "showOptions"), duration, postProcess); + } else { + inst.dpDiv[(showAnim === "slideDown" ? "slideUp" : + (showAnim === "fadeIn" ? "fadeOut" : "hide"))]((showAnim ? duration : null), postProcess); + } + + if (!showAnim) { + postProcess(); + } + this._datepickerShowing = false; + + onClose = this._get(inst, "onClose"); + if (onClose) { + onClose.apply((inst.input ? inst.input[0] : null), [(inst.input ? inst.input.val() : ""), inst]); + } + + this._lastInput = null; + if (this._inDialog) { + this._dialogInput.css({ position: "absolute", left: "0", top: "-100px" }); + if ($.blockUI) { + $.unblockUI(); + $("body").append(this.dpDiv); + } + } + this._inDialog = false; + } + }, + + /* Tidy up after a dialog display. */ + _tidyDialog: function(inst) { + inst.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar"); + }, + + /* Close date picker if clicked elsewhere. */ + _checkExternalClick: function(event) { + if (!$.datepicker._curInst) { + return; + } + + var $target = $(event.target), + inst = $.datepicker._getInst($target[0]); + + if ( ( ( $target[0].id !== $.datepicker._mainDivId && + $target.parents("#" + $.datepicker._mainDivId).length === 0 && + !$target.hasClass($.datepicker.markerClassName) && + !$target.closest("." + $.datepicker._triggerClass).length && + $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI) ) ) || + ( $target.hasClass($.datepicker.markerClassName) && $.datepicker._curInst !== inst ) ) { + $.datepicker._hideDatepicker(); + } + }, + + /* Adjust one of the date sub-fields. */ + _adjustDate: function(id, offset, period) { + var target = $(id), + inst = this._getInst(target[0]); + + if (this._isDisabledDatepicker(target[0])) { + return; + } + this._adjustInstDate(inst, offset + + (period === "M" ? this._get(inst, "showCurrentAtPos") : 0), // undo positioning + period); + this._updateDatepicker(inst); + }, + + /* Action for current link. */ + _gotoToday: function(id) { + var date, + target = $(id), + inst = this._getInst(target[0]); + + if (this._get(inst, "gotoCurrent") && inst.currentDay) { + inst.selectedDay = inst.currentDay; + inst.drawMonth = inst.selectedMonth = inst.currentMonth; + inst.drawYear = inst.selectedYear = inst.currentYear; + } else { + date = new Date(); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + } + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a new month/year. */ + _selectMonthYear: function(id, select, period) { + var target = $(id), + inst = this._getInst(target[0]); + + inst["selected" + (period === "M" ? "Month" : "Year")] = + inst["draw" + (period === "M" ? "Month" : "Year")] = + parseInt(select.options[select.selectedIndex].value,10); + + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a day. */ + _selectDay: function(id, month, year, td) { + var inst, + target = $(id); + + if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { + return; + } + + inst = this._getInst(target[0]); + inst.selectedDay = inst.currentDay = $("a", td).html(); + inst.selectedMonth = inst.currentMonth = month; + inst.selectedYear = inst.currentYear = year; + this._selectDate(id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + }, + + /* Erase the input field and hide the date picker. */ + _clearDate: function(id) { + var target = $(id); + this._selectDate(target, ""); + }, + + /* Update the input field with the selected date. */ + _selectDate: function(id, dateStr) { + var onSelect, + target = $(id), + inst = this._getInst(target[0]); + + dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); + if (inst.input) { + inst.input.val(dateStr); + } + this._updateAlternate(inst); + + onSelect = this._get(inst, "onSelect"); + if (onSelect) { + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback + } else if (inst.input) { + inst.input.trigger("change"); // fire the change event + } + + if (inst.inline){ + this._updateDatepicker(inst); + } else { + this._hideDatepicker(); + this._lastInput = inst.input[0]; + if (typeof(inst.input[0]) !== "object") { + inst.input.focus(); // restore focus + } + this._lastInput = null; + } + }, + + /* Update any alternate field to synchronise with the main field. */ + _updateAlternate: function(inst) { + var altFormat, date, dateStr, + altField = this._get(inst, "altField"); + + if (altField) { // update alternate field too + altFormat = this._get(inst, "altFormat") || this._get(inst, "dateFormat"); + date = this._getDate(inst); + dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); + $(altField).each(function() { $(this).val(dateStr); }); + } + }, + + /* Set as beforeShowDay function to prevent selection of weekends. + * @param date Date - the date to customise + * @return [boolean, string] - is this date selectable?, what is its CSS class? + */ + noWeekends: function(date) { + var day = date.getDay(); + return [(day > 0 && day < 6), ""]; + }, + + /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. + * @param date Date - the date to get the week for + * @return number - the number of the week within the year that contains this date + */ + iso8601Week: function(date) { + var time, + checkDate = new Date(date.getTime()); + + // Find Thursday of this week starting on Monday + checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); + + time = checkDate.getTime(); + checkDate.setMonth(0); // Compare with Jan 1 + checkDate.setDate(1); + return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; + }, + + /* Parse a string value into a date object. + * See formatDate below for the possible formats. + * + * @param format string - the expected format of the date + * @param value string - the date in the above format + * @param settings Object - attributes include: + * shortYearCutoff number - the cutoff year for determining the century (optional) + * dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + * dayNames string[7] - names of the days from Sunday (optional) + * monthNamesShort string[12] - abbreviated names of the months (optional) + * monthNames string[12] - names of the months (optional) + * @return Date - the extracted date value or null if value is blank + */ + parseDate: function (format, value, settings) { + if (format == null || value == null) { + throw "Invalid arguments"; + } + + value = (typeof value === "object" ? value.toString() : value + ""); + if (value === "") { + return null; + } + + var iFormat, dim, extra, + iValue = 0, + shortYearCutoffTemp = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff, + shortYearCutoff = (typeof shortYearCutoffTemp !== "string" ? shortYearCutoffTemp : + new Date().getFullYear() % 100 + parseInt(shortYearCutoffTemp, 10)), + dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort, + dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames, + monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort, + monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames, + year = -1, + month = -1, + day = -1, + doy = -1, + literal = false, + date, + // Check whether a format character is doubled + lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match); + if (matches) { + iFormat++; + } + return matches; + }, + // Extract a number from the string value + getNumber = function(match) { + var isDoubled = lookAhead(match), + size = (match === "@" ? 14 : (match === "!" ? 20 : + (match === "y" && isDoubled ? 4 : (match === "o" ? 3 : 2)))), + digits = new RegExp("^\\d{1," + size + "}"), + num = value.substring(iValue).match(digits); + if (!num) { + throw "Missing number at position " + iValue; + } + iValue += num[0].length; + return parseInt(num[0], 10); + }, + // Extract a name from the string value and convert to an index + getName = function(match, shortNames, longNames) { + var index = -1, + names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) { + return [ [k, v] ]; + }).sort(function (a, b) { + return -(a[1].length - b[1].length); + }); + + $.each(names, function (i, pair) { + var name = pair[1]; + if (value.substr(iValue, name.length).toLowerCase() === name.toLowerCase()) { + index = pair[0]; + iValue += name.length; + return false; + } + }); + if (index !== -1) { + return index + 1; + } else { + throw "Unknown name at position " + iValue; + } + }, + // Confirm that a literal character matches the string value + checkLiteral = function() { + if (value.charAt(iValue) !== format.charAt(iFormat)) { + throw "Unexpected literal at position " + iValue; + } + iValue++; + }; + + for (iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) { + if (format.charAt(iFormat) === "'" && !lookAhead("'")) { + literal = false; + } else { + checkLiteral(); + } + } else { + switch (format.charAt(iFormat)) { + case "d": + day = getNumber("d"); + break; + case "D": + getName("D", dayNamesShort, dayNames); + break; + case "o": + doy = getNumber("o"); + break; + case "m": + month = getNumber("m"); + break; + case "M": + month = getName("M", monthNamesShort, monthNames); + break; + case "y": + year = getNumber("y"); + break; + case "@": + date = new Date(getNumber("@")); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "!": + date = new Date((getNumber("!") - this._ticksTo1970) / 10000); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "'": + if (lookAhead("'")){ + checkLiteral(); + } else { + literal = true; + } + break; + default: + checkLiteral(); + } + } + } + + if (iValue < value.length){ + extra = value.substr(iValue); + if (!/^\s+/.test(extra)) { + throw "Extra/unparsed characters found in date: " + extra; + } + } + + if (year === -1) { + year = new Date().getFullYear(); + } else if (year < 100) { + year += new Date().getFullYear() - new Date().getFullYear() % 100 + + (year <= shortYearCutoff ? 0 : -100); + } + + if (doy > -1) { + month = 1; + day = doy; + do { + dim = this._getDaysInMonth(year, month - 1); + if (day <= dim) { + break; + } + month++; + day -= dim; + } while (true); + } + + date = this._daylightSavingAdjust(new Date(year, month - 1, day)); + if (date.getFullYear() !== year || date.getMonth() + 1 !== month || date.getDate() !== day) { + throw "Invalid date"; // E.g. 31/02/00 + } + return date; + }, + + /* Standard date formats. */ + ATOM: "yy-mm-dd", // RFC 3339 (ISO 8601) + COOKIE: "D, dd M yy", + ISO_8601: "yy-mm-dd", + RFC_822: "D, d M y", + RFC_850: "DD, dd-M-y", + RFC_1036: "D, d M y", + RFC_1123: "D, d M yy", + RFC_2822: "D, d M yy", + RSS: "D, d M y", // RFC 822 + TICKS: "!", + TIMESTAMP: "@", + W3C: "yy-mm-dd", // ISO 8601 + + _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + + Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), + + /* Format a date object into a string value. + * The format can be combinations of the following: + * d - day of month (no leading zero) + * dd - day of month (two digit) + * o - day of year (no leading zeros) + * oo - day of year (three digit) + * D - day name short + * DD - day name long + * m - month of year (no leading zero) + * mm - month of year (two digit) + * M - month name short + * MM - month name long + * y - year (two digit) + * yy - year (four digit) + * @ - Unix timestamp (ms since 01/01/1970) + * ! - Windows ticks (100ns since 01/01/0001) + * "..." - literal text + * '' - single quote + * + * @param format string - the desired format of the date + * @param date Date - the date value to format + * @param settings Object - attributes include: + * dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + * dayNames string[7] - names of the days from Sunday (optional) + * monthNamesShort string[12] - abbreviated names of the months (optional) + * monthNames string[12] - names of the months (optional) + * @return string - the date in the above format + */ + formatDate: function (format, date, settings) { + if (!date) { + return ""; + } + + var iFormat, + dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort, + dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames, + monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort, + monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames, + // Check whether a format character is doubled + lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match); + if (matches) { + iFormat++; + } + return matches; + }, + // Format a number, with leading zero if necessary + formatNumber = function(match, value, len) { + var num = "" + value; + if (lookAhead(match)) { + while (num.length < len) { + num = "0" + num; + } + } + return num; + }, + // Format a name, short or long as requested + formatName = function(match, value, shortNames, longNames) { + return (lookAhead(match) ? longNames[value] : shortNames[value]); + }, + output = "", + literal = false; + + if (date) { + for (iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) { + if (format.charAt(iFormat) === "'" && !lookAhead("'")) { + literal = false; + } else { + output += format.charAt(iFormat); + } + } else { + switch (format.charAt(iFormat)) { + case "d": + output += formatNumber("d", date.getDate(), 2); + break; + case "D": + output += formatName("D", date.getDay(), dayNamesShort, dayNames); + break; + case "o": + output += formatNumber("o", + Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3); + break; + case "m": + output += formatNumber("m", date.getMonth() + 1, 2); + break; + case "M": + output += formatName("M", date.getMonth(), monthNamesShort, monthNames); + break; + case "y": + output += (lookAhead("y") ? date.getFullYear() : + (date.getYear() % 100 < 10 ? "0" : "") + date.getYear() % 100); + break; + case "@": + output += date.getTime(); + break; + case "!": + output += date.getTime() * 10000 + this._ticksTo1970; + break; + case "'": + if (lookAhead("'")) { + output += "'"; + } else { + literal = true; + } + break; + default: + output += format.charAt(iFormat); + } + } + } + } + return output; + }, + + /* Extract all possible characters from the date format. */ + _possibleChars: function (format) { + var iFormat, + chars = "", + literal = false, + // Check whether a format character is doubled + lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match); + if (matches) { + iFormat++; + } + return matches; + }; + + for (iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) { + if (format.charAt(iFormat) === "'" && !lookAhead("'")) { + literal = false; + } else { + chars += format.charAt(iFormat); + } + } else { + switch (format.charAt(iFormat)) { + case "d": case "m": case "y": case "@": + chars += "0123456789"; + break; + case "D": case "M": + return null; // Accept anything + case "'": + if (lookAhead("'")) { + chars += "'"; + } else { + literal = true; + } + break; + default: + chars += format.charAt(iFormat); + } + } + } + return chars; + }, + + /* Get a setting value, defaulting if necessary. */ + _get: function(inst, name) { + return inst.settings[name] !== undefined ? + inst.settings[name] : this._defaults[name]; + }, + + /* Parse existing date and initialise date picker. */ + _setDateFromField: function(inst, noDefault) { + if (inst.input.val() === inst.lastVal) { + return; + } + + var dateFormat = this._get(inst, "dateFormat"), + dates = inst.lastVal = inst.input ? inst.input.val() : null, + defaultDate = this._getDefaultDate(inst), + date = defaultDate, + settings = this._getFormatConfig(inst); + + try { + date = this.parseDate(dateFormat, dates, settings) || defaultDate; + } catch (event) { + dates = (noDefault ? "" : dates); + } + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + inst.currentDay = (dates ? date.getDate() : 0); + inst.currentMonth = (dates ? date.getMonth() : 0); + inst.currentYear = (dates ? date.getFullYear() : 0); + this._adjustInstDate(inst); + }, + + /* Retrieve the default date shown on opening. */ + _getDefaultDate: function(inst) { + return this._restrictMinMax(inst, + this._determineDate(inst, this._get(inst, "defaultDate"), new Date())); + }, + + /* A date may be specified as an exact value or a relative one. */ + _determineDate: function(inst, date, defaultDate) { + var offsetNumeric = function(offset) { + var date = new Date(); + date.setDate(date.getDate() + offset); + return date; + }, + offsetString = function(offset) { + try { + return $.datepicker.parseDate($.datepicker._get(inst, "dateFormat"), + offset, $.datepicker._getFormatConfig(inst)); + } + catch (e) { + // Ignore + } + + var date = (offset.toLowerCase().match(/^c/) ? + $.datepicker._getDate(inst) : null) || new Date(), + year = date.getFullYear(), + month = date.getMonth(), + day = date.getDate(), + pattern = /([+\-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g, + matches = pattern.exec(offset); + + while (matches) { + switch (matches[2] || "d") { + case "d" : case "D" : + day += parseInt(matches[1],10); break; + case "w" : case "W" : + day += parseInt(matches[1],10) * 7; break; + case "m" : case "M" : + month += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + case "y": case "Y" : + year += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + } + matches = pattern.exec(offset); + } + return new Date(year, month, day); + }, + newDate = (date == null || date === "" ? defaultDate : (typeof date === "string" ? offsetString(date) : + (typeof date === "number" ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime())))); + + newDate = (newDate && newDate.toString() === "Invalid Date" ? defaultDate : newDate); + if (newDate) { + newDate.setHours(0); + newDate.setMinutes(0); + newDate.setSeconds(0); + newDate.setMilliseconds(0); + } + return this._daylightSavingAdjust(newDate); + }, + + /* Handle switch to/from daylight saving. + * Hours may be non-zero on daylight saving cut-over: + * > 12 when midnight changeover, but then cannot generate + * midnight datetime, so jump to 1AM, otherwise reset. + * @param date (Date) the date to check + * @return (Date) the corrected date + */ + _daylightSavingAdjust: function(date) { + if (!date) { + return null; + } + date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); + return date; + }, + + /* Set the date(s) directly. */ + _setDate: function(inst, date, noChange) { + var clear = !date, + origMonth = inst.selectedMonth, + origYear = inst.selectedYear, + newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); + + inst.selectedDay = inst.currentDay = newDate.getDate(); + inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); + inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); + if ((origMonth !== inst.selectedMonth || origYear !== inst.selectedYear) && !noChange) { + this._notifyChange(inst); + } + this._adjustInstDate(inst); + if (inst.input) { + inst.input.val(clear ? "" : this._formatDate(inst)); + } + }, + + /* Retrieve the date(s) directly. */ + _getDate: function(inst) { + var startDate = (!inst.currentYear || (inst.input && inst.input.val() === "") ? null : + this._daylightSavingAdjust(new Date( + inst.currentYear, inst.currentMonth, inst.currentDay))); + return startDate; + }, + + /* Attach the onxxx handlers. These are declared statically so + * they work with static code transformers like Caja. + */ + _attachHandlers: function(inst) { + var stepMonths = this._get(inst, "stepMonths"), + id = "#" + inst.id.replace( /\\\\/g, "\\" ); + inst.dpDiv.find("[data-handler]").map(function () { + var handler = { + prev: function () { + window["DP_jQuery_" + dpuuid].datepicker._adjustDate(id, -stepMonths, "M"); + }, + next: function () { + window["DP_jQuery_" + dpuuid].datepicker._adjustDate(id, +stepMonths, "M"); + }, + hide: function () { + window["DP_jQuery_" + dpuuid].datepicker._hideDatepicker(); + }, + today: function () { + window["DP_jQuery_" + dpuuid].datepicker._gotoToday(id); + }, + selectDay: function () { + window["DP_jQuery_" + dpuuid].datepicker._selectDay(id, +this.getAttribute("data-month"), +this.getAttribute("data-year"), this); + return false; + }, + selectMonth: function () { + window["DP_jQuery_" + dpuuid].datepicker._selectMonthYear(id, this, "M"); + return false; + }, + selectYear: function () { + window["DP_jQuery_" + dpuuid].datepicker._selectMonthYear(id, this, "Y"); + return false; + } + }; + $(this).bind(this.getAttribute("data-event"), handler[this.getAttribute("data-handler")]); + }); + }, + + /* Generate the HTML for the current state of the date picker. */ + _generateHTML: function(inst) { + var maxDraw, prevText, prev, nextText, next, currentText, gotoDate, + controls, buttonPanel, firstDay, showWeek, dayNames, dayNamesMin, + monthNames, monthNamesShort, beforeShowDay, showOtherMonths, + selectOtherMonths, defaultDate, html, dow, row, group, col, selectedDate, + cornerClass, calender, thead, day, daysInMonth, leadDays, curRows, numRows, + printDate, dRow, tbody, daySettings, otherMonth, unselectable, + tempDate = new Date(), + today = this._daylightSavingAdjust( + new Date(tempDate.getFullYear(), tempDate.getMonth(), tempDate.getDate())), // clear time + isRTL = this._get(inst, "isRTL"), + showButtonPanel = this._get(inst, "showButtonPanel"), + hideIfNoPrevNext = this._get(inst, "hideIfNoPrevNext"), + navigationAsDateFormat = this._get(inst, "navigationAsDateFormat"), + numMonths = this._getNumberOfMonths(inst), + showCurrentAtPos = this._get(inst, "showCurrentAtPos"), + stepMonths = this._get(inst, "stepMonths"), + isMultiMonth = (numMonths[0] !== 1 || numMonths[1] !== 1), + currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : + new Date(inst.currentYear, inst.currentMonth, inst.currentDay))), + minDate = this._getMinMaxDate(inst, "min"), + maxDate = this._getMinMaxDate(inst, "max"), + drawMonth = inst.drawMonth - showCurrentAtPos, + drawYear = inst.drawYear; + + if (drawMonth < 0) { + drawMonth += 12; + drawYear--; + } + if (maxDate) { + maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), + maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); + maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); + while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { + drawMonth--; + if (drawMonth < 0) { + drawMonth = 11; + drawYear--; + } + } + } + inst.drawMonth = drawMonth; + inst.drawYear = drawYear; + + prevText = this._get(inst, "prevText"); + prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), + this._getFormatConfig(inst))); + + prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? + "" + prevText + "" : + (hideIfNoPrevNext ? "" : "" + prevText + "")); + + nextText = this._get(inst, "nextText"); + nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), + this._getFormatConfig(inst))); + + next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? + "" + nextText + "" : + (hideIfNoPrevNext ? "" : "" + nextText + "")); + + currentText = this._get(inst, "currentText"); + gotoDate = (this._get(inst, "gotoCurrent") && inst.currentDay ? currentDate : today); + currentText = (!navigationAsDateFormat ? currentText : + this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); + + controls = (!inst.inline ? "" : ""); + + buttonPanel = (showButtonPanel) ? "
      " + (isRTL ? controls : "") + + (this._isInRange(inst, gotoDate) ? "" : "") + (isRTL ? "" : controls) + "
      " : ""; + + firstDay = parseInt(this._get(inst, "firstDay"),10); + firstDay = (isNaN(firstDay) ? 0 : firstDay); + + showWeek = this._get(inst, "showWeek"); + dayNames = this._get(inst, "dayNames"); + dayNamesMin = this._get(inst, "dayNamesMin"); + monthNames = this._get(inst, "monthNames"); + monthNamesShort = this._get(inst, "monthNamesShort"); + beforeShowDay = this._get(inst, "beforeShowDay"); + showOtherMonths = this._get(inst, "showOtherMonths"); + selectOtherMonths = this._get(inst, "selectOtherMonths"); + defaultDate = this._getDefaultDate(inst); + html = ""; + dow; + for (row = 0; row < numMonths[0]; row++) { + group = ""; + this.maxRows = 4; + for (col = 0; col < numMonths[1]; col++) { + selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); + cornerClass = " ui-corner-all"; + calender = ""; + if (isMultiMonth) { + calender += "
      "; + } + calender += "
      " + + (/all|left/.test(cornerClass) && row === 0 ? (isRTL ? next : prev) : "") + + (/all|right/.test(cornerClass) && row === 0 ? (isRTL ? prev : next) : "") + + this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, + row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers + "
      " + + ""; + thead = (showWeek ? "" : ""); + for (dow = 0; dow < 7; dow++) { // days of the week + day = (dow + firstDay) % 7; + thead += "= 5 ? " class='ui-datepicker-week-end'" : "") + ">" + + "" + dayNamesMin[day] + ""; + } + calender += thead + ""; + daysInMonth = this._getDaysInMonth(drawYear, drawMonth); + if (drawYear === inst.selectedYear && drawMonth === inst.selectedMonth) { + inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); + } + leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; + curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate + numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043) + this.maxRows = numRows; + printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); + for (dRow = 0; dRow < numRows; dRow++) { // create date picker rows + calender += ""; + tbody = (!showWeek ? "" : ""); + for (dow = 0; dow < 7; dow++) { // create date picker days + daySettings = (beforeShowDay ? + beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, ""]); + otherMonth = (printDate.getMonth() !== drawMonth); + unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || + (minDate && printDate < minDate) || (maxDate && printDate > maxDate); + tbody += ""; // display selectable date + printDate.setDate(printDate.getDate() + 1); + printDate = this._daylightSavingAdjust(printDate); + } + calender += tbody + ""; + } + drawMonth++; + if (drawMonth > 11) { + drawMonth = 0; + drawYear++; + } + calender += "
      " + this._get(inst, "weekHeader") + "
      " + + this._get(inst, "calculateWeek")(printDate) + "" + // actions + (otherMonth && !showOtherMonths ? " " : // display for other months + (unselectable ? "" + printDate.getDate() + "" : "" + printDate.getDate() + "")) + "
      " + (isMultiMonth ? "
      " + + ((numMonths[0] > 0 && col === numMonths[1]-1) ? "
      " : "") : ""); + group += calender; + } + html += group; + } + html += buttonPanel; + inst._keyEvent = false; + return html; + }, + + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + secondary, monthNames, monthNamesShort) { + + var inMinYear, inMaxYear, month, years, thisYear, determineYear, year, endYear, + changeMonth = this._get(inst, "changeMonth"), + changeYear = this._get(inst, "changeYear"), + showMonthAfterYear = this._get(inst, "showMonthAfterYear"), + html = "
      ", + monthHtml = ""; + + // month selection + if (secondary || !changeMonth) { + monthHtml += "" + monthNames[drawMonth] + ""; + } else { + inMinYear = (minDate && minDate.getFullYear() === drawYear); + inMaxYear = (maxDate && maxDate.getFullYear() === drawYear); + monthHtml += ""; + } + + if (!showMonthAfterYear) { + html += monthHtml + (secondary || !(changeMonth && changeYear) ? " " : ""); + } + + // year selection + if ( !inst.yearshtml ) { + inst.yearshtml = ""; + if (secondary || !changeYear) { + html += "" + drawYear + ""; + } else { + // determine range of years to display + years = this._get(inst, "yearRange").split(":"); + thisYear = new Date().getFullYear(); + determineYear = function(value) { + var year = (value.match(/c[+\-].*/) ? drawYear + parseInt(value.substring(1), 10) : + (value.match(/[+\-].*/) ? thisYear + parseInt(value, 10) : + parseInt(value, 10))); + return (isNaN(year) ? thisYear : year); + }; + year = determineYear(years[0]); + endYear = Math.max(year, determineYear(years[1] || "")); + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + inst.yearshtml += ""; + + html += inst.yearshtml; + inst.yearshtml = null; + } + } + + html += this._get(inst, "yearSuffix"); + if (showMonthAfterYear) { + html += (secondary || !(changeMonth && changeYear) ? " " : "") + monthHtml; + } + html += "
      "; // Close datepicker_header + return html; + }, + + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period === "Y" ? offset : 0), + month = inst.drawMonth + (period === "M" ? offset : 0), + day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + (period === "D" ? offset : 0), + date = this._restrictMinMax(inst, this._daylightSavingAdjust(new Date(year, month, day))); + + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period === "M" || period === "Y") { + this._notifyChange(inst); + } + }, + + /* Ensure a date is within any min/max bounds. */ + _restrictMinMax: function(inst, date) { + var minDate = this._getMinMaxDate(inst, "min"), + maxDate = this._getMinMaxDate(inst, "max"), + newDate = (minDate && date < minDate ? minDate : date); + return (maxDate && newDate > maxDate ? maxDate : newDate); + }, + + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, "onChangeMonthYear"); + if (onChange) { + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); + } + }, + + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, "numberOfMonths"); + return (numMonths == null ? [1, 1] : (typeof numMonths === "number" ? [1, numMonths] : numMonths)); + }, + + /* Determine the current maximum date - ensure no time components are set. */ + _getMinMaxDate: function(inst, minMax) { + return this._determineDate(inst, this._get(inst, minMax + "Date"), null); + }, + + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate(); + }, + + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, + + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst), + date = this._daylightSavingAdjust(new Date(curYear, + curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); + + if (offset < 0) { + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + } + return this._isInRange(inst, date); + }, + + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + var yearSplit, currentYear, + minDate = this._getMinMaxDate(inst, "min"), + maxDate = this._getMinMaxDate(inst, "max"), + minYear = null, + maxYear = null, + years = this._get(inst, "yearRange"); + if (years){ + yearSplit = years.split(":"); + currentYear = new Date().getFullYear(); + minYear = parseInt(yearSplit[0], 10); + maxYear = parseInt(yearSplit[1], 10); + if ( yearSplit[0].match(/[+\-].*/) ) { + minYear += currentYear; + } + if ( yearSplit[1].match(/[+\-].*/) ) { + maxYear += currentYear; + } + } + + return ((!minDate || date.getTime() >= minDate.getTime()) && + (!maxDate || date.getTime() <= maxDate.getTime()) && + (!minYear || date.getFullYear() >= minYear) && + (!maxYear || date.getFullYear() <= maxYear)); + }, + + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, "shortYearCutoff"); + shortYearCutoff = (typeof shortYearCutoff !== "string" ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, "dayNamesShort"), dayNames: this._get(inst, "dayNames"), + monthNamesShort: this._get(inst, "monthNamesShort"), monthNames: this._get(inst, "monthNames")}; + }, + + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = (day ? (typeof day === "object" ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, "dateFormat"), date, this._getFormatConfig(inst)); + } +}); + +/* + * Bind hover events for datepicker elements. + * Done via delegate so the binding only occurs once in the lifetime of the parent div. + * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker. + */ +function bindHover(dpDiv) { + var selector = "button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a"; + return dpDiv.delegate(selector, "mouseout", function() { + $(this).removeClass("ui-state-hover"); + if (this.className.indexOf("ui-datepicker-prev") !== -1) { + $(this).removeClass("ui-datepicker-prev-hover"); + } + if (this.className.indexOf("ui-datepicker-next") !== -1) { + $(this).removeClass("ui-datepicker-next-hover"); + } + }) + .delegate(selector, "mouseover", function(){ + if (!$.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0])) { + $(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover"); + $(this).addClass("ui-state-hover"); + if (this.className.indexOf("ui-datepicker-prev") !== -1) { + $(this).addClass("ui-datepicker-prev-hover"); + } + if (this.className.indexOf("ui-datepicker-next") !== -1) { + $(this).addClass("ui-datepicker-next-hover"); + } + } + }); +} + +/* jQuery extend now ignores nulls! */ +function extendRemove(target, props) { + $.extend(target, props); + for (var name in props) { + if (props[name] == null) { + target[name] = props[name]; + } + } + return target; +} + +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ + + /* Verify an empty collection wasn't passed - Fixes #6976 */ + if ( !this.length ) { + return this; + } + + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick); + $.datepicker.initialized = true; + } + + /* Append datepicker main container to body if not exist. */ + if ($("#"+$.datepicker._mainDivId).length === 0) { + $("body").append($.datepicker.dpDiv); + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options === "string" && (options === "isDisabled" || options === "getDate" || options === "widget")) { + return $.datepicker["_" + options + "Datepicker"]. + apply($.datepicker, [this[0]].concat(otherArgs)); + } + if (options === "option" && arguments.length === 2 && typeof arguments[1] === "string") { + return $.datepicker["_" + options + "Datepicker"]. + apply($.datepicker, [this[0]].concat(otherArgs)); + } + return this.each(function() { + typeof options === "string" ? + $.datepicker["_" + options + "Datepicker"]. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.10.2"; + +// Workaround for #4055 +// Add another global to avoid noConflict issues with inline event handlers +window["DP_jQuery_" + dpuuid] = $; + +})(jQuery); + +(function( $, undefined ) { + +var sizeRelatedOptions = { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true + }, + resizableRelatedOptions = { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true + }; + +$.widget( "ui.dialog", { + version: "1.10.2", + options: { + appendTo: "body", + autoOpen: true, + buttons: [], + closeOnEscape: true, + closeText: "close", + dialogClass: "", + draggable: true, + hide: null, + height: "auto", + maxHeight: null, + maxWidth: null, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: "center", + at: "center", + of: window, + collision: "fit", + // Ensure the titlebar is always visible + using: function( pos ) { + var topOffset = $( this ).css( pos ).offset().top; + if ( topOffset < 0 ) { + $( this ).css( "top", pos.top - topOffset ); + } + } + }, + resizable: true, + show: null, + title: null, + width: 300, + + // callbacks + beforeClose: null, + close: null, + drag: null, + dragStart: null, + dragStop: null, + focus: null, + open: null, + resize: null, + resizeStart: null, + resizeStop: null + }, + + _create: function() { + this.originalCss = { + display: this.element[0].style.display, + width: this.element[0].style.width, + minHeight: this.element[0].style.minHeight, + maxHeight: this.element[0].style.maxHeight, + height: this.element[0].style.height + }; + this.originalPosition = { + parent: this.element.parent(), + index: this.element.parent().children().index( this.element ) + }; + this.originalTitle = this.element.attr("title"); + this.options.title = this.options.title || this.originalTitle; + + this._createWrapper(); + + this.element + .show() + .removeAttr("title") + .addClass("ui-dialog-content ui-widget-content") + .appendTo( this.uiDialog ); + + this._createTitlebar(); + this._createButtonPane(); + + if ( this.options.draggable && $.fn.draggable ) { + this._makeDraggable(); + } + if ( this.options.resizable && $.fn.resizable ) { + this._makeResizable(); + } + + this._isOpen = false; + }, + + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + _appendTo: function() { + var element = this.options.appendTo; + if ( element && (element.jquery || element.nodeType) ) { + return $( element ); + } + return this.document.find( element || "body" ).eq( 0 ); + }, + + _destroy: function() { + var next, + originalPosition = this.originalPosition; + + this._destroyOverlay(); + + this.element + .removeUniqueId() + .removeClass("ui-dialog-content ui-widget-content") + .css( this.originalCss ) + // Without detaching first, the following becomes really slow + .detach(); + + this.uiDialog.stop( true, true ).remove(); + + if ( this.originalTitle ) { + this.element.attr( "title", this.originalTitle ); + } + + next = originalPosition.parent.children().eq( originalPosition.index ); + // Don't try to place the dialog next to itself (#8613) + if ( next.length && next[0] !== this.element[0] ) { + next.before( this.element ); + } else { + originalPosition.parent.append( this.element ); + } + }, + + widget: function() { + return this.uiDialog; + }, + + disable: $.noop, + enable: $.noop, + + close: function( event ) { + var that = this; + + if ( !this._isOpen || this._trigger( "beforeClose", event ) === false ) { + return; + } + + this._isOpen = false; + this._destroyOverlay(); + + if ( !this.opener.filter(":focusable").focus().length ) { + // Hiding a focused element doesn't trigger blur in WebKit + // so in case we have nothing to focus on, explicitly blur the active element + // https://bugs.webkit.org/show_bug.cgi?id=47182 + $( this.document[0].activeElement ).blur(); + } + + this._hide( this.uiDialog, this.options.hide, function() { + that._trigger( "close", event ); + }); + }, + + isOpen: function() { + return this._isOpen; + }, + + moveToTop: function() { + this._moveToTop(); + }, + + _moveToTop: function( event, silent ) { + var moved = !!this.uiDialog.nextAll(":visible").insertBefore( this.uiDialog ).length; + if ( moved && !silent ) { + this._trigger( "focus", event ); + } + return moved; + }, + + open: function() { + var that = this; + if ( this._isOpen ) { + if ( this._moveToTop() ) { + this._focusTabbable(); + } + return; + } + + this._isOpen = true; + this.opener = $( this.document[0].activeElement ); + + this._size(); + this._position(); + this._createOverlay(); + this._moveToTop( null, true ); + this._show( this.uiDialog, this.options.show, function() { + that._focusTabbable(); + that._trigger("focus"); + }); + + this._trigger("open"); + }, + + _focusTabbable: function() { + // Set focus to the first match: + // 1. First element inside the dialog matching [autofocus] + // 2. Tabbable element inside the content element + // 3. Tabbable element inside the buttonpane + // 4. The close button + // 5. The dialog itself + var hasFocus = this.element.find("[autofocus]"); + if ( !hasFocus.length ) { + hasFocus = this.element.find(":tabbable"); + } + if ( !hasFocus.length ) { + hasFocus = this.uiDialogButtonPane.find(":tabbable"); + } + if ( !hasFocus.length ) { + hasFocus = this.uiDialogTitlebarClose.filter(":tabbable"); + } + if ( !hasFocus.length ) { + hasFocus = this.uiDialog; + } + hasFocus.eq( 0 ).focus(); + }, + + _keepFocus: function( event ) { + function checkFocus() { + var activeElement = this.document[0].activeElement, + isActive = this.uiDialog[0] === activeElement || + $.contains( this.uiDialog[0], activeElement ); + if ( !isActive ) { + this._focusTabbable(); + } + } + event.preventDefault(); + checkFocus.call( this ); + // support: IE + // IE <= 8 doesn't prevent moving focus even with event.preventDefault() + // so we check again later + this._delay( checkFocus ); + }, + + _createWrapper: function() { + this.uiDialog = $("
      ") + .addClass( "ui-dialog ui-widget ui-widget-content ui-corner-all ui-front " + + this.options.dialogClass ) + .hide() + .attr({ + // Setting tabIndex makes the div focusable + tabIndex: -1, + role: "dialog" + }) + .appendTo( this._appendTo() ); + + this._on( this.uiDialog, { + keydown: function( event ) { + if ( this.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE ) { + event.preventDefault(); + this.close( event ); + return; + } + + // prevent tabbing out of dialogs + if ( event.keyCode !== $.ui.keyCode.TAB ) { + return; + } + var tabbables = this.uiDialog.find(":tabbable"), + first = tabbables.filter(":first"), + last = tabbables.filter(":last"); + + if ( ( event.target === last[0] || event.target === this.uiDialog[0] ) && !event.shiftKey ) { + first.focus( 1 ); + event.preventDefault(); + } else if ( ( event.target === first[0] || event.target === this.uiDialog[0] ) && event.shiftKey ) { + last.focus( 1 ); + event.preventDefault(); + } + }, + mousedown: function( event ) { + if ( this._moveToTop( event ) ) { + this._focusTabbable(); + } + } + }); + + // We assume that any existing aria-describedby attribute means + // that the dialog content is marked up properly + // otherwise we brute force the content as the description + if ( !this.element.find("[aria-describedby]").length ) { + this.uiDialog.attr({ + "aria-describedby": this.element.uniqueId().attr("id") + }); + } + }, + + _createTitlebar: function() { + var uiDialogTitle; + + this.uiDialogTitlebar = $("
      ") + .addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix") + .prependTo( this.uiDialog ); + this._on( this.uiDialogTitlebar, { + mousedown: function( event ) { + // Don't prevent click on close button (#8838) + // Focusing a dialog that is partially scrolled out of view + // causes the browser to scroll it into view, preventing the click event + if ( !$( event.target ).closest(".ui-dialog-titlebar-close") ) { + // Dialog isn't getting focus when dragging (#8063) + this.uiDialog.focus(); + } + } + }); + + this.uiDialogTitlebarClose = $("") + .button({ + label: this.options.closeText, + icons: { + primary: "ui-icon-closethick" + }, + text: false + }) + .addClass("ui-dialog-titlebar-close") + .appendTo( this.uiDialogTitlebar ); + this._on( this.uiDialogTitlebarClose, { + click: function( event ) { + event.preventDefault(); + this.close( event ); + } + }); + + uiDialogTitle = $("") + .uniqueId() + .addClass("ui-dialog-title") + .prependTo( this.uiDialogTitlebar ); + this._title( uiDialogTitle ); + + this.uiDialog.attr({ + "aria-labelledby": uiDialogTitle.attr("id") + }); + }, + + _title: function( title ) { + if ( !this.options.title ) { + title.html(" "); + } + title.text( this.options.title ); + }, + + _createButtonPane: function() { + this.uiDialogButtonPane = $("
      ") + .addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"); + + this.uiButtonSet = $("
      ") + .addClass("ui-dialog-buttonset") + .appendTo( this.uiDialogButtonPane ); + + this._createButtons(); + }, + + _createButtons: function() { + var that = this, + buttons = this.options.buttons; + + // if we already have a button pane, remove it + this.uiDialogButtonPane.remove(); + this.uiButtonSet.empty(); + + if ( $.isEmptyObject( buttons ) || ($.isArray( buttons ) && !buttons.length) ) { + this.uiDialog.removeClass("ui-dialog-buttons"); + return; + } + + $.each( buttons, function( name, props ) { + var click, buttonOptions; + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + // Default to a non-submitting button + props = $.extend( { type: "button" }, props ); + // Change the context for the click callback to be the main element + click = props.click; + props.click = function() { + click.apply( that.element[0], arguments ); + }; + buttonOptions = { + icons: props.icons, + text: props.showText + }; + delete props.icons; + delete props.showText; + $( "", props ) + .button( buttonOptions ) + .appendTo( that.uiButtonSet ); + }); + this.uiDialog.addClass("ui-dialog-buttons"); + this.uiDialogButtonPane.appendTo( this.uiDialog ); + }, + + _makeDraggable: function() { + var that = this, + options = this.options; + + function filteredUi( ui ) { + return { + position: ui.position, + offset: ui.offset + }; + } + + this.uiDialog.draggable({ + cancel: ".ui-dialog-content, .ui-dialog-titlebar-close", + handle: ".ui-dialog-titlebar", + containment: "document", + start: function( event, ui ) { + $( this ).addClass("ui-dialog-dragging"); + that._blockFrames(); + that._trigger( "dragStart", event, filteredUi( ui ) ); + }, + drag: function( event, ui ) { + that._trigger( "drag", event, filteredUi( ui ) ); + }, + stop: function( event, ui ) { + options.position = [ + ui.position.left - that.document.scrollLeft(), + ui.position.top - that.document.scrollTop() + ]; + $( this ).removeClass("ui-dialog-dragging"); + that._unblockFrames(); + that._trigger( "dragStop", event, filteredUi( ui ) ); + } + }); + }, + + _makeResizable: function() { + var that = this, + options = this.options, + handles = options.resizable, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = this.uiDialog.css("position"), + resizeHandles = typeof handles === "string" ? + handles : + "n,e,s,w,se,sw,ne,nw"; + + function filteredUi( ui ) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; + } + + this.uiDialog.resizable({ + cancel: ".ui-dialog-content", + containment: "document", + alsoResize: this.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: this._minHeight(), + handles: resizeHandles, + start: function( event, ui ) { + $( this ).addClass("ui-dialog-resizing"); + that._blockFrames(); + that._trigger( "resizeStart", event, filteredUi( ui ) ); + }, + resize: function( event, ui ) { + that._trigger( "resize", event, filteredUi( ui ) ); + }, + stop: function( event, ui ) { + options.height = $( this ).height(); + options.width = $( this ).width(); + $( this ).removeClass("ui-dialog-resizing"); + that._unblockFrames(); + that._trigger( "resizeStop", event, filteredUi( ui ) ); + } + }) + .css( "position", position ); + }, + + _minHeight: function() { + var options = this.options; + + return options.height === "auto" ? + options.minHeight : + Math.min( options.minHeight, options.height ); + }, + + _position: function() { + // Need to show the dialog to get the actual offset in the position plugin + var isVisible = this.uiDialog.is(":visible"); + if ( !isVisible ) { + this.uiDialog.show(); + } + this.uiDialog.position( this.options.position ); + if ( !isVisible ) { + this.uiDialog.hide(); + } + }, + + _setOptions: function( options ) { + var that = this, + resize = false, + resizableOptions = {}; + + $.each( options, function( key, value ) { + that._setOption( key, value ); + + if ( key in sizeRelatedOptions ) { + resize = true; + } + if ( key in resizableRelatedOptions ) { + resizableOptions[ key ] = value; + } + }); + + if ( resize ) { + this._size(); + this._position(); + } + if ( this.uiDialog.is(":data(ui-resizable)") ) { + this.uiDialog.resizable( "option", resizableOptions ); + } + }, + + _setOption: function( key, value ) { + /*jshint maxcomplexity:15*/ + var isDraggable, isResizable, + uiDialog = this.uiDialog; + + if ( key === "dialogClass" ) { + uiDialog + .removeClass( this.options.dialogClass ) + .addClass( value ); + } + + if ( key === "disabled" ) { + return; + } + + this._super( key, value ); + + if ( key === "appendTo" ) { + this.uiDialog.appendTo( this._appendTo() ); + } + + if ( key === "buttons" ) { + this._createButtons(); + } + + if ( key === "closeText" ) { + this.uiDialogTitlebarClose.button({ + // Ensure that we always pass a string + label: "" + value + }); + } + + if ( key === "draggable" ) { + isDraggable = uiDialog.is(":data(ui-draggable)"); + if ( isDraggable && !value ) { + uiDialog.draggable("destroy"); + } + + if ( !isDraggable && value ) { + this._makeDraggable(); + } + } + + if ( key === "position" ) { + this._position(); + } + + if ( key === "resizable" ) { + // currently resizable, becoming non-resizable + isResizable = uiDialog.is(":data(ui-resizable)"); + if ( isResizable && !value ) { + uiDialog.resizable("destroy"); + } + + // currently resizable, changing handles + if ( isResizable && typeof value === "string" ) { + uiDialog.resizable( "option", "handles", value ); + } + + // currently non-resizable, becoming resizable + if ( !isResizable && value !== false ) { + this._makeResizable(); + } + } + + if ( key === "title" ) { + this._title( this.uiDialogTitlebar.find(".ui-dialog-title") ); + } + }, + + _size: function() { + // If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + // divs will both have width and height set, so we need to reset them + var nonContentHeight, minContentHeight, maxContentHeight, + options = this.options; + + // Reset content sizing + this.element.show().css({ + width: "auto", + minHeight: 0, + maxHeight: "none", + height: 0 + }); + + if ( options.minWidth > options.width ) { + options.width = options.minWidth; + } + + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: "auto", + width: options.width + }) + .outerHeight(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + maxContentHeight = typeof options.maxHeight === "number" ? + Math.max( 0, options.maxHeight - nonContentHeight ) : + "none"; + + if ( options.height === "auto" ) { + this.element.css({ + minHeight: minContentHeight, + maxHeight: maxContentHeight, + height: "auto" + }); + } else { + this.element.height( Math.max( 0, options.height - nonContentHeight ) ); + } + + if (this.uiDialog.is(":data(ui-resizable)") ) { + this.uiDialog.resizable( "option", "minHeight", this._minHeight() ); + } + }, + + _blockFrames: function() { + this.iframeBlocks = this.document.find( "iframe" ).map(function() { + var iframe = $( this ); + + return $( "
      " ) + .css({ + position: "absolute", + width: iframe.outerWidth(), + height: iframe.outerHeight() + }) + .appendTo( iframe.parent() ) + .offset( iframe.offset() )[0]; + }); + }, + + _unblockFrames: function() { + if ( this.iframeBlocks ) { + this.iframeBlocks.remove(); + delete this.iframeBlocks; + } + }, + + _allowInteraction: function( event ) { + if ( $( event.target ).closest(".ui-dialog").length ) { + return true; + } + + // TODO: Remove hack when datepicker implements + // the .ui-front logic (#8989) + return !!$( event.target ).closest(".ui-datepicker").length; + }, + + _createOverlay: function() { + if ( !this.options.modal ) { + return; + } + + var that = this, + widgetFullName = this.widgetFullName; + if ( !$.ui.dialog.overlayInstances ) { + // Prevent use of anchors and inputs. + // We use a delay in case the overlay is created from an + // event that we're going to be cancelling. (#2804) + this._delay(function() { + // Handle .dialog().dialog("close") (#4065) + if ( $.ui.dialog.overlayInstances ) { + this.document.bind( "focusin.dialog", function( event ) { + if ( !that._allowInteraction( event ) ) { + event.preventDefault(); + $(".ui-dialog:visible:last .ui-dialog-content") + .data( widgetFullName )._focusTabbable(); + } + }); + } + }); + } + + this.overlay = $("
      ") + .addClass("ui-widget-overlay ui-front") + .appendTo( this._appendTo() ); + this._on( this.overlay, { + mousedown: "_keepFocus" + }); + $.ui.dialog.overlayInstances++; + }, + + _destroyOverlay: function() { + if ( !this.options.modal ) { + return; + } + + if ( this.overlay ) { + $.ui.dialog.overlayInstances--; + + if ( !$.ui.dialog.overlayInstances ) { + this.document.unbind( "focusin.dialog" ); + } + this.overlay.remove(); + this.overlay = null; + } + } +}); + +$.ui.dialog.overlayInstances = 0; + +// DEPRECATED +if ( $.uiBackCompat !== false ) { + // position option with array notation + // just override with old implementation + $.widget( "ui.dialog", $.ui.dialog, { + _position: function() { + var position = this.options.position, + myAt = [], + offset = [ 0, 0 ], + isVisible; + + if ( position ) { + if ( typeof position === "string" || (typeof position === "object" && "0" in position ) ) { + myAt = position.split ? position.split(" ") : [ position[0], position[1] ]; + if ( myAt.length === 1 ) { + myAt[1] = myAt[0]; + } + + $.each( [ "left", "top" ], function( i, offsetPosition ) { + if ( +myAt[ i ] === myAt[ i ] ) { + offset[ i ] = myAt[ i ]; + myAt[ i ] = offsetPosition; + } + }); + + position = { + my: myAt[0] + (offset[0] < 0 ? offset[0] : "+" + offset[0]) + " " + + myAt[1] + (offset[1] < 0 ? offset[1] : "+" + offset[1]), + at: myAt.join(" ") + }; + } + + position = $.extend( {}, $.ui.dialog.prototype.options.position, position ); + } else { + position = $.ui.dialog.prototype.options.position; + } + + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is(":visible"); + if ( !isVisible ) { + this.uiDialog.show(); + } + this.uiDialog.position( position ); + if ( !isVisible ) { + this.uiDialog.hide(); + } + } + }); +} + +}( jQuery ) ); + +(function( $, undefined ) { + +var rvertical = /up|down|vertical/, + rpositivemotion = /up|left|vertical|horizontal/; + +$.effects.effect.blind = function( o, done ) { + // Create element + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "height", "width" ], + mode = $.effects.setMode( el, o.mode || "hide" ), + direction = o.direction || "up", + vertical = rvertical.test( direction ), + ref = vertical ? "height" : "width", + ref2 = vertical ? "top" : "left", + motion = rpositivemotion.test( direction ), + animation = {}, + show = mode === "show", + wrapper, distance, margin; + + // if already wrapped, the wrapper's properties are my property. #6245 + if ( el.parent().is( ".ui-effects-wrapper" ) ) { + $.effects.save( el.parent(), props ); + } else { + $.effects.save( el, props ); + } + el.show(); + wrapper = $.effects.createWrapper( el ).css({ + overflow: "hidden" + }); + + distance = wrapper[ ref ](); + margin = parseFloat( wrapper.css( ref2 ) ) || 0; + + animation[ ref ] = show ? distance : 0; + if ( !motion ) { + el + .css( vertical ? "bottom" : "right", 0 ) + .css( vertical ? "top" : "left", "auto" ) + .css({ position: "absolute" }); + + animation[ ref2 ] = show ? margin : distance + margin; + } + + // start at 0 if we are showing + if ( show ) { + wrapper.css( ref, 0 ); + if ( ! motion ) { + wrapper.css( ref2, margin + distance ); + } + } + + // Animate + wrapper.animate( animation, { + duration: o.duration, + easing: o.easing, + queue: false, + complete: function() { + if ( mode === "hide" ) { + el.hide(); + } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); + } + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.effect.bounce = function( o, done ) { + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "height", "width" ], + + // defaults: + mode = $.effects.setMode( el, o.mode || "effect" ), + hide = mode === "hide", + show = mode === "show", + direction = o.direction || "up", + distance = o.distance, + times = o.times || 5, + + // number of internal animations + anims = times * 2 + ( show || hide ? 1 : 0 ), + speed = o.duration / anims, + easing = o.easing, + + // utility: + ref = ( direction === "up" || direction === "down" ) ? "top" : "left", + motion = ( direction === "up" || direction === "left" ), + i, + upAnim, + downAnim, + + // we will need to re-assemble the queue to stack our animations in place + queue = el.queue(), + queuelen = queue.length; + + // Avoid touching opacity to prevent clearType and PNG issues in IE + if ( show || hide ) { + props.push( "opacity" ); + } + + $.effects.save( el, props ); + el.show(); + $.effects.createWrapper( el ); // Create Wrapper + + // default distance for the BIGGEST bounce is the outer Distance / 3 + if ( !distance ) { + distance = el[ ref === "top" ? "outerHeight" : "outerWidth" ]() / 3; + } + + if ( show ) { + downAnim = { opacity: 1 }; + downAnim[ ref ] = 0; + + // if we are showing, force opacity 0 and set the initial position + // then do the "first" animation + el.css( "opacity", 0 ) + .css( ref, motion ? -distance * 2 : distance * 2 ) + .animate( downAnim, speed, easing ); + } + + // start at the smallest distance if we are hiding + if ( hide ) { + distance = distance / Math.pow( 2, times - 1 ); + } + + downAnim = {}; + downAnim[ ref ] = 0; + // Bounces up/down/left/right then back to 0 -- times * 2 animations happen here + for ( i = 0; i < times; i++ ) { + upAnim = {}; + upAnim[ ref ] = ( motion ? "-=" : "+=" ) + distance; + + el.animate( upAnim, speed, easing ) + .animate( downAnim, speed, easing ); + + distance = hide ? distance * 2 : distance / 2; + } + + // Last Bounce when Hiding + if ( hide ) { + upAnim = { opacity: 0 }; + upAnim[ ref ] = ( motion ? "-=" : "+=" ) + distance; + + el.animate( upAnim, speed, easing ); + } + + el.queue(function() { + if ( hide ) { + el.hide(); + } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); + }); + + // inject all the animations we just queued to be first in line (after "inprogress") + if ( queuelen > 1) { + queue.splice.apply( queue, + [ 1, 0 ].concat( queue.splice( queuelen, anims + 1 ) ) ); + } + el.dequeue(); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.effect.clip = function( o, done ) { + // Create element + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "height", "width" ], + mode = $.effects.setMode( el, o.mode || "hide" ), + show = mode === "show", + direction = o.direction || "vertical", + vert = direction === "vertical", + size = vert ? "height" : "width", + position = vert ? "top" : "left", + animation = {}, + wrapper, animate, distance; + + // Save & Show + $.effects.save( el, props ); + el.show(); + + // Create Wrapper + wrapper = $.effects.createWrapper( el ).css({ + overflow: "hidden" + }); + animate = ( el[0].tagName === "IMG" ) ? wrapper : el; + distance = animate[ size ](); + + // Shift + if ( show ) { + animate.css( size, 0 ); + animate.css( position, distance / 2 ); + } + + // Create Animation Object: + animation[ size ] = show ? distance : 0; + animation[ position ] = show ? 0 : distance / 2; + + // Animate + animate.animate( animation, { + queue: false, + duration: o.duration, + easing: o.easing, + complete: function() { + if ( !show ) { + el.hide(); + } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); + } + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.effect.drop = function( o, done ) { + + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "opacity", "height", "width" ], + mode = $.effects.setMode( el, o.mode || "hide" ), + show = mode === "show", + direction = o.direction || "left", + ref = ( direction === "up" || direction === "down" ) ? "top" : "left", + motion = ( direction === "up" || direction === "left" ) ? "pos" : "neg", + animation = { + opacity: show ? 1 : 0 + }, + distance; + + // Adjust + $.effects.save( el, props ); + el.show(); + $.effects.createWrapper( el ); + + distance = o.distance || el[ ref === "top" ? "outerHeight": "outerWidth" ]( true ) / 2; + + if ( show ) { + el + .css( "opacity", 0 ) + .css( ref, motion === "pos" ? -distance : distance ); + } + + // Animation + animation[ ref ] = ( show ? + ( motion === "pos" ? "+=" : "-=" ) : + ( motion === "pos" ? "-=" : "+=" ) ) + + distance; + + // Animate + el.animate( animation, { + queue: false, + duration: o.duration, + easing: o.easing, + complete: function() { + if ( mode === "hide" ) { + el.hide(); + } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); + } + }); +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.effect.explode = function( o, done ) { + + var rows = o.pieces ? Math.round( Math.sqrt( o.pieces ) ) : 3, + cells = rows, + el = $( this ), + mode = $.effects.setMode( el, o.mode || "hide" ), + show = mode === "show", + + // show and then visibility:hidden the element before calculating offset + offset = el.show().css( "visibility", "hidden" ).offset(), + + // width and height of a piece + width = Math.ceil( el.outerWidth() / cells ), + height = Math.ceil( el.outerHeight() / rows ), + pieces = [], + + // loop + i, j, left, top, mx, my; + + // children animate complete: + function childComplete() { + pieces.push( this ); + if ( pieces.length === rows * cells ) { + animComplete(); + } + } + + // clone the element for each row and cell. + for( i = 0; i < rows ; i++ ) { // ===> + top = offset.top + i * height; + my = i - ( rows - 1 ) / 2 ; + + for( j = 0; j < cells ; j++ ) { // ||| + left = offset.left + j * width; + mx = j - ( cells - 1 ) / 2 ; + + // Create a clone of the now hidden main element that will be absolute positioned + // within a wrapper div off the -left and -top equal to size of our pieces + el + .clone() + .appendTo( "body" ) + .wrap( "
      " ) + .css({ + position: "absolute", + visibility: "visible", + left: -j * width, + top: -i * height + }) + + // select the wrapper - make it overflow: hidden and absolute positioned based on + // where the original was located +left and +top equal to the size of pieces + .parent() + .addClass( "ui-effects-explode" ) + .css({ + position: "absolute", + overflow: "hidden", + width: width, + height: height, + left: left + ( show ? mx * width : 0 ), + top: top + ( show ? my * height : 0 ), + opacity: show ? 0 : 1 + }).animate({ + left: left + ( show ? 0 : mx * width ), + top: top + ( show ? 0 : my * height ), + opacity: show ? 1 : 0 + }, o.duration || 500, o.easing, childComplete ); + } + } + + function animComplete() { + el.css({ + visibility: "visible" + }); + $( pieces ).remove(); + if ( !show ) { + el.hide(); + } + done(); + } +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.effect.fade = function( o, done ) { + var el = $( this ), + mode = $.effects.setMode( el, o.mode || "toggle" ); + + el.animate({ + opacity: mode + }, { + queue: false, + duration: o.duration, + easing: o.easing, + complete: done + }); +}; + +})( jQuery ); + +(function( $, undefined ) { + +$.effects.effect.fold = function( o, done ) { + + // Create element + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "height", "width" ], + mode = $.effects.setMode( el, o.mode || "hide" ), + show = mode === "show", + hide = mode === "hide", + size = o.size || 15, + percent = /([0-9]+)%/.exec( size ), + horizFirst = !!o.horizFirst, + widthFirst = show !== horizFirst, + ref = widthFirst ? [ "width", "height" ] : [ "height", "width" ], + duration = o.duration / 2, + wrapper, distance, + animation1 = {}, + animation2 = {}; + + $.effects.save( el, props ); + el.show(); + + // Create Wrapper + wrapper = $.effects.createWrapper( el ).css({ + overflow: "hidden" + }); + distance = widthFirst ? + [ wrapper.width(), wrapper.height() ] : + [ wrapper.height(), wrapper.width() ]; + + if ( percent ) { + size = parseInt( percent[ 1 ], 10 ) / 100 * distance[ hide ? 0 : 1 ]; + } + if ( show ) { + wrapper.css( horizFirst ? { + height: 0, + width: size + } : { + height: size, + width: 0 + }); + } + + // Animation + animation1[ ref[ 0 ] ] = show ? distance[ 0 ] : size; + animation2[ ref[ 1 ] ] = show ? distance[ 1 ] : 0; + + // Animate + wrapper + .animate( animation1, duration, o.easing ) + .animate( animation2, duration, o.easing, function() { + if ( hide ) { + el.hide(); + } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.effect.highlight = function( o, done ) { + var elem = $( this ), + props = [ "backgroundImage", "backgroundColor", "opacity" ], + mode = $.effects.setMode( elem, o.mode || "show" ), + animation = { + backgroundColor: elem.css( "backgroundColor" ) + }; + + if (mode === "hide") { + animation.opacity = 0; + } + + $.effects.save( elem, props ); + + elem + .show() + .css({ + backgroundImage: "none", + backgroundColor: o.color || "#ffff99" + }) + .animate( animation, { + queue: false, + duration: o.duration, + easing: o.easing, + complete: function() { + if ( mode === "hide" ) { + elem.hide(); + } + $.effects.restore( elem, props ); + done(); + } + }); +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.effect.pulsate = function( o, done ) { + var elem = $( this ), + mode = $.effects.setMode( elem, o.mode || "show" ), + show = mode === "show", + hide = mode === "hide", + showhide = ( show || mode === "hide" ), + + // showing or hiding leaves of the "last" animation + anims = ( ( o.times || 5 ) * 2 ) + ( showhide ? 1 : 0 ), + duration = o.duration / anims, + animateTo = 0, + queue = elem.queue(), + queuelen = queue.length, + i; + + if ( show || !elem.is(":visible")) { + elem.css( "opacity", 0 ).show(); + animateTo = 1; + } + + // anims - 1 opacity "toggles" + for ( i = 1; i < anims; i++ ) { + elem.animate({ + opacity: animateTo + }, duration, o.easing ); + animateTo = 1 - animateTo; + } + + elem.animate({ + opacity: animateTo + }, duration, o.easing); + + elem.queue(function() { + if ( hide ) { + elem.hide(); + } + done(); + }); + + // We just queued up "anims" animations, we need to put them next in the queue + if ( queuelen > 1 ) { + queue.splice.apply( queue, + [ 1, 0 ].concat( queue.splice( queuelen, anims + 1 ) ) ); + } + elem.dequeue(); +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.effect.puff = function( o, done ) { + var elem = $( this ), + mode = $.effects.setMode( elem, o.mode || "hide" ), + hide = mode === "hide", + percent = parseInt( o.percent, 10 ) || 150, + factor = percent / 100, + original = { + height: elem.height(), + width: elem.width(), + outerHeight: elem.outerHeight(), + outerWidth: elem.outerWidth() + }; + + $.extend( o, { + effect: "scale", + queue: false, + fade: true, + mode: mode, + complete: done, + percent: hide ? percent : 100, + from: hide ? + original : + { + height: original.height * factor, + width: original.width * factor, + outerHeight: original.outerHeight * factor, + outerWidth: original.outerWidth * factor + } + }); + + elem.effect( o ); +}; + +$.effects.effect.scale = function( o, done ) { + + // Create element + var el = $( this ), + options = $.extend( true, {}, o ), + mode = $.effects.setMode( el, o.mode || "effect" ), + percent = parseInt( o.percent, 10 ) || + ( parseInt( o.percent, 10 ) === 0 ? 0 : ( mode === "hide" ? 0 : 100 ) ), + direction = o.direction || "both", + origin = o.origin, + original = { + height: el.height(), + width: el.width(), + outerHeight: el.outerHeight(), + outerWidth: el.outerWidth() + }, + factor = { + y: direction !== "horizontal" ? (percent / 100) : 1, + x: direction !== "vertical" ? (percent / 100) : 1 + }; + + // We are going to pass this effect to the size effect: + options.effect = "size"; + options.queue = false; + options.complete = done; + + // Set default origin and restore for show/hide + if ( mode !== "effect" ) { + options.origin = origin || ["middle","center"]; + options.restore = true; + } + + options.from = o.from || ( mode === "show" ? { + height: 0, + width: 0, + outerHeight: 0, + outerWidth: 0 + } : original ); + options.to = { + height: original.height * factor.y, + width: original.width * factor.x, + outerHeight: original.outerHeight * factor.y, + outerWidth: original.outerWidth * factor.x + }; + + // Fade option to support puff + if ( options.fade ) { + if ( mode === "show" ) { + options.from.opacity = 0; + options.to.opacity = 1; + } + if ( mode === "hide" ) { + options.from.opacity = 1; + options.to.opacity = 0; + } + } + + // Animate + el.effect( options ); + +}; + +$.effects.effect.size = function( o, done ) { + + // Create element + var original, baseline, factor, + el = $( this ), + props0 = [ "position", "top", "bottom", "left", "right", "width", "height", "overflow", "opacity" ], + + // Always restore + props1 = [ "position", "top", "bottom", "left", "right", "overflow", "opacity" ], + + // Copy for children + props2 = [ "width", "height", "overflow" ], + cProps = [ "fontSize" ], + vProps = [ "borderTopWidth", "borderBottomWidth", "paddingTop", "paddingBottom" ], + hProps = [ "borderLeftWidth", "borderRightWidth", "paddingLeft", "paddingRight" ], + + // Set options + mode = $.effects.setMode( el, o.mode || "effect" ), + restore = o.restore || mode !== "effect", + scale = o.scale || "both", + origin = o.origin || [ "middle", "center" ], + position = el.css( "position" ), + props = restore ? props0 : props1, + zero = { + height: 0, + width: 0, + outerHeight: 0, + outerWidth: 0 + }; + + if ( mode === "show" ) { + el.show(); + } + original = { + height: el.height(), + width: el.width(), + outerHeight: el.outerHeight(), + outerWidth: el.outerWidth() + }; + + if ( o.mode === "toggle" && mode === "show" ) { + el.from = o.to || zero; + el.to = o.from || original; + } else { + el.from = o.from || ( mode === "show" ? zero : original ); + el.to = o.to || ( mode === "hide" ? zero : original ); + } + + // Set scaling factor + factor = { + from: { + y: el.from.height / original.height, + x: el.from.width / original.width + }, + to: { + y: el.to.height / original.height, + x: el.to.width / original.width + } + }; + + // Scale the css box + if ( scale === "box" || scale === "both" ) { + + // Vertical props scaling + if ( factor.from.y !== factor.to.y ) { + props = props.concat( vProps ); + el.from = $.effects.setTransition( el, vProps, factor.from.y, el.from ); + el.to = $.effects.setTransition( el, vProps, factor.to.y, el.to ); + } + + // Horizontal props scaling + if ( factor.from.x !== factor.to.x ) { + props = props.concat( hProps ); + el.from = $.effects.setTransition( el, hProps, factor.from.x, el.from ); + el.to = $.effects.setTransition( el, hProps, factor.to.x, el.to ); + } + } + + // Scale the content + if ( scale === "content" || scale === "both" ) { + + // Vertical props scaling + if ( factor.from.y !== factor.to.y ) { + props = props.concat( cProps ).concat( props2 ); + el.from = $.effects.setTransition( el, cProps, factor.from.y, el.from ); + el.to = $.effects.setTransition( el, cProps, factor.to.y, el.to ); + } + } + + $.effects.save( el, props ); + el.show(); + $.effects.createWrapper( el ); + el.css( "overflow", "hidden" ).css( el.from ); + + // Adjust + if (origin) { // Calculate baseline shifts + baseline = $.effects.getBaseline( origin, original ); + el.from.top = ( original.outerHeight - el.outerHeight() ) * baseline.y; + el.from.left = ( original.outerWidth - el.outerWidth() ) * baseline.x; + el.to.top = ( original.outerHeight - el.to.outerHeight ) * baseline.y; + el.to.left = ( original.outerWidth - el.to.outerWidth ) * baseline.x; + } + el.css( el.from ); // set top & left + + // Animate + if ( scale === "content" || scale === "both" ) { // Scale the children + + // Add margins/font-size + vProps = vProps.concat([ "marginTop", "marginBottom" ]).concat(cProps); + hProps = hProps.concat([ "marginLeft", "marginRight" ]); + props2 = props0.concat(vProps).concat(hProps); + + el.find( "*[width]" ).each( function(){ + var child = $( this ), + c_original = { + height: child.height(), + width: child.width(), + outerHeight: child.outerHeight(), + outerWidth: child.outerWidth() + }; + if (restore) { + $.effects.save(child, props2); + } + + child.from = { + height: c_original.height * factor.from.y, + width: c_original.width * factor.from.x, + outerHeight: c_original.outerHeight * factor.from.y, + outerWidth: c_original.outerWidth * factor.from.x + }; + child.to = { + height: c_original.height * factor.to.y, + width: c_original.width * factor.to.x, + outerHeight: c_original.height * factor.to.y, + outerWidth: c_original.width * factor.to.x + }; + + // Vertical props scaling + if ( factor.from.y !== factor.to.y ) { + child.from = $.effects.setTransition( child, vProps, factor.from.y, child.from ); + child.to = $.effects.setTransition( child, vProps, factor.to.y, child.to ); + } + + // Horizontal props scaling + if ( factor.from.x !== factor.to.x ) { + child.from = $.effects.setTransition( child, hProps, factor.from.x, child.from ); + child.to = $.effects.setTransition( child, hProps, factor.to.x, child.to ); + } + + // Animate children + child.css( child.from ); + child.animate( child.to, o.duration, o.easing, function() { + + // Restore children + if ( restore ) { + $.effects.restore( child, props2 ); + } + }); + }); + } + + // Animate + el.animate( el.to, { + queue: false, + duration: o.duration, + easing: o.easing, + complete: function() { + if ( el.to.opacity === 0 ) { + el.css( "opacity", el.from.opacity ); + } + if( mode === "hide" ) { + el.hide(); + } + $.effects.restore( el, props ); + if ( !restore ) { + + // we need to calculate our new positioning based on the scaling + if ( position === "static" ) { + el.css({ + position: "relative", + top: el.to.top, + left: el.to.left + }); + } else { + $.each([ "top", "left" ], function( idx, pos ) { + el.css( pos, function( _, str ) { + var val = parseInt( str, 10 ), + toRef = idx ? el.to.left : el.to.top; + + // if original was "auto", recalculate the new value from wrapper + if ( str === "auto" ) { + return toRef + "px"; + } + + return val + toRef + "px"; + }); + }); + } + } + + $.effects.removeWrapper( el ); + done(); + } + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.effect.shake = function( o, done ) { + + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "height", "width" ], + mode = $.effects.setMode( el, o.mode || "effect" ), + direction = o.direction || "left", + distance = o.distance || 20, + times = o.times || 3, + anims = times * 2 + 1, + speed = Math.round(o.duration/anims), + ref = (direction === "up" || direction === "down") ? "top" : "left", + positiveMotion = (direction === "up" || direction === "left"), + animation = {}, + animation1 = {}, + animation2 = {}, + i, + + // we will need to re-assemble the queue to stack our animations in place + queue = el.queue(), + queuelen = queue.length; + + $.effects.save( el, props ); + el.show(); + $.effects.createWrapper( el ); + + // Animation + animation[ ref ] = ( positiveMotion ? "-=" : "+=" ) + distance; + animation1[ ref ] = ( positiveMotion ? "+=" : "-=" ) + distance * 2; + animation2[ ref ] = ( positiveMotion ? "-=" : "+=" ) + distance * 2; + + // Animate + el.animate( animation, speed, o.easing ); + + // Shakes + for ( i = 1; i < times; i++ ) { + el.animate( animation1, speed, o.easing ).animate( animation2, speed, o.easing ); + } + el + .animate( animation1, speed, o.easing ) + .animate( animation, speed / 2, o.easing ) + .queue(function() { + if ( mode === "hide" ) { + el.hide(); + } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); + }); + + // inject all the animations we just queued to be first in line (after "inprogress") + if ( queuelen > 1) { + queue.splice.apply( queue, + [ 1, 0 ].concat( queue.splice( queuelen, anims + 1 ) ) ); + } + el.dequeue(); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.effect.slide = function( o, done ) { + + // Create element + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "width", "height" ], + mode = $.effects.setMode( el, o.mode || "show" ), + show = mode === "show", + direction = o.direction || "left", + ref = (direction === "up" || direction === "down") ? "top" : "left", + positiveMotion = (direction === "up" || direction === "left"), + distance, + animation = {}; + + // Adjust + $.effects.save( el, props ); + el.show(); + distance = o.distance || el[ ref === "top" ? "outerHeight" : "outerWidth" ]( true ); + + $.effects.createWrapper( el ).css({ + overflow: "hidden" + }); + + if ( show ) { + el.css( ref, positiveMotion ? (isNaN(distance) ? "-" + distance : -distance) : distance ); + } + + // Animation + animation[ ref ] = ( show ? + ( positiveMotion ? "+=" : "-=") : + ( positiveMotion ? "-=" : "+=")) + + distance; + + // Animate + el.animate( animation, { + queue: false, + duration: o.duration, + easing: o.easing, + complete: function() { + if ( mode === "hide" ) { + el.hide(); + } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); + } + }); +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.effect.transfer = function( o, done ) { + var elem = $( this ), + target = $( o.to ), + targetFixed = target.css( "position" ) === "fixed", + body = $("body"), + fixTop = targetFixed ? body.scrollTop() : 0, + fixLeft = targetFixed ? body.scrollLeft() : 0, + endPosition = target.offset(), + animation = { + top: endPosition.top - fixTop , + left: endPosition.left - fixLeft , + height: target.innerHeight(), + width: target.innerWidth() + }, + startPosition = elem.offset(), + transfer = $( "
      " ) + .appendTo( document.body ) + .addClass( o.className ) + .css({ + top: startPosition.top - fixTop , + left: startPosition.left - fixLeft , + height: elem.innerHeight(), + width: elem.innerWidth(), + position: targetFixed ? "fixed" : "absolute" + }) + .animate( animation, o.duration, o.easing, function() { + transfer.remove(); + done(); + }); +}; + +})(jQuery); + +(function( $, undefined ) { + +$.widget( "ui.menu", { + version: "1.10.2", + defaultElement: "
        ", + delay: 300, + options: { + icons: { + submenu: "ui-icon-carat-1-e" + }, + menus: "ul", + position: { + my: "left top", + at: "right top" + }, + role: "menu", + + // callbacks + blur: null, + focus: null, + select: null + }, + + _create: function() { + this.activeMenu = this.element; + // flag used to prevent firing of the click handler + // as the event bubbles up through nested menus + this.mouseHandled = false; + this.element + .uniqueId() + .addClass( "ui-menu ui-widget ui-widget-content ui-corner-all" ) + .toggleClass( "ui-menu-icons", !!this.element.find( ".ui-icon" ).length ) + .attr({ + role: this.options.role, + tabIndex: 0 + }) + // need to catch all clicks on disabled menu + // not possible through _on + .bind( "click" + this.eventNamespace, $.proxy(function( event ) { + if ( this.options.disabled ) { + event.preventDefault(); + } + }, this )); + + if ( this.options.disabled ) { + this.element + .addClass( "ui-state-disabled" ) + .attr( "aria-disabled", "true" ); + } + + this._on({ + // Prevent focus from sticking to links inside menu after clicking + // them (focus should always stay on UL during navigation). + "mousedown .ui-menu-item > a": function( event ) { + event.preventDefault(); + }, + "click .ui-state-disabled > a": function( event ) { + event.preventDefault(); + }, + "click .ui-menu-item:has(a)": function( event ) { + var target = $( event.target ).closest( ".ui-menu-item" ); + if ( !this.mouseHandled && target.not( ".ui-state-disabled" ).length ) { + this.mouseHandled = true; + + this.select( event ); + // Open submenu on click + if ( target.has( ".ui-menu" ).length ) { + this.expand( event ); + } else if ( !this.element.is( ":focus" ) ) { + // Redirect focus to the menu + this.element.trigger( "focus", [ true ] ); + + // If the active item is on the top level, let it stay active. + // Otherwise, blur the active item since it is no longer visible. + if ( this.active && this.active.parents( ".ui-menu" ).length === 1 ) { + clearTimeout( this.timer ); + } + } + } + }, + "mouseenter .ui-menu-item": function( event ) { + var target = $( event.currentTarget ); + // Remove ui-state-active class from siblings of the newly focused menu item + // to avoid a jump caused by adjacent elements both having a class with a border + target.siblings().children( ".ui-state-active" ).removeClass( "ui-state-active" ); + this.focus( event, target ); + }, + mouseleave: "collapseAll", + "mouseleave .ui-menu": "collapseAll", + focus: function( event, keepActiveItem ) { + // If there's already an active item, keep it active + // If not, activate the first item + var item = this.active || this.element.children( ".ui-menu-item" ).eq( 0 ); + + if ( !keepActiveItem ) { + this.focus( event, item ); + } + }, + blur: function( event ) { + this._delay(function() { + if ( !$.contains( this.element[0], this.document[0].activeElement ) ) { + this.collapseAll( event ); + } + }); + }, + keydown: "_keydown" + }); + + this.refresh(); + + // Clicks outside of a menu collapse any open menus + this._on( this.document, { + click: function( event ) { + if ( !$( event.target ).closest( ".ui-menu" ).length ) { + this.collapseAll( event ); + } + + // Reset the mouseHandled flag + this.mouseHandled = false; + } + }); + }, + + _destroy: function() { + // Destroy (sub)menus + this.element + .removeAttr( "aria-activedescendant" ) + .find( ".ui-menu" ).addBack() + .removeClass( "ui-menu ui-widget ui-widget-content ui-corner-all ui-menu-icons" ) + .removeAttr( "role" ) + .removeAttr( "tabIndex" ) + .removeAttr( "aria-labelledby" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "aria-hidden" ) + .removeAttr( "aria-disabled" ) + .removeUniqueId() + .show(); + + // Destroy menu items + this.element.find( ".ui-menu-item" ) + .removeClass( "ui-menu-item" ) + .removeAttr( "role" ) + .removeAttr( "aria-disabled" ) + .children( "a" ) + .removeUniqueId() + .removeClass( "ui-corner-all ui-state-hover" ) + .removeAttr( "tabIndex" ) + .removeAttr( "role" ) + .removeAttr( "aria-haspopup" ) + .children().each( function() { + var elem = $( this ); + if ( elem.data( "ui-menu-submenu-carat" ) ) { + elem.remove(); + } + }); + + // Destroy menu dividers + this.element.find( ".ui-menu-divider" ).removeClass( "ui-menu-divider ui-widget-content" ); + }, + + _keydown: function( event ) { + /*jshint maxcomplexity:20*/ + var match, prev, character, skip, regex, + preventDefault = true; + + function escape( value ) { + return value.replace( /[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&" ); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.PAGE_UP: + this.previousPage( event ); + break; + case $.ui.keyCode.PAGE_DOWN: + this.nextPage( event ); + break; + case $.ui.keyCode.HOME: + this._move( "first", "first", event ); + break; + case $.ui.keyCode.END: + this._move( "last", "last", event ); + break; + case $.ui.keyCode.UP: + this.previous( event ); + break; + case $.ui.keyCode.DOWN: + this.next( event ); + break; + case $.ui.keyCode.LEFT: + this.collapse( event ); + break; + case $.ui.keyCode.RIGHT: + if ( this.active && !this.active.is( ".ui-state-disabled" ) ) { + this.expand( event ); + } + break; + case $.ui.keyCode.ENTER: + case $.ui.keyCode.SPACE: + this._activate( event ); + break; + case $.ui.keyCode.ESCAPE: + this.collapse( event ); + break; + default: + preventDefault = false; + prev = this.previousFilter || ""; + character = String.fromCharCode( event.keyCode ); + skip = false; + + clearTimeout( this.filterTimer ); + + if ( character === prev ) { + skip = true; + } else { + character = prev + character; + } + + regex = new RegExp( "^" + escape( character ), "i" ); + match = this.activeMenu.children( ".ui-menu-item" ).filter(function() { + return regex.test( $( this ).children( "a" ).text() ); + }); + match = skip && match.index( this.active.next() ) !== -1 ? + this.active.nextAll( ".ui-menu-item" ) : + match; + + // If no matches on the current filter, reset to the last character pressed + // to move down the menu to the first item that starts with that character + if ( !match.length ) { + character = String.fromCharCode( event.keyCode ); + regex = new RegExp( "^" + escape( character ), "i" ); + match = this.activeMenu.children( ".ui-menu-item" ).filter(function() { + return regex.test( $( this ).children( "a" ).text() ); + }); + } + + if ( match.length ) { + this.focus( event, match ); + if ( match.length > 1 ) { + this.previousFilter = character; + this.filterTimer = this._delay(function() { + delete this.previousFilter; + }, 1000 ); + } else { + delete this.previousFilter; + } + } else { + delete this.previousFilter; + } + } + + if ( preventDefault ) { + event.preventDefault(); + } + }, + + _activate: function( event ) { + if ( !this.active.is( ".ui-state-disabled" ) ) { + if ( this.active.children( "a[aria-haspopup='true']" ).length ) { + this.expand( event ); + } else { + this.select( event ); + } + } + }, + + refresh: function() { + var menus, + icon = this.options.icons.submenu, + submenus = this.element.find( this.options.menus ); + + // Initialize nested menus + submenus.filter( ":not(.ui-menu)" ) + .addClass( "ui-menu ui-widget ui-widget-content ui-corner-all" ) + .hide() + .attr({ + role: this.options.role, + "aria-hidden": "true", + "aria-expanded": "false" + }) + .each(function() { + var menu = $( this ), + item = menu.prev( "a" ), + submenuCarat = $( "" ) + .addClass( "ui-menu-icon ui-icon " + icon ) + .data( "ui-menu-submenu-carat", true ); + + item + .attr( "aria-haspopup", "true" ) + .prepend( submenuCarat ); + menu.attr( "aria-labelledby", item.attr( "id" ) ); + }); + + menus = submenus.add( this.element ); + + // Don't refresh list items that are already adapted + menus.children( ":not(.ui-menu-item):has(a)" ) + .addClass( "ui-menu-item" ) + .attr( "role", "presentation" ) + .children( "a" ) + .uniqueId() + .addClass( "ui-corner-all" ) + .attr({ + tabIndex: -1, + role: this._itemRole() + }); + + // Initialize unlinked menu-items containing spaces and/or dashes only as dividers + menus.children( ":not(.ui-menu-item)" ).each(function() { + var item = $( this ); + // hyphen, em dash, en dash + if ( !/[^\-\u2014\u2013\s]/.test( item.text() ) ) { + item.addClass( "ui-widget-content ui-menu-divider" ); + } + }); + + // Add aria-disabled attribute to any disabled menu item + menus.children( ".ui-state-disabled" ).attr( "aria-disabled", "true" ); + + // If the active item has been removed, blur the menu + if ( this.active && !$.contains( this.element[ 0 ], this.active[ 0 ] ) ) { + this.blur(); + } + }, + + _itemRole: function() { + return { + menu: "menuitem", + listbox: "option" + }[ this.options.role ]; + }, + + _setOption: function( key, value ) { + if ( key === "icons" ) { + this.element.find( ".ui-menu-icon" ) + .removeClass( this.options.icons.submenu ) + .addClass( value.submenu ); + } + this._super( key, value ); + }, + + focus: function( event, item ) { + var nested, focused; + this.blur( event, event && event.type === "focus" ); + + this._scrollIntoView( item ); + + this.active = item.first(); + focused = this.active.children( "a" ).addClass( "ui-state-focus" ); + // Only update aria-activedescendant if there's a role + // otherwise we assume focus is managed elsewhere + if ( this.options.role ) { + this.element.attr( "aria-activedescendant", focused.attr( "id" ) ); + } + + // Highlight active parent menu item, if any + this.active + .parent() + .closest( ".ui-menu-item" ) + .children( "a:first" ) + .addClass( "ui-state-active" ); + + if ( event && event.type === "keydown" ) { + this._close(); + } else { + this.timer = this._delay(function() { + this._close(); + }, this.delay ); + } + + nested = item.children( ".ui-menu" ); + if ( nested.length && ( /^mouse/.test( event.type ) ) ) { + this._startOpening(nested); + } + this.activeMenu = item.parent(); + + this._trigger( "focus", event, { item: item } ); + }, + + _scrollIntoView: function( item ) { + var borderTop, paddingTop, offset, scroll, elementHeight, itemHeight; + if ( this._hasScroll() ) { + borderTop = parseFloat( $.css( this.activeMenu[0], "borderTopWidth" ) ) || 0; + paddingTop = parseFloat( $.css( this.activeMenu[0], "paddingTop" ) ) || 0; + offset = item.offset().top - this.activeMenu.offset().top - borderTop - paddingTop; + scroll = this.activeMenu.scrollTop(); + elementHeight = this.activeMenu.height(); + itemHeight = item.height(); + + if ( offset < 0 ) { + this.activeMenu.scrollTop( scroll + offset ); + } else if ( offset + itemHeight > elementHeight ) { + this.activeMenu.scrollTop( scroll + offset - elementHeight + itemHeight ); + } + } + }, + + blur: function( event, fromFocus ) { + if ( !fromFocus ) { + clearTimeout( this.timer ); + } + + if ( !this.active ) { + return; + } + + this.active.children( "a" ).removeClass( "ui-state-focus" ); + this.active = null; + + this._trigger( "blur", event, { item: this.active } ); + }, + + _startOpening: function( submenu ) { + clearTimeout( this.timer ); + + // Don't open if already open fixes a Firefox bug that caused a .5 pixel + // shift in the submenu position when mousing over the carat icon + if ( submenu.attr( "aria-hidden" ) !== "true" ) { + return; + } + + this.timer = this._delay(function() { + this._close(); + this._open( submenu ); + }, this.delay ); + }, + + _open: function( submenu ) { + var position = $.extend({ + of: this.active + }, this.options.position ); + + clearTimeout( this.timer ); + this.element.find( ".ui-menu" ).not( submenu.parents( ".ui-menu" ) ) + .hide() + .attr( "aria-hidden", "true" ); + + submenu + .show() + .removeAttr( "aria-hidden" ) + .attr( "aria-expanded", "true" ) + .position( position ); + }, + + collapseAll: function( event, all ) { + clearTimeout( this.timer ); + this.timer = this._delay(function() { + // If we were passed an event, look for the submenu that contains the event + var currentMenu = all ? this.element : + $( event && event.target ).closest( this.element.find( ".ui-menu" ) ); + + // If we found no valid submenu ancestor, use the main menu to close all sub menus anyway + if ( !currentMenu.length ) { + currentMenu = this.element; + } + + this._close( currentMenu ); + + this.blur( event ); + this.activeMenu = currentMenu; + }, this.delay ); + }, + + // With no arguments, closes the currently active menu - if nothing is active + // it closes all menus. If passed an argument, it will search for menus BELOW + _close: function( startMenu ) { + if ( !startMenu ) { + startMenu = this.active ? this.active.parent() : this.element; + } + + startMenu + .find( ".ui-menu" ) + .hide() + .attr( "aria-hidden", "true" ) + .attr( "aria-expanded", "false" ) + .end() + .find( "a.ui-state-active" ) + .removeClass( "ui-state-active" ); + }, + + collapse: function( event ) { + var newItem = this.active && + this.active.parent().closest( ".ui-menu-item", this.element ); + if ( newItem && newItem.length ) { + this._close(); + this.focus( event, newItem ); + } + }, + + expand: function( event ) { + var newItem = this.active && + this.active + .children( ".ui-menu " ) + .children( ".ui-menu-item" ) + .first(); + + if ( newItem && newItem.length ) { + this._open( newItem.parent() ); + + // Delay so Firefox will not hide activedescendant change in expanding submenu from AT + this._delay(function() { + this.focus( event, newItem ); + }); + } + }, + + next: function( event ) { + this._move( "next", "first", event ); + }, + + previous: function( event ) { + this._move( "prev", "last", event ); + }, + + isFirstItem: function() { + return this.active && !this.active.prevAll( ".ui-menu-item" ).length; + }, + + isLastItem: function() { + return this.active && !this.active.nextAll( ".ui-menu-item" ).length; + }, + + _move: function( direction, filter, event ) { + var next; + if ( this.active ) { + if ( direction === "first" || direction === "last" ) { + next = this.active + [ direction === "first" ? "prevAll" : "nextAll" ]( ".ui-menu-item" ) + .eq( -1 ); + } else { + next = this.active + [ direction + "All" ]( ".ui-menu-item" ) + .eq( 0 ); + } + } + if ( !next || !next.length || !this.active ) { + next = this.activeMenu.children( ".ui-menu-item" )[ filter ](); + } + + this.focus( event, next ); + }, + + nextPage: function( event ) { + var item, base, height; + + if ( !this.active ) { + this.next( event ); + return; + } + if ( this.isLastItem() ) { + return; + } + if ( this._hasScroll() ) { + base = this.active.offset().top; + height = this.element.height(); + this.active.nextAll( ".ui-menu-item" ).each(function() { + item = $( this ); + return item.offset().top - base - height < 0; + }); + + this.focus( event, item ); + } else { + this.focus( event, this.activeMenu.children( ".ui-menu-item" ) + [ !this.active ? "first" : "last" ]() ); + } + }, + + previousPage: function( event ) { + var item, base, height; + if ( !this.active ) { + this.next( event ); + return; + } + if ( this.isFirstItem() ) { + return; + } + if ( this._hasScroll() ) { + base = this.active.offset().top; + height = this.element.height(); + this.active.prevAll( ".ui-menu-item" ).each(function() { + item = $( this ); + return item.offset().top - base + height > 0; + }); + + this.focus( event, item ); + } else { + this.focus( event, this.activeMenu.children( ".ui-menu-item" ).first() ); + } + }, + + _hasScroll: function() { + return this.element.outerHeight() < this.element.prop( "scrollHeight" ); + }, + + select: function( event ) { + // TODO: It should never be possible to not have an active item at this + // point, but the tests don't trigger mouseenter before click. + this.active = this.active || $( event.target ).closest( ".ui-menu-item" ); + var ui = { item: this.active }; + if ( !this.active.has( ".ui-menu" ).length ) { + this.collapseAll( event, true ); + } + this._trigger( "select", event, ui ); + } +}); + +}( jQuery )); + +(function( $, undefined ) { + +$.ui = $.ui || {}; + +var cachedScrollbarWidth, + max = Math.max, + abs = Math.abs, + round = Math.round, + rhorizontal = /left|center|right/, + rvertical = /top|center|bottom/, + roffset = /[\+\-]\d+(\.[\d]+)?%?/, + rposition = /^\w+/, + rpercent = /%$/, + _position = $.fn.position; + +function getOffsets( offsets, width, height ) { + return [ + parseFloat( offsets[ 0 ] ) * ( rpercent.test( offsets[ 0 ] ) ? width / 100 : 1 ), + parseFloat( offsets[ 1 ] ) * ( rpercent.test( offsets[ 1 ] ) ? height / 100 : 1 ) + ]; +} + +function parseCss( element, property ) { + return parseInt( $.css( element, property ), 10 ) || 0; +} + +function getDimensions( elem ) { + var raw = elem[0]; + if ( raw.nodeType === 9 ) { + return { + width: elem.width(), + height: elem.height(), + offset: { top: 0, left: 0 } + }; + } + if ( $.isWindow( raw ) ) { + return { + width: elem.width(), + height: elem.height(), + offset: { top: elem.scrollTop(), left: elem.scrollLeft() } + }; + } + if ( raw.preventDefault ) { + return { + width: 0, + height: 0, + offset: { top: raw.pageY, left: raw.pageX } + }; + } + return { + width: elem.outerWidth(), + height: elem.outerHeight(), + offset: elem.offset() + }; +} + +$.position = { + scrollbarWidth: function() { + if ( cachedScrollbarWidth !== undefined ) { + return cachedScrollbarWidth; + } + var w1, w2, + div = $( "
        " ), + innerDiv = div.children()[0]; + + $( "body" ).append( div ); + w1 = innerDiv.offsetWidth; + div.css( "overflow", "scroll" ); + + w2 = innerDiv.offsetWidth; + + if ( w1 === w2 ) { + w2 = div[0].clientWidth; + } + + div.remove(); + + return (cachedScrollbarWidth = w1 - w2); + }, + getScrollInfo: function( within ) { + var overflowX = within.isWindow ? "" : within.element.css( "overflow-x" ), + overflowY = within.isWindow ? "" : within.element.css( "overflow-y" ), + hasOverflowX = overflowX === "scroll" || + ( overflowX === "auto" && within.width < within.element[0].scrollWidth ), + hasOverflowY = overflowY === "scroll" || + ( overflowY === "auto" && within.height < within.element[0].scrollHeight ); + return { + width: hasOverflowY ? $.position.scrollbarWidth() : 0, + height: hasOverflowX ? $.position.scrollbarWidth() : 0 + }; + }, + getWithinInfo: function( element ) { + var withinElement = $( element || window ), + isWindow = $.isWindow( withinElement[0] ); + return { + element: withinElement, + isWindow: isWindow, + offset: withinElement.offset() || { left: 0, top: 0 }, + scrollLeft: withinElement.scrollLeft(), + scrollTop: withinElement.scrollTop(), + width: isWindow ? withinElement.width() : withinElement.outerWidth(), + height: isWindow ? withinElement.height() : withinElement.outerHeight() + }; + } +}; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var atOffset, targetWidth, targetHeight, targetOffset, basePosition, dimensions, + target = $( options.of ), + within = $.position.getWithinInfo( options.within ), + scrollInfo = $.position.getScrollInfo( within ), + collision = ( options.collision || "flip" ).split( " " ), + offsets = {}; + + dimensions = getDimensions( target ); + if ( target[0].preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + } + targetWidth = dimensions.width; + targetHeight = dimensions.height; + targetOffset = dimensions.offset; + // clone to reuse original targetOffset later + basePosition = $.extend( {}, targetOffset ); + + // force my and at to have valid horizontal and vertical positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[ this ] || "" ).split( " " ), + horizontalOffset, + verticalOffset; + + if ( pos.length === 1) { + pos = rhorizontal.test( pos[ 0 ] ) ? + pos.concat( [ "center" ] ) : + rvertical.test( pos[ 0 ] ) ? + [ "center" ].concat( pos ) : + [ "center", "center" ]; + } + pos[ 0 ] = rhorizontal.test( pos[ 0 ] ) ? pos[ 0 ] : "center"; + pos[ 1 ] = rvertical.test( pos[ 1 ] ) ? pos[ 1 ] : "center"; + + // calculate offsets + horizontalOffset = roffset.exec( pos[ 0 ] ); + verticalOffset = roffset.exec( pos[ 1 ] ); + offsets[ this ] = [ + horizontalOffset ? horizontalOffset[ 0 ] : 0, + verticalOffset ? verticalOffset[ 0 ] : 0 + ]; + + // reduce to just the positions without the offsets + options[ this ] = [ + rposition.exec( pos[ 0 ] )[ 0 ], + rposition.exec( pos[ 1 ] )[ 0 ] + ]; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + if ( options.at[ 0 ] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[ 0 ] === "center" ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[ 1 ] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[ 1 ] === "center" ) { + basePosition.top += targetHeight / 2; + } + + atOffset = getOffsets( offsets.at, targetWidth, targetHeight ); + basePosition.left += atOffset[ 0 ]; + basePosition.top += atOffset[ 1 ]; + + return this.each(function() { + var collisionPosition, using, + elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseCss( this, "marginLeft" ), + marginTop = parseCss( this, "marginTop" ), + collisionWidth = elemWidth + marginLeft + parseCss( this, "marginRight" ) + scrollInfo.width, + collisionHeight = elemHeight + marginTop + parseCss( this, "marginBottom" ) + scrollInfo.height, + position = $.extend( {}, basePosition ), + myOffset = getOffsets( offsets.my, elem.outerWidth(), elem.outerHeight() ); + + if ( options.my[ 0 ] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[ 0 ] === "center" ) { + position.left -= elemWidth / 2; + } + + if ( options.my[ 1 ] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[ 1 ] === "center" ) { + position.top -= elemHeight / 2; + } + + position.left += myOffset[ 0 ]; + position.top += myOffset[ 1 ]; + + // if the browser doesn't support fractions, then round for consistent results + if ( !$.support.offsetFractions ) { + position.left = round( position.left ); + position.top = round( position.top ); + } + + collisionPosition = { + marginLeft: marginLeft, + marginTop: marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[ i ] ] ) { + $.ui.position[ collision[ i ] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: [ atOffset[ 0 ] + myOffset[ 0 ], atOffset [ 1 ] + myOffset[ 1 ] ], + my: options.my, + at: options.at, + within: within, + elem : elem + }); + } + }); + + if ( options.using ) { + // adds feedback as second argument to using callback, if present + using = function( props ) { + var left = targetOffset.left - position.left, + right = left + targetWidth - elemWidth, + top = targetOffset.top - position.top, + bottom = top + targetHeight - elemHeight, + feedback = { + target: { + element: target, + left: targetOffset.left, + top: targetOffset.top, + width: targetWidth, + height: targetHeight + }, + element: { + element: elem, + left: position.left, + top: position.top, + width: elemWidth, + height: elemHeight + }, + horizontal: right < 0 ? "left" : left > 0 ? "right" : "center", + vertical: bottom < 0 ? "top" : top > 0 ? "bottom" : "middle" + }; + if ( targetWidth < elemWidth && abs( left + right ) < targetWidth ) { + feedback.horizontal = "center"; + } + if ( targetHeight < elemHeight && abs( top + bottom ) < targetHeight ) { + feedback.vertical = "middle"; + } + if ( max( abs( left ), abs( right ) ) > max( abs( top ), abs( bottom ) ) ) { + feedback.important = "horizontal"; + } else { + feedback.important = "vertical"; + } + options.using.call( this, props, feedback ); + }; + } + + elem.offset( $.extend( position, { using: using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var within = data.within, + withinOffset = within.isWindow ? within.scrollLeft : within.offset.left, + outerWidth = within.width, + collisionPosLeft = position.left - data.collisionPosition.marginLeft, + overLeft = withinOffset - collisionPosLeft, + overRight = collisionPosLeft + data.collisionWidth - outerWidth - withinOffset, + newOverRight; + + // element is wider than within + if ( data.collisionWidth > outerWidth ) { + // element is initially over the left side of within + if ( overLeft > 0 && overRight <= 0 ) { + newOverRight = position.left + overLeft + data.collisionWidth - outerWidth - withinOffset; + position.left += overLeft - newOverRight; + // element is initially over right side of within + } else if ( overRight > 0 && overLeft <= 0 ) { + position.left = withinOffset; + // element is initially over both left and right sides of within + } else { + if ( overLeft > overRight ) { + position.left = withinOffset + outerWidth - data.collisionWidth; + } else { + position.left = withinOffset; + } + } + // too far left -> align with left edge + } else if ( overLeft > 0 ) { + position.left += overLeft; + // too far right -> align with right edge + } else if ( overRight > 0 ) { + position.left -= overRight; + // adjust based on position and margin + } else { + position.left = max( position.left - collisionPosLeft, position.left ); + } + }, + top: function( position, data ) { + var within = data.within, + withinOffset = within.isWindow ? within.scrollTop : within.offset.top, + outerHeight = data.within.height, + collisionPosTop = position.top - data.collisionPosition.marginTop, + overTop = withinOffset - collisionPosTop, + overBottom = collisionPosTop + data.collisionHeight - outerHeight - withinOffset, + newOverBottom; + + // element is taller than within + if ( data.collisionHeight > outerHeight ) { + // element is initially over the top of within + if ( overTop > 0 && overBottom <= 0 ) { + newOverBottom = position.top + overTop + data.collisionHeight - outerHeight - withinOffset; + position.top += overTop - newOverBottom; + // element is initially over bottom of within + } else if ( overBottom > 0 && overTop <= 0 ) { + position.top = withinOffset; + // element is initially over both top and bottom of within + } else { + if ( overTop > overBottom ) { + position.top = withinOffset + outerHeight - data.collisionHeight; + } else { + position.top = withinOffset; + } + } + // too far up -> align with top + } else if ( overTop > 0 ) { + position.top += overTop; + // too far down -> align with bottom edge + } else if ( overBottom > 0 ) { + position.top -= overBottom; + // adjust based on position and margin + } else { + position.top = max( position.top - collisionPosTop, position.top ); + } + } + }, + flip: { + left: function( position, data ) { + var within = data.within, + withinOffset = within.offset.left + within.scrollLeft, + outerWidth = within.width, + offsetLeft = within.isWindow ? within.scrollLeft : within.offset.left, + collisionPosLeft = position.left - data.collisionPosition.marginLeft, + overLeft = collisionPosLeft - offsetLeft, + overRight = collisionPosLeft + data.collisionWidth - outerWidth - offsetLeft, + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + data.at[ 0 ] === "right" ? + -data.targetWidth : + 0, + offset = -2 * data.offset[ 0 ], + newOverRight, + newOverLeft; + + if ( overLeft < 0 ) { + newOverRight = position.left + myOffset + atOffset + offset + data.collisionWidth - outerWidth - withinOffset; + if ( newOverRight < 0 || newOverRight < abs( overLeft ) ) { + position.left += myOffset + atOffset + offset; + } + } + else if ( overRight > 0 ) { + newOverLeft = position.left - data.collisionPosition.marginLeft + myOffset + atOffset + offset - offsetLeft; + if ( newOverLeft > 0 || abs( newOverLeft ) < overRight ) { + position.left += myOffset + atOffset + offset; + } + } + }, + top: function( position, data ) { + var within = data.within, + withinOffset = within.offset.top + within.scrollTop, + outerHeight = within.height, + offsetTop = within.isWindow ? within.scrollTop : within.offset.top, + collisionPosTop = position.top - data.collisionPosition.marginTop, + overTop = collisionPosTop - offsetTop, + overBottom = collisionPosTop + data.collisionHeight - outerHeight - offsetTop, + top = data.my[ 1 ] === "top", + myOffset = top ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + data.at[ 1 ] === "bottom" ? + -data.targetHeight : + 0, + offset = -2 * data.offset[ 1 ], + newOverTop, + newOverBottom; + if ( overTop < 0 ) { + newOverBottom = position.top + myOffset + atOffset + offset + data.collisionHeight - outerHeight - withinOffset; + if ( ( position.top + myOffset + atOffset + offset) > overTop && ( newOverBottom < 0 || newOverBottom < abs( overTop ) ) ) { + position.top += myOffset + atOffset + offset; + } + } + else if ( overBottom > 0 ) { + newOverTop = position.top - data.collisionPosition.marginTop + myOffset + atOffset + offset - offsetTop; + if ( ( position.top + myOffset + atOffset + offset) > overBottom && ( newOverTop > 0 || abs( newOverTop ) < overBottom ) ) { + position.top += myOffset + atOffset + offset; + } + } + } + }, + flipfit: { + left: function() { + $.ui.position.flip.left.apply( this, arguments ); + $.ui.position.fit.left.apply( this, arguments ); + }, + top: function() { + $.ui.position.flip.top.apply( this, arguments ); + $.ui.position.fit.top.apply( this, arguments ); + } + } +}; + +// fraction support test +(function () { + var testElement, testElementParent, testElementStyle, offsetLeft, i, + body = document.getElementsByTagName( "body" )[ 0 ], + div = document.createElement( "div" ); + + //Create a "fake body" for testing based on method used in jQuery.support + testElement = document.createElement( body ? "div" : "body" ); + testElementStyle = { + visibility: "hidden", + width: 0, + height: 0, + border: 0, + margin: 0, + background: "none" + }; + if ( body ) { + $.extend( testElementStyle, { + position: "absolute", + left: "-1000px", + top: "-1000px" + }); + } + for ( i in testElementStyle ) { + testElement.style[ i ] = testElementStyle[ i ]; + } + testElement.appendChild( div ); + testElementParent = body || document.documentElement; + testElementParent.insertBefore( testElement, testElementParent.firstChild ); + + div.style.cssText = "position: absolute; left: 10.7432222px;"; + + offsetLeft = $( div ).offset().left; + $.support.offsetFractions = offsetLeft > 10 && offsetLeft < 11; + + testElement.innerHTML = ""; + testElementParent.removeChild( testElement ); +})(); + +}( jQuery ) ); + +(function( $, undefined ) { + +$.widget( "ui.progressbar", { + version: "1.10.2", + options: { + max: 100, + value: 0, + + change: null, + complete: null + }, + + min: 0, + + _create: function() { + // Constrain initial value + this.oldValue = this.options.value = this._constrainedValue(); + + this.element + .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .attr({ + // Only set static values, aria-valuenow and aria-valuemax are + // set inside _refreshValue() + role: "progressbar", + "aria-valuemin": this.min + }); + + this.valueDiv = $( "
        " ) + .appendTo( this.element ); + + this._refreshValue(); + }, + + _destroy: function() { + this.element + .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + + this.valueDiv.remove(); + }, + + value: function( newValue ) { + if ( newValue === undefined ) { + return this.options.value; + } + + this.options.value = this._constrainedValue( newValue ); + this._refreshValue(); + }, + + _constrainedValue: function( newValue ) { + if ( newValue === undefined ) { + newValue = this.options.value; + } + + this.indeterminate = newValue === false; + + // sanitize value + if ( typeof newValue !== "number" ) { + newValue = 0; + } + + return this.indeterminate ? false : + Math.min( this.options.max, Math.max( this.min, newValue ) ); + }, + + _setOptions: function( options ) { + // Ensure "value" option is set after other values (like max) + var value = options.value; + delete options.value; + + this._super( options ); + + this.options.value = this._constrainedValue( value ); + this._refreshValue(); + }, + + _setOption: function( key, value ) { + if ( key === "max" ) { + // Don't allow a max less than min + value = Math.max( this.min, value ); + } + + this._super( key, value ); + }, + + _percentage: function() { + return this.indeterminate ? 100 : 100 * ( this.options.value - this.min ) / ( this.options.max - this.min ); + }, + + _refreshValue: function() { + var value = this.options.value, + percentage = this._percentage(); + + this.valueDiv + .toggle( this.indeterminate || value > this.min ) + .toggleClass( "ui-corner-right", value === this.options.max ) + .width( percentage.toFixed(0) + "%" ); + + this.element.toggleClass( "ui-progressbar-indeterminate", this.indeterminate ); + + if ( this.indeterminate ) { + this.element.removeAttr( "aria-valuenow" ); + if ( !this.overlayDiv ) { + this.overlayDiv = $( "
        " ).appendTo( this.valueDiv ); + } + } else { + this.element.attr({ + "aria-valuemax": this.options.max, + "aria-valuenow": value + }); + if ( this.overlayDiv ) { + this.overlayDiv.remove(); + this.overlayDiv = null; + } + } + + if ( this.oldValue !== value ) { + this.oldValue = value; + this._trigger( "change" ); + } + if ( value === this.options.max ) { + this._trigger( "complete" ); + } + } +}); + +})( jQuery ); + +(function( $, undefined ) { + +// number of pages in a slider +// (how many times can you page up/down to go through the whole range) +var numPages = 5; + +$.widget( "ui.slider", $.ui.mouse, { + version: "1.10.2", + widgetEventPrefix: "slide", + + options: { + animate: false, + distance: 0, + max: 100, + min: 0, + orientation: "horizontal", + range: false, + step: 1, + value: 0, + values: null, + + // callbacks + change: null, + slide: null, + start: null, + stop: null + }, + + _create: function() { + this._keySliding = false; + this._mouseSliding = false; + this._animateOff = true; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass( "ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all"); + + this._refresh(); + this._setOption( "disabled", this.options.disabled ); + + this._animateOff = false; + }, + + _refresh: function() { + this._createRange(); + this._createHandles(); + this._setupEvents(); + this._refreshValue(); + }, + + _createHandles: function() { + var i, handleCount, + options = this.options, + existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ), + handle = "", + handles = []; + + handleCount = ( options.values && options.values.length ) || 1; + + if ( existingHandles.length > handleCount ) { + existingHandles.slice( handleCount ).remove(); + existingHandles = existingHandles.slice( 0, handleCount ); + } + + for ( i = existingHandles.length; i < handleCount; i++ ) { + handles.push( handle ); + } + + this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( this.element ) ); + + this.handle = this.handles.eq( 0 ); + + this.handles.each(function( i ) { + $( this ).data( "ui-slider-handle-index", i ); + }); + }, + + _createRange: function() { + var options = this.options, + classes = ""; + + if ( options.range ) { + if ( options.range === true ) { + if ( !options.values ) { + options.values = [ this._valueMin(), this._valueMin() ]; + } else if ( options.values.length && options.values.length !== 2 ) { + options.values = [ options.values[0], options.values[0] ]; + } else if ( $.isArray( options.values ) ) { + options.values = options.values.slice(0); + } + } + + if ( !this.range || !this.range.length ) { + this.range = $( "
        " ) + .appendTo( this.element ); + + classes = "ui-slider-range" + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + " ui-widget-header ui-corner-all"; + } else { + this.range.removeClass( "ui-slider-range-min ui-slider-range-max" ) + // Handle range switching from true to min/max + .css({ + "left": "", + "bottom": "" + }); + } + + this.range.addClass( classes + + ( ( options.range === "min" || options.range === "max" ) ? " ui-slider-range-" + options.range : "" ) ); + } else { + this.range = $([]); + } + }, + + _setupEvents: function() { + var elements = this.handles.add( this.range ).filter( "a" ); + this._off( elements ); + this._on( elements, this._handleEvents ); + this._hoverable( elements ); + this._focusable( elements ); + }, + + _destroy: function() { + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass( "ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ); + + this._mouseDestroy(); + }, + + _mouseCapture: function( event ) { + var position, normValue, distance, closestHandle, index, allowed, offset, mouseOverHandle, + that = this, + o = this.options; + + if ( o.disabled ) { + return false; + } + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + position = { x: event.pageX, y: event.pageY }; + normValue = this._normValueFromMouse( position ); + distance = this._valueMax() - this._valueMin() + 1; + this.handles.each(function( i ) { + var thisDistance = Math.abs( normValue - that.values(i) ); + if (( distance > thisDistance ) || + ( distance === thisDistance && + (i === that._lastChangedValue || that.values(i) === o.min ))) { + distance = thisDistance; + closestHandle = $( this ); + index = i; + } + }); + + allowed = this._start( event, index ); + if ( allowed === false ) { + return false; + } + this._mouseSliding = true; + + this._handleIndex = index; + + closestHandle + .addClass( "ui-state-active" ) + .focus(); + + offset = closestHandle.offset(); + mouseOverHandle = !$( event.target ).parents().addBack().is( ".ui-slider-handle" ); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - ( closestHandle.width() / 2 ), + top: event.pageY - offset.top - + ( closestHandle.height() / 2 ) - + ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - + ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + + ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) + }; + + if ( !this.handles.hasClass( "ui-state-hover" ) ) { + this._slide( event, index, normValue ); + } + this._animateOff = true; + return true; + }, + + _mouseStart: function() { + return true; + }, + + _mouseDrag: function( event ) { + var position = { x: event.pageX, y: event.pageY }, + normValue = this._normValueFromMouse( position ); + + this._slide( event, this._handleIndex, normValue ); + + return false; + }, + + _mouseStop: function( event ) { + this.handles.removeClass( "ui-state-active" ); + this._mouseSliding = false; + + this._stop( event, this._handleIndex ); + this._change( event, this._handleIndex ); + + this._handleIndex = null; + this._clickOffset = null; + this._animateOff = false; + + return false; + }, + + _detectOrientation: function() { + this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; + }, + + _normValueFromMouse: function( position ) { + var pixelTotal, + pixelMouse, + percentMouse, + valueTotal, + valueMouse; + + if ( this.orientation === "horizontal" ) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); + } + + percentMouse = ( pixelMouse / pixelTotal ); + if ( percentMouse > 1 ) { + percentMouse = 1; + } + if ( percentMouse < 0 ) { + percentMouse = 0; + } + if ( this.orientation === "vertical" ) { + percentMouse = 1 - percentMouse; + } + + valueTotal = this._valueMax() - this._valueMin(); + valueMouse = this._valueMin() + percentMouse * valueTotal; + + return this._trimAlignValue( valueMouse ); + }, + + _start: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + return this._trigger( "start", event, uiHash ); + }, + + _slide: function( event, index, newVal ) { + var otherVal, + newValues, + allowed; + + if ( this.options.values && this.options.values.length ) { + otherVal = this.values( index ? 0 : 1 ); + + if ( ( this.options.values.length === 2 && this.options.range === true ) && + ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) + ) { + newVal = otherVal; + } + + if ( newVal !== this.values( index ) ) { + newValues = this.values(); + newValues[ index ] = newVal; + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal, + values: newValues + } ); + otherVal = this.values( index ? 0 : 1 ); + if ( allowed !== false ) { + this.values( index, newVal, true ); + } + } + } else { + if ( newVal !== this.value() ) { + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal + } ); + if ( allowed !== false ) { + this.value( newVal ); + } + } + } + }, + + _stop: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "stop", event, uiHash ); + }, + + _change: function( event, index ) { + if ( !this._keySliding && !this._mouseSliding ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + //store the last changed value index for reference when handles overlap + this._lastChangedValue = index; + + this._trigger( "change", event, uiHash ); + } + }, + + value: function( newValue ) { + if ( arguments.length ) { + this.options.value = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, 0 ); + return; + } + + return this._value(); + }, + + values: function( index, newValue ) { + var vals, + newValues, + i; + + if ( arguments.length > 1 ) { + this.options.values[ index ] = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, index ); + return; + } + + if ( arguments.length ) { + if ( $.isArray( arguments[ 0 ] ) ) { + vals = this.options.values; + newValues = arguments[ 0 ]; + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( newValues[ i ] ); + this._change( null, i ); + } + this._refreshValue(); + } else { + if ( this.options.values && this.options.values.length ) { + return this._values( index ); + } else { + return this.value(); + } + } + } else { + return this._values(); + } + }, + + _setOption: function( key, value ) { + var i, + valsLength = 0; + + if ( key === "range" && this.options.range === true ) { + if ( value === "min" ) { + this.options.value = this._values( 0 ); + this.options.values = null; + } else if ( value === "max" ) { + this.options.value = this._values( this.options.values.length-1 ); + this.options.values = null; + } + } + + if ( $.isArray( this.options.values ) ) { + valsLength = this.options.values.length; + } + + $.Widget.prototype._setOption.apply( this, arguments ); + + switch ( key ) { + case "orientation": + this._detectOrientation(); + this.element + .removeClass( "ui-slider-horizontal ui-slider-vertical" ) + .addClass( "ui-slider-" + this.orientation ); + this._refreshValue(); + break; + case "value": + this._animateOff = true; + this._refreshValue(); + this._change( null, 0 ); + this._animateOff = false; + break; + case "values": + this._animateOff = true; + this._refreshValue(); + for ( i = 0; i < valsLength; i += 1 ) { + this._change( null, i ); + } + this._animateOff = false; + break; + case "min": + case "max": + this._animateOff = true; + this._refreshValue(); + this._animateOff = false; + break; + case "range": + this._animateOff = true; + this._refresh(); + this._animateOff = false; + break; + } + }, + + //internal value getter + // _value() returns value trimmed by min and max, aligned by step + _value: function() { + var val = this.options.value; + val = this._trimAlignValue( val ); + + return val; + }, + + //internal values getter + // _values() returns array of values trimmed by min and max, aligned by step + // _values( index ) returns single value trimmed by min and max, aligned by step + _values: function( index ) { + var val, + vals, + i; + + if ( arguments.length ) { + val = this.options.values[ index ]; + val = this._trimAlignValue( val ); + + return val; + } else if ( this.options.values && this.options.values.length ) { + // .slice() creates a copy of the array + // this copy gets trimmed by min and max and then returned + vals = this.options.values.slice(); + for ( i = 0; i < vals.length; i+= 1) { + vals[ i ] = this._trimAlignValue( vals[ i ] ); + } + + return vals; + } else { + return []; + } + }, + + // returns the step-aligned value that val is closest to, between (inclusive) min and max + _trimAlignValue: function( val ) { + if ( val <= this._valueMin() ) { + return this._valueMin(); + } + if ( val >= this._valueMax() ) { + return this._valueMax(); + } + var step = ( this.options.step > 0 ) ? this.options.step : 1, + valModStep = (val - this._valueMin()) % step, + alignValue = val - valModStep; + + if ( Math.abs(valModStep) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat( alignValue.toFixed(5) ); + }, + + _valueMin: function() { + return this.options.min; + }, + + _valueMax: function() { + return this.options.max; + }, + + _refreshValue: function() { + var lastValPercent, valPercent, value, valueMin, valueMax, + oRange = this.options.range, + o = this.options, + that = this, + animate = ( !this._animateOff ) ? o.animate : false, + _set = {}; + + if ( this.options.values && this.options.values.length ) { + this.handles.each(function( i ) { + valPercent = ( that.values(i) - that._valueMin() ) / ( that._valueMax() - that._valueMin() ) * 100; + _set[ that.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + if ( that.options.range === true ) { + if ( that.orientation === "horizontal" ) { + if ( i === 0 ) { + that.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); + } + if ( i === 1 ) { + that.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } else { + if ( i === 0 ) { + that.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); + } + if ( i === 1 ) { + that.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + lastValPercent = valPercent; + }); + } else { + value = this.value(); + valueMin = this._valueMin(); + valueMax = this._valueMax(); + valPercent = ( valueMax !== valueMin ) ? + ( value - valueMin ) / ( valueMax - valueMin ) * 100 : + 0; + _set[ this.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + + if ( oRange === "min" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "horizontal" ) { + this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + if ( oRange === "min" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "vertical" ) { + this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + }, + + _handleEvents: { + keydown: function( event ) { + /*jshint maxcomplexity:25*/ + var allowed, curVal, newVal, step, + index = $( event.target ).data( "ui-slider-handle-index" ); + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_UP: + case $.ui.keyCode.PAGE_DOWN: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + event.preventDefault(); + if ( !this._keySliding ) { + this._keySliding = true; + $( event.target ).addClass( "ui-state-active" ); + allowed = this._start( event, index ); + if ( allowed === false ) { + return; + } + } + break; + } + + step = this.options.step; + if ( this.options.values && this.options.values.length ) { + curVal = newVal = this.values( index ); + } else { + curVal = newVal = this.value(); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + newVal = this._valueMin(); + break; + case $.ui.keyCode.END: + newVal = this._valueMax(); + break; + case $.ui.keyCode.PAGE_UP: + newVal = this._trimAlignValue( curVal + ( (this._valueMax() - this._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.PAGE_DOWN: + newVal = this._trimAlignValue( curVal - ( (this._valueMax() - this._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if ( curVal === this._valueMax() ) { + return; + } + newVal = this._trimAlignValue( curVal + step ); + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if ( curVal === this._valueMin() ) { + return; + } + newVal = this._trimAlignValue( curVal - step ); + break; + } + + this._slide( event, index, newVal ); + }, + click: function( event ) { + event.preventDefault(); + }, + keyup: function( event ) { + var index = $( event.target ).data( "ui-slider-handle-index" ); + + if ( this._keySliding ) { + this._keySliding = false; + this._stop( event, index ); + this._change( event, index ); + $( event.target ).removeClass( "ui-state-active" ); + } + } + } + +}); + +}(jQuery)); + +(function( $ ) { + +function modifier( fn ) { + return function() { + var previous = this.element.val(); + fn.apply( this, arguments ); + this._refresh(); + if ( previous !== this.element.val() ) { + this._trigger( "change" ); + } + }; +} + +$.widget( "ui.spinner", { + version: "1.10.2", + defaultElement: "", + widgetEventPrefix: "spin", + options: { + culture: null, + icons: { + down: "ui-icon-triangle-1-s", + up: "ui-icon-triangle-1-n" + }, + incremental: true, + max: null, + min: null, + numberFormat: null, + page: 10, + step: 1, + + change: null, + spin: null, + start: null, + stop: null + }, + + _create: function() { + // handle string values that need to be parsed + this._setOption( "max", this.options.max ); + this._setOption( "min", this.options.min ); + this._setOption( "step", this.options.step ); + + // format the value, but don't constrain + this._value( this.element.val(), true ); + + this._draw(); + this._on( this._events ); + this._refresh(); + + // turning off autocomplete prevents the browser from remembering the + // value when navigating through history, so we re-enable autocomplete + // if the page is unloaded before the widget is destroyed. #7790 + this._on( this.window, { + beforeunload: function() { + this.element.removeAttr( "autocomplete" ); + } + }); + }, + + _getCreateOptions: function() { + var options = {}, + element = this.element; + + $.each( [ "min", "max", "step" ], function( i, option ) { + var value = element.attr( option ); + if ( value !== undefined && value.length ) { + options[ option ] = value; + } + }); + + return options; + }, + + _events: { + keydown: function( event ) { + if ( this._start( event ) && this._keydown( event ) ) { + event.preventDefault(); + } + }, + keyup: "_stop", + focus: function() { + this.previous = this.element.val(); + }, + blur: function( event ) { + if ( this.cancelBlur ) { + delete this.cancelBlur; + return; + } + + this._stop(); + this._refresh(); + if ( this.previous !== this.element.val() ) { + this._trigger( "change", event ); + } + }, + mousewheel: function( event, delta ) { + if ( !delta ) { + return; + } + if ( !this.spinning && !this._start( event ) ) { + return false; + } + + this._spin( (delta > 0 ? 1 : -1) * this.options.step, event ); + clearTimeout( this.mousewheelTimer ); + this.mousewheelTimer = this._delay(function() { + if ( this.spinning ) { + this._stop( event ); + } + }, 100 ); + event.preventDefault(); + }, + "mousedown .ui-spinner-button": function( event ) { + var previous; + + // We never want the buttons to have focus; whenever the user is + // interacting with the spinner, the focus should be on the input. + // If the input is focused then this.previous is properly set from + // when the input first received focus. If the input is not focused + // then we need to set this.previous based on the value before spinning. + previous = this.element[0] === this.document[0].activeElement ? + this.previous : this.element.val(); + function checkFocus() { + var isActive = this.element[0] === this.document[0].activeElement; + if ( !isActive ) { + this.element.focus(); + this.previous = previous; + // support: IE + // IE sets focus asynchronously, so we need to check if focus + // moved off of the input because the user clicked on the button. + this._delay(function() { + this.previous = previous; + }); + } + } + + // ensure focus is on (or stays on) the text field + event.preventDefault(); + checkFocus.call( this ); + + // support: IE + // IE doesn't prevent moving focus even with event.preventDefault() + // so we set a flag to know when we should ignore the blur event + // and check (again) if focus moved off of the input. + this.cancelBlur = true; + this._delay(function() { + delete this.cancelBlur; + checkFocus.call( this ); + }); + + if ( this._start( event ) === false ) { + return; + } + + this._repeat( null, $( event.currentTarget ).hasClass( "ui-spinner-up" ) ? 1 : -1, event ); + }, + "mouseup .ui-spinner-button": "_stop", + "mouseenter .ui-spinner-button": function( event ) { + // button will add ui-state-active if mouse was down while mouseleave and kept down + if ( !$( event.currentTarget ).hasClass( "ui-state-active" ) ) { + return; + } + + if ( this._start( event ) === false ) { + return false; + } + this._repeat( null, $( event.currentTarget ).hasClass( "ui-spinner-up" ) ? 1 : -1, event ); + }, + // TODO: do we really want to consider this a stop? + // shouldn't we just stop the repeater and wait until mouseup before + // we trigger the stop event? + "mouseleave .ui-spinner-button": "_stop" + }, + + _draw: function() { + var uiSpinner = this.uiSpinner = this.element + .addClass( "ui-spinner-input" ) + .attr( "autocomplete", "off" ) + .wrap( this._uiSpinnerHtml() ) + .parent() + // add buttons + .append( this._buttonHtml() ); + + this.element.attr( "role", "spinbutton" ); + + // button bindings + this.buttons = uiSpinner.find( ".ui-spinner-button" ) + .attr( "tabIndex", -1 ) + .button() + .removeClass( "ui-corner-all" ); + + // IE 6 doesn't understand height: 50% for the buttons + // unless the wrapper has an explicit height + if ( this.buttons.height() > Math.ceil( uiSpinner.height() * 0.5 ) && + uiSpinner.height() > 0 ) { + uiSpinner.height( uiSpinner.height() ); + } + + // disable spinner if element was already disabled + if ( this.options.disabled ) { + this.disable(); + } + }, + + _keydown: function( event ) { + var options = this.options, + keyCode = $.ui.keyCode; + + switch ( event.keyCode ) { + case keyCode.UP: + this._repeat( null, 1, event ); + return true; + case keyCode.DOWN: + this._repeat( null, -1, event ); + return true; + case keyCode.PAGE_UP: + this._repeat( null, options.page, event ); + return true; + case keyCode.PAGE_DOWN: + this._repeat( null, -options.page, event ); + return true; + } + + return false; + }, + + _uiSpinnerHtml: function() { + return ""; + }, + + _buttonHtml: function() { + return "" + + "" + + ""; + }, + + _start: function( event ) { + if ( !this.spinning && this._trigger( "start", event ) === false ) { + return false; + } + + if ( !this.counter ) { + this.counter = 1; + } + this.spinning = true; + return true; + }, + + _repeat: function( i, steps, event ) { + i = i || 500; + + clearTimeout( this.timer ); + this.timer = this._delay(function() { + this._repeat( 40, steps, event ); + }, i ); + + this._spin( steps * this.options.step, event ); + }, + + _spin: function( step, event ) { + var value = this.value() || 0; + + if ( !this.counter ) { + this.counter = 1; + } + + value = this._adjustValue( value + step * this._increment( this.counter ) ); + + if ( !this.spinning || this._trigger( "spin", event, { value: value } ) !== false) { + this._value( value ); + this.counter++; + } + }, + + _increment: function( i ) { + var incremental = this.options.incremental; + + if ( incremental ) { + return $.isFunction( incremental ) ? + incremental( i ) : + Math.floor( i*i*i/50000 - i*i/500 + 17*i/200 + 1 ); + } + + return 1; + }, + + _precision: function() { + var precision = this._precisionOf( this.options.step ); + if ( this.options.min !== null ) { + precision = Math.max( precision, this._precisionOf( this.options.min ) ); + } + return precision; + }, + + _precisionOf: function( num ) { + var str = num.toString(), + decimal = str.indexOf( "." ); + return decimal === -1 ? 0 : str.length - decimal - 1; + }, + + _adjustValue: function( value ) { + var base, aboveMin, + options = this.options; + + // make sure we're at a valid step + // - find out where we are relative to the base (min or 0) + base = options.min !== null ? options.min : 0; + aboveMin = value - base; + // - round to the nearest step + aboveMin = Math.round(aboveMin / options.step) * options.step; + // - rounding is based on 0, so adjust back to our base + value = base + aboveMin; + + // fix precision from bad JS floating point math + value = parseFloat( value.toFixed( this._precision() ) ); + + // clamp the value + if ( options.max !== null && value > options.max) { + return options.max; + } + if ( options.min !== null && value < options.min ) { + return options.min; + } + + return value; + }, + + _stop: function( event ) { + if ( !this.spinning ) { + return; + } + + clearTimeout( this.timer ); + clearTimeout( this.mousewheelTimer ); + this.counter = 0; + this.spinning = false; + this._trigger( "stop", event ); + }, + + _setOption: function( key, value ) { + if ( key === "culture" || key === "numberFormat" ) { + var prevValue = this._parse( this.element.val() ); + this.options[ key ] = value; + this.element.val( this._format( prevValue ) ); + return; + } + + if ( key === "max" || key === "min" || key === "step" ) { + if ( typeof value === "string" ) { + value = this._parse( value ); + } + } + if ( key === "icons" ) { + this.buttons.first().find( ".ui-icon" ) + .removeClass( this.options.icons.up ) + .addClass( value.up ); + this.buttons.last().find( ".ui-icon" ) + .removeClass( this.options.icons.down ) + .addClass( value.down ); + } + + this._super( key, value ); + + if ( key === "disabled" ) { + if ( value ) { + this.element.prop( "disabled", true ); + this.buttons.button( "disable" ); + } else { + this.element.prop( "disabled", false ); + this.buttons.button( "enable" ); + } + } + }, + + _setOptions: modifier(function( options ) { + this._super( options ); + this._value( this.element.val() ); + }), + + _parse: function( val ) { + if ( typeof val === "string" && val !== "" ) { + val = window.Globalize && this.options.numberFormat ? + Globalize.parseFloat( val, 10, this.options.culture ) : +val; + } + return val === "" || isNaN( val ) ? null : val; + }, + + _format: function( value ) { + if ( value === "" ) { + return ""; + } + return window.Globalize && this.options.numberFormat ? + Globalize.format( value, this.options.numberFormat, this.options.culture ) : + value; + }, + + _refresh: function() { + this.element.attr({ + "aria-valuemin": this.options.min, + "aria-valuemax": this.options.max, + // TODO: what should we do with values that can't be parsed? + "aria-valuenow": this._parse( this.element.val() ) + }); + }, + + // update the value without triggering change + _value: function( value, allowAny ) { + var parsed; + if ( value !== "" ) { + parsed = this._parse( value ); + if ( parsed !== null ) { + if ( !allowAny ) { + parsed = this._adjustValue( parsed ); + } + value = this._format( parsed ); + } + } + this.element.val( value ); + this._refresh(); + }, + + _destroy: function() { + this.element + .removeClass( "ui-spinner-input" ) + .prop( "disabled", false ) + .removeAttr( "autocomplete" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + this.uiSpinner.replaceWith( this.element ); + }, + + stepUp: modifier(function( steps ) { + this._stepUp( steps ); + }), + _stepUp: function( steps ) { + if ( this._start() ) { + this._spin( (steps || 1) * this.options.step ); + this._stop(); + } + }, + + stepDown: modifier(function( steps ) { + this._stepDown( steps ); + }), + _stepDown: function( steps ) { + if ( this._start() ) { + this._spin( (steps || 1) * -this.options.step ); + this._stop(); + } + }, + + pageUp: modifier(function( pages ) { + this._stepUp( (pages || 1) * this.options.page ); + }), + + pageDown: modifier(function( pages ) { + this._stepDown( (pages || 1) * this.options.page ); + }), + + value: function( newVal ) { + if ( !arguments.length ) { + return this._parse( this.element.val() ); + } + modifier( this._value ).call( this, newVal ); + }, + + widget: function() { + return this.uiSpinner; + } +}); + +}( jQuery ) ); + +(function( $, undefined ) { + +var tabId = 0, + rhash = /#.*$/; + +function getNextTabId() { + return ++tabId; +} + +function isLocal( anchor ) { + return anchor.hash.length > 1 && + decodeURIComponent( anchor.href.replace( rhash, "" ) ) === + decodeURIComponent( location.href.replace( rhash, "" ) ); +} + +$.widget( "ui.tabs", { + version: "1.10.2", + delay: 300, + options: { + active: null, + collapsible: false, + event: "click", + heightStyle: "content", + hide: null, + show: null, + + // callbacks + activate: null, + beforeActivate: null, + beforeLoad: null, + load: null + }, + + _create: function() { + var that = this, + options = this.options; + + this.running = false; + + this.element + .addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" ) + .toggleClass( "ui-tabs-collapsible", options.collapsible ) + // Prevent users from focusing disabled tabs via click + .delegate( ".ui-tabs-nav > li", "mousedown" + this.eventNamespace, function( event ) { + if ( $( this ).is( ".ui-state-disabled" ) ) { + event.preventDefault(); + } + }) + // support: IE <9 + // Preventing the default action in mousedown doesn't prevent IE + // from focusing the element, so if the anchor gets focused, blur. + // We don't have to worry about focusing the previously focused + // element since clicking on a non-focusable element should focus + // the body anyway. + .delegate( ".ui-tabs-anchor", "focus" + this.eventNamespace, function() { + if ( $( this ).closest( "li" ).is( ".ui-state-disabled" ) ) { + this.blur(); + } + }); + + this._processTabs(); + options.active = this._initialActive(); + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + if ( $.isArray( options.disabled ) ) { + options.disabled = $.unique( options.disabled.concat( + $.map( this.tabs.filter( ".ui-state-disabled" ), function( li ) { + return that.tabs.index( li ); + }) + ) ).sort(); + } + + // check for length avoids error when initializing empty list + if ( this.options.active !== false && this.anchors.length ) { + this.active = this._findActive( options.active ); + } else { + this.active = $(); + } + + this._refresh(); + + if ( this.active.length ) { + this.load( options.active ); + } + }, + + _initialActive: function() { + var active = this.options.active, + collapsible = this.options.collapsible, + locationHash = location.hash.substring( 1 ); + + if ( active === null ) { + // check the fragment identifier in the URL + if ( locationHash ) { + this.tabs.each(function( i, tab ) { + if ( $( tab ).attr( "aria-controls" ) === locationHash ) { + active = i; + return false; + } + }); + } + + // check for a tab marked active via a class + if ( active === null ) { + active = this.tabs.index( this.tabs.filter( ".ui-tabs-active" ) ); + } + + // no active tab, set to false + if ( active === null || active === -1 ) { + active = this.tabs.length ? 0 : false; + } + } + + // handle numbers: negative, out of range + if ( active !== false ) { + active = this.tabs.index( this.tabs.eq( active ) ); + if ( active === -1 ) { + active = collapsible ? false : 0; + } + } + + // don't allow collapsible: false and active: false + if ( !collapsible && active === false && this.anchors.length ) { + active = 0; + } + + return active; + }, + + _getCreateEventData: function() { + return { + tab: this.active, + panel: !this.active.length ? $() : this._getPanelForTab( this.active ) + }; + }, + + _tabKeydown: function( event ) { + /*jshint maxcomplexity:15*/ + var focusedTab = $( this.document[0].activeElement ).closest( "li" ), + selectedIndex = this.tabs.index( focusedTab ), + goingForward = true; + + if ( this._handlePageNav( event ) ) { + return; + } + + switch ( event.keyCode ) { + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + selectedIndex++; + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.LEFT: + goingForward = false; + selectedIndex--; + break; + case $.ui.keyCode.END: + selectedIndex = this.anchors.length - 1; + break; + case $.ui.keyCode.HOME: + selectedIndex = 0; + break; + case $.ui.keyCode.SPACE: + // Activate only, no collapsing + event.preventDefault(); + clearTimeout( this.activating ); + this._activate( selectedIndex ); + return; + case $.ui.keyCode.ENTER: + // Toggle (cancel delayed activation, allow collapsing) + event.preventDefault(); + clearTimeout( this.activating ); + // Determine if we should collapse or activate + this._activate( selectedIndex === this.options.active ? false : selectedIndex ); + return; + default: + return; + } + + // Focus the appropriate tab, based on which key was pressed + event.preventDefault(); + clearTimeout( this.activating ); + selectedIndex = this._focusNextTab( selectedIndex, goingForward ); + + // Navigating with control key will prevent automatic activation + if ( !event.ctrlKey ) { + // Update aria-selected immediately so that AT think the tab is already selected. + // Otherwise AT may confuse the user by stating that they need to activate the tab, + // but the tab will already be activated by the time the announcement finishes. + focusedTab.attr( "aria-selected", "false" ); + this.tabs.eq( selectedIndex ).attr( "aria-selected", "true" ); + + this.activating = this._delay(function() { + this.option( "active", selectedIndex ); + }, this.delay ); + } + }, + + _panelKeydown: function( event ) { + if ( this._handlePageNav( event ) ) { + return; + } + + // Ctrl+up moves focus to the current tab + if ( event.ctrlKey && event.keyCode === $.ui.keyCode.UP ) { + event.preventDefault(); + this.active.focus(); + } + }, + + // Alt+page up/down moves focus to the previous/next tab (and activates) + _handlePageNav: function( event ) { + if ( event.altKey && event.keyCode === $.ui.keyCode.PAGE_UP ) { + this._activate( this._focusNextTab( this.options.active - 1, false ) ); + return true; + } + if ( event.altKey && event.keyCode === $.ui.keyCode.PAGE_DOWN ) { + this._activate( this._focusNextTab( this.options.active + 1, true ) ); + return true; + } + }, + + _findNextTab: function( index, goingForward ) { + var lastTabIndex = this.tabs.length - 1; + + function constrain() { + if ( index > lastTabIndex ) { + index = 0; + } + if ( index < 0 ) { + index = lastTabIndex; + } + return index; + } + + while ( $.inArray( constrain(), this.options.disabled ) !== -1 ) { + index = goingForward ? index + 1 : index - 1; + } + + return index; + }, + + _focusNextTab: function( index, goingForward ) { + index = this._findNextTab( index, goingForward ); + this.tabs.eq( index ).focus(); + return index; + }, + + _setOption: function( key, value ) { + if ( key === "active" ) { + // _activate() will handle invalid values and update this.options + this._activate( value ); + return; + } + + if ( key === "disabled" ) { + // don't use the widget factory's disabled handling + this._setupDisabled( value ); + return; + } + + this._super( key, value); + + if ( key === "collapsible" ) { + this.element.toggleClass( "ui-tabs-collapsible", value ); + // Setting collapsible: false while collapsed; open first panel + if ( !value && this.options.active === false ) { + this._activate( 0 ); + } + } + + if ( key === "event" ) { + this._setupEvents( value ); + } + + if ( key === "heightStyle" ) { + this._setupHeightStyle( value ); + } + }, + + _tabId: function( tab ) { + return tab.attr( "aria-controls" ) || "ui-tabs-" + getNextTabId(); + }, + + _sanitizeSelector: function( hash ) { + return hash ? hash.replace( /[!"$%&'()*+,.\/:;<=>?@\[\]\^`{|}~]/g, "\\$&" ) : ""; + }, + + refresh: function() { + var options = this.options, + lis = this.tablist.children( ":has(a[href])" ); + + // get disabled tabs from class attribute from HTML + // this will get converted to a boolean if needed in _refresh() + options.disabled = $.map( lis.filter( ".ui-state-disabled" ), function( tab ) { + return lis.index( tab ); + }); + + this._processTabs(); + + // was collapsed or no tabs + if ( options.active === false || !this.anchors.length ) { + options.active = false; + this.active = $(); + // was active, but active tab is gone + } else if ( this.active.length && !$.contains( this.tablist[ 0 ], this.active[ 0 ] ) ) { + // all remaining tabs are disabled + if ( this.tabs.length === options.disabled.length ) { + options.active = false; + this.active = $(); + // activate previous tab + } else { + this._activate( this._findNextTab( Math.max( 0, options.active - 1 ), false ) ); + } + // was active, active tab still exists + } else { + // make sure active index is correct + options.active = this.tabs.index( this.active ); + } + + this._refresh(); + }, + + _refresh: function() { + this._setupDisabled( this.options.disabled ); + this._setupEvents( this.options.event ); + this._setupHeightStyle( this.options.heightStyle ); + + this.tabs.not( this.active ).attr({ + "aria-selected": "false", + tabIndex: -1 + }); + this.panels.not( this._getPanelForTab( this.active ) ) + .hide() + .attr({ + "aria-expanded": "false", + "aria-hidden": "true" + }); + + // Make sure one tab is in the tab order + if ( !this.active.length ) { + this.tabs.eq( 0 ).attr( "tabIndex", 0 ); + } else { + this.active + .addClass( "ui-tabs-active ui-state-active" ) + .attr({ + "aria-selected": "true", + tabIndex: 0 + }); + this._getPanelForTab( this.active ) + .show() + .attr({ + "aria-expanded": "true", + "aria-hidden": "false" + }); + } + }, + + _processTabs: function() { + var that = this; + + this.tablist = this._getList() + .addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ) + .attr( "role", "tablist" ); + + this.tabs = this.tablist.find( "> li:has(a[href])" ) + .addClass( "ui-state-default ui-corner-top" ) + .attr({ + role: "tab", + tabIndex: -1 + }); + + this.anchors = this.tabs.map(function() { + return $( "a", this )[ 0 ]; + }) + .addClass( "ui-tabs-anchor" ) + .attr({ + role: "presentation", + tabIndex: -1 + }); + + this.panels = $(); + + this.anchors.each(function( i, anchor ) { + var selector, panel, panelId, + anchorId = $( anchor ).uniqueId().attr( "id" ), + tab = $( anchor ).closest( "li" ), + originalAriaControls = tab.attr( "aria-controls" ); + + // inline tab + if ( isLocal( anchor ) ) { + selector = anchor.hash; + panel = that.element.find( that._sanitizeSelector( selector ) ); + // remote tab + } else { + panelId = that._tabId( tab ); + selector = "#" + panelId; + panel = that.element.find( selector ); + if ( !panel.length ) { + panel = that._createPanel( panelId ); + panel.insertAfter( that.panels[ i - 1 ] || that.tablist ); + } + panel.attr( "aria-live", "polite" ); + } + + if ( panel.length) { + that.panels = that.panels.add( panel ); + } + if ( originalAriaControls ) { + tab.data( "ui-tabs-aria-controls", originalAriaControls ); + } + tab.attr({ + "aria-controls": selector.substring( 1 ), + "aria-labelledby": anchorId + }); + panel.attr( "aria-labelledby", anchorId ); + }); + + this.panels + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .attr( "role", "tabpanel" ); + }, + + // allow overriding how to find the list for rare usage scenarios (#7715) + _getList: function() { + return this.element.find( "ol,ul" ).eq( 0 ); + }, + + _createPanel: function( id ) { + return $( "
        " ) + .attr( "id", id ) + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .data( "ui-tabs-destroy", true ); + }, + + _setupDisabled: function( disabled ) { + if ( $.isArray( disabled ) ) { + if ( !disabled.length ) { + disabled = false; + } else if ( disabled.length === this.anchors.length ) { + disabled = true; + } + } + + // disable tabs + for ( var i = 0, li; ( li = this.tabs[ i ] ); i++ ) { + if ( disabled === true || $.inArray( i, disabled ) !== -1 ) { + $( li ) + .addClass( "ui-state-disabled" ) + .attr( "aria-disabled", "true" ); + } else { + $( li ) + .removeClass( "ui-state-disabled" ) + .removeAttr( "aria-disabled" ); + } + } + + this.options.disabled = disabled; + }, + + _setupEvents: function( event ) { + var events = { + click: function( event ) { + event.preventDefault(); + } + }; + if ( event ) { + $.each( event.split(" "), function( index, eventName ) { + events[ eventName ] = "_eventHandler"; + }); + } + + this._off( this.anchors.add( this.tabs ).add( this.panels ) ); + this._on( this.anchors, events ); + this._on( this.tabs, { keydown: "_tabKeydown" } ); + this._on( this.panels, { keydown: "_panelKeydown" } ); + + this._focusable( this.tabs ); + this._hoverable( this.tabs ); + }, + + _setupHeightStyle: function( heightStyle ) { + var maxHeight, + parent = this.element.parent(); + + if ( heightStyle === "fill" ) { + maxHeight = parent.height(); + maxHeight -= this.element.outerHeight() - this.element.height(); + + this.element.siblings( ":visible" ).each(function() { + var elem = $( this ), + position = elem.css( "position" ); + + if ( position === "absolute" || position === "fixed" ) { + return; + } + maxHeight -= elem.outerHeight( true ); + }); + + this.element.children().not( this.panels ).each(function() { + maxHeight -= $( this ).outerHeight( true ); + }); + + this.panels.each(function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + }) + .css( "overflow", "auto" ); + } else if ( heightStyle === "auto" ) { + maxHeight = 0; + this.panels.each(function() { + maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() ); + }).height( maxHeight ); + } + }, + + _eventHandler: function( event ) { + var options = this.options, + active = this.active, + anchor = $( event.currentTarget ), + tab = anchor.closest( "li" ), + clickedIsActive = tab[ 0 ] === active[ 0 ], + collapsing = clickedIsActive && options.collapsible, + toShow = collapsing ? $() : this._getPanelForTab( tab ), + toHide = !active.length ? $() : this._getPanelForTab( active ), + eventData = { + oldTab: active, + oldPanel: toHide, + newTab: collapsing ? $() : tab, + newPanel: toShow + }; + + event.preventDefault(); + + if ( tab.hasClass( "ui-state-disabled" ) || + // tab is already loading + tab.hasClass( "ui-tabs-loading" ) || + // can't switch durning an animation + this.running || + // click on active header, but not collapsible + ( clickedIsActive && !options.collapsible ) || + // allow canceling activation + ( this._trigger( "beforeActivate", event, eventData ) === false ) ) { + return; + } + + options.active = collapsing ? false : this.tabs.index( tab ); + + this.active = clickedIsActive ? $() : tab; + if ( this.xhr ) { + this.xhr.abort(); + } + + if ( !toHide.length && !toShow.length ) { + $.error( "jQuery UI Tabs: Mismatching fragment identifier." ); + } + + if ( toShow.length ) { + this.load( this.tabs.index( tab ), event ); + } + this._toggle( event, eventData ); + }, + + // handles show/hide for selecting tabs + _toggle: function( event, eventData ) { + var that = this, + toShow = eventData.newPanel, + toHide = eventData.oldPanel; + + this.running = true; + + function complete() { + that.running = false; + that._trigger( "activate", event, eventData ); + } + + function show() { + eventData.newTab.closest( "li" ).addClass( "ui-tabs-active ui-state-active" ); + + if ( toShow.length && that.options.show ) { + that._show( toShow, that.options.show, complete ); + } else { + toShow.show(); + complete(); + } + } + + // start out by hiding, then showing, then completing + if ( toHide.length && this.options.hide ) { + this._hide( toHide, this.options.hide, function() { + eventData.oldTab.closest( "li" ).removeClass( "ui-tabs-active ui-state-active" ); + show(); + }); + } else { + eventData.oldTab.closest( "li" ).removeClass( "ui-tabs-active ui-state-active" ); + toHide.hide(); + show(); + } + + toHide.attr({ + "aria-expanded": "false", + "aria-hidden": "true" + }); + eventData.oldTab.attr( "aria-selected", "false" ); + // If we're switching tabs, remove the old tab from the tab order. + // If we're opening from collapsed state, remove the previous tab from the tab order. + // If we're collapsing, then keep the collapsing tab in the tab order. + if ( toShow.length && toHide.length ) { + eventData.oldTab.attr( "tabIndex", -1 ); + } else if ( toShow.length ) { + this.tabs.filter(function() { + return $( this ).attr( "tabIndex" ) === 0; + }) + .attr( "tabIndex", -1 ); + } + + toShow.attr({ + "aria-expanded": "true", + "aria-hidden": "false" + }); + eventData.newTab.attr({ + "aria-selected": "true", + tabIndex: 0 + }); + }, + + _activate: function( index ) { + var anchor, + active = this._findActive( index ); + + // trying to activate the already active panel + if ( active[ 0 ] === this.active[ 0 ] ) { + return; + } + + // trying to collapse, simulate a click on the current active header + if ( !active.length ) { + active = this.active; + } + + anchor = active.find( ".ui-tabs-anchor" )[ 0 ]; + this._eventHandler({ + target: anchor, + currentTarget: anchor, + preventDefault: $.noop + }); + }, + + _findActive: function( index ) { + return index === false ? $() : this.tabs.eq( index ); + }, + + _getIndex: function( index ) { + // meta-function to give users option to provide a href string instead of a numerical index. + if ( typeof index === "string" ) { + index = this.anchors.index( this.anchors.filter( "[href$='" + index + "']" ) ); + } + + return index; + }, + + _destroy: function() { + if ( this.xhr ) { + this.xhr.abort(); + } + + this.element.removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ); + + this.tablist + .removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ) + .removeAttr( "role" ); + + this.anchors + .removeClass( "ui-tabs-anchor" ) + .removeAttr( "role" ) + .removeAttr( "tabIndex" ) + .removeUniqueId(); + + this.tabs.add( this.panels ).each(function() { + if ( $.data( this, "ui-tabs-destroy" ) ) { + $( this ).remove(); + } else { + $( this ) + .removeClass( "ui-state-default ui-state-active ui-state-disabled " + + "ui-corner-top ui-corner-bottom ui-widget-content ui-tabs-active ui-tabs-panel" ) + .removeAttr( "tabIndex" ) + .removeAttr( "aria-live" ) + .removeAttr( "aria-busy" ) + .removeAttr( "aria-selected" ) + .removeAttr( "aria-labelledby" ) + .removeAttr( "aria-hidden" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "role" ); + } + }); + + this.tabs.each(function() { + var li = $( this ), + prev = li.data( "ui-tabs-aria-controls" ); + if ( prev ) { + li + .attr( "aria-controls", prev ) + .removeData( "ui-tabs-aria-controls" ); + } else { + li.removeAttr( "aria-controls" ); + } + }); + + this.panels.show(); + + if ( this.options.heightStyle !== "content" ) { + this.panels.css( "height", "" ); + } + }, + + enable: function( index ) { + var disabled = this.options.disabled; + if ( disabled === false ) { + return; + } + + if ( index === undefined ) { + disabled = false; + } else { + index = this._getIndex( index ); + if ( $.isArray( disabled ) ) { + disabled = $.map( disabled, function( num ) { + return num !== index ? num : null; + }); + } else { + disabled = $.map( this.tabs, function( li, num ) { + return num !== index ? num : null; + }); + } + } + this._setupDisabled( disabled ); + }, + + disable: function( index ) { + var disabled = this.options.disabled; + if ( disabled === true ) { + return; + } + + if ( index === undefined ) { + disabled = true; + } else { + index = this._getIndex( index ); + if ( $.inArray( index, disabled ) !== -1 ) { + return; + } + if ( $.isArray( disabled ) ) { + disabled = $.merge( [ index ], disabled ).sort(); + } else { + disabled = [ index ]; + } + } + this._setupDisabled( disabled ); + }, + + load: function( index, event ) { + index = this._getIndex( index ); + var that = this, + tab = this.tabs.eq( index ), + anchor = tab.find( ".ui-tabs-anchor" ), + panel = this._getPanelForTab( tab ), + eventData = { + tab: tab, + panel: panel + }; + + // not remote + if ( isLocal( anchor[ 0 ] ) ) { + return; + } + + this.xhr = $.ajax( this._ajaxSettings( anchor, event, eventData ) ); + + // support: jQuery <1.8 + // jQuery <1.8 returns false if the request is canceled in beforeSend, + // but as of 1.8, $.ajax() always returns a jqXHR object. + if ( this.xhr && this.xhr.statusText !== "canceled" ) { + tab.addClass( "ui-tabs-loading" ); + panel.attr( "aria-busy", "true" ); + + this.xhr + .success(function( response ) { + // support: jQuery <1.8 + // http://bugs.jquery.com/ticket/11778 + setTimeout(function() { + panel.html( response ); + that._trigger( "load", event, eventData ); + }, 1 ); + }) + .complete(function( jqXHR, status ) { + // support: jQuery <1.8 + // http://bugs.jquery.com/ticket/11778 + setTimeout(function() { + if ( status === "abort" ) { + that.panels.stop( false, true ); + } + + tab.removeClass( "ui-tabs-loading" ); + panel.removeAttr( "aria-busy" ); + + if ( jqXHR === that.xhr ) { + delete that.xhr; + } + }, 1 ); + }); + } + }, + + _ajaxSettings: function( anchor, event, eventData ) { + var that = this; + return { + url: anchor.attr( "href" ), + beforeSend: function( jqXHR, settings ) { + return that._trigger( "beforeLoad", event, + $.extend( { jqXHR : jqXHR, ajaxSettings: settings }, eventData ) ); + } + }; + }, + + _getPanelForTab: function( tab ) { + var id = $( tab ).attr( "aria-controls" ); + return this.element.find( this._sanitizeSelector( "#" + id ) ); + } +}); + +})( jQuery ); + +(function( $ ) { + +var increments = 0; + +function addDescribedBy( elem, id ) { + var describedby = (elem.attr( "aria-describedby" ) || "").split( /\s+/ ); + describedby.push( id ); + elem + .data( "ui-tooltip-id", id ) + .attr( "aria-describedby", $.trim( describedby.join( " " ) ) ); +} + +function removeDescribedBy( elem ) { + var id = elem.data( "ui-tooltip-id" ), + describedby = (elem.attr( "aria-describedby" ) || "").split( /\s+/ ), + index = $.inArray( id, describedby ); + if ( index !== -1 ) { + describedby.splice( index, 1 ); + } + + elem.removeData( "ui-tooltip-id" ); + describedby = $.trim( describedby.join( " " ) ); + if ( describedby ) { + elem.attr( "aria-describedby", describedby ); + } else { + elem.removeAttr( "aria-describedby" ); + } +} + +$.widget( "ui.tooltip", { + version: "1.10.2", + options: { + content: function() { + // support: IE<9, Opera in jQuery <1.7 + // .text() can't accept undefined, so coerce to a string + var title = $( this ).attr( "title" ) || ""; + // Escape title, since we're going from an attribute to raw HTML + return $( "" ).text( title ).html(); + }, + hide: true, + // Disabled elements have inconsistent behavior across browsers (#8661) + items: "[title]:not([disabled])", + position: { + my: "left top+15", + at: "left bottom", + collision: "flipfit flip" + }, + show: true, + tooltipClass: null, + track: false, + + // callbacks + close: null, + open: null + }, + + _create: function() { + this._on({ + mouseover: "open", + focusin: "open" + }); + + // IDs of generated tooltips, needed for destroy + this.tooltips = {}; + // IDs of parent tooltips where we removed the title attribute + this.parents = {}; + + if ( this.options.disabled ) { + this._disable(); + } + }, + + _setOption: function( key, value ) { + var that = this; + + if ( key === "disabled" ) { + this[ value ? "_disable" : "_enable" ](); + this.options[ key ] = value; + // disable element style changes + return; + } + + this._super( key, value ); + + if ( key === "content" ) { + $.each( this.tooltips, function( id, element ) { + that._updateContent( element ); + }); + } + }, + + _disable: function() { + var that = this; + + // close open tooltips + $.each( this.tooltips, function( id, element ) { + var event = $.Event( "blur" ); + event.target = event.currentTarget = element[0]; + that.close( event, true ); + }); + + // remove title attributes to prevent native tooltips + this.element.find( this.options.items ).addBack().each(function() { + var element = $( this ); + if ( element.is( "[title]" ) ) { + element + .data( "ui-tooltip-title", element.attr( "title" ) ) + .attr( "title", "" ); + } + }); + }, + + _enable: function() { + // restore title attributes + this.element.find( this.options.items ).addBack().each(function() { + var element = $( this ); + if ( element.data( "ui-tooltip-title" ) ) { + element.attr( "title", element.data( "ui-tooltip-title" ) ); + } + }); + }, + + open: function( event ) { + var that = this, + target = $( event ? event.target : this.element ) + // we need closest here due to mouseover bubbling, + // but always pointing at the same event target + .closest( this.options.items ); + + // No element to show a tooltip for or the tooltip is already open + if ( !target.length || target.data( "ui-tooltip-id" ) ) { + return; + } + + if ( target.attr( "title" ) ) { + target.data( "ui-tooltip-title", target.attr( "title" ) ); + } + + target.data( "ui-tooltip-open", true ); + + // kill parent tooltips, custom or native, for hover + if ( event && event.type === "mouseover" ) { + target.parents().each(function() { + var parent = $( this ), + blurEvent; + if ( parent.data( "ui-tooltip-open" ) ) { + blurEvent = $.Event( "blur" ); + blurEvent.target = blurEvent.currentTarget = this; + that.close( blurEvent, true ); + } + if ( parent.attr( "title" ) ) { + parent.uniqueId(); + that.parents[ this.id ] = { + element: this, + title: parent.attr( "title" ) + }; + parent.attr( "title", "" ); + } + }); + } + + this._updateContent( target, event ); + }, + + _updateContent: function( target, event ) { + var content, + contentOption = this.options.content, + that = this, + eventType = event ? event.type : null; + + if ( typeof contentOption === "string" ) { + return this._open( event, target, contentOption ); + } + + content = contentOption.call( target[0], function( response ) { + // ignore async response if tooltip was closed already + if ( !target.data( "ui-tooltip-open" ) ) { + return; + } + // IE may instantly serve a cached response for ajax requests + // delay this call to _open so the other call to _open runs first + that._delay(function() { + // jQuery creates a special event for focusin when it doesn't + // exist natively. To improve performance, the native event + // object is reused and the type is changed. Therefore, we can't + // rely on the type being correct after the event finished + // bubbling, so we set it back to the previous value. (#8740) + if ( event ) { + event.type = eventType; + } + this._open( event, target, response ); + }); + }); + if ( content ) { + this._open( event, target, content ); + } + }, + + _open: function( event, target, content ) { + var tooltip, events, delayedShow, + positionOption = $.extend( {}, this.options.position ); + + if ( !content ) { + return; + } + + // Content can be updated multiple times. If the tooltip already + // exists, then just update the content and bail. + tooltip = this._find( target ); + if ( tooltip.length ) { + tooltip.find( ".ui-tooltip-content" ).html( content ); + return; + } + + // if we have a title, clear it to prevent the native tooltip + // we have to check first to avoid defining a title if none exists + // (we don't want to cause an element to start matching [title]) + // + // We use removeAttr only for key events, to allow IE to export the correct + // accessible attributes. For mouse events, set to empty string to avoid + // native tooltip showing up (happens only when removing inside mouseover). + if ( target.is( "[title]" ) ) { + if ( event && event.type === "mouseover" ) { + target.attr( "title", "" ); + } else { + target.removeAttr( "title" ); + } + } + + tooltip = this._tooltip( target ); + addDescribedBy( target, tooltip.attr( "id" ) ); + tooltip.find( ".ui-tooltip-content" ).html( content ); + + function position( event ) { + positionOption.of = event; + if ( tooltip.is( ":hidden" ) ) { + return; + } + tooltip.position( positionOption ); + } + if ( this.options.track && event && /^mouse/.test( event.type ) ) { + this._on( this.document, { + mousemove: position + }); + // trigger once to override element-relative positioning + position( event ); + } else { + tooltip.position( $.extend({ + of: target + }, this.options.position ) ); + } + + tooltip.hide(); + + this._show( tooltip, this.options.show ); + // Handle tracking tooltips that are shown with a delay (#8644). As soon + // as the tooltip is visible, position the tooltip using the most recent + // event. + if ( this.options.show && this.options.show.delay ) { + delayedShow = this.delayedShow = setInterval(function() { + if ( tooltip.is( ":visible" ) ) { + position( positionOption.of ); + clearInterval( delayedShow ); + } + }, $.fx.interval ); + } + + this._trigger( "open", event, { tooltip: tooltip } ); + + events = { + keyup: function( event ) { + if ( event.keyCode === $.ui.keyCode.ESCAPE ) { + var fakeEvent = $.Event(event); + fakeEvent.currentTarget = target[0]; + this.close( fakeEvent, true ); + } + }, + remove: function() { + this._removeTooltip( tooltip ); + } + }; + if ( !event || event.type === "mouseover" ) { + events.mouseleave = "close"; + } + if ( !event || event.type === "focusin" ) { + events.focusout = "close"; + } + this._on( true, target, events ); + }, + + close: function( event ) { + var that = this, + target = $( event ? event.currentTarget : this.element ), + tooltip = this._find( target ); + + // disabling closes the tooltip, so we need to track when we're closing + // to avoid an infinite loop in case the tooltip becomes disabled on close + if ( this.closing ) { + return; + } + + // Clear the interval for delayed tracking tooltips + clearInterval( this.delayedShow ); + + // only set title if we had one before (see comment in _open()) + if ( target.data( "ui-tooltip-title" ) ) { + target.attr( "title", target.data( "ui-tooltip-title" ) ); + } + + removeDescribedBy( target ); + + tooltip.stop( true ); + this._hide( tooltip, this.options.hide, function() { + that._removeTooltip( $( this ) ); + }); + + target.removeData( "ui-tooltip-open" ); + this._off( target, "mouseleave focusout keyup" ); + // Remove 'remove' binding only on delegated targets + if ( target[0] !== this.element[0] ) { + this._off( target, "remove" ); + } + this._off( this.document, "mousemove" ); + + if ( event && event.type === "mouseleave" ) { + $.each( this.parents, function( id, parent ) { + $( parent.element ).attr( "title", parent.title ); + delete that.parents[ id ]; + }); + } + + this.closing = true; + this._trigger( "close", event, { tooltip: tooltip } ); + this.closing = false; + }, + + _tooltip: function( element ) { + var id = "ui-tooltip-" + increments++, + tooltip = $( "
        " ) + .attr({ + id: id, + role: "tooltip" + }) + .addClass( "ui-tooltip ui-widget ui-corner-all ui-widget-content " + + ( this.options.tooltipClass || "" ) ); + $( "
        " ) + .addClass( "ui-tooltip-content" ) + .appendTo( tooltip ); + tooltip.appendTo( this.document[0].body ); + this.tooltips[ id ] = element; + return tooltip; + }, + + _find: function( target ) { + var id = target.data( "ui-tooltip-id" ); + return id ? $( "#" + id ) : $(); + }, + + _removeTooltip: function( tooltip ) { + tooltip.remove(); + delete this.tooltips[ tooltip.attr( "id" ) ]; + }, + + _destroy: function() { + var that = this; + + // close open tooltips + $.each( this.tooltips, function( id, element ) { + // Delegate to close method to handle common cleanup + var event = $.Event( "blur" ); + event.target = event.currentTarget = element[0]; + that.close( event, true ); + + // Remove immediately; destroying an open tooltip doesn't use the + // hide animation + $( "#" + id ).remove(); + + // Restore the title + if ( element.data( "ui-tooltip-title" ) ) { + element.attr( "title", element.data( "ui-tooltip-title" ) ); + element.removeData( "ui-tooltip-title" ); + } + }); + } +}); + +}( jQuery ) ); diff --git a/web/external/jquery/jquery-1.9.1.js b/web/external/jquery/jquery-1.9.1.js new file mode 100644 index 0000000..e2c203f --- /dev/null +++ b/web/external/jquery/jquery-1.9.1.js @@ -0,0 +1,9597 @@ +/*! + * jQuery JavaScript Library v1.9.1 + * http://jquery.com/ + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * + * Copyright 2005, 2012 jQuery Foundation, Inc. and other contributors + * Released under the MIT license + * http://jquery.org/license + * + * Date: 2013-2-4 + */ +(function( window, undefined ) { + +// Can't do this because several apps including ASP.NET trace +// the stack via arguments.caller.callee and Firefox dies if +// you try to trace through "use strict" call chains. (#13335) +// Support: Firefox 18+ +//"use strict"; +var + // The deferred used on DOM ready + readyList, + + // A central reference to the root jQuery(document) + rootjQuery, + + // Support: IE<9 + // For `typeof node.method` instead of `node.method !== undefined` + core_strundefined = typeof undefined, + + // Use the correct document accordingly with window argument (sandbox) + document = window.document, + location = window.location, + + // Map over jQuery in case of overwrite + _jQuery = window.jQuery, + + // Map over the $ in case of overwrite + _$ = window.$, + + // [[Class]] -> type pairs + class2type = {}, + + // List of deleted data cache ids, so we can reuse them + core_deletedIds = [], + + core_version = "1.9.1", + + // Save a reference to some core methods + core_concat = core_deletedIds.concat, + core_push = core_deletedIds.push, + core_slice = core_deletedIds.slice, + core_indexOf = core_deletedIds.indexOf, + core_toString = class2type.toString, + core_hasOwn = class2type.hasOwnProperty, + core_trim = core_version.trim, + + // Define a local copy of jQuery + jQuery = function( selector, context ) { + // The jQuery object is actually just the init constructor 'enhanced' + return new jQuery.fn.init( selector, context, rootjQuery ); + }, + + // Used for matching numbers + core_pnum = /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/.source, + + // Used for splitting on whitespace + core_rnotwhite = /\S+/g, + + // Make sure we trim BOM and NBSP (here's looking at you, Safari 5.0 and IE) + rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g, + + // A simple way to check for HTML strings + // Prioritize #id over to avoid XSS via location.hash (#9521) + // Strict HTML recognition (#11290: must start with <) + rquickExpr = /^(?:(<[\w\W]+>)[^>]*|#([\w-]*))$/, + + // Match a standalone tag + rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>|)$/, + + // JSON RegExp + rvalidchars = /^[\],:{}\s]*$/, + rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g, + rvalidescape = /\\(?:["\\\/bfnrt]|u[\da-fA-F]{4})/g, + rvalidtokens = /"[^"\\\r\n]*"|true|false|null|-?(?:\d+\.|)\d+(?:[eE][+-]?\d+|)/g, + + // Matches dashed string for camelizing + rmsPrefix = /^-ms-/, + rdashAlpha = /-([\da-z])/gi, + + // Used by jQuery.camelCase as callback to replace() + fcamelCase = function( all, letter ) { + return letter.toUpperCase(); + }, + + // The ready event handler + completed = function( event ) { + + // readyState === "complete" is good enough for us to call the dom ready in oldIE + if ( document.addEventListener || event.type === "load" || document.readyState === "complete" ) { + detach(); + jQuery.ready(); + } + }, + // Clean-up method for dom ready events + detach = function() { + if ( document.addEventListener ) { + document.removeEventListener( "DOMContentLoaded", completed, false ); + window.removeEventListener( "load", completed, false ); + + } else { + document.detachEvent( "onreadystatechange", completed ); + window.detachEvent( "onload", completed ); + } + }; + +jQuery.fn = jQuery.prototype = { + // The current version of jQuery being used + jquery: core_version, + + constructor: jQuery, + init: function( selector, context, rootjQuery ) { + var match, elem; + + // HANDLE: $(""), $(null), $(undefined), $(false) + if ( !selector ) { + return this; + } + + // Handle HTML strings + if ( typeof selector === "string" ) { + if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) { + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = rquickExpr.exec( selector ); + } + + // Match html or make sure no context is specified for #id + if ( match && (match[1] || !context) ) { + + // HANDLE: $(html) -> $(array) + if ( match[1] ) { + context = context instanceof jQuery ? context[0] : context; + + // scripts is true for back-compat + jQuery.merge( this, jQuery.parseHTML( + match[1], + context && context.nodeType ? context.ownerDocument || context : document, + true + ) ); + + // HANDLE: $(html, props) + if ( rsingleTag.test( match[1] ) && jQuery.isPlainObject( context ) ) { + for ( match in context ) { + // Properties of context are called as methods if possible + if ( jQuery.isFunction( this[ match ] ) ) { + this[ match ]( context[ match ] ); + + // ...and otherwise set as attributes + } else { + this.attr( match, context[ match ] ); + } + } + } + + return this; + + // HANDLE: $(#id) + } else { + elem = document.getElementById( match[2] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id !== match[2] ) { + return rootjQuery.find( selector ); + } + + // Otherwise, we inject the element directly into the jQuery object + this.length = 1; + this[0] = elem; + } + + this.context = document; + this.selector = selector; + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return ( context || rootjQuery ).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(DOMElement) + } else if ( selector.nodeType ) { + this.context = this[0] = selector; + this.length = 1; + return this; + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( jQuery.isFunction( selector ) ) { + return rootjQuery.ready( selector ); + } + + if ( selector.selector !== undefined ) { + this.selector = selector.selector; + this.context = selector.context; + } + + return jQuery.makeArray( selector, this ); + }, + + // Start with an empty selector + selector: "", + + // The default length of a jQuery object is 0 + length: 0, + + // The number of elements contained in the matched element set + size: function() { + return this.length; + }, + + toArray: function() { + return core_slice.call( this ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + return num == null ? + + // Return a 'clean' array + this.toArray() : + + // Return just the object + ( num < 0 ? this[ this.length + num ] : this[ num ] ); + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems ) { + + // Build a new jQuery matched element set + var ret = jQuery.merge( this.constructor(), elems ); + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + ret.context = this.context; + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + // (You can seed the arguments with an array of args, but this is + // only used internally.) + each: function( callback, args ) { + return jQuery.each( this, callback, args ); + }, + + ready: function( fn ) { + // Add the callback + jQuery.ready.promise().done( fn ); + + return this; + }, + + slice: function() { + return this.pushStack( core_slice.apply( this, arguments ) ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + eq: function( i ) { + var len = this.length, + j = +i + ( i < 0 ? len : 0 ); + return this.pushStack( j >= 0 && j < len ? [ this[j] ] : [] ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map(this, function( elem, i ) { + return callback.call( elem, i, elem ); + })); + }, + + end: function() { + return this.prevObject || this.constructor(null); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: core_push, + sort: [].sort, + splice: [].splice +}; + +// Give the init function the jQuery prototype for later instantiation +jQuery.fn.init.prototype = jQuery.fn; + +jQuery.extend = jQuery.fn.extend = function() { + var src, copyIsArray, copy, name, options, clone, + target = arguments[0] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction(target) ) { + target = {}; + } + + // extend jQuery itself if only one argument is passed + if ( length === i ) { + target = this; + --i; + } + + for ( ; i < length; i++ ) { + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) { + // Extend the base object + for ( name in options ) { + src = target[ name ]; + copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) { + if ( copyIsArray ) { + copyIsArray = false; + clone = src && jQuery.isArray(src) ? src : []; + + } else { + clone = src && jQuery.isPlainObject(src) ? src : {}; + } + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend({ + noConflict: function( deep ) { + if ( window.$ === jQuery ) { + window.$ = _$; + } + + if ( deep && window.jQuery === jQuery ) { + window.jQuery = _jQuery; + } + + return jQuery; + }, + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Hold (or release) the ready event + holdReady: function( hold ) { + if ( hold ) { + jQuery.readyWait++; + } else { + jQuery.ready( true ); + } + }, + + // Handle when the DOM is ready + ready: function( wait ) { + + // Abort if there are pending holds or we're already ready + if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) { + return; + } + + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( !document.body ) { + return setTimeout( jQuery.ready ); + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.resolveWith( document, [ jQuery ] ); + + // Trigger any bound ready events + if ( jQuery.fn.trigger ) { + jQuery( document ).trigger("ready").off("ready"); + } + }, + + // See test/unit/core.js for details concerning isFunction. + // Since version 1.3, DOM methods and functions like alert + // aren't supported. They return false on IE (#2968). + isFunction: function( obj ) { + return jQuery.type(obj) === "function"; + }, + + isArray: Array.isArray || function( obj ) { + return jQuery.type(obj) === "array"; + }, + + isWindow: function( obj ) { + return obj != null && obj == obj.window; + }, + + isNumeric: function( obj ) { + return !isNaN( parseFloat(obj) ) && isFinite( obj ); + }, + + type: function( obj ) { + if ( obj == null ) { + return String( obj ); + } + return typeof obj === "object" || typeof obj === "function" ? + class2type[ core_toString.call(obj) ] || "object" : + typeof obj; + }, + + isPlainObject: function( obj ) { + // Must be an Object. + // Because of IE, we also have to check the presence of the constructor property. + // Make sure that DOM nodes and window objects don't pass through, as well + if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) { + return false; + } + + try { + // Not own constructor property must be Object + if ( obj.constructor && + !core_hasOwn.call(obj, "constructor") && + !core_hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { + return false; + } + } catch ( e ) { + // IE8,9 Will throw exceptions on certain host objects #9897 + return false; + } + + // Own properties are enumerated firstly, so to speed up, + // if last one is own, then all properties are own. + + var key; + for ( key in obj ) {} + + return key === undefined || core_hasOwn.call( obj, key ); + }, + + isEmptyObject: function( obj ) { + var name; + for ( name in obj ) { + return false; + } + return true; + }, + + error: function( msg ) { + throw new Error( msg ); + }, + + // data: string of html + // context (optional): If specified, the fragment will be created in this context, defaults to document + // keepScripts (optional): If true, will include scripts passed in the html string + parseHTML: function( data, context, keepScripts ) { + if ( !data || typeof data !== "string" ) { + return null; + } + if ( typeof context === "boolean" ) { + keepScripts = context; + context = false; + } + context = context || document; + + var parsed = rsingleTag.exec( data ), + scripts = !keepScripts && []; + + // Single tag + if ( parsed ) { + return [ context.createElement( parsed[1] ) ]; + } + + parsed = jQuery.buildFragment( [ data ], context, scripts ); + if ( scripts ) { + jQuery( scripts ).remove(); + } + return jQuery.merge( [], parsed.childNodes ); + }, + + parseJSON: function( data ) { + // Attempt to parse using the native JSON parser first + if ( window.JSON && window.JSON.parse ) { + return window.JSON.parse( data ); + } + + if ( data === null ) { + return data; + } + + if ( typeof data === "string" ) { + + // Make sure leading/trailing whitespace is removed (IE can't handle it) + data = jQuery.trim( data ); + + if ( data ) { + // Make sure the incoming data is actual JSON + // Logic borrowed from http://json.org/json2.js + if ( rvalidchars.test( data.replace( rvalidescape, "@" ) + .replace( rvalidtokens, "]" ) + .replace( rvalidbraces, "")) ) { + + return ( new Function( "return " + data ) )(); + } + } + } + + jQuery.error( "Invalid JSON: " + data ); + }, + + // Cross-browser xml parsing + parseXML: function( data ) { + var xml, tmp; + if ( !data || typeof data !== "string" ) { + return null; + } + try { + if ( window.DOMParser ) { // Standard + tmp = new DOMParser(); + xml = tmp.parseFromString( data , "text/xml" ); + } else { // IE + xml = new ActiveXObject( "Microsoft.XMLDOM" ); + xml.async = "false"; + xml.loadXML( data ); + } + } catch( e ) { + xml = undefined; + } + if ( !xml || !xml.documentElement || xml.getElementsByTagName( "parsererror" ).length ) { + jQuery.error( "Invalid XML: " + data ); + } + return xml; + }, + + noop: function() {}, + + // Evaluates a script in a global context + // Workarounds based on findings by Jim Driscoll + // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context + globalEval: function( data ) { + if ( data && jQuery.trim( data ) ) { + // We use execScript on Internet Explorer + // We use an anonymous function so that context is window + // rather than jQuery in Firefox + ( window.execScript || function( data ) { + window[ "eval" ].call( window, data ); + } )( data ); + } + }, + + // Convert dashed to camelCase; used by the css and data modules + // Microsoft forgot to hump their vendor prefix (#9572) + camelCase: function( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); + }, + + nodeName: function( elem, name ) { + return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase(); + }, + + // args is for internal usage only + each: function( obj, callback, args ) { + var value, + i = 0, + length = obj.length, + isArray = isArraylike( obj ); + + if ( args ) { + if ( isArray ) { + for ( ; i < length; i++ ) { + value = callback.apply( obj[ i ], args ); + + if ( value === false ) { + break; + } + } + } else { + for ( i in obj ) { + value = callback.apply( obj[ i ], args ); + + if ( value === false ) { + break; + } + } + } + + // A special, fast, case for the most common use of each + } else { + if ( isArray ) { + for ( ; i < length; i++ ) { + value = callback.call( obj[ i ], i, obj[ i ] ); + + if ( value === false ) { + break; + } + } + } else { + for ( i in obj ) { + value = callback.call( obj[ i ], i, obj[ i ] ); + + if ( value === false ) { + break; + } + } + } + } + + return obj; + }, + + // Use native String.trim function wherever possible + trim: core_trim && !core_trim.call("\uFEFF\xA0") ? + function( text ) { + return text == null ? + "" : + core_trim.call( text ); + } : + + // Otherwise use our own trimming functionality + function( text ) { + return text == null ? + "" : + ( text + "" ).replace( rtrim, "" ); + }, + + // results is for internal usage only + makeArray: function( arr, results ) { + var ret = results || []; + + if ( arr != null ) { + if ( isArraylike( Object(arr) ) ) { + jQuery.merge( ret, + typeof arr === "string" ? + [ arr ] : arr + ); + } else { + core_push.call( ret, arr ); + } + } + + return ret; + }, + + inArray: function( elem, arr, i ) { + var len; + + if ( arr ) { + if ( core_indexOf ) { + return core_indexOf.call( arr, elem, i ); + } + + len = arr.length; + i = i ? i < 0 ? Math.max( 0, len + i ) : i : 0; + + for ( ; i < len; i++ ) { + // Skip accessing in sparse arrays + if ( i in arr && arr[ i ] === elem ) { + return i; + } + } + } + + return -1; + }, + + merge: function( first, second ) { + var l = second.length, + i = first.length, + j = 0; + + if ( typeof l === "number" ) { + for ( ; j < l; j++ ) { + first[ i++ ] = second[ j ]; + } + } else { + while ( second[j] !== undefined ) { + first[ i++ ] = second[ j++ ]; + } + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, inv ) { + var retVal, + ret = [], + i = 0, + length = elems.length; + inv = !!inv; + + // Go through the array, only saving the items + // that pass the validator function + for ( ; i < length; i++ ) { + retVal = !!callback( elems[ i ], i ); + if ( inv !== retVal ) { + ret.push( elems[ i ] ); + } + } + + return ret; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var value, + i = 0, + length = elems.length, + isArray = isArraylike( elems ), + ret = []; + + // Go through the array, translating each of the items to their + if ( isArray ) { + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + + // Go through every key on the object, + } else { + for ( i in elems ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + } + + // Flatten any nested arrays + return core_concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // Bind a function to a context, optionally partially applying any + // arguments. + proxy: function( fn, context ) { + var args, proxy, tmp; + + if ( typeof context === "string" ) { + tmp = fn[ context ]; + context = fn; + fn = tmp; + } + + // Quick check to determine if target is callable, in the spec + // this throws a TypeError, but we will just return undefined. + if ( !jQuery.isFunction( fn ) ) { + return undefined; + } + + // Simulated bind + args = core_slice.call( arguments, 2 ); + proxy = function() { + return fn.apply( context || this, args.concat( core_slice.call( arguments ) ) ); + }; + + // Set the guid of unique handler to the same of original handler, so it can be removed + proxy.guid = fn.guid = fn.guid || jQuery.guid++; + + return proxy; + }, + + // Multifunctional method to get and set values of a collection + // The value/s can optionally be executed if it's a function + access: function( elems, fn, key, value, chainable, emptyGet, raw ) { + var i = 0, + length = elems.length, + bulk = key == null; + + // Sets many values + if ( jQuery.type( key ) === "object" ) { + chainable = true; + for ( i in key ) { + jQuery.access( elems, fn, i, key[i], true, emptyGet, raw ); + } + + // Sets one value + } else if ( value !== undefined ) { + chainable = true; + + if ( !jQuery.isFunction( value ) ) { + raw = true; + } + + if ( bulk ) { + // Bulk operations run against the entire set + if ( raw ) { + fn.call( elems, value ); + fn = null; + + // ...except when executing function values + } else { + bulk = fn; + fn = function( elem, key, value ) { + return bulk.call( jQuery( elem ), value ); + }; + } + } + + if ( fn ) { + for ( ; i < length; i++ ) { + fn( elems[i], key, raw ? value : value.call( elems[i], i, fn( elems[i], key ) ) ); + } + } + } + + return chainable ? + elems : + + // Gets + bulk ? + fn.call( elems ) : + length ? fn( elems[0], key ) : emptyGet; + }, + + now: function() { + return ( new Date() ).getTime(); + } +}); + +jQuery.ready.promise = function( obj ) { + if ( !readyList ) { + + readyList = jQuery.Deferred(); + + // Catch cases where $(document).ready() is called after the browser event has already occurred. + // we once tried to use readyState "interactive" here, but it caused issues like the one + // discovered by ChrisS here: http://bugs.jquery.com/ticket/12282#comment:15 + if ( document.readyState === "complete" ) { + // Handle it asynchronously to allow scripts the opportunity to delay ready + setTimeout( jQuery.ready ); + + // Standards-based browsers support DOMContentLoaded + } else if ( document.addEventListener ) { + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", completed, false ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", completed, false ); + + // If IE event model is used + } else { + // Ensure firing before onload, maybe late but safe also for iframes + document.attachEvent( "onreadystatechange", completed ); + + // A fallback to window.onload, that will always work + window.attachEvent( "onload", completed ); + + // If IE and not a frame + // continually check to see if the document is ready + var top = false; + + try { + top = window.frameElement == null && document.documentElement; + } catch(e) {} + + if ( top && top.doScroll ) { + (function doScrollCheck() { + if ( !jQuery.isReady ) { + + try { + // Use the trick by Diego Perini + // http://javascript.nwbox.com/IEContentLoaded/ + top.doScroll("left"); + } catch(e) { + return setTimeout( doScrollCheck, 50 ); + } + + // detach all dom ready events + detach(); + + // and execute any waiting functions + jQuery.ready(); + } + })(); + } + } + } + return readyList.promise( obj ); +}; + +// Populate the class2type map +jQuery.each("Boolean Number String Function Array Date RegExp Object Error".split(" "), function(i, name) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +}); + +function isArraylike( obj ) { + var length = obj.length, + type = jQuery.type( obj ); + + if ( jQuery.isWindow( obj ) ) { + return false; + } + + if ( obj.nodeType === 1 && length ) { + return true; + } + + return type === "array" || type !== "function" && + ( length === 0 || + typeof length === "number" && length > 0 && ( length - 1 ) in obj ); +} + +// All jQuery objects should point back to these +rootjQuery = jQuery(document); +// String to Object options format cache +var optionsCache = {}; + +// Convert String-formatted options into Object-formatted ones and store in cache +function createOptions( options ) { + var object = optionsCache[ options ] = {}; + jQuery.each( options.match( core_rnotwhite ) || [], function( _, flag ) { + object[ flag ] = true; + }); + return object; +} + +/* + * Create a callback list using the following parameters: + * + * options: an optional list of space-separated options that will change how + * the callback list behaves or a more traditional option object + * + * By default a callback list will act like an event callback list and can be + * "fired" multiple times. + * + * Possible options: + * + * once: will ensure the callback list can only be fired once (like a Deferred) + * + * memory: will keep track of previous values and will call any callback added + * after the list has been fired right away with the latest "memorized" + * values (like a Deferred) + * + * unique: will ensure a callback can only be added once (no duplicate in the list) + * + * stopOnFalse: interrupt callings when a callback returns false + * + */ +jQuery.Callbacks = function( options ) { + + // Convert options from String-formatted to Object-formatted if needed + // (we check in cache first) + options = typeof options === "string" ? + ( optionsCache[ options ] || createOptions( options ) ) : + jQuery.extend( {}, options ); + + var // Flag to know if list is currently firing + firing, + // Last fire value (for non-forgettable lists) + memory, + // Flag to know if list was already fired + fired, + // End of the loop when firing + firingLength, + // Index of currently firing callback (modified by remove if needed) + firingIndex, + // First callback to fire (used internally by add and fireWith) + firingStart, + // Actual callback list + list = [], + // Stack of fire calls for repeatable lists + stack = !options.once && [], + // Fire callbacks + fire = function( data ) { + memory = options.memory && data; + fired = true; + firingIndex = firingStart || 0; + firingStart = 0; + firingLength = list.length; + firing = true; + for ( ; list && firingIndex < firingLength; firingIndex++ ) { + if ( list[ firingIndex ].apply( data[ 0 ], data[ 1 ] ) === false && options.stopOnFalse ) { + memory = false; // To prevent further calls using add + break; + } + } + firing = false; + if ( list ) { + if ( stack ) { + if ( stack.length ) { + fire( stack.shift() ); + } + } else if ( memory ) { + list = []; + } else { + self.disable(); + } + } + }, + // Actual Callbacks object + self = { + // Add a callback or a collection of callbacks to the list + add: function() { + if ( list ) { + // First, we save the current length + var start = list.length; + (function add( args ) { + jQuery.each( args, function( _, arg ) { + var type = jQuery.type( arg ); + if ( type === "function" ) { + if ( !options.unique || !self.has( arg ) ) { + list.push( arg ); + } + } else if ( arg && arg.length && type !== "string" ) { + // Inspect recursively + add( arg ); + } + }); + })( arguments ); + // Do we need to add the callbacks to the + // current firing batch? + if ( firing ) { + firingLength = list.length; + // With memory, if we're not firing then + // we should call right away + } else if ( memory ) { + firingStart = start; + fire( memory ); + } + } + return this; + }, + // Remove a callback from the list + remove: function() { + if ( list ) { + jQuery.each( arguments, function( _, arg ) { + var index; + while( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) { + list.splice( index, 1 ); + // Handle firing indexes + if ( firing ) { + if ( index <= firingLength ) { + firingLength--; + } + if ( index <= firingIndex ) { + firingIndex--; + } + } + } + }); + } + return this; + }, + // Check if a given callback is in the list. + // If no argument is given, return whether or not list has callbacks attached. + has: function( fn ) { + return fn ? jQuery.inArray( fn, list ) > -1 : !!( list && list.length ); + }, + // Remove all callbacks from the list + empty: function() { + list = []; + return this; + }, + // Have the list do nothing anymore + disable: function() { + list = stack = memory = undefined; + return this; + }, + // Is it disabled? + disabled: function() { + return !list; + }, + // Lock the list in its current state + lock: function() { + stack = undefined; + if ( !memory ) { + self.disable(); + } + return this; + }, + // Is it locked? + locked: function() { + return !stack; + }, + // Call all callbacks with the given context and arguments + fireWith: function( context, args ) { + args = args || []; + args = [ context, args.slice ? args.slice() : args ]; + if ( list && ( !fired || stack ) ) { + if ( firing ) { + stack.push( args ); + } else { + fire( args ); + } + } + return this; + }, + // Call all the callbacks with the given arguments + fire: function() { + self.fireWith( this, arguments ); + return this; + }, + // To know if the callbacks have already been called at least once + fired: function() { + return !!fired; + } + }; + + return self; +}; +jQuery.extend({ + + Deferred: function( func ) { + var tuples = [ + // action, add listener, listener list, final state + [ "resolve", "done", jQuery.Callbacks("once memory"), "resolved" ], + [ "reject", "fail", jQuery.Callbacks("once memory"), "rejected" ], + [ "notify", "progress", jQuery.Callbacks("memory") ] + ], + state = "pending", + promise = { + state: function() { + return state; + }, + always: function() { + deferred.done( arguments ).fail( arguments ); + return this; + }, + then: function( /* fnDone, fnFail, fnProgress */ ) { + var fns = arguments; + return jQuery.Deferred(function( newDefer ) { + jQuery.each( tuples, function( i, tuple ) { + var action = tuple[ 0 ], + fn = jQuery.isFunction( fns[ i ] ) && fns[ i ]; + // deferred[ done | fail | progress ] for forwarding actions to newDefer + deferred[ tuple[1] ](function() { + var returned = fn && fn.apply( this, arguments ); + if ( returned && jQuery.isFunction( returned.promise ) ) { + returned.promise() + .done( newDefer.resolve ) + .fail( newDefer.reject ) + .progress( newDefer.notify ); + } else { + newDefer[ action + "With" ]( this === promise ? newDefer.promise() : this, fn ? [ returned ] : arguments ); + } + }); + }); + fns = null; + }).promise(); + }, + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + return obj != null ? jQuery.extend( obj, promise ) : promise; + } + }, + deferred = {}; + + // Keep pipe for back-compat + promise.pipe = promise.then; + + // Add list-specific methods + jQuery.each( tuples, function( i, tuple ) { + var list = tuple[ 2 ], + stateString = tuple[ 3 ]; + + // promise[ done | fail | progress ] = list.add + promise[ tuple[1] ] = list.add; + + // Handle state + if ( stateString ) { + list.add(function() { + // state = [ resolved | rejected ] + state = stateString; + + // [ reject_list | resolve_list ].disable; progress_list.lock + }, tuples[ i ^ 1 ][ 2 ].disable, tuples[ 2 ][ 2 ].lock ); + } + + // deferred[ resolve | reject | notify ] + deferred[ tuple[0] ] = function() { + deferred[ tuple[0] + "With" ]( this === deferred ? promise : this, arguments ); + return this; + }; + deferred[ tuple[0] + "With" ] = list.fireWith; + }); + + // Make the deferred a promise + promise.promise( deferred ); + + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + + // All done! + return deferred; + }, + + // Deferred helper + when: function( subordinate /* , ..., subordinateN */ ) { + var i = 0, + resolveValues = core_slice.call( arguments ), + length = resolveValues.length, + + // the count of uncompleted subordinates + remaining = length !== 1 || ( subordinate && jQuery.isFunction( subordinate.promise ) ) ? length : 0, + + // the master Deferred. If resolveValues consist of only a single Deferred, just use that. + deferred = remaining === 1 ? subordinate : jQuery.Deferred(), + + // Update function for both resolve and progress values + updateFunc = function( i, contexts, values ) { + return function( value ) { + contexts[ i ] = this; + values[ i ] = arguments.length > 1 ? core_slice.call( arguments ) : value; + if( values === progressValues ) { + deferred.notifyWith( contexts, values ); + } else if ( !( --remaining ) ) { + deferred.resolveWith( contexts, values ); + } + }; + }, + + progressValues, progressContexts, resolveContexts; + + // add listeners to Deferred subordinates; treat others as resolved + if ( length > 1 ) { + progressValues = new Array( length ); + progressContexts = new Array( length ); + resolveContexts = new Array( length ); + for ( ; i < length; i++ ) { + if ( resolveValues[ i ] && jQuery.isFunction( resolveValues[ i ].promise ) ) { + resolveValues[ i ].promise() + .done( updateFunc( i, resolveContexts, resolveValues ) ) + .fail( deferred.reject ) + .progress( updateFunc( i, progressContexts, progressValues ) ); + } else { + --remaining; + } + } + } + + // if we're not waiting on anything, resolve the master + if ( !remaining ) { + deferred.resolveWith( resolveContexts, resolveValues ); + } + + return deferred.promise(); + } +}); +jQuery.support = (function() { + + var support, all, a, + input, select, fragment, + opt, eventName, isSupported, i, + div = document.createElement("div"); + + // Setup + div.setAttribute( "className", "t" ); + div.innerHTML = "
        a"; + + // Support tests won't run in some limited or non-browser environments + all = div.getElementsByTagName("*"); + a = div.getElementsByTagName("a")[ 0 ]; + if ( !all || !a || !all.length ) { + return {}; + } + + // First batch of tests + select = document.createElement("select"); + opt = select.appendChild( document.createElement("option") ); + input = div.getElementsByTagName("input")[ 0 ]; + + a.style.cssText = "top:1px;float:left;opacity:.5"; + support = { + // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7) + getSetAttribute: div.className !== "t", + + // IE strips leading whitespace when .innerHTML is used + leadingWhitespace: div.firstChild.nodeType === 3, + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + tbody: !div.getElementsByTagName("tbody").length, + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + htmlSerialize: !!div.getElementsByTagName("link").length, + + // Get the style information from getAttribute + // (IE uses .cssText instead) + style: /top/.test( a.getAttribute("style") ), + + // Make sure that URLs aren't manipulated + // (IE normalizes it by default) + hrefNormalized: a.getAttribute("href") === "/a", + + // Make sure that element opacity exists + // (IE uses filter instead) + // Use a regex to work around a WebKit issue. See #5145 + opacity: /^0.5/.test( a.style.opacity ), + + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + cssFloat: !!a.style.cssFloat, + + // Check the default checkbox/radio value ("" on WebKit; "on" elsewhere) + checkOn: !!input.value, + + // Make sure that a selected-by-default option has a working selected property. + // (WebKit defaults to false instead of true, IE too, if it's in an optgroup) + optSelected: opt.selected, + + // Tests for enctype support on a form (#6743) + enctype: !!document.createElement("form").enctype, + + // Makes sure cloning an html5 element does not cause problems + // Where outerHTML is undefined, this still works + html5Clone: document.createElement("nav").cloneNode( true ).outerHTML !== "<:nav>", + + // jQuery.support.boxModel DEPRECATED in 1.8 since we don't support Quirks Mode + boxModel: document.compatMode === "CSS1Compat", + + // Will be defined later + deleteExpando: true, + noCloneEvent: true, + inlineBlockNeedsLayout: false, + shrinkWrapBlocks: false, + reliableMarginRight: true, + boxSizingReliable: true, + pixelPosition: false + }; + + // Make sure checked status is properly cloned + input.checked = true; + support.noCloneChecked = input.cloneNode( true ).checked; + + // Make sure that the options inside disabled selects aren't marked as disabled + // (WebKit marks them as disabled) + select.disabled = true; + support.optDisabled = !opt.disabled; + + // Support: IE<9 + try { + delete div.test; + } catch( e ) { + support.deleteExpando = false; + } + + // Check if we can trust getAttribute("value") + input = document.createElement("input"); + input.setAttribute( "value", "" ); + support.input = input.getAttribute( "value" ) === ""; + + // Check if an input maintains its value after becoming a radio + input.value = "t"; + input.setAttribute( "type", "radio" ); + support.radioValue = input.value === "t"; + + // #11217 - WebKit loses check when the name is after the checked attribute + input.setAttribute( "checked", "t" ); + input.setAttribute( "name", "t" ); + + fragment = document.createDocumentFragment(); + fragment.appendChild( input ); + + // Check if a disconnected checkbox will retain its checked + // value of true after appended to the DOM (IE6/7) + support.appendChecked = input.checked; + + // WebKit doesn't clone checked state correctly in fragments + support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked; + + // Support: IE<9 + // Opera does not clone events (and typeof div.attachEvent === undefined). + // IE9-10 clones events bound via attachEvent, but they don't trigger with .click() + if ( div.attachEvent ) { + div.attachEvent( "onclick", function() { + support.noCloneEvent = false; + }); + + div.cloneNode( true ).click(); + } + + // Support: IE<9 (lack submit/change bubble), Firefox 17+ (lack focusin event) + // Beware of CSP restrictions (https://developer.mozilla.org/en/Security/CSP), test/csp.php + for ( i in { submit: true, change: true, focusin: true }) { + div.setAttribute( eventName = "on" + i, "t" ); + + support[ i + "Bubbles" ] = eventName in window || div.attributes[ eventName ].expando === false; + } + + div.style.backgroundClip = "content-box"; + div.cloneNode( true ).style.backgroundClip = ""; + support.clearCloneStyle = div.style.backgroundClip === "content-box"; + + // Run tests that need a body at doc ready + jQuery(function() { + var container, marginDiv, tds, + divReset = "padding:0;margin:0;border:0;display:block;box-sizing:content-box;-moz-box-sizing:content-box;-webkit-box-sizing:content-box;", + body = document.getElementsByTagName("body")[0]; + + if ( !body ) { + // Return for frameset docs that don't have a body + return; + } + + container = document.createElement("div"); + container.style.cssText = "border:0;width:0;height:0;position:absolute;top:0;left:-9999px;margin-top:1px"; + + body.appendChild( container ).appendChild( div ); + + // Support: IE8 + // Check if table cells still have offsetWidth/Height when they are set + // to display:none and there are still other visible table cells in a + // table row; if so, offsetWidth/Height are not reliable for use when + // determining if an element has been hidden directly using + // display:none (it is still safe to use offsets if a parent element is + // hidden; don safety goggles and see bug #4512 for more information). + div.innerHTML = "
        t
        "; + tds = div.getElementsByTagName("td"); + tds[ 0 ].style.cssText = "padding:0;margin:0;border:0;display:none"; + isSupported = ( tds[ 0 ].offsetHeight === 0 ); + + tds[ 0 ].style.display = ""; + tds[ 1 ].style.display = "none"; + + // Support: IE8 + // Check if empty table cells still have offsetWidth/Height + support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 ); + + // Check box-sizing and margin behavior + div.innerHTML = ""; + div.style.cssText = "box-sizing:border-box;-moz-box-sizing:border-box;-webkit-box-sizing:border-box;padding:1px;border:1px;display:block;width:4px;margin-top:1%;position:absolute;top:1%;"; + support.boxSizing = ( div.offsetWidth === 4 ); + support.doesNotIncludeMarginInBodyOffset = ( body.offsetTop !== 1 ); + + // Use window.getComputedStyle because jsdom on node.js will break without it. + if ( window.getComputedStyle ) { + support.pixelPosition = ( window.getComputedStyle( div, null ) || {} ).top !== "1%"; + support.boxSizingReliable = ( window.getComputedStyle( div, null ) || { width: "4px" } ).width === "4px"; + + // Check if div with explicit width and no margin-right incorrectly + // gets computed margin-right based on width of container. (#3333) + // Fails in WebKit before Feb 2011 nightlies + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + marginDiv = div.appendChild( document.createElement("div") ); + marginDiv.style.cssText = div.style.cssText = divReset; + marginDiv.style.marginRight = marginDiv.style.width = "0"; + div.style.width = "1px"; + + support.reliableMarginRight = + !parseFloat( ( window.getComputedStyle( marginDiv, null ) || {} ).marginRight ); + } + + if ( typeof div.style.zoom !== core_strundefined ) { + // Support: IE<8 + // Check if natively block-level elements act like inline-block + // elements when setting their display to 'inline' and giving + // them layout + div.innerHTML = ""; + div.style.cssText = divReset + "width:1px;padding:1px;display:inline;zoom:1"; + support.inlineBlockNeedsLayout = ( div.offsetWidth === 3 ); + + // Support: IE6 + // Check if elements with layout shrink-wrap their children + div.style.display = "block"; + div.innerHTML = "
        "; + div.firstChild.style.width = "5px"; + support.shrinkWrapBlocks = ( div.offsetWidth !== 3 ); + + if ( support.inlineBlockNeedsLayout ) { + // Prevent IE 6 from affecting layout for positioned elements #11048 + // Prevent IE from shrinking the body in IE 7 mode #12869 + // Support: IE<8 + body.style.zoom = 1; + } + } + + body.removeChild( container ); + + // Null elements to avoid leaks in IE + container = div = tds = marginDiv = null; + }); + + // Null elements to avoid leaks in IE + all = select = fragment = opt = a = input = null; + + return support; +})(); + +var rbrace = /(?:\{[\s\S]*\}|\[[\s\S]*\])$/, + rmultiDash = /([A-Z])/g; + +function internalData( elem, name, data, pvt /* Internal Use Only */ ){ + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var thisCache, ret, + internalKey = jQuery.expando, + getByName = typeof name === "string", + + // We have to handle DOM nodes and JS objects differently because IE6-7 + // can't GC object references properly across the DOM-JS boundary + isNode = elem.nodeType, + + // Only DOM nodes need the global jQuery cache; JS object data is + // attached directly to the object so GC can occur automatically + cache = isNode ? jQuery.cache : elem, + + // Only defining an ID for JS objects if its cache already exists allows + // the code to shortcut on the same path as a DOM node with no cache + id = isNode ? elem[ internalKey ] : elem[ internalKey ] && internalKey; + + // Avoid doing any more work than we need to when trying to get data on an + // object that has no data at all + if ( (!id || !cache[id] || (!pvt && !cache[id].data)) && getByName && data === undefined ) { + return; + } + + if ( !id ) { + // Only DOM nodes need a new unique ID for each element since their data + // ends up in the global cache + if ( isNode ) { + elem[ internalKey ] = id = core_deletedIds.pop() || jQuery.guid++; + } else { + id = internalKey; + } + } + + if ( !cache[ id ] ) { + cache[ id ] = {}; + + // Avoids exposing jQuery metadata on plain JS objects when the object + // is serialized using JSON.stringify + if ( !isNode ) { + cache[ id ].toJSON = jQuery.noop; + } + } + + // An object can be passed to jQuery.data instead of a key/value pair; this gets + // shallow copied over onto the existing cache + if ( typeof name === "object" || typeof name === "function" ) { + if ( pvt ) { + cache[ id ] = jQuery.extend( cache[ id ], name ); + } else { + cache[ id ].data = jQuery.extend( cache[ id ].data, name ); + } + } + + thisCache = cache[ id ]; + + // jQuery data() is stored in a separate object inside the object's internal data + // cache in order to avoid key collisions between internal data and user-defined + // data. + if ( !pvt ) { + if ( !thisCache.data ) { + thisCache.data = {}; + } + + thisCache = thisCache.data; + } + + if ( data !== undefined ) { + thisCache[ jQuery.camelCase( name ) ] = data; + } + + // Check for both converted-to-camel and non-converted data property names + // If a data property was specified + if ( getByName ) { + + // First Try to find as-is property data + ret = thisCache[ name ]; + + // Test for null|undefined property data + if ( ret == null ) { + + // Try to find the camelCased property + ret = thisCache[ jQuery.camelCase( name ) ]; + } + } else { + ret = thisCache; + } + + return ret; +} + +function internalRemoveData( elem, name, pvt ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var i, l, thisCache, + isNode = elem.nodeType, + + // See jQuery.data for more information + cache = isNode ? jQuery.cache : elem, + id = isNode ? elem[ jQuery.expando ] : jQuery.expando; + + // If there is already no cache entry for this object, there is no + // purpose in continuing + if ( !cache[ id ] ) { + return; + } + + if ( name ) { + + thisCache = pvt ? cache[ id ] : cache[ id ].data; + + if ( thisCache ) { + + // Support array or space separated string names for data keys + if ( !jQuery.isArray( name ) ) { + + // try the string as a key before any manipulation + if ( name in thisCache ) { + name = [ name ]; + } else { + + // split the camel cased version by spaces unless a key with the spaces exists + name = jQuery.camelCase( name ); + if ( name in thisCache ) { + name = [ name ]; + } else { + name = name.split(" "); + } + } + } else { + // If "name" is an array of keys... + // When data is initially created, via ("key", "val") signature, + // keys will be converted to camelCase. + // Since there is no way to tell _how_ a key was added, remove + // both plain key and camelCase key. #12786 + // This will only penalize the array argument path. + name = name.concat( jQuery.map( name, jQuery.camelCase ) ); + } + + for ( i = 0, l = name.length; i < l; i++ ) { + delete thisCache[ name[i] ]; + } + + // If there is no data left in the cache, we want to continue + // and let the cache object itself get destroyed + if ( !( pvt ? isEmptyDataObject : jQuery.isEmptyObject )( thisCache ) ) { + return; + } + } + } + + // See jQuery.data for more information + if ( !pvt ) { + delete cache[ id ].data; + + // Don't destroy the parent cache unless the internal data object + // had been the only thing left in it + if ( !isEmptyDataObject( cache[ id ] ) ) { + return; + } + } + + // Destroy the cache + if ( isNode ) { + jQuery.cleanData( [ elem ], true ); + + // Use delete when supported for expandos or `cache` is not a window per isWindow (#10080) + } else if ( jQuery.support.deleteExpando || cache != cache.window ) { + delete cache[ id ]; + + // When all else fails, null + } else { + cache[ id ] = null; + } +} + +jQuery.extend({ + cache: {}, + + // Unique for each copy of jQuery on the page + // Non-digits removed to match rinlinejQuery + expando: "jQuery" + ( core_version + Math.random() ).replace( /\D/g, "" ), + + // The following elements throw uncatchable exceptions if you + // attempt to add expando properties to them. + noData: { + "embed": true, + // Ban all objects except for Flash (which handle expandos) + "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000", + "applet": true + }, + + hasData: function( elem ) { + elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ]; + return !!elem && !isEmptyDataObject( elem ); + }, + + data: function( elem, name, data ) { + return internalData( elem, name, data ); + }, + + removeData: function( elem, name ) { + return internalRemoveData( elem, name ); + }, + + // For internal use only. + _data: function( elem, name, data ) { + return internalData( elem, name, data, true ); + }, + + _removeData: function( elem, name ) { + return internalRemoveData( elem, name, true ); + }, + + // A method for determining if a DOM node can handle the data expando + acceptData: function( elem ) { + // Do not set data on non-element because it will not be cleared (#8335). + if ( elem.nodeType && elem.nodeType !== 1 && elem.nodeType !== 9 ) { + return false; + } + + var noData = elem.nodeName && jQuery.noData[ elem.nodeName.toLowerCase() ]; + + // nodes accept data unless otherwise specified; rejection can be conditional + return !noData || noData !== true && elem.getAttribute("classid") === noData; + } +}); + +jQuery.fn.extend({ + data: function( key, value ) { + var attrs, name, + elem = this[0], + i = 0, + data = null; + + // Gets all values + if ( key === undefined ) { + if ( this.length ) { + data = jQuery.data( elem ); + + if ( elem.nodeType === 1 && !jQuery._data( elem, "parsedAttrs" ) ) { + attrs = elem.attributes; + for ( ; i < attrs.length; i++ ) { + name = attrs[i].name; + + if ( !name.indexOf( "data-" ) ) { + name = jQuery.camelCase( name.slice(5) ); + + dataAttr( elem, name, data[ name ] ); + } + } + jQuery._data( elem, "parsedAttrs", true ); + } + } + + return data; + } + + // Sets multiple values + if ( typeof key === "object" ) { + return this.each(function() { + jQuery.data( this, key ); + }); + } + + return jQuery.access( this, function( value ) { + + if ( value === undefined ) { + // Try to fetch any internally stored data first + return elem ? dataAttr( elem, key, jQuery.data( elem, key ) ) : null; + } + + this.each(function() { + jQuery.data( this, key, value ); + }); + }, null, value, arguments.length > 1, null, true ); + }, + + removeData: function( key ) { + return this.each(function() { + jQuery.removeData( this, key ); + }); + } +}); + +function dataAttr( elem, key, data ) { + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + + var name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase(); + + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = data === "true" ? true : + data === "false" ? false : + data === "null" ? null : + // Only convert to a number if it doesn't change the string + +data + "" === data ? +data : + rbrace.test( data ) ? jQuery.parseJSON( data ) : + data; + } catch( e ) {} + + // Make sure we set the data so it isn't changed later + jQuery.data( elem, key, data ); + + } else { + data = undefined; + } + } + + return data; +} + +// checks a cache object for emptiness +function isEmptyDataObject( obj ) { + var name; + for ( name in obj ) { + + // if the public data object is empty, the private is still empty + if ( name === "data" && jQuery.isEmptyObject( obj[name] ) ) { + continue; + } + if ( name !== "toJSON" ) { + return false; + } + } + + return true; +} +jQuery.extend({ + queue: function( elem, type, data ) { + var queue; + + if ( elem ) { + type = ( type || "fx" ) + "queue"; + queue = jQuery._data( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !queue || jQuery.isArray(data) ) { + queue = jQuery._data( elem, type, jQuery.makeArray(data) ); + } else { + queue.push( data ); + } + } + return queue || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + startLength = queue.length, + fn = queue.shift(), + hooks = jQuery._queueHooks( elem, type ), + next = function() { + jQuery.dequeue( elem, type ); + }; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + startLength--; + } + + hooks.cur = fn; + if ( fn ) { + + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift( "inprogress" ); + } + + // clear up the last queue stop function + delete hooks.stop; + fn.call( elem, next, hooks ); + } + + if ( !startLength && hooks ) { + hooks.empty.fire(); + } + }, + + // not intended for public consumption - generates a queueHooks object, or returns the current one + _queueHooks: function( elem, type ) { + var key = type + "queueHooks"; + return jQuery._data( elem, key ) || jQuery._data( elem, key, { + empty: jQuery.Callbacks("once memory").add(function() { + jQuery._removeData( elem, type + "queue" ); + jQuery._removeData( elem, key ); + }) + }); + } +}); + +jQuery.fn.extend({ + queue: function( type, data ) { + var setter = 2; + + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + setter--; + } + + if ( arguments.length < setter ) { + return jQuery.queue( this[0], type ); + } + + return data === undefined ? + this : + this.each(function() { + var queue = jQuery.queue( this, type, data ); + + // ensure a hooks for this queue + jQuery._queueHooks( this, type ); + + if ( type === "fx" && queue[0] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + }); + }, + dequeue: function( type ) { + return this.each(function() { + jQuery.dequeue( this, type ); + }); + }, + // Based off of the plugin by Clint Helfers, with permission. + // http://blindsignals.com/index.php/2009/07/jquery-delay/ + delay: function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; + type = type || "fx"; + + return this.queue( type, function( next, hooks ) { + var timeout = setTimeout( next, time ); + hooks.stop = function() { + clearTimeout( timeout ); + }; + }); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, obj ) { + var tmp, + count = 1, + defer = jQuery.Deferred(), + elements = this, + i = this.length, + resolve = function() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + }; + + if ( typeof type !== "string" ) { + obj = type; + type = undefined; + } + type = type || "fx"; + + while( i-- ) { + tmp = jQuery._data( elements[ i ], type + "queueHooks" ); + if ( tmp && tmp.empty ) { + count++; + tmp.empty.add( resolve ); + } + } + resolve(); + return defer.promise( obj ); + } +}); +var nodeHook, boolHook, + rclass = /[\t\r\n]/g, + rreturn = /\r/g, + rfocusable = /^(?:input|select|textarea|button|object)$/i, + rclickable = /^(?:a|area)$/i, + rboolean = /^(?:checked|selected|autofocus|autoplay|async|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped)$/i, + ruseDefault = /^(?:checked|selected)$/i, + getSetAttribute = jQuery.support.getSetAttribute, + getSetInput = jQuery.support.input; + +jQuery.fn.extend({ + attr: function( name, value ) { + return jQuery.access( this, jQuery.attr, name, value, arguments.length > 1 ); + }, + + removeAttr: function( name ) { + return this.each(function() { + jQuery.removeAttr( this, name ); + }); + }, + + prop: function( name, value ) { + return jQuery.access( this, jQuery.prop, name, value, arguments.length > 1 ); + }, + + removeProp: function( name ) { + name = jQuery.propFix[ name ] || name; + return this.each(function() { + // try/catch handles cases where IE balks (such as removing a property on window) + try { + this[ name ] = undefined; + delete this[ name ]; + } catch( e ) {} + }); + }, + + addClass: function( value ) { + var classes, elem, cur, clazz, j, + i = 0, + len = this.length, + proceed = typeof value === "string" && value; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).addClass( value.call( this, j, this.className ) ); + }); + } + + if ( proceed ) { + // The disjunction here is for better compressibility (see removeClass) + classes = ( value || "" ).match( core_rnotwhite ) || []; + + for ( ; i < len; i++ ) { + elem = this[ i ]; + cur = elem.nodeType === 1 && ( elem.className ? + ( " " + elem.className + " " ).replace( rclass, " " ) : + " " + ); + + if ( cur ) { + j = 0; + while ( (clazz = classes[j++]) ) { + if ( cur.indexOf( " " + clazz + " " ) < 0 ) { + cur += clazz + " "; + } + } + elem.className = jQuery.trim( cur ); + + } + } + } + + return this; + }, + + removeClass: function( value ) { + var classes, elem, cur, clazz, j, + i = 0, + len = this.length, + proceed = arguments.length === 0 || typeof value === "string" && value; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).removeClass( value.call( this, j, this.className ) ); + }); + } + if ( proceed ) { + classes = ( value || "" ).match( core_rnotwhite ) || []; + + for ( ; i < len; i++ ) { + elem = this[ i ]; + // This expression is here for better compressibility (see addClass) + cur = elem.nodeType === 1 && ( elem.className ? + ( " " + elem.className + " " ).replace( rclass, " " ) : + "" + ); + + if ( cur ) { + j = 0; + while ( (clazz = classes[j++]) ) { + // Remove *all* instances + while ( cur.indexOf( " " + clazz + " " ) >= 0 ) { + cur = cur.replace( " " + clazz + " ", " " ); + } + } + elem.className = value ? jQuery.trim( cur ) : ""; + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isBool = typeof stateVal === "boolean"; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( i ) { + jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal ); + }); + } + + return this.each(function() { + if ( type === "string" ) { + // toggle individual class names + var className, + i = 0, + self = jQuery( this ), + state = stateVal, + classNames = value.match( core_rnotwhite ) || []; + + while ( (className = classNames[ i++ ]) ) { + // check each className given, space separated list + state = isBool ? state : !self.hasClass( className ); + self[ state ? "addClass" : "removeClass" ]( className ); + } + + // Toggle whole class name + } else if ( type === core_strundefined || type === "boolean" ) { + if ( this.className ) { + // store className if set + jQuery._data( this, "__className__", this.className ); + } + + // If the element has a class name or if we're passed "false", + // then remove the whole classname (if there was one, the above saved it). + // Otherwise bring back whatever was previously saved (if anything), + // falling back to the empty string if nothing was stored. + this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || ""; + } + }); + }, + + hasClass: function( selector ) { + var className = " " + selector + " ", + i = 0, + l = this.length; + for ( ; i < l; i++ ) { + if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) >= 0 ) { + return true; + } + } + + return false; + }, + + val: function( value ) { + var ret, hooks, isFunction, + elem = this[0]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.type ] || jQuery.valHooks[ elem.nodeName.toLowerCase() ]; + + if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) { + return ret; + } + + ret = elem.value; + + return typeof ret === "string" ? + // handle most common string cases + ret.replace(rreturn, "") : + // handle cases where value is null/undef or number + ret == null ? "" : ret; + } + + return; + } + + isFunction = jQuery.isFunction( value ); + + return this.each(function( i ) { + var val, + self = jQuery(this); + + if ( this.nodeType !== 1 ) { + return; + } + + if ( isFunction ) { + val = value.call( this, i, self.val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + } else if ( typeof val === "number" ) { + val += ""; + } else if ( jQuery.isArray( val ) ) { + val = jQuery.map(val, function ( value ) { + return value == null ? "" : value + ""; + }); + } + + hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + }); + } +}); + +jQuery.extend({ + valHooks: { + option: { + get: function( elem ) { + // attributes.value is undefined in Blackberry 4.7 but + // uses .value. See #6932 + var val = elem.attributes.value; + return !val || val.specified ? elem.value : elem.text; + } + }, + select: { + get: function( elem ) { + var value, option, + options = elem.options, + index = elem.selectedIndex, + one = elem.type === "select-one" || index < 0, + values = one ? null : [], + max = one ? index + 1 : options.length, + i = index < 0 ? + max : + one ? index : 0; + + // Loop through all the selected options + for ( ; i < max; i++ ) { + option = options[ i ]; + + // oldIE doesn't update selected after form reset (#2551) + if ( ( option.selected || i === index ) && + // Don't return options that are disabled or in a disabled optgroup + ( jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null ) && + ( !option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" ) ) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + return values; + }, + + set: function( elem, value ) { + var values = jQuery.makeArray( value ); + + jQuery(elem).find("option").each(function() { + this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; + }); + + if ( !values.length ) { + elem.selectedIndex = -1; + } + return values; + } + } + }, + + attr: function( elem, name, value ) { + var hooks, notxml, ret, + nType = elem.nodeType; + + // don't get/set attributes on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + // Fallback to prop when attributes are not supported + if ( typeof elem.getAttribute === core_strundefined ) { + return jQuery.prop( elem, name, value ); + } + + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + // All attributes are lowercase + // Grab necessary hook if one is defined + if ( notxml ) { + name = name.toLowerCase(); + hooks = jQuery.attrHooks[ name ] || ( rboolean.test( name ) ? boolHook : nodeHook ); + } + + if ( value !== undefined ) { + + if ( value === null ) { + jQuery.removeAttr( elem, name ); + + } else if ( hooks && notxml && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + elem.setAttribute( name, value + "" ); + return value; + } + + } else if ( hooks && notxml && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + + // In IE9+, Flash objects don't have .getAttribute (#12945) + // Support: IE9+ + if ( typeof elem.getAttribute !== core_strundefined ) { + ret = elem.getAttribute( name ); + } + + // Non-existent attributes return null, we normalize to undefined + return ret == null ? + undefined : + ret; + } + }, + + removeAttr: function( elem, value ) { + var name, propName, + i = 0, + attrNames = value && value.match( core_rnotwhite ); + + if ( attrNames && elem.nodeType === 1 ) { + while ( (name = attrNames[i++]) ) { + propName = jQuery.propFix[ name ] || name; + + // Boolean attributes get special treatment (#10870) + if ( rboolean.test( name ) ) { + // Set corresponding property to false for boolean attributes + // Also clear defaultChecked/defaultSelected (if appropriate) for IE<8 + if ( !getSetAttribute && ruseDefault.test( name ) ) { + elem[ jQuery.camelCase( "default-" + name ) ] = + elem[ propName ] = false; + } else { + elem[ propName ] = false; + } + + // See #9699 for explanation of this approach (setting first, then removal) + } else { + jQuery.attr( elem, name, "" ); + } + + elem.removeAttribute( getSetAttribute ? name : propName ); + } + } + }, + + attrHooks: { + type: { + set: function( elem, value ) { + if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) { + // Setting the type on a radio button after the value resets the value in IE6-9 + // Reset value to default in case type is set after value during creation + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + } + }, + + propFix: { + tabindex: "tabIndex", + readonly: "readOnly", + "for": "htmlFor", + "class": "className", + maxlength: "maxLength", + cellspacing: "cellSpacing", + cellpadding: "cellPadding", + rowspan: "rowSpan", + colspan: "colSpan", + usemap: "useMap", + frameborder: "frameBorder", + contenteditable: "contentEditable" + }, + + prop: function( elem, name, value ) { + var ret, hooks, notxml, + nType = elem.nodeType; + + // don't get/set properties on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + if ( notxml ) { + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + return ( elem[ name ] = value ); + } + + } else { + if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + return elem[ name ]; + } + } + }, + + propHooks: { + tabIndex: { + get: function( elem ) { + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + var attributeNode = elem.getAttributeNode("tabindex"); + + return attributeNode && attributeNode.specified ? + parseInt( attributeNode.value, 10 ) : + rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? + 0 : + undefined; + } + } + } +}); + +// Hook for boolean attributes +boolHook = { + get: function( elem, name ) { + var + // Use .prop to determine if this attribute is understood as boolean + prop = jQuery.prop( elem, name ), + + // Fetch it accordingly + attr = typeof prop === "boolean" && elem.getAttribute( name ), + detail = typeof prop === "boolean" ? + + getSetInput && getSetAttribute ? + attr != null : + // oldIE fabricates an empty string for missing boolean attributes + // and conflates checked/selected into attroperties + ruseDefault.test( name ) ? + elem[ jQuery.camelCase( "default-" + name ) ] : + !!attr : + + // fetch an attribute node for properties not recognized as boolean + elem.getAttributeNode( name ); + + return detail && detail.value !== false ? + name.toLowerCase() : + undefined; + }, + set: function( elem, value, name ) { + if ( value === false ) { + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else if ( getSetInput && getSetAttribute || !ruseDefault.test( name ) ) { + // IE<8 needs the *property* name + elem.setAttribute( !getSetAttribute && jQuery.propFix[ name ] || name, name ); + + // Use defaultChecked and defaultSelected for oldIE + } else { + elem[ jQuery.camelCase( "default-" + name ) ] = elem[ name ] = true; + } + + return name; + } +}; + +// fix oldIE value attroperty +if ( !getSetInput || !getSetAttribute ) { + jQuery.attrHooks.value = { + get: function( elem, name ) { + var ret = elem.getAttributeNode( name ); + return jQuery.nodeName( elem, "input" ) ? + + // Ignore the value *property* by using defaultValue + elem.defaultValue : + + ret && ret.specified ? ret.value : undefined; + }, + set: function( elem, value, name ) { + if ( jQuery.nodeName( elem, "input" ) ) { + // Does not return so that setAttribute is also used + elem.defaultValue = value; + } else { + // Use nodeHook if defined (#1954); otherwise setAttribute is fine + return nodeHook && nodeHook.set( elem, value, name ); + } + } + }; +} + +// IE6/7 do not support getting/setting some attributes with get/setAttribute +if ( !getSetAttribute ) { + + // Use this for any attribute in IE6/7 + // This fixes almost every IE6/7 issue + nodeHook = jQuery.valHooks.button = { + get: function( elem, name ) { + var ret = elem.getAttributeNode( name ); + return ret && ( name === "id" || name === "name" || name === "coords" ? ret.value !== "" : ret.specified ) ? + ret.value : + undefined; + }, + set: function( elem, value, name ) { + // Set the existing or create a new attribute node + var ret = elem.getAttributeNode( name ); + if ( !ret ) { + elem.setAttributeNode( + (ret = elem.ownerDocument.createAttribute( name )) + ); + } + + ret.value = value += ""; + + // Break association with cloned elements by also using setAttribute (#9646) + return name === "value" || value === elem.getAttribute( name ) ? + value : + undefined; + } + }; + + // Set contenteditable to false on removals(#10429) + // Setting to empty string throws an error as an invalid value + jQuery.attrHooks.contenteditable = { + get: nodeHook.get, + set: function( elem, value, name ) { + nodeHook.set( elem, value === "" ? false : value, name ); + } + }; + + // Set width and height to auto instead of 0 on empty string( Bug #8150 ) + // This is for removals + jQuery.each([ "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + set: function( elem, value ) { + if ( value === "" ) { + elem.setAttribute( name, "auto" ); + return value; + } + } + }); + }); +} + + +// Some attributes require a special call on IE +// http://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx +if ( !jQuery.support.hrefNormalized ) { + jQuery.each([ "href", "src", "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + get: function( elem ) { + var ret = elem.getAttribute( name, 2 ); + return ret == null ? undefined : ret; + } + }); + }); + + // href/src property should get the full normalized URL (#10299/#12915) + jQuery.each([ "href", "src" ], function( i, name ) { + jQuery.propHooks[ name ] = { + get: function( elem ) { + return elem.getAttribute( name, 4 ); + } + }; + }); +} + +if ( !jQuery.support.style ) { + jQuery.attrHooks.style = { + get: function( elem ) { + // Return undefined in the case of empty string + // Note: IE uppercases css property names, but if we were to .toLowerCase() + // .cssText, that would destroy case senstitivity in URL's, like in "background" + return elem.style.cssText || undefined; + }, + set: function( elem, value ) { + return ( elem.style.cssText = value + "" ); + } + }; +} + +// Safari mis-reports the default selected property of an option +// Accessing the parent's selectedIndex property fixes it +if ( !jQuery.support.optSelected ) { + jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, { + get: function( elem ) { + var parent = elem.parentNode; + + if ( parent ) { + parent.selectedIndex; + + // Make sure that it also works with optgroups, see #5701 + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + return null; + } + }); +} + +// IE6/7 call enctype encoding +if ( !jQuery.support.enctype ) { + jQuery.propFix.enctype = "encoding"; +} + +// Radios and checkboxes getter/setter +if ( !jQuery.support.checkOn ) { + jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + get: function( elem ) { + // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified + return elem.getAttribute("value") === null ? "on" : elem.value; + } + }; + }); +} +jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], { + set: function( elem, value ) { + if ( jQuery.isArray( value ) ) { + return ( elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0 ); + } + } + }); +}); +var rformElems = /^(?:input|select|textarea)$/i, + rkeyEvent = /^key/, + rmouseEvent = /^(?:mouse|contextmenu)|click/, + rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, + rtypenamespace = /^([^.]*)(?:\.(.+)|)$/; + +function returnTrue() { + return true; +} + +function returnFalse() { + return false; +} + +/* + * Helper functions for managing events -- not part of the public interface. + * Props to Dean Edwards' addEvent library for many of the ideas. + */ +jQuery.event = { + + global: {}, + + add: function( elem, types, handler, data, selector ) { + var tmp, events, t, handleObjIn, + special, eventHandle, handleObj, + handlers, type, namespaces, origType, + elemData = jQuery._data( elem ); + + // Don't attach events to noData or text/comment nodes (but allow plain objects) + if ( !elemData ) { + return; + } + + // Caller can pass in an object of custom data in lieu of the handler + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + selector = handleObjIn.selector; + } + + // Make sure that the handler has a unique ID, used to find/remove it later + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure and main handler, if this is the first + if ( !(events = elemData.events) ) { + events = elemData.events = {}; + } + if ( !(eventHandle = elemData.handle) ) { + eventHandle = elemData.handle = function( e ) { + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== core_strundefined && (!e || jQuery.event.triggered !== e.type) ? + jQuery.event.dispatch.apply( eventHandle.elem, arguments ) : + undefined; + }; + // Add elem as a property of the handle fn to prevent a memory leak with IE non-native events + eventHandle.elem = elem; + } + + // Handle multiple events separated by a space + // jQuery(...).bind("mouseover mouseout", fn); + types = ( types || "" ).match( core_rnotwhite ) || [""]; + t = types.length; + while ( t-- ) { + tmp = rtypenamespace.exec( types[t] ) || []; + type = origType = tmp[1]; + namespaces = ( tmp[2] || "" ).split( "." ).sort(); + + // If event changes its type, use the special event handlers for the changed type + special = jQuery.event.special[ type ] || {}; + + // If selector defined, determine special event api type, otherwise given type + type = ( selector ? special.delegateType : special.bindType ) || type; + + // Update special based on newly reset type + special = jQuery.event.special[ type ] || {}; + + // handleObj is passed to all event handlers + handleObj = jQuery.extend({ + type: type, + origType: origType, + data: data, + handler: handler, + guid: handler.guid, + selector: selector, + needsContext: selector && jQuery.expr.match.needsContext.test( selector ), + namespace: namespaces.join(".") + }, handleObjIn ); + + // Init the event handler queue if we're the first + if ( !(handlers = events[ type ]) ) { + handlers = events[ type ] = []; + handlers.delegateCount = 0; + + // Only use addEventListener/attachEvent if the special events handler returns false + if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + // Bind the global event handler to the element + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle, false ); + + } else if ( elem.attachEvent ) { + elem.attachEvent( "on" + type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add to the element's handler list, delegates in front + if ( selector ) { + handlers.splice( handlers.delegateCount++, 0, handleObj ); + } else { + handlers.push( handleObj ); + } + + // Keep track of which events have ever been used, for event optimization + jQuery.event.global[ type ] = true; + } + + // Nullify elem to prevent memory leaks in IE + elem = null; + }, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, selector, mappedTypes ) { + var j, handleObj, tmp, + origCount, t, events, + special, handlers, type, + namespaces, origType, + elemData = jQuery.hasData( elem ) && jQuery._data( elem ); + + if ( !elemData || !(events = elemData.events) ) { + return; + } + + // Once for each type.namespace in types; type may be omitted + types = ( types || "" ).match( core_rnotwhite ) || [""]; + t = types.length; + while ( t-- ) { + tmp = rtypenamespace.exec( types[t] ) || []; + type = origType = tmp[1]; + namespaces = ( tmp[2] || "" ).split( "." ).sort(); + + // Unbind all events (on this namespace, if provided) for the element + if ( !type ) { + for ( type in events ) { + jQuery.event.remove( elem, type + types[ t ], handler, selector, true ); + } + continue; + } + + special = jQuery.event.special[ type ] || {}; + type = ( selector ? special.delegateType : special.bindType ) || type; + handlers = events[ type ] || []; + tmp = tmp[2] && new RegExp( "(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)" ); + + // Remove matching events + origCount = j = handlers.length; + while ( j-- ) { + handleObj = handlers[ j ]; + + if ( ( mappedTypes || origType === handleObj.origType ) && + ( !handler || handler.guid === handleObj.guid ) && + ( !tmp || tmp.test( handleObj.namespace ) ) && + ( !selector || selector === handleObj.selector || selector === "**" && handleObj.selector ) ) { + handlers.splice( j, 1 ); + + if ( handleObj.selector ) { + handlers.delegateCount--; + } + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + } + + // Remove generic event handler if we removed something and no more handlers exist + // (avoids potential for endless recursion during removal of special event handlers) + if ( origCount && !handlers.length ) { + if ( !special.teardown || special.teardown.call( elem, namespaces, elemData.handle ) === false ) { + jQuery.removeEvent( elem, type, elemData.handle ); + } + + delete events[ type ]; + } + } + + // Remove the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + delete elemData.handle; + + // removeData also checks for emptiness and clears the expando if empty + // so use it instead of delete + jQuery._removeData( elem, "events" ); + } + }, + + trigger: function( event, data, elem, onlyHandlers ) { + var handle, ontype, cur, + bubbleType, special, tmp, i, + eventPath = [ elem || document ], + type = core_hasOwn.call( event, "type" ) ? event.type : event, + namespaces = core_hasOwn.call( event, "namespace" ) ? event.namespace.split(".") : []; + + cur = tmp = elem = elem || document; + + // Don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + // focus/blur morphs to focusin/out; ensure we're not firing them right now + if ( rfocusMorph.test( type + jQuery.event.triggered ) ) { + return; + } + + if ( type.indexOf(".") >= 0 ) { + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split("."); + type = namespaces.shift(); + namespaces.sort(); + } + ontype = type.indexOf(":") < 0 && "on" + type; + + // Caller can pass in a jQuery.Event object, Object, or just an event type string + event = event[ jQuery.expando ] ? + event : + new jQuery.Event( type, typeof event === "object" && event ); + + event.isTrigger = true; + event.namespace = namespaces.join("."); + event.namespace_re = event.namespace ? + new RegExp( "(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)" ) : + null; + + // Clean up the event in case it is being reused + event.result = undefined; + if ( !event.target ) { + event.target = elem; + } + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data == null ? + [ event ] : + jQuery.makeArray( data, [ event ] ); + + // Allow special events to draw outside the lines + special = jQuery.event.special[ type ] || {}; + if ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) { + return; + } + + // Determine event propagation path in advance, per W3C events spec (#9951) + // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) + if ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) { + + bubbleType = special.delegateType || type; + if ( !rfocusMorph.test( bubbleType + type ) ) { + cur = cur.parentNode; + } + for ( ; cur; cur = cur.parentNode ) { + eventPath.push( cur ); + tmp = cur; + } + + // Only add window if we got to document (e.g., not plain obj or detached DOM) + if ( tmp === (elem.ownerDocument || document) ) { + eventPath.push( tmp.defaultView || tmp.parentWindow || window ); + } + } + + // Fire handlers on the event path + i = 0; + while ( (cur = eventPath[i++]) && !event.isPropagationStopped() ) { + + event.type = i > 1 ? + bubbleType : + special.bindType || type; + + // jQuery handler + handle = ( jQuery._data( cur, "events" ) || {} )[ event.type ] && jQuery._data( cur, "handle" ); + if ( handle ) { + handle.apply( cur, data ); + } + + // Native handler + handle = ontype && cur[ ontype ]; + if ( handle && jQuery.acceptData( cur ) && handle.apply && handle.apply( cur, data ) === false ) { + event.preventDefault(); + } + } + event.type = type; + + // If nobody prevented the default action, do it now + if ( !onlyHandlers && !event.isDefaultPrevented() ) { + + if ( (!special._default || special._default.apply( elem.ownerDocument, data ) === false) && + !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name name as the event. + // Can't use an .isFunction() check here because IE6/7 fails that test. + // Don't do default actions on window, that's where global variables be (#6170) + if ( ontype && elem[ type ] && !jQuery.isWindow( elem ) ) { + + // Don't re-trigger an onFOO event when we call its FOO() method + tmp = elem[ ontype ]; + + if ( tmp ) { + elem[ ontype ] = null; + } + + // Prevent re-triggering of the same event, since we already bubbled it above + jQuery.event.triggered = type; + try { + elem[ type ](); + } catch ( e ) { + // IE<9 dies on focus/blur to hidden element (#1486,#12518) + // only reproducible on winXP IE8 native, not IE9 in IE8 mode + } + jQuery.event.triggered = undefined; + + if ( tmp ) { + elem[ ontype ] = tmp; + } + } + } + } + + return event.result; + }, + + dispatch: function( event ) { + + // Make a writable jQuery.Event from the native event object + event = jQuery.event.fix( event ); + + var i, ret, handleObj, matched, j, + handlerQueue = [], + args = core_slice.call( arguments ), + handlers = ( jQuery._data( this, "events" ) || {} )[ event.type ] || [], + special = jQuery.event.special[ event.type ] || {}; + + // Use the fix-ed jQuery.Event rather than the (read-only) native event + args[0] = event; + event.delegateTarget = this; + + // Call the preDispatch hook for the mapped type, and let it bail if desired + if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) { + return; + } + + // Determine handlers + handlerQueue = jQuery.event.handlers.call( this, event, handlers ); + + // Run delegates first; they may want to stop propagation beneath us + i = 0; + while ( (matched = handlerQueue[ i++ ]) && !event.isPropagationStopped() ) { + event.currentTarget = matched.elem; + + j = 0; + while ( (handleObj = matched.handlers[ j++ ]) && !event.isImmediatePropagationStopped() ) { + + // Triggered event must either 1) have no namespace, or + // 2) have namespace(s) a subset or equal to those in the bound event (both can have no namespace). + if ( !event.namespace_re || event.namespace_re.test( handleObj.namespace ) ) { + + event.handleObj = handleObj; + event.data = handleObj.data; + + ret = ( (jQuery.event.special[ handleObj.origType ] || {}).handle || handleObj.handler ) + .apply( matched.elem, args ); + + if ( ret !== undefined ) { + if ( (event.result = ret) === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } + + // Call the postDispatch hook for the mapped type + if ( special.postDispatch ) { + special.postDispatch.call( this, event ); + } + + return event.result; + }, + + handlers: function( event, handlers ) { + var sel, handleObj, matches, i, + handlerQueue = [], + delegateCount = handlers.delegateCount, + cur = event.target; + + // Find delegate handlers + // Black-hole SVG instance trees (#13180) + // Avoid non-left-click bubbling in Firefox (#3861) + if ( delegateCount && cur.nodeType && (!event.button || event.type !== "click") ) { + + for ( ; cur != this; cur = cur.parentNode || this ) { + + // Don't check non-elements (#13208) + // Don't process clicks on disabled elements (#6911, #8165, #11382, #11764) + if ( cur.nodeType === 1 && (cur.disabled !== true || event.type !== "click") ) { + matches = []; + for ( i = 0; i < delegateCount; i++ ) { + handleObj = handlers[ i ]; + + // Don't conflict with Object.prototype properties (#13203) + sel = handleObj.selector + " "; + + if ( matches[ sel ] === undefined ) { + matches[ sel ] = handleObj.needsContext ? + jQuery( sel, this ).index( cur ) >= 0 : + jQuery.find( sel, this, null, [ cur ] ).length; + } + if ( matches[ sel ] ) { + matches.push( handleObj ); + } + } + if ( matches.length ) { + handlerQueue.push({ elem: cur, handlers: matches }); + } + } + } + } + + // Add the remaining (directly-bound) handlers + if ( delegateCount < handlers.length ) { + handlerQueue.push({ elem: this, handlers: handlers.slice( delegateCount ) }); + } + + return handlerQueue; + }, + + fix: function( event ) { + if ( event[ jQuery.expando ] ) { + return event; + } + + // Create a writable copy of the event object and normalize some properties + var i, prop, copy, + type = event.type, + originalEvent = event, + fixHook = this.fixHooks[ type ]; + + if ( !fixHook ) { + this.fixHooks[ type ] = fixHook = + rmouseEvent.test( type ) ? this.mouseHooks : + rkeyEvent.test( type ) ? this.keyHooks : + {}; + } + copy = fixHook.props ? this.props.concat( fixHook.props ) : this.props; + + event = new jQuery.Event( originalEvent ); + + i = copy.length; + while ( i-- ) { + prop = copy[ i ]; + event[ prop ] = originalEvent[ prop ]; + } + + // Support: IE<9 + // Fix target property (#1925) + if ( !event.target ) { + event.target = originalEvent.srcElement || document; + } + + // Support: Chrome 23+, Safari? + // Target should not be a text node (#504, #13143) + if ( event.target.nodeType === 3 ) { + event.target = event.target.parentNode; + } + + // Support: IE<9 + // For mouse/key events, metaKey==false if it's undefined (#3368, #11328) + event.metaKey = !!event.metaKey; + + return fixHook.filter ? fixHook.filter( event, originalEvent ) : event; + }, + + // Includes some event props shared by KeyEvent and MouseEvent + props: "altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "), + + fixHooks: {}, + + keyHooks: { + props: "char charCode key keyCode".split(" "), + filter: function( event, original ) { + + // Add which for key events + if ( event.which == null ) { + event.which = original.charCode != null ? original.charCode : original.keyCode; + } + + return event; + } + }, + + mouseHooks: { + props: "button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "), + filter: function( event, original ) { + var body, eventDoc, doc, + button = original.button, + fromElement = original.fromElement; + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && original.clientX != null ) { + eventDoc = event.target.ownerDocument || document; + doc = eventDoc.documentElement; + body = eventDoc.body; + + event.pageX = original.clientX + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - ( doc && doc.clientLeft || body && body.clientLeft || 0 ); + event.pageY = original.clientY + ( doc && doc.scrollTop || body && body.scrollTop || 0 ) - ( doc && doc.clientTop || body && body.clientTop || 0 ); + } + + // Add relatedTarget, if necessary + if ( !event.relatedTarget && fromElement ) { + event.relatedTarget = fromElement === event.target ? original.toElement : fromElement; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + // Note: button is not normalized, so don't use it + if ( !event.which && button !== undefined ) { + event.which = ( button & 1 ? 1 : ( button & 2 ? 3 : ( button & 4 ? 2 : 0 ) ) ); + } + + return event; + } + }, + + special: { + load: { + // Prevent triggered image.load events from bubbling to window.load + noBubble: true + }, + click: { + // For checkbox, fire native event so checked state will be right + trigger: function() { + if ( jQuery.nodeName( this, "input" ) && this.type === "checkbox" && this.click ) { + this.click(); + return false; + } + } + }, + focus: { + // Fire native event if possible so blur/focus sequence is correct + trigger: function() { + if ( this !== document.activeElement && this.focus ) { + try { + this.focus(); + return false; + } catch ( e ) { + // Support: IE<9 + // If we error on focus to hidden element (#1486, #12518), + // let .trigger() run the handlers + } + } + }, + delegateType: "focusin" + }, + blur: { + trigger: function() { + if ( this === document.activeElement && this.blur ) { + this.blur(); + return false; + } + }, + delegateType: "focusout" + }, + + beforeunload: { + postDispatch: function( event ) { + + // Even when returnValue equals to undefined Firefox will still show alert + if ( event.result !== undefined ) { + event.originalEvent.returnValue = event.result; + } + } + } + }, + + simulate: function( type, elem, event, bubble ) { + // Piggyback on a donor event to simulate a different one. + // Fake originalEvent to avoid donor's stopPropagation, but if the + // simulated event prevents default then we do the same on the donor. + var e = jQuery.extend( + new jQuery.Event(), + event, + { type: type, + isSimulated: true, + originalEvent: {} + } + ); + if ( bubble ) { + jQuery.event.trigger( e, null, elem ); + } else { + jQuery.event.dispatch.call( elem, e ); + } + if ( e.isDefaultPrevented() ) { + event.preventDefault(); + } + } +}; + +jQuery.removeEvent = document.removeEventListener ? + function( elem, type, handle ) { + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle, false ); + } + } : + function( elem, type, handle ) { + var name = "on" + type; + + if ( elem.detachEvent ) { + + // #8545, #7054, preventing memory leaks for custom events in IE6-8 + // detachEvent needed property on element, by name of that event, to properly expose it to GC + if ( typeof elem[ name ] === core_strundefined ) { + elem[ name ] = null; + } + + elem.detachEvent( name, handle ); + } + }; + +jQuery.Event = function( src, props ) { + // Allow instantiation without the 'new' keyword + if ( !(this instanceof jQuery.Event) ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = ( src.defaultPrevented || src.returnValue === false || + src.getPreventDefault && src.getPreventDefault() ) ? returnTrue : returnFalse; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // Create a timestamp if incoming event doesn't have one + this.timeStamp = src && src.timeStamp || jQuery.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse, + + preventDefault: function() { + var e = this.originalEvent; + + this.isDefaultPrevented = returnTrue; + if ( !e ) { + return; + } + + // If preventDefault exists, run it on the original event + if ( e.preventDefault ) { + e.preventDefault(); + + // Support: IE + // Otherwise set the returnValue property of the original event to false + } else { + e.returnValue = false; + } + }, + stopPropagation: function() { + var e = this.originalEvent; + + this.isPropagationStopped = returnTrue; + if ( !e ) { + return; + } + // If stopPropagation exists, run it on the original event + if ( e.stopPropagation ) { + e.stopPropagation(); + } + + // Support: IE + // Set the cancelBubble property of the original event to true + e.cancelBubble = true; + }, + stopImmediatePropagation: function() { + this.isImmediatePropagationStopped = returnTrue; + this.stopPropagation(); + } +}; + +// Create mouseenter/leave events using mouseover/out and event-time checks +jQuery.each({ + mouseenter: "mouseover", + mouseleave: "mouseout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + delegateType: fix, + bindType: fix, + + handle: function( event ) { + var ret, + target = this, + related = event.relatedTarget, + handleObj = event.handleObj; + + // For mousenter/leave call the handler if related is outside the target. + // NB: No relatedTarget if the mouse left/entered the browser window + if ( !related || (related !== target && !jQuery.contains( target, related )) ) { + event.type = handleObj.origType; + ret = handleObj.handler.apply( this, arguments ); + event.type = fix; + } + return ret; + } + }; +}); + +// IE submit delegation +if ( !jQuery.support.submitBubbles ) { + + jQuery.event.special.submit = { + setup: function() { + // Only need this for delegated form submit events + if ( jQuery.nodeName( this, "form" ) ) { + return false; + } + + // Lazy-add a submit handler when a descendant form may potentially be submitted + jQuery.event.add( this, "click._submit keypress._submit", function( e ) { + // Node name check avoids a VML-related crash in IE (#9807) + var elem = e.target, + form = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.form : undefined; + if ( form && !jQuery._data( form, "submitBubbles" ) ) { + jQuery.event.add( form, "submit._submit", function( event ) { + event._submit_bubble = true; + }); + jQuery._data( form, "submitBubbles", true ); + } + }); + // return undefined since we don't need an event listener + }, + + postDispatch: function( event ) { + // If form was submitted by the user, bubble the event up the tree + if ( event._submit_bubble ) { + delete event._submit_bubble; + if ( this.parentNode && !event.isTrigger ) { + jQuery.event.simulate( "submit", this.parentNode, event, true ); + } + } + }, + + teardown: function() { + // Only need this for delegated form submit events + if ( jQuery.nodeName( this, "form" ) ) { + return false; + } + + // Remove delegated handlers; cleanData eventually reaps submit handlers attached above + jQuery.event.remove( this, "._submit" ); + } + }; +} + +// IE change delegation and checkbox/radio fix +if ( !jQuery.support.changeBubbles ) { + + jQuery.event.special.change = { + + setup: function() { + + if ( rformElems.test( this.nodeName ) ) { + // IE doesn't fire change on a check/radio until blur; trigger it on click + // after a propertychange. Eat the blur-change in special.change.handle. + // This still fires onchange a second time for check/radio after blur. + if ( this.type === "checkbox" || this.type === "radio" ) { + jQuery.event.add( this, "propertychange._change", function( event ) { + if ( event.originalEvent.propertyName === "checked" ) { + this._just_changed = true; + } + }); + jQuery.event.add( this, "click._change", function( event ) { + if ( this._just_changed && !event.isTrigger ) { + this._just_changed = false; + } + // Allow triggered, simulated change events (#11500) + jQuery.event.simulate( "change", this, event, true ); + }); + } + return false; + } + // Delegated event; lazy-add a change handler on descendant inputs + jQuery.event.add( this, "beforeactivate._change", function( e ) { + var elem = e.target; + + if ( rformElems.test( elem.nodeName ) && !jQuery._data( elem, "changeBubbles" ) ) { + jQuery.event.add( elem, "change._change", function( event ) { + if ( this.parentNode && !event.isSimulated && !event.isTrigger ) { + jQuery.event.simulate( "change", this.parentNode, event, true ); + } + }); + jQuery._data( elem, "changeBubbles", true ); + } + }); + }, + + handle: function( event ) { + var elem = event.target; + + // Swallow native change events from checkbox/radio, we already triggered them above + if ( this !== elem || event.isSimulated || event.isTrigger || (elem.type !== "radio" && elem.type !== "checkbox") ) { + return event.handleObj.handler.apply( this, arguments ); + } + }, + + teardown: function() { + jQuery.event.remove( this, "._change" ); + + return !rformElems.test( this.nodeName ); + } + }; +} + +// Create "bubbling" focus and blur events +if ( !jQuery.support.focusinBubbles ) { + jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler while someone wants focusin/focusout + var attaches = 0, + handler = function( event ) { + jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ), true ); + }; + + jQuery.event.special[ fix ] = { + setup: function() { + if ( attaches++ === 0 ) { + document.addEventListener( orig, handler, true ); + } + }, + teardown: function() { + if ( --attaches === 0 ) { + document.removeEventListener( orig, handler, true ); + } + } + }; + }); +} + +jQuery.fn.extend({ + + on: function( types, selector, data, fn, /*INTERNAL*/ one ) { + var type, origFn; + + // Types can be a map of types/handlers + if ( typeof types === "object" ) { + // ( types-Object, selector, data ) + if ( typeof selector !== "string" ) { + // ( types-Object, data ) + data = data || selector; + selector = undefined; + } + for ( type in types ) { + this.on( type, selector, data, types[ type ], one ); + } + return this; + } + + if ( data == null && fn == null ) { + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if ( fn == null ) { + if ( typeof selector === "string" ) { + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if ( fn === false ) { + fn = returnFalse; + } else if ( !fn ) { + return this; + } + + if ( one === 1 ) { + origFn = fn; + fn = function( event ) { + // Can use an empty set, since event contains the info + jQuery().off( event ); + return origFn.apply( this, arguments ); + }; + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); + } + return this.each( function() { + jQuery.event.add( this, types, fn, data, selector ); + }); + }, + one: function( types, selector, data, fn ) { + return this.on( types, selector, data, fn, 1 ); + }, + off: function( types, selector, fn ) { + var handleObj, type; + if ( types && types.preventDefault && types.handleObj ) { + // ( event ) dispatched jQuery.Event + handleObj = types.handleObj; + jQuery( types.delegateTarget ).off( + handleObj.namespace ? handleObj.origType + "." + handleObj.namespace : handleObj.origType, + handleObj.selector, + handleObj.handler + ); + return this; + } + if ( typeof types === "object" ) { + // ( types-object [, selector] ) + for ( type in types ) { + this.off( type, selector, types[ type ] ); + } + return this; + } + if ( selector === false || typeof selector === "function" ) { + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if ( fn === false ) { + fn = returnFalse; + } + return this.each(function() { + jQuery.event.remove( this, types, fn, selector ); + }); + }, + + bind: function( types, data, fn ) { + return this.on( types, null, data, fn ); + }, + unbind: function( types, fn ) { + return this.off( types, null, fn ); + }, + + delegate: function( selector, types, data, fn ) { + return this.on( types, selector, data, fn ); + }, + undelegate: function( selector, types, fn ) { + // ( namespace ) or ( selector, types [, fn] ) + return arguments.length === 1 ? this.off( selector, "**" ) : this.off( types, selector || "**", fn ); + }, + + trigger: function( type, data ) { + return this.each(function() { + jQuery.event.trigger( type, data, this ); + }); + }, + triggerHandler: function( type, data ) { + var elem = this[0]; + if ( elem ) { + return jQuery.event.trigger( type, data, elem, true ); + } + } +}); +/*! + * Sizzle CSS Selector Engine + * Copyright 2012 jQuery Foundation and other contributors + * Released under the MIT license + * http://sizzlejs.com/ + */ +(function( window, undefined ) { + +var i, + cachedruns, + Expr, + getText, + isXML, + compile, + hasDuplicate, + outermostContext, + + // Local document vars + setDocument, + document, + docElem, + documentIsXML, + rbuggyQSA, + rbuggyMatches, + matches, + contains, + sortOrder, + + // Instance-specific data + expando = "sizzle" + -(new Date()), + preferredDoc = window.document, + support = {}, + dirruns = 0, + done = 0, + classCache = createCache(), + tokenCache = createCache(), + compilerCache = createCache(), + + // General-purpose constants + strundefined = typeof undefined, + MAX_NEGATIVE = 1 << 31, + + // Array methods + arr = [], + pop = arr.pop, + push = arr.push, + slice = arr.slice, + // Use a stripped-down indexOf if we can't use a native one + indexOf = arr.indexOf || function( elem ) { + var i = 0, + len = this.length; + for ( ; i < len; i++ ) { + if ( this[i] === elem ) { + return i; + } + } + return -1; + }, + + + // Regular expressions + + // Whitespace characters http://www.w3.org/TR/css3-selectors/#whitespace + whitespace = "[\\x20\\t\\r\\n\\f]", + // http://www.w3.org/TR/css3-syntax/#characters + characterEncoding = "(?:\\\\.|[\\w-]|[^\\x00-\\xa0])+", + + // Loosely modeled on CSS identifier characters + // An unquoted value should be a CSS identifier http://www.w3.org/TR/css3-selectors/#attribute-selectors + // Proper syntax: http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier + identifier = characterEncoding.replace( "w", "w#" ), + + // Acceptable operators http://www.w3.org/TR/selectors/#attribute-selectors + operators = "([*^$|!~]?=)", + attributes = "\\[" + whitespace + "*(" + characterEncoding + ")" + whitespace + + "*(?:" + operators + whitespace + "*(?:(['\"])((?:\\\\.|[^\\\\])*?)\\3|(" + identifier + ")|)|)" + whitespace + "*\\]", + + // Prefer arguments quoted, + // then not containing pseudos/brackets, + // then attribute selectors/non-parenthetical expressions, + // then anything else + // These preferences are here to reduce the number of selectors + // needing tokenize in the PSEUDO preFilter + pseudos = ":(" + characterEncoding + ")(?:\\(((['\"])((?:\\\\.|[^\\\\])*?)\\3|((?:\\\\.|[^\\\\()[\\]]|" + attributes.replace( 3, 8 ) + ")*)|.*)\\)|)", + + // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter + rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g" ), + + rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ), + rcombinators = new RegExp( "^" + whitespace + "*([\\x20\\t\\r\\n\\f>+~])" + whitespace + "*" ), + rpseudo = new RegExp( pseudos ), + ridentifier = new RegExp( "^" + identifier + "$" ), + + matchExpr = { + "ID": new RegExp( "^#(" + characterEncoding + ")" ), + "CLASS": new RegExp( "^\\.(" + characterEncoding + ")" ), + "NAME": new RegExp( "^\\[name=['\"]?(" + characterEncoding + ")['\"]?\\]" ), + "TAG": new RegExp( "^(" + characterEncoding.replace( "w", "w*" ) + ")" ), + "ATTR": new RegExp( "^" + attributes ), + "PSEUDO": new RegExp( "^" + pseudos ), + "CHILD": new RegExp( "^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + whitespace + + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace + + "*(\\d+)|))" + whitespace + "*\\)|)", "i" ), + // For use in libraries implementing .is() + // We use this for POS matching in `select` + "needsContext": new RegExp( "^" + whitespace + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + + whitespace + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i" ) + }, + + rsibling = /[\x20\t\r\n\f]*[+~]/, + + rnative = /^[^{]+\{\s*\[native code/, + + // Easily-parseable/retrievable ID or TAG or CLASS selectors + rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/, + + rinputs = /^(?:input|select|textarea|button)$/i, + rheader = /^h\d$/i, + + rescape = /'|\\/g, + rattributeQuotes = /\=[\x20\t\r\n\f]*([^'"\]]*)[\x20\t\r\n\f]*\]/g, + + // CSS escapes http://www.w3.org/TR/CSS21/syndata.html#escaped-characters + runescape = /\\([\da-fA-F]{1,6}[\x20\t\r\n\f]?|.)/g, + funescape = function( _, escaped ) { + var high = "0x" + escaped - 0x10000; + // NaN means non-codepoint + return high !== high ? + escaped : + // BMP codepoint + high < 0 ? + String.fromCharCode( high + 0x10000 ) : + // Supplemental Plane codepoint (surrogate pair) + String.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 ); + }; + +// Use a stripped-down slice if we can't use a native one +try { + slice.call( preferredDoc.documentElement.childNodes, 0 )[0].nodeType; +} catch ( e ) { + slice = function( i ) { + var elem, + results = []; + while ( (elem = this[i++]) ) { + results.push( elem ); + } + return results; + }; +} + +/** + * For feature detection + * @param {Function} fn The function to test for native support + */ +function isNative( fn ) { + return rnative.test( fn + "" ); +} + +/** + * Create key-value caches of limited size + * @returns {Function(string, Object)} Returns the Object data after storing it on itself with + * property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength) + * deleting the oldest entry + */ +function createCache() { + var cache, + keys = []; + + return (cache = function( key, value ) { + // Use (key + " ") to avoid collision with native prototype properties (see Issue #157) + if ( keys.push( key += " " ) > Expr.cacheLength ) { + // Only keep the most recent entries + delete cache[ keys.shift() ]; + } + return (cache[ key ] = value); + }); +} + +/** + * Mark a function for special use by Sizzle + * @param {Function} fn The function to mark + */ +function markFunction( fn ) { + fn[ expando ] = true; + return fn; +} + +/** + * Support testing using an element + * @param {Function} fn Passed the created div and expects a boolean result + */ +function assert( fn ) { + var div = document.createElement("div"); + + try { + return fn( div ); + } catch (e) { + return false; + } finally { + // release memory in IE + div = null; + } +} + +function Sizzle( selector, context, results, seed ) { + var match, elem, m, nodeType, + // QSA vars + i, groups, old, nid, newContext, newSelector; + + if ( ( context ? context.ownerDocument || context : preferredDoc ) !== document ) { + setDocument( context ); + } + + context = context || document; + results = results || []; + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + if ( (nodeType = context.nodeType) !== 1 && nodeType !== 9 ) { + return []; + } + + if ( !documentIsXML && !seed ) { + + // Shortcuts + if ( (match = rquickExpr.exec( selector )) ) { + // Speed-up: Sizzle("#ID") + if ( (m = match[1]) ) { + if ( nodeType === 9 ) { + elem = context.getElementById( m ); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE, Opera, and Webkit return items + // by name instead of ID + if ( elem.id === m ) { + results.push( elem ); + return results; + } + } else { + return results; + } + } else { + // Context is not a document + if ( context.ownerDocument && (elem = context.ownerDocument.getElementById( m )) && + contains( context, elem ) && elem.id === m ) { + results.push( elem ); + return results; + } + } + + // Speed-up: Sizzle("TAG") + } else if ( match[2] ) { + push.apply( results, slice.call(context.getElementsByTagName( selector ), 0) ); + return results; + + // Speed-up: Sizzle(".CLASS") + } else if ( (m = match[3]) && support.getByClassName && context.getElementsByClassName ) { + push.apply( results, slice.call(context.getElementsByClassName( m ), 0) ); + return results; + } + } + + // QSA path + if ( support.qsa && !rbuggyQSA.test(selector) ) { + old = true; + nid = expando; + newContext = context; + newSelector = nodeType === 9 && selector; + + // qSA works strangely on Element-rooted queries + // We can work around this by specifying an extra ID on the root + // and working up from there (Thanks to Andrew Dupont for the technique) + // IE 8 doesn't work on object elements + if ( nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { + groups = tokenize( selector ); + + if ( (old = context.getAttribute("id")) ) { + nid = old.replace( rescape, "\\$&" ); + } else { + context.setAttribute( "id", nid ); + } + nid = "[id='" + nid + "'] "; + + i = groups.length; + while ( i-- ) { + groups[i] = nid + toSelector( groups[i] ); + } + newContext = rsibling.test( selector ) && context.parentNode || context; + newSelector = groups.join(","); + } + + if ( newSelector ) { + try { + push.apply( results, slice.call( newContext.querySelectorAll( + newSelector + ), 0 ) ); + return results; + } catch(qsaError) { + } finally { + if ( !old ) { + context.removeAttribute("id"); + } + } + } + } + } + + // All others + return select( selector.replace( rtrim, "$1" ), context, results, seed ); +} + +/** + * Detect xml + * @param {Element|Object} elem An element or a document + */ +isXML = Sizzle.isXML = function( elem ) { + // documentElement is verified for cases where it doesn't yet exist + // (such as loading iframes in IE - #4833) + var documentElement = elem && (elem.ownerDocument || elem).documentElement; + return documentElement ? documentElement.nodeName !== "HTML" : false; +}; + +/** + * Sets document-related variables once based on the current document + * @param {Element|Object} [doc] An element or document object to use to set the document + * @returns {Object} Returns the current document + */ +setDocument = Sizzle.setDocument = function( node ) { + var doc = node ? node.ownerDocument || node : preferredDoc; + + // If no document and documentElement is available, return + if ( doc === document || doc.nodeType !== 9 || !doc.documentElement ) { + return document; + } + + // Set our document + document = doc; + docElem = doc.documentElement; + + // Support tests + documentIsXML = isXML( doc ); + + // Check if getElementsByTagName("*") returns only elements + support.tagNameNoComments = assert(function( div ) { + div.appendChild( doc.createComment("") ); + return !div.getElementsByTagName("*").length; + }); + + // Check if attributes should be retrieved by attribute nodes + support.attributes = assert(function( div ) { + div.innerHTML = ""; + var type = typeof div.lastChild.getAttribute("multiple"); + // IE8 returns a string for some attributes even when not present + return type !== "boolean" && type !== "string"; + }); + + // Check if getElementsByClassName can be trusted + support.getByClassName = assert(function( div ) { + // Opera can't find a second classname (in 9.6) + div.innerHTML = ""; + if ( !div.getElementsByClassName || !div.getElementsByClassName("e").length ) { + return false; + } + + // Safari 3.2 caches class attributes and doesn't catch changes + div.lastChild.className = "e"; + return div.getElementsByClassName("e").length === 2; + }); + + // Check if getElementById returns elements by name + // Check if getElementsByName privileges form controls or returns elements by ID + support.getByName = assert(function( div ) { + // Inject content + div.id = expando + 0; + div.innerHTML = "
        "; + docElem.insertBefore( div, docElem.firstChild ); + + // Test + var pass = doc.getElementsByName && + // buggy browsers will return fewer than the correct 2 + doc.getElementsByName( expando ).length === 2 + + // buggy browsers will return more than the correct 0 + doc.getElementsByName( expando + 0 ).length; + support.getIdNotName = !doc.getElementById( expando ); + + // Cleanup + docElem.removeChild( div ); + + return pass; + }); + + // IE6/7 return modified attributes + Expr.attrHandle = assert(function( div ) { + div.innerHTML = ""; + return div.firstChild && typeof div.firstChild.getAttribute !== strundefined && + div.firstChild.getAttribute("href") === "#"; + }) ? + {} : + { + "href": function( elem ) { + return elem.getAttribute( "href", 2 ); + }, + "type": function( elem ) { + return elem.getAttribute("type"); + } + }; + + // ID find and filter + if ( support.getIdNotName ) { + Expr.find["ID"] = function( id, context ) { + if ( typeof context.getElementById !== strundefined && !documentIsXML ) { + var m = context.getElementById( id ); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + return m && m.parentNode ? [m] : []; + } + }; + Expr.filter["ID"] = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + return elem.getAttribute("id") === attrId; + }; + }; + } else { + Expr.find["ID"] = function( id, context ) { + if ( typeof context.getElementById !== strundefined && !documentIsXML ) { + var m = context.getElementById( id ); + + return m ? + m.id === id || typeof m.getAttributeNode !== strundefined && m.getAttributeNode("id").value === id ? + [m] : + undefined : + []; + } + }; + Expr.filter["ID"] = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + var node = typeof elem.getAttributeNode !== strundefined && elem.getAttributeNode("id"); + return node && node.value === attrId; + }; + }; + } + + // Tag + Expr.find["TAG"] = support.tagNameNoComments ? + function( tag, context ) { + if ( typeof context.getElementsByTagName !== strundefined ) { + return context.getElementsByTagName( tag ); + } + } : + function( tag, context ) { + var elem, + tmp = [], + i = 0, + results = context.getElementsByTagName( tag ); + + // Filter out possible comments + if ( tag === "*" ) { + while ( (elem = results[i++]) ) { + if ( elem.nodeType === 1 ) { + tmp.push( elem ); + } + } + + return tmp; + } + return results; + }; + + // Name + Expr.find["NAME"] = support.getByName && function( tag, context ) { + if ( typeof context.getElementsByName !== strundefined ) { + return context.getElementsByName( name ); + } + }; + + // Class + Expr.find["CLASS"] = support.getByClassName && function( className, context ) { + if ( typeof context.getElementsByClassName !== strundefined && !documentIsXML ) { + return context.getElementsByClassName( className ); + } + }; + + // QSA and matchesSelector support + + // matchesSelector(:active) reports false when true (IE9/Opera 11.5) + rbuggyMatches = []; + + // qSa(:focus) reports false when true (Chrome 21), + // no need to also add to buggyMatches since matches checks buggyQSA + // A support test would require too much code (would include document ready) + rbuggyQSA = [ ":focus" ]; + + if ( (support.qsa = isNative(doc.querySelectorAll)) ) { + // Build QSA regex + // Regex strategy adopted from Diego Perini + assert(function( div ) { + // Select is set to empty string on purpose + // This is to test IE's treatment of not explictly + // setting a boolean content attribute, + // since its presence should be enough + // http://bugs.jquery.com/ticket/12359 + div.innerHTML = ""; + + // IE8 - Some boolean attributes are not treated correctly + if ( !div.querySelectorAll("[selected]").length ) { + rbuggyQSA.push( "\\[" + whitespace + "*(?:checked|disabled|ismap|multiple|readonly|selected|value)" ); + } + + // Webkit/Opera - :checked should return selected option elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + // IE8 throws error here and will not see later tests + if ( !div.querySelectorAll(":checked").length ) { + rbuggyQSA.push(":checked"); + } + }); + + assert(function( div ) { + + // Opera 10-12/IE8 - ^= $= *= and empty values + // Should not select anything + div.innerHTML = ""; + if ( div.querySelectorAll("[i^='']").length ) { + rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:\"\"|'')" ); + } + + // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled) + // IE8 throws error here and will not see later tests + if ( !div.querySelectorAll(":enabled").length ) { + rbuggyQSA.push( ":enabled", ":disabled" ); + } + + // Opera 10-11 does not throw on post-comma invalid pseudos + div.querySelectorAll("*,:x"); + rbuggyQSA.push(",.*:"); + }); + } + + if ( (support.matchesSelector = isNative( (matches = docElem.matchesSelector || + docElem.mozMatchesSelector || + docElem.webkitMatchesSelector || + docElem.oMatchesSelector || + docElem.msMatchesSelector) )) ) { + + assert(function( div ) { + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9) + support.disconnectedMatch = matches.call( div, "div" ); + + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( div, "[s!='']:x" ); + rbuggyMatches.push( "!=", pseudos ); + }); + } + + rbuggyQSA = new RegExp( rbuggyQSA.join("|") ); + rbuggyMatches = new RegExp( rbuggyMatches.join("|") ); + + // Element contains another + // Purposefully does not implement inclusive descendent + // As in, an element does not contain itself + contains = isNative(docElem.contains) || docElem.compareDocumentPosition ? + function( a, b ) { + var adown = a.nodeType === 9 ? a.documentElement : a, + bup = b && b.parentNode; + return a === bup || !!( bup && bup.nodeType === 1 && ( + adown.contains ? + adown.contains( bup ) : + a.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16 + )); + } : + function( a, b ) { + if ( b ) { + while ( (b = b.parentNode) ) { + if ( b === a ) { + return true; + } + } + } + return false; + }; + + // Document order sorting + sortOrder = docElem.compareDocumentPosition ? + function( a, b ) { + var compare; + + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + if ( (compare = b.compareDocumentPosition && a.compareDocumentPosition && a.compareDocumentPosition( b )) ) { + if ( compare & 1 || a.parentNode && a.parentNode.nodeType === 11 ) { + if ( a === doc || contains( preferredDoc, a ) ) { + return -1; + } + if ( b === doc || contains( preferredDoc, b ) ) { + return 1; + } + return 0; + } + return compare & 4 ? -1 : 1; + } + + return a.compareDocumentPosition ? -1 : 1; + } : + function( a, b ) { + var cur, + i = 0, + aup = a.parentNode, + bup = b.parentNode, + ap = [ a ], + bp = [ b ]; + + // Exit early if the nodes are identical + if ( a === b ) { + hasDuplicate = true; + return 0; + + // Parentless nodes are either documents or disconnected + } else if ( !aup || !bup ) { + return a === doc ? -1 : + b === doc ? 1 : + aup ? -1 : + bup ? 1 : + 0; + + // If the nodes are siblings, we can do a quick check + } else if ( aup === bup ) { + return siblingCheck( a, b ); + } + + // Otherwise we need full lists of their ancestors for comparison + cur = a; + while ( (cur = cur.parentNode) ) { + ap.unshift( cur ); + } + cur = b; + while ( (cur = cur.parentNode) ) { + bp.unshift( cur ); + } + + // Walk down the tree looking for a discrepancy + while ( ap[i] === bp[i] ) { + i++; + } + + return i ? + // Do a sibling check if the nodes have a common ancestor + siblingCheck( ap[i], bp[i] ) : + + // Otherwise nodes in our document sort first + ap[i] === preferredDoc ? -1 : + bp[i] === preferredDoc ? 1 : + 0; + }; + + // Always assume the presence of duplicates if sort doesn't + // pass them to our comparison function (as in Google Chrome). + hasDuplicate = false; + [0, 0].sort( sortOrder ); + support.detectDuplicates = hasDuplicate; + + return document; +}; + +Sizzle.matches = function( expr, elements ) { + return Sizzle( expr, null, null, elements ); +}; + +Sizzle.matchesSelector = function( elem, expr ) { + // Set document vars if needed + if ( ( elem.ownerDocument || elem ) !== document ) { + setDocument( elem ); + } + + // Make sure that attribute selectors are quoted + expr = expr.replace( rattributeQuotes, "='$1']" ); + + // rbuggyQSA always contains :focus, so no need for an existence check + if ( support.matchesSelector && !documentIsXML && (!rbuggyMatches || !rbuggyMatches.test(expr)) && !rbuggyQSA.test(expr) ) { + try { + var ret = matches.call( elem, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || support.disconnectedMatch || + // As well, disconnected nodes are said to be in a document + // fragment in IE 9 + elem.document && elem.document.nodeType !== 11 ) { + return ret; + } + } catch(e) {} + } + + return Sizzle( expr, document, null, [elem] ).length > 0; +}; + +Sizzle.contains = function( context, elem ) { + // Set document vars if needed + if ( ( context.ownerDocument || context ) !== document ) { + setDocument( context ); + } + return contains( context, elem ); +}; + +Sizzle.attr = function( elem, name ) { + var val; + + // Set document vars if needed + if ( ( elem.ownerDocument || elem ) !== document ) { + setDocument( elem ); + } + + if ( !documentIsXML ) { + name = name.toLowerCase(); + } + if ( (val = Expr.attrHandle[ name ]) ) { + return val( elem ); + } + if ( documentIsXML || support.attributes ) { + return elem.getAttribute( name ); + } + return ( (val = elem.getAttributeNode( name )) || elem.getAttribute( name ) ) && elem[ name ] === true ? + name : + val && val.specified ? val.value : null; +}; + +Sizzle.error = function( msg ) { + throw new Error( "Syntax error, unrecognized expression: " + msg ); +}; + +// Document sorting and removing duplicates +Sizzle.uniqueSort = function( results ) { + var elem, + duplicates = [], + i = 1, + j = 0; + + // Unless we *know* we can detect duplicates, assume their presence + hasDuplicate = !support.detectDuplicates; + results.sort( sortOrder ); + + if ( hasDuplicate ) { + for ( ; (elem = results[i]); i++ ) { + if ( elem === results[ i - 1 ] ) { + j = duplicates.push( i ); + } + } + while ( j-- ) { + results.splice( duplicates[ j ], 1 ); + } + } + + return results; +}; + +function siblingCheck( a, b ) { + var cur = b && a, + diff = cur && ( ~b.sourceIndex || MAX_NEGATIVE ) - ( ~a.sourceIndex || MAX_NEGATIVE ); + + // Use IE sourceIndex if available on both nodes + if ( diff ) { + return diff; + } + + // Check if b follows a + if ( cur ) { + while ( (cur = cur.nextSibling) ) { + if ( cur === b ) { + return -1; + } + } + } + + return a ? 1 : -1; +} + +// Returns a function to use in pseudos for input types +function createInputPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === type; + }; +} + +// Returns a function to use in pseudos for buttons +function createButtonPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && elem.type === type; + }; +} + +// Returns a function to use in pseudos for positionals +function createPositionalPseudo( fn ) { + return markFunction(function( argument ) { + argument = +argument; + return markFunction(function( seed, matches ) { + var j, + matchIndexes = fn( [], seed.length, argument ), + i = matchIndexes.length; + + // Match elements found at the specified indexes + while ( i-- ) { + if ( seed[ (j = matchIndexes[i]) ] ) { + seed[j] = !(matches[j] = seed[j]); + } + } + }); + }); +} + +/** + * Utility function for retrieving the text value of an array of DOM nodes + * @param {Array|Element} elem + */ +getText = Sizzle.getText = function( elem ) { + var node, + ret = "", + i = 0, + nodeType = elem.nodeType; + + if ( !nodeType ) { + // If no nodeType, this is expected to be an array + for ( ; (node = elem[i]); i++ ) { + // Do not traverse comment nodes + ret += getText( node ); + } + } else if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) { + // Use textContent for elements + // innerText usage removed for consistency of new lines (see #11153) + if ( typeof elem.textContent === "string" ) { + return elem.textContent; + } else { + // Traverse its children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + ret += getText( elem ); + } + } + } else if ( nodeType === 3 || nodeType === 4 ) { + return elem.nodeValue; + } + // Do not include comment or processing instruction nodes + + return ret; +}; + +Expr = Sizzle.selectors = { + + // Can be adjusted by the user + cacheLength: 50, + + createPseudo: markFunction, + + match: matchExpr, + + find: {}, + + relative: { + ">": { dir: "parentNode", first: true }, + " ": { dir: "parentNode" }, + "+": { dir: "previousSibling", first: true }, + "~": { dir: "previousSibling" } + }, + + preFilter: { + "ATTR": function( match ) { + match[1] = match[1].replace( runescape, funescape ); + + // Move the given value to match[3] whether quoted or unquoted + match[3] = ( match[4] || match[5] || "" ).replace( runescape, funescape ); + + if ( match[2] === "~=" ) { + match[3] = " " + match[3] + " "; + } + + return match.slice( 0, 4 ); + }, + + "CHILD": function( match ) { + /* matches from matchExpr["CHILD"] + 1 type (only|nth|...) + 2 what (child|of-type) + 3 argument (even|odd|\d*|\d*n([+-]\d+)?|...) + 4 xn-component of xn+y argument ([+-]?\d*n|) + 5 sign of xn-component + 6 x of xn-component + 7 sign of y-component + 8 y of y-component + */ + match[1] = match[1].toLowerCase(); + + if ( match[1].slice( 0, 3 ) === "nth" ) { + // nth-* requires argument + if ( !match[3] ) { + Sizzle.error( match[0] ); + } + + // numeric x and y parameters for Expr.filter.CHILD + // remember that false/true cast respectively to 0/1 + match[4] = +( match[4] ? match[5] + (match[6] || 1) : 2 * ( match[3] === "even" || match[3] === "odd" ) ); + match[5] = +( ( match[7] + match[8] ) || match[3] === "odd" ); + + // other types prohibit arguments + } else if ( match[3] ) { + Sizzle.error( match[0] ); + } + + return match; + }, + + "PSEUDO": function( match ) { + var excess, + unquoted = !match[5] && match[2]; + + if ( matchExpr["CHILD"].test( match[0] ) ) { + return null; + } + + // Accept quoted arguments as-is + if ( match[4] ) { + match[2] = match[4]; + + // Strip excess characters from unquoted arguments + } else if ( unquoted && rpseudo.test( unquoted ) && + // Get excess from tokenize (recursively) + (excess = tokenize( unquoted, true )) && + // advance to the next closing parenthesis + (excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length) ) { + + // excess is a negative index + match[0] = match[0].slice( 0, excess ); + match[2] = unquoted.slice( 0, excess ); + } + + // Return only captures needed by the pseudo filter method (type and argument) + return match.slice( 0, 3 ); + } + }, + + filter: { + + "TAG": function( nodeName ) { + if ( nodeName === "*" ) { + return function() { return true; }; + } + + nodeName = nodeName.replace( runescape, funescape ).toLowerCase(); + return function( elem ) { + return elem.nodeName && elem.nodeName.toLowerCase() === nodeName; + }; + }, + + "CLASS": function( className ) { + var pattern = classCache[ className + " " ]; + + return pattern || + (pattern = new RegExp( "(^|" + whitespace + ")" + className + "(" + whitespace + "|$)" )) && + classCache( className, function( elem ) { + return pattern.test( elem.className || (typeof elem.getAttribute !== strundefined && elem.getAttribute("class")) || "" ); + }); + }, + + "ATTR": function( name, operator, check ) { + return function( elem ) { + var result = Sizzle.attr( elem, name ); + + if ( result == null ) { + return operator === "!="; + } + if ( !operator ) { + return true; + } + + result += ""; + + return operator === "=" ? result === check : + operator === "!=" ? result !== check : + operator === "^=" ? check && result.indexOf( check ) === 0 : + operator === "*=" ? check && result.indexOf( check ) > -1 : + operator === "$=" ? check && result.slice( -check.length ) === check : + operator === "~=" ? ( " " + result + " " ).indexOf( check ) > -1 : + operator === "|=" ? result === check || result.slice( 0, check.length + 1 ) === check + "-" : + false; + }; + }, + + "CHILD": function( type, what, argument, first, last ) { + var simple = type.slice( 0, 3 ) !== "nth", + forward = type.slice( -4 ) !== "last", + ofType = what === "of-type"; + + return first === 1 && last === 0 ? + + // Shortcut for :nth-*(n) + function( elem ) { + return !!elem.parentNode; + } : + + function( elem, context, xml ) { + var cache, outerCache, node, diff, nodeIndex, start, + dir = simple !== forward ? "nextSibling" : "previousSibling", + parent = elem.parentNode, + name = ofType && elem.nodeName.toLowerCase(), + useCache = !xml && !ofType; + + if ( parent ) { + + // :(first|last|only)-(child|of-type) + if ( simple ) { + while ( dir ) { + node = elem; + while ( (node = node[ dir ]) ) { + if ( ofType ? node.nodeName.toLowerCase() === name : node.nodeType === 1 ) { + return false; + } + } + // Reverse direction for :only-* (if we haven't yet done so) + start = dir = type === "only" && !start && "nextSibling"; + } + return true; + } + + start = [ forward ? parent.firstChild : parent.lastChild ]; + + // non-xml :nth-child(...) stores cache data on `parent` + if ( forward && useCache ) { + // Seek `elem` from a previously-cached index + outerCache = parent[ expando ] || (parent[ expando ] = {}); + cache = outerCache[ type ] || []; + nodeIndex = cache[0] === dirruns && cache[1]; + diff = cache[0] === dirruns && cache[2]; + node = nodeIndex && parent.childNodes[ nodeIndex ]; + + while ( (node = ++nodeIndex && node && node[ dir ] || + + // Fallback to seeking `elem` from the start + (diff = nodeIndex = 0) || start.pop()) ) { + + // When found, cache indexes on `parent` and break + if ( node.nodeType === 1 && ++diff && node === elem ) { + outerCache[ type ] = [ dirruns, nodeIndex, diff ]; + break; + } + } + + // Use previously-cached element index if available + } else if ( useCache && (cache = (elem[ expando ] || (elem[ expando ] = {}))[ type ]) && cache[0] === dirruns ) { + diff = cache[1]; + + // xml :nth-child(...) or :nth-last-child(...) or :nth(-last)?-of-type(...) + } else { + // Use the same loop as above to seek `elem` from the start + while ( (node = ++nodeIndex && node && node[ dir ] || + (diff = nodeIndex = 0) || start.pop()) ) { + + if ( ( ofType ? node.nodeName.toLowerCase() === name : node.nodeType === 1 ) && ++diff ) { + // Cache the index of each encountered element + if ( useCache ) { + (node[ expando ] || (node[ expando ] = {}))[ type ] = [ dirruns, diff ]; + } + + if ( node === elem ) { + break; + } + } + } + } + + // Incorporate the offset, then check against cycle size + diff -= last; + return diff === first || ( diff % first === 0 && diff / first >= 0 ); + } + }; + }, + + "PSEUDO": function( pseudo, argument ) { + // pseudo-class names are case-insensitive + // http://www.w3.org/TR/selectors/#pseudo-classes + // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters + // Remember that setFilters inherits from pseudos + var args, + fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] || + Sizzle.error( "unsupported pseudo: " + pseudo ); + + // The user may use createPseudo to indicate that + // arguments are needed to create the filter function + // just as Sizzle does + if ( fn[ expando ] ) { + return fn( argument ); + } + + // But maintain support for old signatures + if ( fn.length > 1 ) { + args = [ pseudo, pseudo, "", argument ]; + return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ? + markFunction(function( seed, matches ) { + var idx, + matched = fn( seed, argument ), + i = matched.length; + while ( i-- ) { + idx = indexOf.call( seed, matched[i] ); + seed[ idx ] = !( matches[ idx ] = matched[i] ); + } + }) : + function( elem ) { + return fn( elem, 0, args ); + }; + } + + return fn; + } + }, + + pseudos: { + // Potentially complex pseudos + "not": markFunction(function( selector ) { + // Trim the selector passed to compile + // to avoid treating leading and trailing + // spaces as combinators + var input = [], + results = [], + matcher = compile( selector.replace( rtrim, "$1" ) ); + + return matcher[ expando ] ? + markFunction(function( seed, matches, context, xml ) { + var elem, + unmatched = matcher( seed, null, xml, [] ), + i = seed.length; + + // Match elements unmatched by `matcher` + while ( i-- ) { + if ( (elem = unmatched[i]) ) { + seed[i] = !(matches[i] = elem); + } + } + }) : + function( elem, context, xml ) { + input[0] = elem; + matcher( input, null, xml, results ); + return !results.pop(); + }; + }), + + "has": markFunction(function( selector ) { + return function( elem ) { + return Sizzle( selector, elem ).length > 0; + }; + }), + + "contains": markFunction(function( text ) { + return function( elem ) { + return ( elem.textContent || elem.innerText || getText( elem ) ).indexOf( text ) > -1; + }; + }), + + // "Whether an element is represented by a :lang() selector + // is based solely on the element's language value + // being equal to the identifier C, + // or beginning with the identifier C immediately followed by "-". + // The matching of C against the element's language value is performed case-insensitively. + // The identifier C does not have to be a valid language name." + // http://www.w3.org/TR/selectors/#lang-pseudo + "lang": markFunction( function( lang ) { + // lang value must be a valid identifider + if ( !ridentifier.test(lang || "") ) { + Sizzle.error( "unsupported lang: " + lang ); + } + lang = lang.replace( runescape, funescape ).toLowerCase(); + return function( elem ) { + var elemLang; + do { + if ( (elemLang = documentIsXML ? + elem.getAttribute("xml:lang") || elem.getAttribute("lang") : + elem.lang) ) { + + elemLang = elemLang.toLowerCase(); + return elemLang === lang || elemLang.indexOf( lang + "-" ) === 0; + } + } while ( (elem = elem.parentNode) && elem.nodeType === 1 ); + return false; + }; + }), + + // Miscellaneous + "target": function( elem ) { + var hash = window.location && window.location.hash; + return hash && hash.slice( 1 ) === elem.id; + }, + + "root": function( elem ) { + return elem === docElem; + }, + + "focus": function( elem ) { + return elem === document.activeElement && (!document.hasFocus || document.hasFocus()) && !!(elem.type || elem.href || ~elem.tabIndex); + }, + + // Boolean properties + "enabled": function( elem ) { + return elem.disabled === false; + }, + + "disabled": function( elem ) { + return elem.disabled === true; + }, + + "checked": function( elem ) { + // In CSS3, :checked should return both checked and selected elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + var nodeName = elem.nodeName.toLowerCase(); + return (nodeName === "input" && !!elem.checked) || (nodeName === "option" && !!elem.selected); + }, + + "selected": function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + // Contents + "empty": function( elem ) { + // http://www.w3.org/TR/selectors/#empty-pseudo + // :empty is only affected by element nodes and content nodes(including text(3), cdata(4)), + // not comment, processing instructions, or others + // Thanks to Diego Perini for the nodeName shortcut + // Greater than "@" means alpha characters (specifically not starting with "#" or "?") + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + if ( elem.nodeName > "@" || elem.nodeType === 3 || elem.nodeType === 4 ) { + return false; + } + } + return true; + }, + + "parent": function( elem ) { + return !Expr.pseudos["empty"]( elem ); + }, + + // Element/input types + "header": function( elem ) { + return rheader.test( elem.nodeName ); + }, + + "input": function( elem ) { + return rinputs.test( elem.nodeName ); + }, + + "button": function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === "button" || name === "button"; + }, + + "text": function( elem ) { + var attr; + // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc) + // use getAttribute instead to test this case + return elem.nodeName.toLowerCase() === "input" && + elem.type === "text" && + ( (attr = elem.getAttribute("type")) == null || attr.toLowerCase() === elem.type ); + }, + + // Position-in-collection + "first": createPositionalPseudo(function() { + return [ 0 ]; + }), + + "last": createPositionalPseudo(function( matchIndexes, length ) { + return [ length - 1 ]; + }), + + "eq": createPositionalPseudo(function( matchIndexes, length, argument ) { + return [ argument < 0 ? argument + length : argument ]; + }), + + "even": createPositionalPseudo(function( matchIndexes, length ) { + var i = 0; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "odd": createPositionalPseudo(function( matchIndexes, length ) { + var i = 1; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "lt": createPositionalPseudo(function( matchIndexes, length, argument ) { + var i = argument < 0 ? argument + length : argument; + for ( ; --i >= 0; ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "gt": createPositionalPseudo(function( matchIndexes, length, argument ) { + var i = argument < 0 ? argument + length : argument; + for ( ; ++i < length; ) { + matchIndexes.push( i ); + } + return matchIndexes; + }) + } +}; + +// Add button/input type pseudos +for ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) { + Expr.pseudos[ i ] = createInputPseudo( i ); +} +for ( i in { submit: true, reset: true } ) { + Expr.pseudos[ i ] = createButtonPseudo( i ); +} + +function tokenize( selector, parseOnly ) { + var matched, match, tokens, type, + soFar, groups, preFilters, + cached = tokenCache[ selector + " " ]; + + if ( cached ) { + return parseOnly ? 0 : cached.slice( 0 ); + } + + soFar = selector; + groups = []; + preFilters = Expr.preFilter; + + while ( soFar ) { + + // Comma and first run + if ( !matched || (match = rcomma.exec( soFar )) ) { + if ( match ) { + // Don't consume trailing commas as valid + soFar = soFar.slice( match[0].length ) || soFar; + } + groups.push( tokens = [] ); + } + + matched = false; + + // Combinators + if ( (match = rcombinators.exec( soFar )) ) { + matched = match.shift(); + tokens.push( { + value: matched, + // Cast descendant combinators to space + type: match[0].replace( rtrim, " " ) + } ); + soFar = soFar.slice( matched.length ); + } + + // Filters + for ( type in Expr.filter ) { + if ( (match = matchExpr[ type ].exec( soFar )) && (!preFilters[ type ] || + (match = preFilters[ type ]( match ))) ) { + matched = match.shift(); + tokens.push( { + value: matched, + type: type, + matches: match + } ); + soFar = soFar.slice( matched.length ); + } + } + + if ( !matched ) { + break; + } + } + + // Return the length of the invalid excess + // if we're just parsing + // Otherwise, throw an error or return tokens + return parseOnly ? + soFar.length : + soFar ? + Sizzle.error( selector ) : + // Cache the tokens + tokenCache( selector, groups ).slice( 0 ); +} + +function toSelector( tokens ) { + var i = 0, + len = tokens.length, + selector = ""; + for ( ; i < len; i++ ) { + selector += tokens[i].value; + } + return selector; +} + +function addCombinator( matcher, combinator, base ) { + var dir = combinator.dir, + checkNonElements = base && dir === "parentNode", + doneName = done++; + + return combinator.first ? + // Check against closest ancestor/preceding element + function( elem, context, xml ) { + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + return matcher( elem, context, xml ); + } + } + } : + + // Check against all ancestor/preceding elements + function( elem, context, xml ) { + var data, cache, outerCache, + dirkey = dirruns + " " + doneName; + + // We can't set arbitrary data on XML nodes, so they don't benefit from dir caching + if ( xml ) { + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + if ( matcher( elem, context, xml ) ) { + return true; + } + } + } + } else { + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + outerCache = elem[ expando ] || (elem[ expando ] = {}); + if ( (cache = outerCache[ dir ]) && cache[0] === dirkey ) { + if ( (data = cache[1]) === true || data === cachedruns ) { + return data === true; + } + } else { + cache = outerCache[ dir ] = [ dirkey ]; + cache[1] = matcher( elem, context, xml ) || cachedruns; + if ( cache[1] === true ) { + return true; + } + } + } + } + } + }; +} + +function elementMatcher( matchers ) { + return matchers.length > 1 ? + function( elem, context, xml ) { + var i = matchers.length; + while ( i-- ) { + if ( !matchers[i]( elem, context, xml ) ) { + return false; + } + } + return true; + } : + matchers[0]; +} + +function condense( unmatched, map, filter, context, xml ) { + var elem, + newUnmatched = [], + i = 0, + len = unmatched.length, + mapped = map != null; + + for ( ; i < len; i++ ) { + if ( (elem = unmatched[i]) ) { + if ( !filter || filter( elem, context, xml ) ) { + newUnmatched.push( elem ); + if ( mapped ) { + map.push( i ); + } + } + } + } + + return newUnmatched; +} + +function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) { + if ( postFilter && !postFilter[ expando ] ) { + postFilter = setMatcher( postFilter ); + } + if ( postFinder && !postFinder[ expando ] ) { + postFinder = setMatcher( postFinder, postSelector ); + } + return markFunction(function( seed, results, context, xml ) { + var temp, i, elem, + preMap = [], + postMap = [], + preexisting = results.length, + + // Get initial elements from seed or context + elems = seed || multipleContexts( selector || "*", context.nodeType ? [ context ] : context, [] ), + + // Prefilter to get matcher input, preserving a map for seed-results synchronization + matcherIn = preFilter && ( seed || !selector ) ? + condense( elems, preMap, preFilter, context, xml ) : + elems, + + matcherOut = matcher ? + // If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results, + postFinder || ( seed ? preFilter : preexisting || postFilter ) ? + + // ...intermediate processing is necessary + [] : + + // ...otherwise use results directly + results : + matcherIn; + + // Find primary matches + if ( matcher ) { + matcher( matcherIn, matcherOut, context, xml ); + } + + // Apply postFilter + if ( postFilter ) { + temp = condense( matcherOut, postMap ); + postFilter( temp, [], context, xml ); + + // Un-match failing elements by moving them back to matcherIn + i = temp.length; + while ( i-- ) { + if ( (elem = temp[i]) ) { + matcherOut[ postMap[i] ] = !(matcherIn[ postMap[i] ] = elem); + } + } + } + + if ( seed ) { + if ( postFinder || preFilter ) { + if ( postFinder ) { + // Get the final matcherOut by condensing this intermediate into postFinder contexts + temp = []; + i = matcherOut.length; + while ( i-- ) { + if ( (elem = matcherOut[i]) ) { + // Restore matcherIn since elem is not yet a final match + temp.push( (matcherIn[i] = elem) ); + } + } + postFinder( null, (matcherOut = []), temp, xml ); + } + + // Move matched elements from seed to results to keep them synchronized + i = matcherOut.length; + while ( i-- ) { + if ( (elem = matcherOut[i]) && + (temp = postFinder ? indexOf.call( seed, elem ) : preMap[i]) > -1 ) { + + seed[temp] = !(results[temp] = elem); + } + } + } + + // Add elements to results, through postFinder if defined + } else { + matcherOut = condense( + matcherOut === results ? + matcherOut.splice( preexisting, matcherOut.length ) : + matcherOut + ); + if ( postFinder ) { + postFinder( null, results, matcherOut, xml ); + } else { + push.apply( results, matcherOut ); + } + } + }); +} + +function matcherFromTokens( tokens ) { + var checkContext, matcher, j, + len = tokens.length, + leadingRelative = Expr.relative[ tokens[0].type ], + implicitRelative = leadingRelative || Expr.relative[" "], + i = leadingRelative ? 1 : 0, + + // The foundational matcher ensures that elements are reachable from top-level context(s) + matchContext = addCombinator( function( elem ) { + return elem === checkContext; + }, implicitRelative, true ), + matchAnyContext = addCombinator( function( elem ) { + return indexOf.call( checkContext, elem ) > -1; + }, implicitRelative, true ), + matchers = [ function( elem, context, xml ) { + return ( !leadingRelative && ( xml || context !== outermostContext ) ) || ( + (checkContext = context).nodeType ? + matchContext( elem, context, xml ) : + matchAnyContext( elem, context, xml ) ); + } ]; + + for ( ; i < len; i++ ) { + if ( (matcher = Expr.relative[ tokens[i].type ]) ) { + matchers = [ addCombinator(elementMatcher( matchers ), matcher) ]; + } else { + matcher = Expr.filter[ tokens[i].type ].apply( null, tokens[i].matches ); + + // Return special upon seeing a positional matcher + if ( matcher[ expando ] ) { + // Find the next relative operator (if any) for proper handling + j = ++i; + for ( ; j < len; j++ ) { + if ( Expr.relative[ tokens[j].type ] ) { + break; + } + } + return setMatcher( + i > 1 && elementMatcher( matchers ), + i > 1 && toSelector( tokens.slice( 0, i - 1 ) ).replace( rtrim, "$1" ), + matcher, + i < j && matcherFromTokens( tokens.slice( i, j ) ), + j < len && matcherFromTokens( (tokens = tokens.slice( j )) ), + j < len && toSelector( tokens ) + ); + } + matchers.push( matcher ); + } + } + + return elementMatcher( matchers ); +} + +function matcherFromGroupMatchers( elementMatchers, setMatchers ) { + // A counter to specify which element is currently being matched + var matcherCachedRuns = 0, + bySet = setMatchers.length > 0, + byElement = elementMatchers.length > 0, + superMatcher = function( seed, context, xml, results, expandContext ) { + var elem, j, matcher, + setMatched = [], + matchedCount = 0, + i = "0", + unmatched = seed && [], + outermost = expandContext != null, + contextBackup = outermostContext, + // We must always have either seed elements or context + elems = seed || byElement && Expr.find["TAG"]( "*", expandContext && context.parentNode || context ), + // Use integer dirruns iff this is the outermost matcher + dirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.random() || 0.1); + + if ( outermost ) { + outermostContext = context !== document && context; + cachedruns = matcherCachedRuns; + } + + // Add elements passing elementMatchers directly to results + // Keep `i` a string if there are no elements so `matchedCount` will be "00" below + for ( ; (elem = elems[i]) != null; i++ ) { + if ( byElement && elem ) { + j = 0; + while ( (matcher = elementMatchers[j++]) ) { + if ( matcher( elem, context, xml ) ) { + results.push( elem ); + break; + } + } + if ( outermost ) { + dirruns = dirrunsUnique; + cachedruns = ++matcherCachedRuns; + } + } + + // Track unmatched elements for set filters + if ( bySet ) { + // They will have gone through all possible matchers + if ( (elem = !matcher && elem) ) { + matchedCount--; + } + + // Lengthen the array for every element, matched or not + if ( seed ) { + unmatched.push( elem ); + } + } + } + + // Apply set filters to unmatched elements + matchedCount += i; + if ( bySet && i !== matchedCount ) { + j = 0; + while ( (matcher = setMatchers[j++]) ) { + matcher( unmatched, setMatched, context, xml ); + } + + if ( seed ) { + // Reintegrate element matches to eliminate the need for sorting + if ( matchedCount > 0 ) { + while ( i-- ) { + if ( !(unmatched[i] || setMatched[i]) ) { + setMatched[i] = pop.call( results ); + } + } + } + + // Discard index placeholder values to get only actual matches + setMatched = condense( setMatched ); + } + + // Add matches to results + push.apply( results, setMatched ); + + // Seedless set matches succeeding multiple successful matchers stipulate sorting + if ( outermost && !seed && setMatched.length > 0 && + ( matchedCount + setMatchers.length ) > 1 ) { + + Sizzle.uniqueSort( results ); + } + } + + // Override manipulation of globals by nested matchers + if ( outermost ) { + dirruns = dirrunsUnique; + outermostContext = contextBackup; + } + + return unmatched; + }; + + return bySet ? + markFunction( superMatcher ) : + superMatcher; +} + +compile = Sizzle.compile = function( selector, group /* Internal Use Only */ ) { + var i, + setMatchers = [], + elementMatchers = [], + cached = compilerCache[ selector + " " ]; + + if ( !cached ) { + // Generate a function of recursive functions that can be used to check each element + if ( !group ) { + group = tokenize( selector ); + } + i = group.length; + while ( i-- ) { + cached = matcherFromTokens( group[i] ); + if ( cached[ expando ] ) { + setMatchers.push( cached ); + } else { + elementMatchers.push( cached ); + } + } + + // Cache the compiled function + cached = compilerCache( selector, matcherFromGroupMatchers( elementMatchers, setMatchers ) ); + } + return cached; +}; + +function multipleContexts( selector, contexts, results ) { + var i = 0, + len = contexts.length; + for ( ; i < len; i++ ) { + Sizzle( selector, contexts[i], results ); + } + return results; +} + +function select( selector, context, results, seed ) { + var i, tokens, token, type, find, + match = tokenize( selector ); + + if ( !seed ) { + // Try to minimize operations if there is only one group + if ( match.length === 1 ) { + + // Take a shortcut and set the context if the root selector is an ID + tokens = match[0] = match[0].slice( 0 ); + if ( tokens.length > 2 && (token = tokens[0]).type === "ID" && + context.nodeType === 9 && !documentIsXML && + Expr.relative[ tokens[1].type ] ) { + + context = Expr.find["ID"]( token.matches[0].replace( runescape, funescape ), context )[0]; + if ( !context ) { + return results; + } + + selector = selector.slice( tokens.shift().value.length ); + } + + // Fetch a seed set for right-to-left matching + i = matchExpr["needsContext"].test( selector ) ? 0 : tokens.length; + while ( i-- ) { + token = tokens[i]; + + // Abort if we hit a combinator + if ( Expr.relative[ (type = token.type) ] ) { + break; + } + if ( (find = Expr.find[ type ]) ) { + // Search, expanding context for leading sibling combinators + if ( (seed = find( + token.matches[0].replace( runescape, funescape ), + rsibling.test( tokens[0].type ) && context.parentNode || context + )) ) { + + // If seed is empty or no tokens remain, we can return early + tokens.splice( i, 1 ); + selector = seed.length && toSelector( tokens ); + if ( !selector ) { + push.apply( results, slice.call( seed, 0 ) ); + return results; + } + + break; + } + } + } + } + } + + // Compile and execute a filtering function + // Provide `match` to avoid retokenization if we modified the selector above + compile( selector, match )( + seed, + context, + documentIsXML, + results, + rsibling.test( selector ) + ); + return results; +} + +// Deprecated +Expr.pseudos["nth"] = Expr.pseudos["eq"]; + +// Easy API for creating new setFilters +function setFilters() {} +Expr.filters = setFilters.prototype = Expr.pseudos; +Expr.setFilters = new setFilters(); + +// Initialize with the default document +setDocument(); + +// Override sizzle attribute retrieval +Sizzle.attr = jQuery.attr; +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; +jQuery.expr[":"] = jQuery.expr.pseudos; +jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; + + +})( window ); +var runtil = /Until$/, + rparentsprev = /^(?:parents|prev(?:Until|All))/, + isSimple = /^.[^:#\[\.,]*$/, + rneedsContext = jQuery.expr.match.needsContext, + // methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend({ + find: function( selector ) { + var i, ret, self, + len = this.length; + + if ( typeof selector !== "string" ) { + self = this; + return this.pushStack( jQuery( selector ).filter(function() { + for ( i = 0; i < len; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + }) ); + } + + ret = []; + for ( i = 0; i < len; i++ ) { + jQuery.find( selector, this[ i ], ret ); + } + + // Needed because $( selector, context ) becomes $( context ).find( selector ) + ret = this.pushStack( len > 1 ? jQuery.unique( ret ) : ret ); + ret.selector = ( this.selector ? this.selector + " " : "" ) + selector; + return ret; + }, + + has: function( target ) { + var i, + targets = jQuery( target, this ), + len = targets.length; + + return this.filter(function() { + for ( i = 0; i < len; i++ ) { + if ( jQuery.contains( this, targets[i] ) ) { + return true; + } + } + }); + }, + + not: function( selector ) { + return this.pushStack( winnow(this, selector, false) ); + }, + + filter: function( selector ) { + return this.pushStack( winnow(this, selector, true) ); + }, + + is: function( selector ) { + return !!selector && ( + typeof selector === "string" ? + // If this is a positional/relative selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + rneedsContext.test( selector ) ? + jQuery( selector, this.context ).index( this[0] ) >= 0 : + jQuery.filter( selector, this ).length > 0 : + this.filter( selector ).length > 0 ); + }, + + closest: function( selectors, context ) { + var cur, + i = 0, + l = this.length, + ret = [], + pos = rneedsContext.test( selectors ) || typeof selectors !== "string" ? + jQuery( selectors, context || this.context ) : + 0; + + for ( ; i < l; i++ ) { + cur = this[i]; + + while ( cur && cur.ownerDocument && cur !== context && cur.nodeType !== 11 ) { + if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) { + ret.push( cur ); + break; + } + cur = cur.parentNode; + } + } + + return this.pushStack( ret.length > 1 ? jQuery.unique( ret ) : ret ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[0] && this[0].parentNode ) ? this.first().prevAll().length : -1; + } + + // index in selector + if ( typeof elem === "string" ) { + return jQuery.inArray( this[0], jQuery( elem ) ); + } + + // Locate the position of the desired element + return jQuery.inArray( + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[0] : elem, this ); + }, + + add: function( selector, context ) { + var set = typeof selector === "string" ? + jQuery( selector, context ) : + jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ), + all = jQuery.merge( this.get(), set ); + + return this.pushStack( jQuery.unique(all) ); + }, + + addBack: function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter(selector) + ); + } +}); + +jQuery.fn.andSelf = jQuery.fn.addBack; + +function sibling( cur, dir ) { + do { + cur = cur[ dir ]; + } while ( cur && cur.nodeType !== 1 ); + + return cur; +} + +jQuery.each({ + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return jQuery.dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, i, until ) { + return jQuery.dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return sibling( elem, "nextSibling" ); + }, + prev: function( elem ) { + return sibling( elem, "previousSibling" ); + }, + nextAll: function( elem ) { + return jQuery.dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return jQuery.dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, i, until ) { + return jQuery.dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return jQuery.dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return jQuery.sibling( ( elem.parentNode || {} ).firstChild, elem ); + }, + children: function( elem ) { + return jQuery.sibling( elem.firstChild ); + }, + contents: function( elem ) { + return jQuery.nodeName( elem, "iframe" ) ? + elem.contentDocument || elem.contentWindow.document : + jQuery.merge( [], elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var ret = jQuery.map( this, fn, until ); + + if ( !runtil.test( name ) ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + ret = jQuery.filter( selector, ret ); + } + + ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret; + + if ( this.length > 1 && rparentsprev.test( name ) ) { + ret = ret.reverse(); + } + + return this.pushStack( ret ); + }; +}); + +jQuery.extend({ + filter: function( expr, elems, not ) { + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return elems.length === 1 ? + jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] : + jQuery.find.matches(expr, elems); + }, + + dir: function( elem, dir, until ) { + var matched = [], + cur = elem[ dir ]; + + while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) { + if ( cur.nodeType === 1 ) { + matched.push( cur ); + } + cur = cur[dir]; + } + return matched; + }, + + sibling: function( n, elem ) { + var r = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + r.push( n ); + } + } + + return r; + } +}); + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, keep ) { + + // Can't pass null or undefined to indexOf in Firefox 4 + // Set to 0 to skip string check + qualifier = qualifier || 0; + + if ( jQuery.isFunction( qualifier ) ) { + return jQuery.grep(elements, function( elem, i ) { + var retVal = !!qualifier.call( elem, i, elem ); + return retVal === keep; + }); + + } else if ( qualifier.nodeType ) { + return jQuery.grep(elements, function( elem ) { + return ( elem === qualifier ) === keep; + }); + + } else if ( typeof qualifier === "string" ) { + var filtered = jQuery.grep(elements, function( elem ) { + return elem.nodeType === 1; + }); + + if ( isSimple.test( qualifier ) ) { + return jQuery.filter(qualifier, filtered, !keep); + } else { + qualifier = jQuery.filter( qualifier, filtered ); + } + } + + return jQuery.grep(elements, function( elem ) { + return ( jQuery.inArray( elem, qualifier ) >= 0 ) === keep; + }); +} +function createSafeFragment( document ) { + var list = nodeNames.split( "|" ), + safeFrag = document.createDocumentFragment(); + + if ( safeFrag.createElement ) { + while ( list.length ) { + safeFrag.createElement( + list.pop() + ); + } + } + return safeFrag; +} + +var nodeNames = "abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|" + + "header|hgroup|mark|meter|nav|output|progress|section|summary|time|video", + rinlinejQuery = / jQuery\d+="(?:null|\d+)"/g, + rnoshimcache = new RegExp("<(?:" + nodeNames + ")[\\s/>]", "i"), + rleadingWhitespace = /^\s+/, + rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi, + rtagName = /<([\w:]+)/, + rtbody = /\s*$/g, + + // We have to close these tags to support XHTML (#13200) + wrapMap = { + option: [ 1, "" ], + legend: [ 1, "
        ", "
        " ], + area: [ 1, "", "" ], + param: [ 1, "", "" ], + thead: [ 1, "", "
        " ], + tr: [ 2, "", "
        " ], + col: [ 2, "", "
        " ], + td: [ 3, "", "
        " ], + + // IE6-8 can't serialize link, script, style, or any html5 (NoScope) tags, + // unless wrapped in a div with non-breaking characters in front of it. + _default: jQuery.support.htmlSerialize ? [ 0, "", "" ] : [ 1, "X
        ", "
        " ] + }, + safeFragment = createSafeFragment( document ), + fragmentDiv = safeFragment.appendChild( document.createElement("div") ); + +wrapMap.optgroup = wrapMap.option; +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +jQuery.fn.extend({ + text: function( value ) { + return jQuery.access( this, function( value ) { + return value === undefined ? + jQuery.text( this ) : + this.empty().append( ( this[0] && this[0].ownerDocument || document ).createTextNode( value ) ); + }, null, value, arguments.length ); + }, + + wrapAll: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapAll( html.call(this, i) ); + }); + } + + if ( this[0] ) { + // The elements to wrap the target around + var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true); + + if ( this[0].parentNode ) { + wrap.insertBefore( this[0] ); + } + + wrap.map(function() { + var elem = this; + + while ( elem.firstChild && elem.firstChild.nodeType === 1 ) { + elem = elem.firstChild; + } + + return elem; + }).append( this ); + } + + return this; + }, + + wrapInner: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapInner( html.call(this, i) ); + }); + } + + return this.each(function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + }); + }, + + wrap: function( html ) { + var isFunction = jQuery.isFunction( html ); + + return this.each(function(i) { + jQuery( this ).wrapAll( isFunction ? html.call(this, i) : html ); + }); + }, + + unwrap: function() { + return this.parent().each(function() { + if ( !jQuery.nodeName( this, "body" ) ) { + jQuery( this ).replaceWith( this.childNodes ); + } + }).end(); + }, + + append: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + this.appendChild( elem ); + } + }); + }, + + prepend: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + this.insertBefore( elem, this.firstChild ); + } + }); + }, + + before: function() { + return this.domManip( arguments, false, function( elem ) { + if ( this.parentNode ) { + this.parentNode.insertBefore( elem, this ); + } + }); + }, + + after: function() { + return this.domManip( arguments, false, function( elem ) { + if ( this.parentNode ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + } + }); + }, + + // keepData is for internal use only--do not document + remove: function( selector, keepData ) { + var elem, + i = 0; + + for ( ; (elem = this[i]) != null; i++ ) { + if ( !selector || jQuery.filter( selector, [ elem ] ).length > 0 ) { + if ( !keepData && elem.nodeType === 1 ) { + jQuery.cleanData( getAll( elem ) ); + } + + if ( elem.parentNode ) { + if ( keepData && jQuery.contains( elem.ownerDocument, elem ) ) { + setGlobalEval( getAll( elem, "script" ) ); + } + elem.parentNode.removeChild( elem ); + } + } + } + + return this; + }, + + empty: function() { + var elem, + i = 0; + + for ( ; (elem = this[i]) != null; i++ ) { + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( getAll( elem, false ) ); + } + + // Remove any remaining nodes + while ( elem.firstChild ) { + elem.removeChild( elem.firstChild ); + } + + // If this is a select, ensure that it displays empty (#12336) + // Support: IE<9 + if ( elem.options && jQuery.nodeName( elem, "select" ) ) { + elem.options.length = 0; + } + } + + return this; + }, + + clone: function( dataAndEvents, deepDataAndEvents ) { + dataAndEvents = dataAndEvents == null ? false : dataAndEvents; + deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; + + return this.map( function () { + return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); + }); + }, + + html: function( value ) { + return jQuery.access( this, function( value ) { + var elem = this[0] || {}, + i = 0, + l = this.length; + + if ( value === undefined ) { + return elem.nodeType === 1 ? + elem.innerHTML.replace( rinlinejQuery, "" ) : + undefined; + } + + // See if we can take a shortcut and just use innerHTML + if ( typeof value === "string" && !rnoInnerhtml.test( value ) && + ( jQuery.support.htmlSerialize || !rnoshimcache.test( value ) ) && + ( jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value ) ) && + !wrapMap[ ( rtagName.exec( value ) || ["", ""] )[1].toLowerCase() ] ) { + + value = value.replace( rxhtmlTag, "<$1>" ); + + try { + for (; i < l; i++ ) { + // Remove element nodes and prevent memory leaks + elem = this[i] || {}; + if ( elem.nodeType === 1 ) { + jQuery.cleanData( getAll( elem, false ) ); + elem.innerHTML = value; + } + } + + elem = 0; + + // If using innerHTML throws an exception, use the fallback method + } catch(e) {} + } + + if ( elem ) { + this.empty().append( value ); + } + }, null, value, arguments.length ); + }, + + replaceWith: function( value ) { + var isFunc = jQuery.isFunction( value ); + + // Make sure that the elements are removed from the DOM before they are inserted + // this can help fix replacing a parent with child elements + if ( !isFunc && typeof value !== "string" ) { + value = jQuery( value ).not( this ).detach(); + } + + return this.domManip( [ value ], true, function( elem ) { + var next = this.nextSibling, + parent = this.parentNode; + + if ( parent ) { + jQuery( this ).remove(); + parent.insertBefore( elem, next ); + } + }); + }, + + detach: function( selector ) { + return this.remove( selector, true ); + }, + + domManip: function( args, table, callback ) { + + // Flatten any nested arrays + args = core_concat.apply( [], args ); + + var first, node, hasScripts, + scripts, doc, fragment, + i = 0, + l = this.length, + set = this, + iNoClone = l - 1, + value = args[0], + isFunction = jQuery.isFunction( value ); + + // We can't cloneNode fragments that contain checked, in WebKit + if ( isFunction || !( l <= 1 || typeof value !== "string" || jQuery.support.checkClone || !rchecked.test( value ) ) ) { + return this.each(function( index ) { + var self = set.eq( index ); + if ( isFunction ) { + args[0] = value.call( this, index, table ? self.html() : undefined ); + } + self.domManip( args, table, callback ); + }); + } + + if ( l ) { + fragment = jQuery.buildFragment( args, this[ 0 ].ownerDocument, false, this ); + first = fragment.firstChild; + + if ( fragment.childNodes.length === 1 ) { + fragment = first; + } + + if ( first ) { + table = table && jQuery.nodeName( first, "tr" ); + scripts = jQuery.map( getAll( fragment, "script" ), disableScript ); + hasScripts = scripts.length; + + // Use the original fragment for the last item instead of the first because it can end up + // being emptied incorrectly in certain situations (#8070). + for ( ; i < l; i++ ) { + node = fragment; + + if ( i !== iNoClone ) { + node = jQuery.clone( node, true, true ); + + // Keep references to cloned scripts for later restoration + if ( hasScripts ) { + jQuery.merge( scripts, getAll( node, "script" ) ); + } + } + + callback.call( + table && jQuery.nodeName( this[i], "table" ) ? + findOrAppend( this[i], "tbody" ) : + this[i], + node, + i + ); + } + + if ( hasScripts ) { + doc = scripts[ scripts.length - 1 ].ownerDocument; + + // Reenable scripts + jQuery.map( scripts, restoreScript ); + + // Evaluate executable scripts on first document insertion + for ( i = 0; i < hasScripts; i++ ) { + node = scripts[ i ]; + if ( rscriptType.test( node.type || "" ) && + !jQuery._data( node, "globalEval" ) && jQuery.contains( doc, node ) ) { + + if ( node.src ) { + // Hope ajax is available... + jQuery.ajax({ + url: node.src, + type: "GET", + dataType: "script", + async: false, + global: false, + "throws": true + }); + } else { + jQuery.globalEval( ( node.text || node.textContent || node.innerHTML || "" ).replace( rcleanScript, "" ) ); + } + } + } + } + + // Fix #11809: Avoid leaking memory + fragment = first = null; + } + } + + return this; + } +}); + +function findOrAppend( elem, tag ) { + return elem.getElementsByTagName( tag )[0] || elem.appendChild( elem.ownerDocument.createElement( tag ) ); +} + +// Replace/restore the type attribute of script elements for safe DOM manipulation +function disableScript( elem ) { + var attr = elem.getAttributeNode("type"); + elem.type = ( attr && attr.specified ) + "/" + elem.type; + return elem; +} +function restoreScript( elem ) { + var match = rscriptTypeMasked.exec( elem.type ); + if ( match ) { + elem.type = match[1]; + } else { + elem.removeAttribute("type"); + } + return elem; +} + +// Mark scripts as having already been evaluated +function setGlobalEval( elems, refElements ) { + var elem, + i = 0; + for ( ; (elem = elems[i]) != null; i++ ) { + jQuery._data( elem, "globalEval", !refElements || jQuery._data( refElements[i], "globalEval" ) ); + } +} + +function cloneCopyEvent( src, dest ) { + + if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) { + return; + } + + var type, i, l, + oldData = jQuery._data( src ), + curData = jQuery._data( dest, oldData ), + events = oldData.events; + + if ( events ) { + delete curData.handle; + curData.events = {}; + + for ( type in events ) { + for ( i = 0, l = events[ type ].length; i < l; i++ ) { + jQuery.event.add( dest, type, events[ type ][ i ] ); + } + } + } + + // make the cloned public data object a copy from the original + if ( curData.data ) { + curData.data = jQuery.extend( {}, curData.data ); + } +} + +function fixCloneNodeIssues( src, dest ) { + var nodeName, e, data; + + // We do not need to do anything for non-Elements + if ( dest.nodeType !== 1 ) { + return; + } + + nodeName = dest.nodeName.toLowerCase(); + + // IE6-8 copies events bound via attachEvent when using cloneNode. + if ( !jQuery.support.noCloneEvent && dest[ jQuery.expando ] ) { + data = jQuery._data( dest ); + + for ( e in data.events ) { + jQuery.removeEvent( dest, e, data.handle ); + } + + // Event data gets referenced instead of copied if the expando gets copied too + dest.removeAttribute( jQuery.expando ); + } + + // IE blanks contents when cloning scripts, and tries to evaluate newly-set text + if ( nodeName === "script" && dest.text !== src.text ) { + disableScript( dest ).text = src.text; + restoreScript( dest ); + + // IE6-10 improperly clones children of object elements using classid. + // IE10 throws NoModificationAllowedError if parent is null, #12132. + } else if ( nodeName === "object" ) { + if ( dest.parentNode ) { + dest.outerHTML = src.outerHTML; + } + + // This path appears unavoidable for IE9. When cloning an object + // element in IE9, the outerHTML strategy above is not sufficient. + // If the src has innerHTML and the destination does not, + // copy the src.innerHTML into the dest.innerHTML. #10324 + if ( jQuery.support.html5Clone && ( src.innerHTML && !jQuery.trim(dest.innerHTML) ) ) { + dest.innerHTML = src.innerHTML; + } + + } else if ( nodeName === "input" && manipulation_rcheckableType.test( src.type ) ) { + // IE6-8 fails to persist the checked state of a cloned checkbox + // or radio button. Worse, IE6-7 fail to give the cloned element + // a checked appearance if the defaultChecked value isn't also set + + dest.defaultChecked = dest.checked = src.checked; + + // IE6-7 get confused and end up setting the value of a cloned + // checkbox/radio button to an empty string instead of "on" + if ( dest.value !== src.value ) { + dest.value = src.value; + } + + // IE6-8 fails to return the selected option to the default selected + // state when cloning options + } else if ( nodeName === "option" ) { + dest.defaultSelected = dest.selected = src.defaultSelected; + + // IE6-8 fails to set the defaultValue to the correct value when + // cloning other types of input fields + } else if ( nodeName === "input" || nodeName === "textarea" ) { + dest.defaultValue = src.defaultValue; + } +} + +jQuery.each({ + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var elems, + i = 0, + ret = [], + insert = jQuery( selector ), + last = insert.length - 1; + + for ( ; i <= last; i++ ) { + elems = i === last ? this : this.clone(true); + jQuery( insert[i] )[ original ]( elems ); + + // Modern browsers can apply jQuery collections as arrays, but oldIE needs a .get() + core_push.apply( ret, elems.get() ); + } + + return this.pushStack( ret ); + }; +}); + +function getAll( context, tag ) { + var elems, elem, + i = 0, + found = typeof context.getElementsByTagName !== core_strundefined ? context.getElementsByTagName( tag || "*" ) : + typeof context.querySelectorAll !== core_strundefined ? context.querySelectorAll( tag || "*" ) : + undefined; + + if ( !found ) { + for ( found = [], elems = context.childNodes || context; (elem = elems[i]) != null; i++ ) { + if ( !tag || jQuery.nodeName( elem, tag ) ) { + found.push( elem ); + } else { + jQuery.merge( found, getAll( elem, tag ) ); + } + } + } + + return tag === undefined || tag && jQuery.nodeName( context, tag ) ? + jQuery.merge( [ context ], found ) : + found; +} + +// Used in buildFragment, fixes the defaultChecked property +function fixDefaultChecked( elem ) { + if ( manipulation_rcheckableType.test( elem.type ) ) { + elem.defaultChecked = elem.checked; + } +} + +jQuery.extend({ + clone: function( elem, dataAndEvents, deepDataAndEvents ) { + var destElements, node, clone, i, srcElements, + inPage = jQuery.contains( elem.ownerDocument, elem ); + + if ( jQuery.support.html5Clone || jQuery.isXMLDoc(elem) || !rnoshimcache.test( "<" + elem.nodeName + ">" ) ) { + clone = elem.cloneNode( true ); + + // IE<=8 does not properly clone detached, unknown element nodes + } else { + fragmentDiv.innerHTML = elem.outerHTML; + fragmentDiv.removeChild( clone = fragmentDiv.firstChild ); + } + + if ( (!jQuery.support.noCloneEvent || !jQuery.support.noCloneChecked) && + (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) { + + // We eschew Sizzle here for performance reasons: http://jsperf.com/getall-vs-sizzle/2 + destElements = getAll( clone ); + srcElements = getAll( elem ); + + // Fix all IE cloning issues + for ( i = 0; (node = srcElements[i]) != null; ++i ) { + // Ensure that the destination node is not null; Fixes #9587 + if ( destElements[i] ) { + fixCloneNodeIssues( node, destElements[i] ); + } + } + } + + // Copy the events from the original to the clone + if ( dataAndEvents ) { + if ( deepDataAndEvents ) { + srcElements = srcElements || getAll( elem ); + destElements = destElements || getAll( clone ); + + for ( i = 0; (node = srcElements[i]) != null; i++ ) { + cloneCopyEvent( node, destElements[i] ); + } + } else { + cloneCopyEvent( elem, clone ); + } + } + + // Preserve script evaluation history + destElements = getAll( clone, "script" ); + if ( destElements.length > 0 ) { + setGlobalEval( destElements, !inPage && getAll( elem, "script" ) ); + } + + destElements = srcElements = node = null; + + // Return the cloned set + return clone; + }, + + buildFragment: function( elems, context, scripts, selection ) { + var j, elem, contains, + tmp, tag, tbody, wrap, + l = elems.length, + + // Ensure a safe fragment + safe = createSafeFragment( context ), + + nodes = [], + i = 0; + + for ( ; i < l; i++ ) { + elem = elems[ i ]; + + if ( elem || elem === 0 ) { + + // Add nodes directly + if ( jQuery.type( elem ) === "object" ) { + jQuery.merge( nodes, elem.nodeType ? [ elem ] : elem ); + + // Convert non-html into a text node + } else if ( !rhtml.test( elem ) ) { + nodes.push( context.createTextNode( elem ) ); + + // Convert html into DOM nodes + } else { + tmp = tmp || safe.appendChild( context.createElement("div") ); + + // Deserialize a standard representation + tag = ( rtagName.exec( elem ) || ["", ""] )[1].toLowerCase(); + wrap = wrapMap[ tag ] || wrapMap._default; + + tmp.innerHTML = wrap[1] + elem.replace( rxhtmlTag, "<$1>" ) + wrap[2]; + + // Descend through wrappers to the right content + j = wrap[0]; + while ( j-- ) { + tmp = tmp.lastChild; + } + + // Manually add leading whitespace removed by IE + if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) { + nodes.push( context.createTextNode( rleadingWhitespace.exec( elem )[0] ) ); + } + + // Remove IE's autoinserted from table fragments + if ( !jQuery.support.tbody ) { + + // String was a , *may* have spurious + elem = tag === "table" && !rtbody.test( elem ) ? + tmp.firstChild : + + // String was a bare or + wrap[1] === "
        " && !rtbody.test( elem ) ? + tmp : + 0; + + j = elem && elem.childNodes.length; + while ( j-- ) { + if ( jQuery.nodeName( (tbody = elem.childNodes[j]), "tbody" ) && !tbody.childNodes.length ) { + elem.removeChild( tbody ); + } + } + } + + jQuery.merge( nodes, tmp.childNodes ); + + // Fix #12392 for WebKit and IE > 9 + tmp.textContent = ""; + + // Fix #12392 for oldIE + while ( tmp.firstChild ) { + tmp.removeChild( tmp.firstChild ); + } + + // Remember the top-level container for proper cleanup + tmp = safe.lastChild; + } + } + } + + // Fix #11356: Clear elements from fragment + if ( tmp ) { + safe.removeChild( tmp ); + } + + // Reset defaultChecked for any radios and checkboxes + // about to be appended to the DOM in IE 6/7 (#8060) + if ( !jQuery.support.appendChecked ) { + jQuery.grep( getAll( nodes, "input" ), fixDefaultChecked ); + } + + i = 0; + while ( (elem = nodes[ i++ ]) ) { + + // #4087 - If origin and destination elements are the same, and this is + // that element, do not do anything + if ( selection && jQuery.inArray( elem, selection ) !== -1 ) { + continue; + } + + contains = jQuery.contains( elem.ownerDocument, elem ); + + // Append to fragment + tmp = getAll( safe.appendChild( elem ), "script" ); + + // Preserve script evaluation history + if ( contains ) { + setGlobalEval( tmp ); + } + + // Capture executables + if ( scripts ) { + j = 0; + while ( (elem = tmp[ j++ ]) ) { + if ( rscriptType.test( elem.type || "" ) ) { + scripts.push( elem ); + } + } + } + } + + tmp = null; + + return safe; + }, + + cleanData: function( elems, /* internal */ acceptData ) { + var elem, type, id, data, + i = 0, + internalKey = jQuery.expando, + cache = jQuery.cache, + deleteExpando = jQuery.support.deleteExpando, + special = jQuery.event.special; + + for ( ; (elem = elems[i]) != null; i++ ) { + + if ( acceptData || jQuery.acceptData( elem ) ) { + + id = elem[ internalKey ]; + data = id && cache[ id ]; + + if ( data ) { + if ( data.events ) { + for ( type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + // This is a shortcut to avoid jQuery.event.remove's overhead + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + } + + // Remove cache only if it was not already removed by jQuery.event.remove + if ( cache[ id ] ) { + + delete cache[ id ]; + + // IE does not allow us to delete expando properties from nodes, + // nor does it have a removeAttribute function on Document nodes; + // we must handle all of these cases + if ( deleteExpando ) { + delete elem[ internalKey ]; + + } else if ( typeof elem.removeAttribute !== core_strundefined ) { + elem.removeAttribute( internalKey ); + + } else { + elem[ internalKey ] = null; + } + + core_deletedIds.push( id ); + } + } + } + } + } +}); +var iframe, getStyles, curCSS, + ralpha = /alpha\([^)]*\)/i, + ropacity = /opacity\s*=\s*([^)]*)/, + rposition = /^(top|right|bottom|left)$/, + // swappable if display is none or starts with table except "table", "table-cell", or "table-caption" + // see here for display values: https://developer.mozilla.org/en-US/docs/CSS/display + rdisplayswap = /^(none|table(?!-c[ea]).+)/, + rmargin = /^margin/, + rnumsplit = new RegExp( "^(" + core_pnum + ")(.*)$", "i" ), + rnumnonpx = new RegExp( "^(" + core_pnum + ")(?!px)[a-z%]+$", "i" ), + rrelNum = new RegExp( "^([+-])=(" + core_pnum + ")", "i" ), + elemdisplay = { BODY: "block" }, + + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssNormalTransform = { + letterSpacing: 0, + fontWeight: 400 + }, + + cssExpand = [ "Top", "Right", "Bottom", "Left" ], + cssPrefixes = [ "Webkit", "O", "Moz", "ms" ]; + +// return a css property mapped to a potentially vendor prefixed property +function vendorPropName( style, name ) { + + // shortcut for names that are not vendor prefixed + if ( name in style ) { + return name; + } + + // check for vendor prefixed names + var capName = name.charAt(0).toUpperCase() + name.slice(1), + origName = name, + i = cssPrefixes.length; + + while ( i-- ) { + name = cssPrefixes[ i ] + capName; + if ( name in style ) { + return name; + } + } + + return origName; +} + +function isHidden( elem, el ) { + // isHidden might be called from jQuery#filter function; + // in that case, element will be second argument + elem = el || elem; + return jQuery.css( elem, "display" ) === "none" || !jQuery.contains( elem.ownerDocument, elem ); +} + +function showHide( elements, show ) { + var display, elem, hidden, + values = [], + index = 0, + length = elements.length; + + for ( ; index < length; index++ ) { + elem = elements[ index ]; + if ( !elem.style ) { + continue; + } + + values[ index ] = jQuery._data( elem, "olddisplay" ); + display = elem.style.display; + if ( show ) { + // Reset the inline display of this element to learn if it is + // being hidden by cascaded rules or not + if ( !values[ index ] && display === "none" ) { + elem.style.display = ""; + } + + // Set elements which have been overridden with display: none + // in a stylesheet to whatever the default browser style is + // for such an element + if ( elem.style.display === "" && isHidden( elem ) ) { + values[ index ] = jQuery._data( elem, "olddisplay", css_defaultDisplay(elem.nodeName) ); + } + } else { + + if ( !values[ index ] ) { + hidden = isHidden( elem ); + + if ( display && display !== "none" || !hidden ) { + jQuery._data( elem, "olddisplay", hidden ? display : jQuery.css( elem, "display" ) ); + } + } + } + } + + // Set the display of most of the elements in a second loop + // to avoid the constant reflow + for ( index = 0; index < length; index++ ) { + elem = elements[ index ]; + if ( !elem.style ) { + continue; + } + if ( !show || elem.style.display === "none" || elem.style.display === "" ) { + elem.style.display = show ? values[ index ] || "" : "none"; + } + } + + return elements; +} + +jQuery.fn.extend({ + css: function( name, value ) { + return jQuery.access( this, function( elem, name, value ) { + var len, styles, + map = {}, + i = 0; + + if ( jQuery.isArray( name ) ) { + styles = getStyles( elem ); + len = name.length; + + for ( ; i < len; i++ ) { + map[ name[ i ] ] = jQuery.css( elem, name[ i ], false, styles ); + } + + return map; + } + + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }, name, value, arguments.length > 1 ); + }, + show: function() { + return showHide( this, true ); + }, + hide: function() { + return showHide( this ); + }, + toggle: function( state ) { + var bool = typeof state === "boolean"; + + return this.each(function() { + if ( bool ? state : isHidden( this ) ) { + jQuery( this ).show(); + } else { + jQuery( this ).hide(); + } + }); + } +}); + +jQuery.extend({ + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity" ); + return ret === "" ? "1" : ret; + } + } + } + }, + + // Exclude the following css properties to add px + cssNumber: { + "columnCount": true, + "fillOpacity": true, + "fontWeight": true, + "lineHeight": true, + "opacity": true, + "orphans": true, + "widows": true, + "zIndex": true, + "zoom": true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: { + // normalize float css property + "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat" + }, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, type, hooks, + origName = jQuery.camelCase( name ), + style = elem.style; + + name = jQuery.cssProps[ origName ] || ( jQuery.cssProps[ origName ] = vendorPropName( style, origName ) ); + + // gets hook for the prefixed version + // followed by the unprefixed version + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // Check if we're setting a value + if ( value !== undefined ) { + type = typeof value; + + // convert relative number strings (+= or -=) to relative numbers. #7345 + if ( type === "string" && (ret = rrelNum.exec( value )) ) { + value = ( ret[1] + 1 ) * ret[2] + parseFloat( jQuery.css( elem, name ) ); + // Fixes bug #9237 + type = "number"; + } + + // Make sure that NaN and null values aren't set. See: #7116 + if ( value == null || type === "number" && isNaN( value ) ) { + return; + } + + // If a number was passed in, add 'px' to the (except for certain CSS properties) + if ( type === "number" && !jQuery.cssNumber[ origName ] ) { + value += "px"; + } + + // Fixes #8908, it can be done more correctly by specifing setters in cssHooks, + // but it would mean to define eight (for every problematic property) identical functions + if ( !jQuery.support.clearCloneStyle && value === "" && name.indexOf("background") === 0 ) { + style[ name ] = "inherit"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value, extra )) !== undefined ) { + + // Wrapped to prevent IE from throwing errors when 'invalid' values are provided + // Fixes bug #5509 + try { + style[ name ] = value; + } catch(e) {} + } + + } else { + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) { + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, extra, styles ) { + var num, val, hooks, + origName = jQuery.camelCase( name ); + + // Make sure that we're working with the right name + name = jQuery.cssProps[ origName ] || ( jQuery.cssProps[ origName ] = vendorPropName( elem.style, origName ) ); + + // gets hook for the prefixed version + // followed by the unprefixed version + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks ) { + val = hooks.get( elem, true, extra ); + } + + // Otherwise, if a way to get the computed value exists, use that + if ( val === undefined ) { + val = curCSS( elem, name, styles ); + } + + //convert "normal" to computed value + if ( val === "normal" && name in cssNormalTransform ) { + val = cssNormalTransform[ name ]; + } + + // Return, converting to number if forced or a qualifier was provided and val looks numeric + if ( extra === "" || extra ) { + num = parseFloat( val ); + return extra === true || jQuery.isNumeric( num ) ? num || 0 : val; + } + return val; + }, + + // A method for quickly swapping in/out CSS properties to get correct calculations + swap: function( elem, options, callback, args ) { + var ret, name, + old = {}; + + // Remember the old values, and insert the new ones + for ( name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + ret = callback.apply( elem, args || [] ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + + return ret; + } +}); + +// NOTE: we've included the "window" in window.getComputedStyle +// because jsdom on node.js will break without it. +if ( window.getComputedStyle ) { + getStyles = function( elem ) { + return window.getComputedStyle( elem, null ); + }; + + curCSS = function( elem, name, _computed ) { + var width, minWidth, maxWidth, + computed = _computed || getStyles( elem ), + + // getPropertyValue is only needed for .css('filter') in IE9, see #12537 + ret = computed ? computed.getPropertyValue( name ) || computed[ name ] : undefined, + style = elem.style; + + if ( computed ) { + + if ( ret === "" && !jQuery.contains( elem.ownerDocument, elem ) ) { + ret = jQuery.style( elem, name ); + } + + // A tribute to the "awesome hack by Dean Edwards" + // Chrome < 17 and Safari 5.0 uses "computed value" instead of "used value" for margin-right + // Safari 5.1.7 (at least) returns percentage for a larger set of values, but width seems to be reliably pixels + // this is against the CSSOM draft spec: http://dev.w3.org/csswg/cssom/#resolved-values + if ( rnumnonpx.test( ret ) && rmargin.test( name ) ) { + + // Remember the original values + width = style.width; + minWidth = style.minWidth; + maxWidth = style.maxWidth; + + // Put in the new values to get a computed value out + style.minWidth = style.maxWidth = style.width = ret; + ret = computed.width; + + // Revert the changed values + style.width = width; + style.minWidth = minWidth; + style.maxWidth = maxWidth; + } + } + + return ret; + }; +} else if ( document.documentElement.currentStyle ) { + getStyles = function( elem ) { + return elem.currentStyle; + }; + + curCSS = function( elem, name, _computed ) { + var left, rs, rsLeft, + computed = _computed || getStyles( elem ), + ret = computed ? computed[ name ] : undefined, + style = elem.style; + + // Avoid setting ret to empty string here + // so we don't default to auto + if ( ret == null && style && style[ name ] ) { + ret = style[ name ]; + } + + // From the awesome hack by Dean Edwards + // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291 + + // If we're not dealing with a regular pixel number + // but a number that has a weird ending, we need to convert it to pixels + // but not position css attributes, as those are proportional to the parent element instead + // and we can't measure the parent instead because it might trigger a "stacking dolls" problem + if ( rnumnonpx.test( ret ) && !rposition.test( name ) ) { + + // Remember the original values + left = style.left; + rs = elem.runtimeStyle; + rsLeft = rs && rs.left; + + // Put in the new values to get a computed value out + if ( rsLeft ) { + rs.left = elem.currentStyle.left; + } + style.left = name === "fontSize" ? "1em" : ret; + ret = style.pixelLeft + "px"; + + // Revert the changed values + style.left = left; + if ( rsLeft ) { + rs.left = rsLeft; + } + } + + return ret === "" ? "auto" : ret; + }; +} + +function setPositiveNumber( elem, value, subtract ) { + var matches = rnumsplit.exec( value ); + return matches ? + // Guard against undefined "subtract", e.g., when used as in cssHooks + Math.max( 0, matches[ 1 ] - ( subtract || 0 ) ) + ( matches[ 2 ] || "px" ) : + value; +} + +function augmentWidthOrHeight( elem, name, extra, isBorderBox, styles ) { + var i = extra === ( isBorderBox ? "border" : "content" ) ? + // If we already have the right measurement, avoid augmentation + 4 : + // Otherwise initialize for horizontal or vertical properties + name === "width" ? 1 : 0, + + val = 0; + + for ( ; i < 4; i += 2 ) { + // both box models exclude margin, so add it if we want it + if ( extra === "margin" ) { + val += jQuery.css( elem, extra + cssExpand[ i ], true, styles ); + } + + if ( isBorderBox ) { + // border-box includes padding, so remove it if we want content + if ( extra === "content" ) { + val -= jQuery.css( elem, "padding" + cssExpand[ i ], true, styles ); + } + + // at this point, extra isn't border nor margin, so remove border + if ( extra !== "margin" ) { + val -= jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + } + } else { + // at this point, extra isn't content, so add padding + val += jQuery.css( elem, "padding" + cssExpand[ i ], true, styles ); + + // at this point, extra isn't content nor padding, so add border + if ( extra !== "padding" ) { + val += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + } + } + } + + return val; +} + +function getWidthOrHeight( elem, name, extra ) { + + // Start with offset property, which is equivalent to the border-box value + var valueIsBorderBox = true, + val = name === "width" ? elem.offsetWidth : elem.offsetHeight, + styles = getStyles( elem ), + isBorderBox = jQuery.support.boxSizing && jQuery.css( elem, "boxSizing", false, styles ) === "border-box"; + + // some non-html elements return undefined for offsetWidth, so check for null/undefined + // svg - https://bugzilla.mozilla.org/show_bug.cgi?id=649285 + // MathML - https://bugzilla.mozilla.org/show_bug.cgi?id=491668 + if ( val <= 0 || val == null ) { + // Fall back to computed then uncomputed css if necessary + val = curCSS( elem, name, styles ); + if ( val < 0 || val == null ) { + val = elem.style[ name ]; + } + + // Computed unit is not pixels. Stop here and return. + if ( rnumnonpx.test(val) ) { + return val; + } + + // we need the check for style in case a browser which returns unreliable values + // for getComputedStyle silently falls back to the reliable elem.style + valueIsBorderBox = isBorderBox && ( jQuery.support.boxSizingReliable || val === elem.style[ name ] ); + + // Normalize "", auto, and prepare for extra + val = parseFloat( val ) || 0; + } + + // use the active box-sizing model to add/subtract irrelevant styles + return ( val + + augmentWidthOrHeight( + elem, + name, + extra || ( isBorderBox ? "border" : "content" ), + valueIsBorderBox, + styles + ) + ) + "px"; +} + +// Try to determine the default display value of an element +function css_defaultDisplay( nodeName ) { + var doc = document, + display = elemdisplay[ nodeName ]; + + if ( !display ) { + display = actualDisplay( nodeName, doc ); + + // If the simple way fails, read from inside an iframe + if ( display === "none" || !display ) { + // Use the already-created iframe if possible + iframe = ( iframe || + jQuery("' : ''); + inst._keyEvent = false; + return html; }, - _determineButtonType: function() { - - if ( this.element.is(":checkbox") ) { - this.type = "checkbox"; - } else if ( this.element.is(":radio") ) { - this.type = "radio"; - } else if ( this.element.is("input") ) { - this.type = "input"; - } else { - this.type = "button"; + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + secondary, monthNames, monthNamesShort) { + var changeMonth = this._get(inst, 'changeMonth'); + var changeYear = this._get(inst, 'changeYear'); + var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); + var html = '
        '; + var monthHtml = ''; + // month selection + if (secondary || !changeMonth) + monthHtml += '' + monthNames[drawMonth] + ''; + else { + var inMinYear = (minDate && minDate.getFullYear() == drawYear); + var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); + monthHtml += ''; } - - if ( this.type === "checkbox" || this.type === "radio" ) { - // we don't search against the document in case the element - // is disconnected from the DOM - var ancestor = this.element.parents().filter(":last"), - labelSelector = "label[for='" + this.element.attr("id") + "']"; - this.buttonElement = ancestor.find( labelSelector ); - if ( !this.buttonElement.length ) { - ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings(); - this.buttonElement = ancestor.filter( labelSelector ); - if ( !this.buttonElement.length ) { - this.buttonElement = ancestor.find( labelSelector ); + if (!showMonthAfterYear) + html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : ''); + // year selection + if ( !inst.yearshtml ) { + inst.yearshtml = ''; + if (secondary || !changeYear) + html += '' + drawYear + ''; + else { + // determine range of years to display + var years = this._get(inst, 'yearRange').split(':'); + var thisYear = new Date().getFullYear(); + var determineYear = function(value) { + var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) : + (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) : + parseInt(value, 10))); + return (isNaN(year) ? thisYear : year); + }; + var year = determineYear(years[0]); + var endYear = Math.max(year, determineYear(years[1] || '')); + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + inst.yearshtml += ''; - var checked = this.element.is( ":checked" ); - if ( checked ) { - this.buttonElement.addClass( "ui-state-active" ); + html += inst.yearshtml; + inst.yearshtml = null; } - this.buttonElement.attr( "aria-pressed", checked ); - } else { - this.buttonElement = this.element; } + html += this._get(inst, 'yearSuffix'); + if (showMonthAfterYear) + html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml; + html += '
        '; // Close datepicker_header + return html; }, - widget: function() { - return this.buttonElement; + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period == 'Y' ? offset : 0); + var month = inst.drawMonth + (period == 'M' ? offset : 0); + var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + + (period == 'D' ? offset : 0); + var date = this._restrictMinMax(inst, + this._daylightSavingAdjust(new Date(year, month, day))); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period == 'M' || period == 'Y') + this._notifyChange(inst); }, - destroy: function() { - this.element - .removeClass( "ui-helper-hidden-accessible" ); - this.buttonElement - .removeClass( baseClasses + " " + stateClasses + " " + typeClasses ) - .removeAttr( "role" ) - .removeAttr( "aria-pressed" ) - .html( this.buttonElement.find(".ui-button-text").html() ); - - if ( !this.hasTitle ) { - this.buttonElement.removeAttr( "title" ); - } - - $.Widget.prototype.destroy.call( this ); + /* Ensure a date is within any min/max bounds. */ + _restrictMinMax: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var newDate = (minDate && date < minDate ? minDate : date); + newDate = (maxDate && newDate > maxDate ? maxDate : newDate); + return newDate; }, - _setOption: function( key, value ) { - $.Widget.prototype._setOption.apply( this, arguments ); - if ( key === "disabled" ) { - if ( value ) { - this.element.propAttr( "disabled", true ); - } else { - this.element.propAttr( "disabled", false ); - } - return; - } - this._resetButton(); + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, 'onChangeMonthYear'); + if (onChange) + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); }, - refresh: function() { - var isDisabled = this.element.is( ":disabled" ); - if ( isDisabled !== this.options.disabled ) { - this._setOption( "disabled", isDisabled ); - } - if ( this.type === "radio" ) { - radioGroup( this.element[0] ).each(function() { - if ( $( this ).is( ":checked" ) ) { - $( this ).button( "widget" ) - .addClass( "ui-state-active" ) - .attr( "aria-pressed", "true" ); - } else { - $( this ).button( "widget" ) - .removeClass( "ui-state-active" ) - .attr( "aria-pressed", "false" ); - } - }); - } else if ( this.type === "checkbox" ) { - if ( this.element.is( ":checked" ) ) { - this.buttonElement - .addClass( "ui-state-active" ) - .attr( "aria-pressed", "true" ); - } else { - this.buttonElement - .removeClass( "ui-state-active" ) - .attr( "aria-pressed", "false" ); - } - } + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, 'numberOfMonths'); + return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); }, - _resetButton: function() { - if ( this.type === "input" ) { - if ( this.options.label ) { - this.element.val( this.options.label ); - } - return; - } - var buttonElement = this.buttonElement.removeClass( typeClasses ), - buttonText = $( "" ) - .addClass( "ui-button-text" ) - .html( this.options.label ) - .appendTo( buttonElement.empty() ) - .text(), - icons = this.options.icons, - multipleIcons = icons.primary && icons.secondary, - buttonClasses = []; - - if ( icons.primary || icons.secondary ) { - if ( this.options.text ) { - buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) ); - } - - if ( icons.primary ) { - buttonElement.prepend( "" ); - } - - if ( icons.secondary ) { - buttonElement.append( "" ); - } - - if ( !this.options.text ) { - buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" ); - - if ( !this.hasTitle ) { - buttonElement.attr( "title", buttonText ); - } - } - } else { - buttonClasses.push( "ui-button-text-only" ); - } - buttonElement.addClass( buttonClasses.join( " " ) ); - } -}); - -$.widget( "ui.buttonset", { - options: { - items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)" + /* Determine the current maximum date - ensure no time components are set. */ + _getMinMaxDate: function(inst, minMax) { + return this._determineDate(inst, this._get(inst, minMax + 'Date'), null); }, - _create: function() { - this.element.addClass( "ui-buttonset" ); - }, - - _init: function() { - this.refresh(); + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate(); }, - _setOption: function( key, value ) { - if ( key === "disabled" ) { - this.buttons.button( "option", key, value ); - } + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, - $.Widget.prototype._setOption.apply( this, arguments ); + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst); + var date = this._daylightSavingAdjust(new Date(curYear, + curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); + if (offset < 0) + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + return this._isInRange(inst, date); }, - - refresh: function() { - var ltr = this.element.css( "direction" ) === "ltr"; - - this.buttons = this.element.find( this.options.items ) - .filter( ":ui-button" ) - .button( "refresh" ) - .end() - .not( ":ui-button" ) - .button() - .end() - .map(function() { - return $( this ).button( "widget" )[ 0 ]; - }) - .removeClass( "ui-corner-all ui-corner-left ui-corner-right" ) - .filter( ":first" ) - .addClass( ltr ? "ui-corner-left" : "ui-corner-right" ) - .end() - .filter( ":last" ) - .addClass( ltr ? "ui-corner-right" : "ui-corner-left" ) - .end() - .end(); + + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + return ((!minDate || date.getTime() >= minDate.getTime()) && + (!maxDate || date.getTime() <= maxDate.getTime())); }, - destroy: function() { - this.element.removeClass( "ui-buttonset" ); - this.buttons - .map(function() { - return $( this ).button( "widget" )[ 0 ]; - }) - .removeClass( "ui-corner-left ui-corner-right" ) - .end() - .button( "destroy" ); + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, 'shortYearCutoff'); + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), + monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + }, - $.Widget.prototype.destroy.call( this ); + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = (day ? (typeof day == 'object' ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); } }); -}( jQuery ) ); /* - * jQuery UI Datepicker 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Datepicker - * - * Depends: - * jquery.ui.core.js + * Bind hover events for datepicker elements. + * Done via delegate so the binding only occurs once in the lifetime of the parent div. + * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker. */ -(function( $, undefined ) { +function bindHover(dpDiv) { + var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a'; + return dpDiv.delegate(selector, 'mouseout', function() { + $(this).removeClass('ui-state-hover'); + if (this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover'); + if (this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover'); + }) + .delegate(selector, 'mouseover', function(){ + if (!$.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0])) { + $(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); + $(this).addClass('ui-state-hover'); + if (this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover'); + if (this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover'); + } + }); +} -$.extend($.ui, { datepicker: { version: "1.8.16" } }); +/* jQuery extend now ignores nulls! */ +function extendRemove(target, props) { + $.extend(target, props); + for (var name in props) + if (props[name] == null || props[name] == undefined) + target[name] = props[name]; + return target; +}; -var PROP_NAME = 'datepicker'; -var dpuuid = new Date().getTime(); -var instActive; +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ -/* Date picker manager. - Use the singleton instance of this class, $.datepicker, to interact with the date picker. - Settings for (groups of) date pickers are maintained in an instance object, - allowing multiple different settings on the same page. */ + /* Verify an empty collection wasn't passed - Fixes #6976 */ + if ( !this.length ) { + return this; + } -function Datepicker() { - this.debug = false; // Change this to true to start debugging - this._curInst = null; // The current instance in use - this._keyEvent = false; // If the last event was a key event - this._disabledInputs = []; // List of date picker inputs that have been disabled - this._datepickerShowing = false; // True if the popup picker is showing , false if not - this._inDialog = false; // True if showing within a "dialog", false if not - this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division - this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class - this._appendClass = 'ui-datepicker-append'; // The name of the append marker class - this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class - this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class - this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class - this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class - this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class - this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class - this.regional = []; // Available regional settings, indexed by language code - this.regional[''] = { // Default regional settings - closeText: 'Done', // Display text for close link - prevText: 'Prev', // Display text for previous month link - nextText: 'Next', // Display text for next month link - currentText: 'Today', // Display text for current month link - monthNames: ['January','February','March','April','May','June', - 'July','August','September','October','November','December'], // Names of months for drop-down and formatting - monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting - dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting - dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting - dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday - weekHeader: 'Wk', // Column header for week of the year - dateFormat: 'mm/dd/yy', // See format options on parseDate - firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... - isRTL: false, // True if right-to-left language, false if left-to-right - showMonthAfterYear: false, // True if the year select precedes month, false for month then year - yearSuffix: '' // Additional text to append to the year in the month headers - }; - this._defaults = { // Global defaults for all the date picker instances - showOn: 'focus', // 'focus' for popup on focus, - // 'button' for trigger button, or 'both' for either - showAnim: 'fadeIn', // Name of jQuery animation for popup - showOptions: {}, // Options for enhanced animations - defaultDate: null, // Used when field is blank: actual date, - // +/-number for offset from today, null for today - appendText: '', // Display text following the input box, e.g. showing the format - buttonText: '...', // Text for trigger button - buttonImage: '', // URL for trigger button image - buttonImageOnly: false, // True if the image appears alone, false if it appears on a button - hideIfNoPrevNext: false, // True to hide next/previous month links - // if not applicable, false to just disable them - navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links - gotoCurrent: false, // True if today link goes back to current selection instead - changeMonth: false, // True if month can be selected directly, false if only prev/next - changeYear: false, // True if year can be selected directly, false if only prev/next - yearRange: 'c-10:c+10', // Range of years to display in drop-down, - // either relative to today's year (-nn:+nn), relative to currently displayed year - // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n) - showOtherMonths: false, // True to show dates in other months, false to leave blank - selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable - showWeek: false, // True to show week of the year, false to not show it - calculateWeek: this.iso8601Week, // How to calculate the week of the year, - // takes a Date and returns the number of the week for it - shortYearCutoff: '+10', // Short year values < this are in the current century, - // > this are in the previous century, - // string value starting with '+' for current year + value - minDate: null, // The earliest selectable date, or null for no limit - maxDate: null, // The latest selectable date, or null for no limit - duration: 'fast', // Duration of display/closure - beforeShowDay: null, // Function that takes a date and returns an array with - // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '', - // [2] = cell title (optional), e.g. $.datepicker.noWeekends - beforeShow: null, // Function that takes an input field and - // returns a set of custom settings for the date picker - onSelect: null, // Define a callback function when a date is selected - onChangeMonthYear: null, // Define a callback function when the month or year is changed - onClose: null, // Define a callback function when the datepicker is closed - numberOfMonths: 1, // Number of months to show at a time - showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) - stepMonths: 1, // Number of months to step back/forward - stepBigMonths: 12, // Number of months to step back/forward for the big links - altField: '', // Selector for an alternate field to store selected dates into - altFormat: '', // The date format to use for the alternate field - constrainInput: true, // The input is constrained by the current date format - showButtonPanel: false, // True to show button panel, false to not show it - autoSize: false, // True to size the input for the date format, false to leave as is - disabled: false // The initial disabled state + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick). + find(document.body).append($.datepicker.dpDiv); + $.datepicker.initialized = true; + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget')) + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string') + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + return this.each(function() { + typeof options == 'string' ? + $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.9.2"; + +// Workaround for #4055 +// Add another global to avoid noConflict issues with inline event handlers +window['DP_jQuery_' + dpuuid] = $; + +})(jQuery); + +(function( $, undefined ) { + +var uiDialogClasses = "ui-dialog ui-widget ui-widget-content ui-corner-all ", + sizeRelatedOptions = { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true + }, + resizableRelatedOptions = { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true }; - $.extend(this._defaults, this.regional['']); - this.dpDiv = bindHover($('
        ')); -} -$.extend(Datepicker.prototype, { - /* Class name added to elements to indicate already configured with a date picker. */ - markerClassName: 'hasDatepicker', - - //Keep track of the maximum number of rows displayed (see #7043) - maxRows: 4, +$.widget("ui.dialog", { + version: "1.9.2", + options: { + autoOpen: true, + buttons: {}, + closeOnEscape: true, + closeText: "close", + dialogClass: "", + draggable: true, + hide: null, + height: "auto", + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: "center", + at: "center", + of: window, + collision: "fit", + // ensure that the titlebar is never outside the document + using: function( pos ) { + var topOffset = $( this ).css( pos ).offset().top; + if ( topOffset < 0 ) { + $( this ).css( "top", pos.top - topOffset ); + } + } + }, + resizable: true, + show: null, + stack: true, + title: "", + width: 300, + zIndex: 1000 + }, + + _create: function() { + this.originalTitle = this.element.attr( "title" ); + // #5742 - .attr() might return a DOMElement + if ( typeof this.originalTitle !== "string" ) { + this.originalTitle = ""; + } + this.oldPosition = { + parent: this.element.parent(), + index: this.element.parent().children().index( this.element ) + }; + this.options.title = this.options.title || this.originalTitle; + var that = this, + options = this.options, - /* Debug logging (if enabled). */ - log: function () { - if (this.debug) - console.log.apply('', arguments); - }, - - // TODO rename to "widget" when switching to widget factory - _widgetDatepicker: function() { - return this.dpDiv; + title = options.title || " ", + uiDialog, + uiDialogTitlebar, + uiDialogTitlebarClose, + uiDialogTitle, + uiDialogButtonPane; + + uiDialog = ( this.uiDialog = $( "
        " ) ) + .addClass( uiDialogClasses + options.dialogClass ) + .css({ + display: "none", + outline: 0, // TODO: move to stylesheet + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + .attr( "tabIndex", -1) + .keydown(function( event ) { + if ( options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE ) { + that.close( event ); + event.preventDefault(); + } + }) + .mousedown(function( event ) { + that.moveToTop( false, event ); + }) + .appendTo( "body" ); + + this.element + .show() + .removeAttr( "title" ) + .addClass( "ui-dialog-content ui-widget-content" ) + .appendTo( uiDialog ); + + uiDialogTitlebar = ( this.uiDialogTitlebar = $( "
        " ) ) + .addClass( "ui-dialog-titlebar ui-widget-header " + + "ui-corner-all ui-helper-clearfix" ) + .bind( "mousedown", function() { + // Dialog isn't getting focus when dragging (#8063) + uiDialog.focus(); + }) + .prependTo( uiDialog ); + + uiDialogTitlebarClose = $( "" ) + .addClass( "ui-dialog-titlebar-close ui-corner-all" ) + .attr( "role", "button" ) + .click(function( event ) { + event.preventDefault(); + that.close( event ); + }) + .appendTo( uiDialogTitlebar ); + + ( this.uiDialogTitlebarCloseText = $( "" ) ) + .addClass( "ui-icon ui-icon-closethick" ) + .text( options.closeText ) + .appendTo( uiDialogTitlebarClose ); + + uiDialogTitle = $( "" ) + .uniqueId() + .addClass( "ui-dialog-title" ) + .html( title ) + .prependTo( uiDialogTitlebar ); + + uiDialogButtonPane = ( this.uiDialogButtonPane = $( "
        " ) ) + .addClass( "ui-dialog-buttonpane ui-widget-content ui-helper-clearfix" ); + + ( this.uiButtonSet = $( "
        " ) ) + .addClass( "ui-dialog-buttonset" ) + .appendTo( uiDialogButtonPane ); + + uiDialog.attr({ + role: "dialog", + "aria-labelledby": uiDialogTitle.attr( "id" ) + }); + + uiDialogTitlebar.find( "*" ).add( uiDialogTitlebar ).disableSelection(); + this._hoverable( uiDialogTitlebarClose ); + this._focusable( uiDialogTitlebarClose ); + + if ( options.draggable && $.fn.draggable ) { + this._makeDraggable(); + } + if ( options.resizable && $.fn.resizable ) { + this._makeResizable(); + } + + this._createButtons( options.buttons ); + this._isOpen = false; + + if ( $.fn.bgiframe ) { + uiDialog.bgiframe(); + } + + // prevent tabbing out of modal dialogs + this._on( uiDialog, { keydown: function( event ) { + if ( !options.modal || event.keyCode !== $.ui.keyCode.TAB ) { + return; + } + + var tabbables = $( ":tabbable", uiDialog ), + first = tabbables.filter( ":first" ), + last = tabbables.filter( ":last" ); + + if ( event.target === last[0] && !event.shiftKey ) { + first.focus( 1 ); + return false; + } else if ( event.target === first[0] && event.shiftKey ) { + last.focus( 1 ); + return false; + } + }}); }, - /* Override the default settings for all instances of the date picker. - @param settings object - the new settings to use as defaults (anonymous object) - @return the manager object */ - setDefaults: function(settings) { - extendRemove(this._defaults, settings || {}); - return this; + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } }, - /* Attach the date picker to a jQuery selection. - @param target element - the target input field or division or span - @param settings object - the new settings to use for this date picker instance (anonymous) */ - _attachDatepicker: function(target, settings) { - // check for settings on the control itself - in namespace 'date:' - var inlineSettings = null; - for (var attrName in this._defaults) { - var attrValue = target.getAttribute('date:' + attrName); - if (attrValue) { - inlineSettings = inlineSettings || {}; - try { - inlineSettings[attrName] = eval(attrValue); - } catch (err) { - inlineSettings[attrName] = attrValue; - } - } + _destroy: function() { + var next, + oldPosition = this.oldPosition; + + if ( this.overlay ) { + this.overlay.destroy(); } - var nodeName = target.nodeName.toLowerCase(); - var inline = (nodeName == 'div' || nodeName == 'span'); - if (!target.id) { - this.uuid += 1; - target.id = 'dp' + this.uuid; + this.uiDialog.hide(); + this.element + .removeClass( "ui-dialog-content ui-widget-content" ) + .hide() + .appendTo( "body" ); + this.uiDialog.remove(); + + if ( this.originalTitle ) { + this.element.attr( "title", this.originalTitle ); } - var inst = this._newInst($(target), inline); - inst.settings = $.extend({}, settings || {}, inlineSettings || {}); - if (nodeName == 'input') { - this._connectDatepicker(target, inst); - } else if (inline) { - this._inlineDatepicker(target, inst); + + next = oldPosition.parent.children().eq( oldPosition.index ); + // Don't try to place the dialog next to itself (#8613) + if ( next.length && next[ 0 ] !== this.element[ 0 ] ) { + next.before( this.element ); + } else { + oldPosition.parent.append( this.element ); } }, - /* Create a new instance object. */ - _newInst: function(target, inline) { - var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars - return {id: id, input: target, // associated target - selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection - drawMonth: 0, drawYear: 0, // month being drawn - inline: inline, // is datepicker inline or not - dpDiv: (!inline ? this.dpDiv : // presentation div - bindHover($('
        ')))}; + widget: function() { + return this.uiDialog; }, - /* Attach the date picker to an input field. */ - _connectDatepicker: function(target, inst) { - var input = $(target); - inst.append = $([]); - inst.trigger = $([]); - if (input.hasClass(this.markerClassName)) + close: function( event ) { + var that = this, + maxZ, thisZ; + + if ( !this._isOpen ) { return; - this._attachments(input, inst); - input.addClass(this.markerClassName).keydown(this._doKeyDown). - keypress(this._doKeyPress).keyup(this._doKeyUp). - bind("setData.datepicker", function(event, key, value) { - inst.settings[key] = value; - }).bind("getData.datepicker", function(event, key) { - return this._get(inst, key); + } + + if ( false === this._trigger( "beforeClose", event ) ) { + return; + } + + this._isOpen = false; + + if ( this.overlay ) { + this.overlay.destroy(); + } + + if ( this.options.hide ) { + this._hide( this.uiDialog, this.options.hide, function() { + that._trigger( "close", event ); }); - this._autoSize(inst); - $.data(target, PROP_NAME, inst); - //If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665) - if( inst.settings.disabled ) { - this._disableDatepicker( target ); + } else { + this.uiDialog.hide(); + this._trigger( "close", event ); + } + + $.ui.dialog.overlay.resize(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if ( this.options.modal ) { + maxZ = 0; + $( ".ui-dialog" ).each(function() { + if ( this !== that.uiDialog[0] ) { + thisZ = $( this ).css( "z-index" ); + if ( !isNaN( thisZ ) ) { + maxZ = Math.max( maxZ, thisZ ); + } + } + }); + $.ui.dialog.maxZ = maxZ; } + + return this; }, - /* Make attachments based on settings. */ - _attachments: function(input, inst) { - var appendText = this._get(inst, 'appendText'); - var isRTL = this._get(inst, 'isRTL'); - if (inst.append) - inst.append.remove(); - if (appendText) { - inst.append = $('' + appendText + ''); - input[isRTL ? 'before' : 'after'](inst.append); + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function( force, event ) { + var options = this.options, + saveScroll; + + if ( ( options.modal && !force ) || + ( !options.stack && !options.modal ) ) { + return this._trigger( "focus", event ); } - input.unbind('focus', this._showDatepicker); - if (inst.trigger) - inst.trigger.remove(); - var showOn = this._get(inst, 'showOn'); - if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field - input.focus(this._showDatepicker); - if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked - var buttonText = this._get(inst, 'buttonText'); - var buttonImage = this._get(inst, 'buttonImage'); - inst.trigger = $(this._get(inst, 'buttonImageOnly') ? - $('').addClass(this._triggerClass). - attr({ src: buttonImage, alt: buttonText, title: buttonText }) : - $('').addClass(this._triggerClass). - html(buttonImage == '' ? buttonText : $('').attr( - { src:buttonImage, alt:buttonText, title:buttonText }))); - input[isRTL ? 'before' : 'after'](inst.trigger); - inst.trigger.click(function() { - if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0]) - $.datepicker._hideDatepicker(); - else - $.datepicker._showDatepicker(input[0]); - return false; - }); + + if ( options.zIndex > $.ui.dialog.maxZ ) { + $.ui.dialog.maxZ = options.zIndex; + } + if ( this.overlay ) { + $.ui.dialog.maxZ += 1; + $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ; + this.overlay.$el.css( "z-index", $.ui.dialog.overlay.maxZ ); } + + // Save and then restore scroll + // Opera 9.5+ resets when parent z-index is changed. + // http://bugs.jqueryui.com/ticket/3193 + saveScroll = { + scrollTop: this.element.scrollTop(), + scrollLeft: this.element.scrollLeft() + }; + $.ui.dialog.maxZ += 1; + this.uiDialog.css( "z-index", $.ui.dialog.maxZ ); + this.element.attr( saveScroll ); + this._trigger( "focus", event ); + + return this; }, - /* Apply the maximum length for the date format. */ - _autoSize: function(inst) { - if (this._get(inst, 'autoSize') && !inst.inline) { - var date = new Date(2009, 12 - 1, 20); // Ensure double digits - var dateFormat = this._get(inst, 'dateFormat'); - if (dateFormat.match(/[DM]/)) { - var findMax = function(names) { - var max = 0; - var maxI = 0; - for (var i = 0; i < names.length; i++) { - if (names[i].length > max) { - max = names[i].length; - maxI = i; - } - } - return maxI; - }; - date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ? - 'monthNames' : 'monthNamesShort')))); - date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ? - 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay()); + open: function() { + if ( this._isOpen ) { + return; + } + + var hasFocus, + options = this.options, + uiDialog = this.uiDialog; + + this._size(); + this._position( options.position ); + uiDialog.show( options.show ); + this.overlay = options.modal ? new $.ui.dialog.overlay( this ) : null; + this.moveToTop( true ); + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + hasFocus = this.element.find( ":tabbable" ); + if ( !hasFocus.length ) { + hasFocus = this.uiDialogButtonPane.find( ":tabbable" ); + if ( !hasFocus.length ) { + hasFocus = uiDialog; } - inst.input.attr('size', this._formatDate(inst, date).length); } + hasFocus.eq( 0 ).focus(); + + this._isOpen = true; + this._trigger( "open" ); + + return this; }, - /* Attach an inline date picker to a div. */ - _inlineDatepicker: function(target, inst) { - var divSpan = $(target); - if (divSpan.hasClass(this.markerClassName)) - return; - divSpan.addClass(this.markerClassName).append(inst.dpDiv). - bind("setData.datepicker", function(event, key, value){ - inst.settings[key] = value; - }).bind("getData.datepicker", function(event, key){ - return this._get(inst, key); + _createButtons: function( buttons ) { + var that = this, + hasButtons = false; + + // if we already have a button pane, remove it + this.uiDialogButtonPane.remove(); + this.uiButtonSet.empty(); + + if ( typeof buttons === "object" && buttons !== null ) { + $.each( buttons, function() { + return !(hasButtons = true); }); - $.data(target, PROP_NAME, inst); - this._setDate(inst, this._getDefaultDate(inst), true); - this._updateDatepicker(inst); - this._updateAlternate(inst); - //If disabled option is true, disable the datepicker before showing it (see ticket #5665) - if( inst.settings.disabled ) { - this._disableDatepicker( target ); } - // Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements - // http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height - inst.dpDiv.css( "display", "block" ); + if ( hasButtons ) { + $.each( buttons, function( name, props ) { + var button, click; + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + // Default to a non-submitting button + props = $.extend( { type: "button" }, props ); + // Change the context for the click callback to be the main element + click = props.click; + props.click = function() { + click.apply( that.element[0], arguments ); + }; + button = $( "", props ) + .appendTo( that.uiButtonSet ); + if ( $.fn.button ) { + button.button(); + } + }); + this.uiDialog.addClass( "ui-dialog-buttons" ); + this.uiDialogButtonPane.appendTo( this.uiDialog ); + } else { + this.uiDialog.removeClass( "ui-dialog-buttons" ); + } }, - /* Pop-up the date picker in a "dialog" box. - @param input element - ignored - @param date string or Date - the initial date to display - @param onSelect function - the function to call when a date is selected - @param settings object - update the dialog date picker instance's settings (anonymous object) - @param pos int[2] - coordinates for the dialog's position within the screen or - event - with x/y coordinates or - leave empty for default (screen centre) - @return the manager object */ - _dialogDatepicker: function(input, date, onSelect, settings, pos) { - var inst = this._dialogInst; // internal instance - if (!inst) { - this.uuid += 1; - var id = 'dp' + this.uuid; - this._dialogInput = $(''); - this._dialogInput.keydown(this._doKeyDown); - $('body').append(this._dialogInput); - inst = this._dialogInst = this._newInst(this._dialogInput, false); - inst.settings = {}; - $.data(this._dialogInput[0], PROP_NAME, inst); + _makeDraggable: function() { + var that = this, + options = this.options; + + function filteredUi( ui ) { + return { + position: ui.position, + offset: ui.offset + }; } - extendRemove(inst.settings, settings || {}); - date = (date && date.constructor == Date ? this._formatDate(inst, date) : date); - this._dialogInput.val(date); - this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); - if (!this._pos) { - var browserWidth = document.documentElement.clientWidth; - var browserHeight = document.documentElement.clientHeight; - var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; - var scrollY = document.documentElement.scrollTop || document.body.scrollTop; - this._pos = // should use actual width/height below - [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + this.uiDialog.draggable({ + cancel: ".ui-dialog-content, .ui-dialog-titlebar-close", + handle: ".ui-dialog-titlebar", + containment: "document", + start: function( event, ui ) { + $( this ) + .addClass( "ui-dialog-dragging" ); + that._trigger( "dragStart", event, filteredUi( ui ) ); + }, + drag: function( event, ui ) { + that._trigger( "drag", event, filteredUi( ui ) ); + }, + stop: function( event, ui ) { + options.position = [ + ui.position.left - that.document.scrollLeft(), + ui.position.top - that.document.scrollTop() + ]; + $( this ) + .removeClass( "ui-dialog-dragging" ); + that._trigger( "dragStop", event, filteredUi( ui ) ); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function( handles ) { + handles = (handles === undefined ? this.options.resizable : handles); + var that = this, + options = this.options, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = this.uiDialog.css( "position" ), + resizeHandles = typeof handles === 'string' ? + handles : + "n,e,s,w,se,sw,ne,nw"; + + function filteredUi( ui ) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; } - // move input on screen for focus, but hidden behind dialog - this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px'); - inst.settings.onSelect = onSelect; - this._inDialog = true; - this.dpDiv.addClass(this._dialogClass); - this._showDatepicker(this._dialogInput[0]); - if ($.blockUI) - $.blockUI(this.dpDiv); - $.data(this._dialogInput[0], PROP_NAME, inst); - return this; + this.uiDialog.resizable({ + cancel: ".ui-dialog-content", + containment: "document", + alsoResize: this.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: this._minHeight(), + handles: resizeHandles, + start: function( event, ui ) { + $( this ).addClass( "ui-dialog-resizing" ); + that._trigger( "resizeStart", event, filteredUi( ui ) ); + }, + resize: function( event, ui ) { + that._trigger( "resize", event, filteredUi( ui ) ); + }, + stop: function( event, ui ) { + $( this ).removeClass( "ui-dialog-resizing" ); + options.height = $( this ).height(); + options.width = $( this ).width(); + that._trigger( "resizeStop", event, filteredUi( ui ) ); + $.ui.dialog.overlay.resize(); + } + }) + .css( "position", position ) + .find( ".ui-resizable-se" ) + .addClass( "ui-icon ui-icon-grip-diagonal-se" ); }, - /* Detach a datepicker from its control. - @param target element - the target input field or division or span */ - _destroyDatepicker: function(target) { - var $target = $(target); - var inst = $.data(target, PROP_NAME); - if (!$target.hasClass(this.markerClassName)) { - return; + _minHeight: function() { + var options = this.options; + + if ( options.height === "auto" ) { + return options.minHeight; + } else { + return Math.min( options.minHeight, options.height ); } - var nodeName = target.nodeName.toLowerCase(); - $.removeData(target, PROP_NAME); - if (nodeName == 'input') { - inst.append.remove(); - inst.trigger.remove(); - $target.removeClass(this.markerClassName). - unbind('focus', this._showDatepicker). - unbind('keydown', this._doKeyDown). - unbind('keypress', this._doKeyPress). - unbind('keyup', this._doKeyUp); - } else if (nodeName == 'div' || nodeName == 'span') - $target.removeClass(this.markerClassName).empty(); }, - /* Enable the date picker to a jQuery selection. - @param target element - the target input field or division or span */ - _enableDatepicker: function(target) { - var $target = $(target); - var inst = $.data(target, PROP_NAME); - if (!$target.hasClass(this.markerClassName)) { - return; + _position: function( position ) { + var myAt = [], + offset = [ 0, 0 ], + isVisible; + + if ( position ) { + // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( + // if (typeof position == 'string' || $.isArray(position)) { + // myAt = $.isArray(position) ? position : position.split(' '); + + if ( typeof position === "string" || (typeof position === "object" && "0" in position ) ) { + myAt = position.split ? position.split( " " ) : [ position[ 0 ], position[ 1 ] ]; + if ( myAt.length === 1 ) { + myAt[ 1 ] = myAt[ 0 ]; + } + + $.each( [ "left", "top" ], function( i, offsetPosition ) { + if ( +myAt[ i ] === myAt[ i ] ) { + offset[ i ] = myAt[ i ]; + myAt[ i ] = offsetPosition; + } + }); + + position = { + my: myAt[0] + (offset[0] < 0 ? offset[0] : "+" + offset[0]) + " " + + myAt[1] + (offset[1] < 0 ? offset[1] : "+" + offset[1]), + at: myAt.join( " " ) + }; + } + + position = $.extend( {}, $.ui.dialog.prototype.options.position, position ); + } else { + position = $.ui.dialog.prototype.options.position; } - var nodeName = target.nodeName.toLowerCase(); - if (nodeName == 'input') { - target.disabled = false; - inst.trigger.filter('button'). - each(function() { this.disabled = false; }).end(). - filter('img').css({opacity: '1.0', cursor: ''}); + + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is( ":visible" ); + if ( !isVisible ) { + this.uiDialog.show(); } - else if (nodeName == 'div' || nodeName == 'span') { - var inline = $target.children('.' + this._inlineClass); - inline.children().removeClass('ui-state-disabled'); - inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). - removeAttr("disabled"); + this.uiDialog.position( position ); + if ( !isVisible ) { + this.uiDialog.hide(); } - this._disabledInputs = $.map(this._disabledInputs, - function(value) { return (value == target ? null : value); }); // delete entry }, - /* Disable the date picker to a jQuery selection. - @param target element - the target input field or division or span */ - _disableDatepicker: function(target) { - var $target = $(target); - var inst = $.data(target, PROP_NAME); - if (!$target.hasClass(this.markerClassName)) { - return; + _setOptions: function( options ) { + var that = this, + resizableOptions = {}, + resize = false; + + $.each( options, function( key, value ) { + that._setOption( key, value ); + + if ( key in sizeRelatedOptions ) { + resize = true; + } + if ( key in resizableRelatedOptions ) { + resizableOptions[ key ] = value; + } + }); + + if ( resize ) { + this._size(); } - var nodeName = target.nodeName.toLowerCase(); - if (nodeName == 'input') { - target.disabled = true; - inst.trigger.filter('button'). - each(function() { this.disabled = true; }).end(). - filter('img').css({opacity: '0.5', cursor: 'default'}); + if ( this.uiDialog.is( ":data(resizable)" ) ) { + this.uiDialog.resizable( "option", resizableOptions ); } - else if (nodeName == 'div' || nodeName == 'span') { - var inline = $target.children('.' + this._inlineClass); - inline.children().addClass('ui-state-disabled'); - inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). - attr("disabled", "disabled"); + }, + + _setOption: function( key, value ) { + var isDraggable, isResizable, + uiDialog = this.uiDialog; + + switch ( key ) { + case "buttons": + this._createButtons( value ); + break; + case "closeText": + // ensure that we always pass a string + this.uiDialogTitlebarCloseText.text( "" + value ); + break; + case "dialogClass": + uiDialog + .removeClass( this.options.dialogClass ) + .addClass( uiDialogClasses + value ); + break; + case "disabled": + if ( value ) { + uiDialog.addClass( "ui-dialog-disabled" ); + } else { + uiDialog.removeClass( "ui-dialog-disabled" ); + } + break; + case "draggable": + isDraggable = uiDialog.is( ":data(draggable)" ); + if ( isDraggable && !value ) { + uiDialog.draggable( "destroy" ); + } + + if ( !isDraggable && value ) { + this._makeDraggable(); + } + break; + case "position": + this._position( value ); + break; + case "resizable": + // currently resizable, becoming non-resizable + isResizable = uiDialog.is( ":data(resizable)" ); + if ( isResizable && !value ) { + uiDialog.resizable( "destroy" ); + } + + // currently resizable, changing handles + if ( isResizable && typeof value === "string" ) { + uiDialog.resizable( "option", "handles", value ); + } + + // currently non-resizable, becoming resizable + if ( !isResizable && value !== false ) { + this._makeResizable( value ); + } + break; + case "title": + // convert whatever was passed in o a string, for html() to not throw up + $( ".ui-dialog-title", this.uiDialogTitlebar ) + .html( "" + ( value || " " ) ); + break; } - this._disabledInputs = $.map(this._disabledInputs, - function(value) { return (value == target ? null : value); }); // delete entry - this._disabledInputs[this._disabledInputs.length] = target; + + this._super( key, value ); }, - /* Is the first field in a jQuery collection disabled as a datepicker? - @param target element - the target input field or division or span - @return boolean - true if disabled, false if enabled */ - _isDisabledDatepicker: function(target) { - if (!target) { - return false; + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var nonContentHeight, minContentHeight, autoHeight, + options = this.options, + isVisible = this.uiDialog.is( ":visible" ); + + // reset content sizing + this.element.show().css({ + width: "auto", + minHeight: 0, + height: 0 + }); + + if ( options.minWidth > options.width ) { + options.width = options.minWidth; } - for (var i = 0; i < this._disabledInputs.length; i++) { - if (this._disabledInputs[i] == target) - return true; + + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: "auto", + width: options.width + }) + .outerHeight(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + + if ( options.height === "auto" ) { + // only needed for IE6 support + if ( $.support.minHeight ) { + this.element.css({ + minHeight: minContentHeight, + height: "auto" + }); + } else { + this.uiDialog.show(); + autoHeight = this.element.css( "height", "auto" ).height(); + if ( !isVisible ) { + this.uiDialog.hide(); + } + this.element.height( Math.max( autoHeight, minContentHeight ) ); + } + } else { + this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); } - return false; - }, - /* Retrieve the instance data for the target control. - @param target element - the target input field or division or span - @return object - the associated instance data - @throws error if a jQuery problem getting data */ - _getInst: function(target) { - try { - return $.data(target, PROP_NAME); + if (this.uiDialog.is( ":data(resizable)" ) ) { + this.uiDialog.resizable( "option", "minHeight", this._minHeight() ); } - catch (err) { - throw 'Missing instance data for this datepicker'; + } +}); + +$.extend($.ui.dialog, { + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + var id = $el.attr( "id" ); + if ( !id ) { + this.uuid += 1; + id = this.uuid; } + return "ui-dialog-title-" + id; }, - /* Update or retrieve the settings for a date picker attached to an input field or division. - @param target element - the target input field or division or span - @param name object - the new settings to update or - string - the name of the setting to change or retrieve, - when retrieving also 'all' for all instance settings or - 'defaults' for all global defaults - @param value any - the new value for the setting - (omit if above is an object or to retrieve a value) */ - _optionDatepicker: function(target, name, value) { - var inst = this._getInst(target); - if (arguments.length == 2 && typeof name == 'string') { - return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) : - (inst ? (name == 'all' ? $.extend({}, inst.settings) : - this._get(inst, name)) : null)); - } - var settings = name || {}; - if (typeof name == 'string') { - settings = {}; - settings[name] = value; + overlay: function( dialog ) { + this.$el = $.ui.dialog.overlay.create( dialog ); + } +}); + +$.extend( $.ui.dialog.overlay, { + instances: [], + // reuse old instances due to IE memory leak with alpha transparency (see #5185) + oldInstances: [], + maxZ: 0, + events: $.map( + "focus,mousedown,mouseup,keydown,keypress,click".split( "," ), + function( event ) { + return event + ".dialog-overlay"; + } + ).join( " " ), + create: function( dialog ) { + if ( this.instances.length === 0 ) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ( $.ui.dialog.overlay.instances.length ) { + $( document ).bind( $.ui.dialog.overlay.events, function( event ) { + // stop events if the z-index of the target is < the z-index of the overlay + // we cannot return true when we don't want to cancel the event (#3523) + if ( $( event.target ).zIndex() < $.ui.dialog.overlay.maxZ ) { + return false; + } + }); + } + }, 1 ); + + // handle window resize + $( window ).bind( "resize.dialog-overlay", $.ui.dialog.overlay.resize ); } - if (inst) { - if (this._curInst == inst) { - this._hideDatepicker(); + + var $el = ( this.oldInstances.pop() || $( "
        " ).addClass( "ui-widget-overlay" ) ); + + // allow closing by pressing the escape key + $( document ).bind( "keydown.dialog-overlay", function( event ) { + var instances = $.ui.dialog.overlay.instances; + // only react to the event if we're the top overlay + if ( instances.length !== 0 && instances[ instances.length - 1 ] === $el && + dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE ) { + + dialog.close( event ); + event.preventDefault(); } - var date = this._getDateDatepicker(target, true); - var minDate = this._getMinMaxDate(inst, 'min'); - var maxDate = this._getMinMaxDate(inst, 'max'); - extendRemove(inst.settings, settings); - // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided - if (minDate !== null && settings['dateFormat'] !== undefined && settings['minDate'] === undefined) - inst.settings.minDate = this._formatDate(inst, minDate); - if (maxDate !== null && settings['dateFormat'] !== undefined && settings['maxDate'] === undefined) - inst.settings.maxDate = this._formatDate(inst, maxDate); - this._attachments($(target), inst); - this._autoSize(inst); - this._setDate(inst, date); - this._updateAlternate(inst); - this._updateDatepicker(inst); + }); + + $el.appendTo( document.body ).css({ + width: this.width(), + height: this.height() + }); + + if ( $.fn.bgiframe ) { + $el.bgiframe(); } - }, - // change method deprecated - _changeDatepicker: function(target, name, value) { - this._optionDatepicker(target, name, value); + this.instances.push( $el ); + return $el; }, - /* Redraw the date picker attached to an input field or division. - @param target element - the target input field or division or span */ - _refreshDatepicker: function(target) { - var inst = this._getInst(target); - if (inst) { - this._updateDatepicker(inst); + destroy: function( $el ) { + var indexOf = $.inArray( $el, this.instances ), + maxZ = 0; + + if ( indexOf !== -1 ) { + this.oldInstances.push( this.instances.splice( indexOf, 1 )[ 0 ] ); } - }, - /* Set the dates for a jQuery selection. - @param target element - the target input field or division or span - @param date Date - the new date */ - _setDateDatepicker: function(target, date) { - var inst = this._getInst(target); - if (inst) { - this._setDate(inst, date); - this._updateDatepicker(inst); - this._updateAlternate(inst); + if ( this.instances.length === 0 ) { + $( [ document, window ] ).unbind( ".dialog-overlay" ); } - }, - /* Get the date(s) for the first entry in a jQuery selection. - @param target element - the target input field or division or span - @param noDefault boolean - true if no default date is to be used - @return Date - the current date */ - _getDateDatepicker: function(target, noDefault) { - var inst = this._getInst(target); - if (inst && !inst.inline) - this._setDateFromField(inst, noDefault); - return (inst ? this._getDate(inst) : null); + $el.height( 0 ).width( 0 ).remove(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + $.each( this.instances, function() { + maxZ = Math.max( maxZ, this.css( "z-index" ) ); + }); + this.maxZ = maxZ; }, - /* Handle keystrokes. */ - _doKeyDown: function(event) { - var inst = $.datepicker._getInst(event.target); - var handled = true; - var isRTL = inst.dpDiv.is('.ui-datepicker-rtl'); - inst._keyEvent = true; - if ($.datepicker._datepickerShowing) - switch (event.keyCode) { - case 9: $.datepicker._hideDatepicker(); - handled = false; - break; // hide on tab out - case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' + - $.datepicker._currentClass + ')', inst.dpDiv); - if (sel[0]) - $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); - var onSelect = $.datepicker._get(inst, 'onSelect'); - if (onSelect) { - var dateStr = $.datepicker._formatDate(inst); + height: function() { + var scrollHeight, + offsetHeight; + // handle IE + if ( $.ui.ie ) { + scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); - // trigger custom callback - onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); - } - else - $.datepicker._hideDatepicker(); - return false; // don't submit the form - break; // select the value on enter - case 27: $.datepicker._hideDatepicker(); - break; // hide on escape - case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? - -$.datepicker._get(inst, 'stepBigMonths') : - -$.datepicker._get(inst, 'stepMonths')), 'M'); - break; // previous month/year on page up/+ ctrl - case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? - +$.datepicker._get(inst, 'stepBigMonths') : - +$.datepicker._get(inst, 'stepMonths')), 'M'); - break; // next month/year on page down/+ ctrl - case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target); - handled = event.ctrlKey || event.metaKey; - break; // clear on ctrl or command +end - case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target); - handled = event.ctrlKey || event.metaKey; - break; // current on ctrl or command +home - case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D'); - handled = event.ctrlKey || event.metaKey; - // -1 day on ctrl or command +left - if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? - -$.datepicker._get(inst, 'stepBigMonths') : - -$.datepicker._get(inst, 'stepMonths')), 'M'); - // next month/year on alt +left on Mac - break; - case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D'); - handled = event.ctrlKey || event.metaKey; - break; // -1 week on ctrl or command +up - case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D'); - handled = event.ctrlKey || event.metaKey; - // +1 day on ctrl or command +right - if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? - +$.datepicker._get(inst, 'stepBigMonths') : - +$.datepicker._get(inst, 'stepMonths')), 'M'); - // next month/year on alt +right - break; - case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D'); - handled = event.ctrlKey || event.metaKey; - break; // +1 week on ctrl or command +down - default: handled = false; + if ( scrollHeight < offsetHeight ) { + return $( window ).height() + "px"; + } else { + return scrollHeight + "px"; } - else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home - $.datepicker._showDatepicker(this); - else { - handled = false; - } - if (handled) { - event.preventDefault(); - event.stopPropagation(); + // handle "good" browsers + } else { + return $( document ).height() + "px"; } }, - /* Filter entered characters - based on date format. */ - _doKeyPress: function(event) { - var inst = $.datepicker._getInst(event.target); - if ($.datepicker._get(inst, 'constrainInput')) { - var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); - var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode); - return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); + width: function() { + var scrollWidth, + offsetWidth; + // handle IE + if ( $.ui.ie ) { + scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if ( scrollWidth < offsetWidth ) { + return $( window ).width() + "px"; + } else { + return scrollWidth + "px"; + } + // handle "good" browsers + } else { + return $( document ).width() + "px"; } }, - /* Synchronise manual entry and field/alternate field. */ - _doKeyUp: function(event) { - var inst = $.datepicker._getInst(event.target); - if (inst.input.val() != inst.lastVal) { - try { - var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), - (inst.input ? inst.input.val() : null), - $.datepicker._getFormatConfig(inst)); - if (date) { // only if valid - $.datepicker._setDateFromField(inst); - $.datepicker._updateAlternate(inst); - $.datepicker._updateDatepicker(inst); - } - } - catch (event) { - $.datepicker.log(event); + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $( [] ); + $.each( $.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add( this ); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend( $.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy( this.$el ); + } +}); + +}( jQuery ) ); + +(function( $, undefined ) { + +var rvertical = /up|down|vertical/, + rpositivemotion = /up|left|vertical|horizontal/; + +$.effects.effect.blind = function( o, done ) { + // Create element + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "height", "width" ], + mode = $.effects.setMode( el, o.mode || "hide" ), + direction = o.direction || "up", + vertical = rvertical.test( direction ), + ref = vertical ? "height" : "width", + ref2 = vertical ? "top" : "left", + motion = rpositivemotion.test( direction ), + animation = {}, + show = mode === "show", + wrapper, distance, margin; + + // if already wrapped, the wrapper's properties are my property. #6245 + if ( el.parent().is( ".ui-effects-wrapper" ) ) { + $.effects.save( el.parent(), props ); + } else { + $.effects.save( el, props ); + } + el.show(); + wrapper = $.effects.createWrapper( el ).css({ + overflow: "hidden" + }); + + distance = wrapper[ ref ](); + margin = parseFloat( wrapper.css( ref2 ) ) || 0; + + animation[ ref ] = show ? distance : 0; + if ( !motion ) { + el + .css( vertical ? "bottom" : "right", 0 ) + .css( vertical ? "top" : "left", "auto" ) + .css({ position: "absolute" }); + + animation[ ref2 ] = show ? margin : distance + margin; + } + + // start at 0 if we are showing + if ( show ) { + wrapper.css( ref, 0 ); + if ( ! motion ) { + wrapper.css( ref2, margin + distance ); + } + } + + // Animate + wrapper.animate( animation, { + duration: o.duration, + easing: o.easing, + queue: false, + complete: function() { + if ( mode === "hide" ) { + el.hide(); } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); } - return true; - }, + }); - /* Pop-up the date picker for a given input field. - If false returned from beforeShow event handler do not show. - @param input element - the input field attached to the date picker or - event - if triggered by focus */ - _showDatepicker: function(input) { - input = input.target || input; - if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger - input = $('input', input.parentNode)[0]; - if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here - return; - var inst = $.datepicker._getInst(input); - if ($.datepicker._curInst && $.datepicker._curInst != inst) { - if ( $.datepicker._datepickerShowing ) { - $.datepicker._triggerOnClose($.datepicker._curInst); +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.effect.bounce = function( o, done ) { + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "height", "width" ], + + // defaults: + mode = $.effects.setMode( el, o.mode || "effect" ), + hide = mode === "hide", + show = mode === "show", + direction = o.direction || "up", + distance = o.distance, + times = o.times || 5, + + // number of internal animations + anims = times * 2 + ( show || hide ? 1 : 0 ), + speed = o.duration / anims, + easing = o.easing, + + // utility: + ref = ( direction === "up" || direction === "down" ) ? "top" : "left", + motion = ( direction === "up" || direction === "left" ), + i, + upAnim, + downAnim, + + // we will need to re-assemble the queue to stack our animations in place + queue = el.queue(), + queuelen = queue.length; + + // Avoid touching opacity to prevent clearType and PNG issues in IE + if ( show || hide ) { + props.push( "opacity" ); + } + + $.effects.save( el, props ); + el.show(); + $.effects.createWrapper( el ); // Create Wrapper + + // default distance for the BIGGEST bounce is the outer Distance / 3 + if ( !distance ) { + distance = el[ ref === "top" ? "outerHeight" : "outerWidth" ]() / 3; + } + + if ( show ) { + downAnim = { opacity: 1 }; + downAnim[ ref ] = 0; + + // if we are showing, force opacity 0 and set the initial position + // then do the "first" animation + el.css( "opacity", 0 ) + .css( ref, motion ? -distance * 2 : distance * 2 ) + .animate( downAnim, speed, easing ); + } + + // start at the smallest distance if we are hiding + if ( hide ) { + distance = distance / Math.pow( 2, times - 1 ); + } + + downAnim = {}; + downAnim[ ref ] = 0; + // Bounces up/down/left/right then back to 0 -- times * 2 animations happen here + for ( i = 0; i < times; i++ ) { + upAnim = {}; + upAnim[ ref ] = ( motion ? "-=" : "+=" ) + distance; + + el.animate( upAnim, speed, easing ) + .animate( downAnim, speed, easing ); + + distance = hide ? distance * 2 : distance / 2; + } + + // Last Bounce when Hiding + if ( hide ) { + upAnim = { opacity: 0 }; + upAnim[ ref ] = ( motion ? "-=" : "+=" ) + distance; + + el.animate( upAnim, speed, easing ); + } + + el.queue(function() { + if ( hide ) { + el.hide(); + } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); + }); + + // inject all the animations we just queued to be first in line (after "inprogress") + if ( queuelen > 1) { + queue.splice.apply( queue, + [ 1, 0 ].concat( queue.splice( queuelen, anims + 1 ) ) ); + } + el.dequeue(); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.effect.clip = function( o, done ) { + // Create element + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "height", "width" ], + mode = $.effects.setMode( el, o.mode || "hide" ), + show = mode === "show", + direction = o.direction || "vertical", + vert = direction === "vertical", + size = vert ? "height" : "width", + position = vert ? "top" : "left", + animation = {}, + wrapper, animate, distance; + + // Save & Show + $.effects.save( el, props ); + el.show(); + + // Create Wrapper + wrapper = $.effects.createWrapper( el ).css({ + overflow: "hidden" + }); + animate = ( el[0].tagName === "IMG" ) ? wrapper : el; + distance = animate[ size ](); + + // Shift + if ( show ) { + animate.css( size, 0 ); + animate.css( position, distance / 2 ); + } + + // Create Animation Object: + animation[ size ] = show ? distance : 0; + animation[ position ] = show ? 0 : distance / 2; + + // Animate + animate.animate( animation, { + queue: false, + duration: o.duration, + easing: o.easing, + complete: function() { + if ( !show ) { + el.hide(); } - $.datepicker._curInst.dpDiv.stop(true, true); + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); } - var beforeShow = $.datepicker._get(inst, 'beforeShow'); - var beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {}; - if(beforeShowSettings === false){ - //false - return; + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.effect.drop = function( o, done ) { + + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "opacity", "height", "width" ], + mode = $.effects.setMode( el, o.mode || "hide" ), + show = mode === "show", + direction = o.direction || "left", + ref = ( direction === "up" || direction === "down" ) ? "top" : "left", + motion = ( direction === "up" || direction === "left" ) ? "pos" : "neg", + animation = { + opacity: show ? 1 : 0 + }, + distance; + + // Adjust + $.effects.save( el, props ); + el.show(); + $.effects.createWrapper( el ); + + distance = o.distance || el[ ref === "top" ? "outerHeight": "outerWidth" ]( true ) / 2; + + if ( show ) { + el + .css( "opacity", 0 ) + .css( ref, motion === "pos" ? -distance : distance ); + } + + // Animation + animation[ ref ] = ( show ? + ( motion === "pos" ? "+=" : "-=" ) : + ( motion === "pos" ? "-=" : "+=" ) ) + + distance; + + // Animate + el.animate( animation, { + queue: false, + duration: o.duration, + easing: o.easing, + complete: function() { + if ( mode === "hide" ) { + el.hide(); + } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); } - extendRemove(inst.settings, beforeShowSettings); - inst.lastVal = null; - $.datepicker._lastInput = input; - $.datepicker._setDateFromField(inst); - if ($.datepicker._inDialog) // hide cursor - input.value = ''; - if (!$.datepicker._pos) { // position below input - $.datepicker._pos = $.datepicker._findPos(input); - $.datepicker._pos[1] += input.offsetHeight; // add the height + }); +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.effect.explode = function( o, done ) { + + var rows = o.pieces ? Math.round( Math.sqrt( o.pieces ) ) : 3, + cells = rows, + el = $( this ), + mode = $.effects.setMode( el, o.mode || "hide" ), + show = mode === "show", + + // show and then visibility:hidden the element before calculating offset + offset = el.show().css( "visibility", "hidden" ).offset(), + + // width and height of a piece + width = Math.ceil( el.outerWidth() / cells ), + height = Math.ceil( el.outerHeight() / rows ), + pieces = [], + + // loop + i, j, left, top, mx, my; + + // children animate complete: + function childComplete() { + pieces.push( this ); + if ( pieces.length === rows * cells ) { + animComplete(); } - var isFixed = false; - $(input).parents().each(function() { - isFixed |= $(this).css('position') == 'fixed'; - return !isFixed; + } + + // clone the element for each row and cell. + for( i = 0; i < rows ; i++ ) { // ===> + top = offset.top + i * height; + my = i - ( rows - 1 ) / 2 ; + + for( j = 0; j < cells ; j++ ) { // ||| + left = offset.left + j * width; + mx = j - ( cells - 1 ) / 2 ; + + // Create a clone of the now hidden main element that will be absolute positioned + // within a wrapper div off the -left and -top equal to size of our pieces + el + .clone() + .appendTo( "body" ) + .wrap( "
        " ) + .css({ + position: "absolute", + visibility: "visible", + left: -j * width, + top: -i * height + }) + + // select the wrapper - make it overflow: hidden and absolute positioned based on + // where the original was located +left and +top equal to the size of pieces + .parent() + .addClass( "ui-effects-explode" ) + .css({ + position: "absolute", + overflow: "hidden", + width: width, + height: height, + left: left + ( show ? mx * width : 0 ), + top: top + ( show ? my * height : 0 ), + opacity: show ? 0 : 1 + }).animate({ + left: left + ( show ? 0 : mx * width ), + top: top + ( show ? 0 : my * height ), + opacity: show ? 1 : 0 + }, o.duration || 500, o.easing, childComplete ); + } + } + + function animComplete() { + el.css({ + visibility: "visible" }); - if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled - $.datepicker._pos[0] -= document.documentElement.scrollLeft; - $.datepicker._pos[1] -= document.documentElement.scrollTop; + $( pieces ).remove(); + if ( !show ) { + el.hide(); } - var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; - $.datepicker._pos = null; - //to avoid flashes on Firefox - inst.dpDiv.empty(); - // determine sizing offscreen - inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); - $.datepicker._updateDatepicker(inst); - // fix width for dynamic number of date pickers - // and adjust position before showing - offset = $.datepicker._checkOffset(inst, offset, isFixed); - inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? - 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', - left: offset.left + 'px', top: offset.top + 'px'}); - if (!inst.inline) { - var showAnim = $.datepicker._get(inst, 'showAnim'); - var duration = $.datepicker._get(inst, 'duration'); - var postProcess = function() { - var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only - if( !! cover.length ){ - var borders = $.datepicker._getBorders(inst.dpDiv); - cover.css({left: -borders[0], top: -borders[1], - width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}); - } - }; - inst.dpDiv.zIndex($(input).zIndex()+1); - $.datepicker._datepickerShowing = true; - if ($.effects && $.effects[showAnim]) - inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); - else - inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess); - if (!showAnim || !duration) - postProcess(); - if (inst.input.is(':visible') && !inst.input.is(':disabled')) - inst.input.focus(); - $.datepicker._curInst = inst; + done(); + } +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.effect.fade = function( o, done ) { + var el = $( this ), + mode = $.effects.setMode( el, o.mode || "toggle" ); + + el.animate({ + opacity: mode + }, { + queue: false, + duration: o.duration, + easing: o.easing, + complete: done + }); +}; + +})( jQuery ); + +(function( $, undefined ) { + +$.effects.effect.fold = function( o, done ) { + + // Create element + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "height", "width" ], + mode = $.effects.setMode( el, o.mode || "hide" ), + show = mode === "show", + hide = mode === "hide", + size = o.size || 15, + percent = /([0-9]+)%/.exec( size ), + horizFirst = !!o.horizFirst, + widthFirst = show !== horizFirst, + ref = widthFirst ? [ "width", "height" ] : [ "height", "width" ], + duration = o.duration / 2, + wrapper, distance, + animation1 = {}, + animation2 = {}; + + $.effects.save( el, props ); + el.show(); + + // Create Wrapper + wrapper = $.effects.createWrapper( el ).css({ + overflow: "hidden" + }); + distance = widthFirst ? + [ wrapper.width(), wrapper.height() ] : + [ wrapper.height(), wrapper.width() ]; + + if ( percent ) { + size = parseInt( percent[ 1 ], 10 ) / 100 * distance[ hide ? 0 : 1 ]; + } + if ( show ) { + wrapper.css( horizFirst ? { + height: 0, + width: size + } : { + height: size, + width: 0 + }); + } + + // Animation + animation1[ ref[ 0 ] ] = show ? distance[ 0 ] : size; + animation2[ ref[ 1 ] ] = show ? distance[ 1 ] : 0; + + // Animate + wrapper + .animate( animation1, duration, o.easing ) + .animate( animation2, duration, o.easing, function() { + if ( hide ) { + el.hide(); + } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.effect.highlight = function( o, done ) { + var elem = $( this ), + props = [ "backgroundImage", "backgroundColor", "opacity" ], + mode = $.effects.setMode( elem, o.mode || "show" ), + animation = { + backgroundColor: elem.css( "backgroundColor" ) + }; + + if (mode === "hide") { + animation.opacity = 0; + } + + $.effects.save( elem, props ); + + elem + .show() + .css({ + backgroundImage: "none", + backgroundColor: o.color || "#ffff99" + }) + .animate( animation, { + queue: false, + duration: o.duration, + easing: o.easing, + complete: function() { + if ( mode === "hide" ) { + elem.hide(); + } + $.effects.restore( elem, props ); + done(); + } + }); +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.effect.pulsate = function( o, done ) { + var elem = $( this ), + mode = $.effects.setMode( elem, o.mode || "show" ), + show = mode === "show", + hide = mode === "hide", + showhide = ( show || mode === "hide" ), + + // showing or hiding leaves of the "last" animation + anims = ( ( o.times || 5 ) * 2 ) + ( showhide ? 1 : 0 ), + duration = o.duration / anims, + animateTo = 0, + queue = elem.queue(), + queuelen = queue.length, + i; + + if ( show || !elem.is(":visible")) { + elem.css( "opacity", 0 ).show(); + animateTo = 1; + } + + // anims - 1 opacity "toggles" + for ( i = 1; i < anims; i++ ) { + elem.animate({ + opacity: animateTo + }, duration, o.easing ); + animateTo = 1 - animateTo; + } + + elem.animate({ + opacity: animateTo + }, duration, o.easing); + + elem.queue(function() { + if ( hide ) { + elem.hide(); } - }, + done(); + }); - /* Generate the date picker content. */ - _updateDatepicker: function(inst) { - var self = this; - self.maxRows = 4; //Reset the max number of rows being displayed (see #7043) - var borders = $.datepicker._getBorders(inst.dpDiv); - instActive = inst; // for delegate hover events - inst.dpDiv.empty().append(this._generateHTML(inst)); - var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only - if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6 - cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}) + // We just queued up "anims" animations, we need to put them next in the queue + if ( queuelen > 1 ) { + queue.splice.apply( queue, + [ 1, 0 ].concat( queue.splice( queuelen, anims + 1 ) ) ); + } + elem.dequeue(); +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.effect.puff = function( o, done ) { + var elem = $( this ), + mode = $.effects.setMode( elem, o.mode || "hide" ), + hide = mode === "hide", + percent = parseInt( o.percent, 10 ) || 150, + factor = percent / 100, + original = { + height: elem.height(), + width: elem.width(), + outerHeight: elem.outerHeight(), + outerWidth: elem.outerWidth() + }; + + $.extend( o, { + effect: "scale", + queue: false, + fade: true, + mode: mode, + complete: done, + percent: hide ? percent : 100, + from: hide ? + original : + { + height: original.height * factor, + width: original.width * factor, + outerHeight: original.outerHeight * factor, + outerWidth: original.outerWidth * factor + } + }); + + elem.effect( o ); +}; + +$.effects.effect.scale = function( o, done ) { + + // Create element + var el = $( this ), + options = $.extend( true, {}, o ), + mode = $.effects.setMode( el, o.mode || "effect" ), + percent = parseInt( o.percent, 10 ) || + ( parseInt( o.percent, 10 ) === 0 ? 0 : ( mode === "hide" ? 0 : 100 ) ), + direction = o.direction || "both", + origin = o.origin, + original = { + height: el.height(), + width: el.width(), + outerHeight: el.outerHeight(), + outerWidth: el.outerWidth() + }, + factor = { + y: direction !== "horizontal" ? (percent / 100) : 1, + x: direction !== "vertical" ? (percent / 100) : 1 + }; + + // We are going to pass this effect to the size effect: + options.effect = "size"; + options.queue = false; + options.complete = done; + + // Set default origin and restore for show/hide + if ( mode !== "effect" ) { + options.origin = origin || ["middle","center"]; + options.restore = true; + } + + options.from = o.from || ( mode === "show" ? { + height: 0, + width: 0, + outerHeight: 0, + outerWidth: 0 + } : original ); + options.to = { + height: original.height * factor.y, + width: original.width * factor.x, + outerHeight: original.outerHeight * factor.y, + outerWidth: original.outerWidth * factor.x + }; + + // Fade option to support puff + if ( options.fade ) { + if ( mode === "show" ) { + options.from.opacity = 0; + options.to.opacity = 1; } - inst.dpDiv.find('.' + this._dayOverClass + ' a').mouseover(); - var numMonths = this._getNumberOfMonths(inst); - var cols = numMonths[1]; - var width = 17; - inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width(''); - if (cols > 1) - inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em'); - inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + - 'Class']('ui-datepicker-multi'); - inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + - 'Class']('ui-datepicker-rtl'); - if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input && - // #6694 - don't focus the input if it's already focused - // this breaks the change event in IE - inst.input.is(':visible') && !inst.input.is(':disabled') && inst.input[0] != document.activeElement) - inst.input.focus(); - // deffered render of the years select (to avoid flashes on Firefox) - if( inst.yearshtml ){ - var origyearshtml = inst.yearshtml; - setTimeout(function(){ - //assure that inst.yearshtml didn't change. - if( origyearshtml === inst.yearshtml && inst.yearshtml ){ - inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml); - } - origyearshtml = inst.yearshtml = null; - }, 0); + if ( mode === "hide" ) { + options.from.opacity = 1; + options.to.opacity = 0; } - }, + } - /* Retrieve the size of left and top borders for an element. - @param elem (jQuery object) the element of interest - @return (number[2]) the left and top borders */ - _getBorders: function(elem) { - var convert = function(value) { - return {thin: 1, medium: 2, thick: 3}[value] || value; + // Animate + el.effect( options ); + +}; + +$.effects.effect.size = function( o, done ) { + + // Create element + var original, baseline, factor, + el = $( this ), + props0 = [ "position", "top", "bottom", "left", "right", "width", "height", "overflow", "opacity" ], + + // Always restore + props1 = [ "position", "top", "bottom", "left", "right", "overflow", "opacity" ], + + // Copy for children + props2 = [ "width", "height", "overflow" ], + cProps = [ "fontSize" ], + vProps = [ "borderTopWidth", "borderBottomWidth", "paddingTop", "paddingBottom" ], + hProps = [ "borderLeftWidth", "borderRightWidth", "paddingLeft", "paddingRight" ], + + // Set options + mode = $.effects.setMode( el, o.mode || "effect" ), + restore = o.restore || mode !== "effect", + scale = o.scale || "both", + origin = o.origin || [ "middle", "center" ], + position = el.css( "position" ), + props = restore ? props0 : props1, + zero = { + height: 0, + width: 0, + outerHeight: 0, + outerWidth: 0 }; - return [parseFloat(convert(elem.css('border-left-width'))), - parseFloat(convert(elem.css('border-top-width')))]; - }, - /* Check positioning to remain on screen. */ - _checkOffset: function(inst, offset, isFixed) { - var dpWidth = inst.dpDiv.outerWidth(); - var dpHeight = inst.dpDiv.outerHeight(); - var inputWidth = inst.input ? inst.input.outerWidth() : 0; - var inputHeight = inst.input ? inst.input.outerHeight() : 0; - var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft(); - var viewHeight = document.documentElement.clientHeight + $(document).scrollTop(); + if ( mode === "show" ) { + el.show(); + } + original = { + height: el.height(), + width: el.width(), + outerHeight: el.outerHeight(), + outerWidth: el.outerWidth() + }; - offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0); - offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0; - offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; + if ( o.mode === "toggle" && mode === "show" ) { + el.from = o.to || zero; + el.to = o.from || original; + } else { + el.from = o.from || ( mode === "show" ? zero : original ); + el.to = o.to || ( mode === "hide" ? zero : original ); + } - // now check if datepicker is showing outside window viewport - move to a better place if so. - offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? - Math.abs(offset.left + dpWidth - viewWidth) : 0); - offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? - Math.abs(dpHeight + inputHeight) : 0); + // Set scaling factor + factor = { + from: { + y: el.from.height / original.height, + x: el.from.width / original.width + }, + to: { + y: el.to.height / original.height, + x: el.to.width / original.width + } + }; - return offset; - }, + // Scale the css box + if ( scale === "box" || scale === "both" ) { - /* Find an object's position on the screen. */ - _findPos: function(obj) { - var inst = this._getInst(obj); - var isRTL = this._get(inst, 'isRTL'); - while (obj && (obj.type == 'hidden' || obj.nodeType != 1 || $.expr.filters.hidden(obj))) { - obj = obj[isRTL ? 'previousSibling' : 'nextSibling']; - } - var position = $(obj).offset(); - return [position.left, position.top]; - }, + // Vertical props scaling + if ( factor.from.y !== factor.to.y ) { + props = props.concat( vProps ); + el.from = $.effects.setTransition( el, vProps, factor.from.y, el.from ); + el.to = $.effects.setTransition( el, vProps, factor.to.y, el.to ); + } - /* Trigger custom callback of onClose. */ - _triggerOnClose: function(inst) { - var onClose = this._get(inst, 'onClose'); - if (onClose) - onClose.apply((inst.input ? inst.input[0] : null), - [(inst.input ? inst.input.val() : ''), inst]); - }, + // Horizontal props scaling + if ( factor.from.x !== factor.to.x ) { + props = props.concat( hProps ); + el.from = $.effects.setTransition( el, hProps, factor.from.x, el.from ); + el.to = $.effects.setTransition( el, hProps, factor.to.x, el.to ); + } + } - /* Hide the date picker from view. - @param input element - the input field attached to the date picker */ - _hideDatepicker: function(input) { - var inst = this._curInst; - if (!inst || (input && inst != $.data(input, PROP_NAME))) - return; - if (this._datepickerShowing) { - var showAnim = this._get(inst, 'showAnim'); - var duration = this._get(inst, 'duration'); - var postProcess = function() { - $.datepicker._tidyDialog(inst); - this._curInst = null; + // Scale the content + if ( scale === "content" || scale === "both" ) { + + // Vertical props scaling + if ( factor.from.y !== factor.to.y ) { + props = props.concat( cProps ).concat( props2 ); + el.from = $.effects.setTransition( el, cProps, factor.from.y, el.from ); + el.to = $.effects.setTransition( el, cProps, factor.to.y, el.to ); + } + } + + $.effects.save( el, props ); + el.show(); + $.effects.createWrapper( el ); + el.css( "overflow", "hidden" ).css( el.from ); + + // Adjust + if (origin) { // Calculate baseline shifts + baseline = $.effects.getBaseline( origin, original ); + el.from.top = ( original.outerHeight - el.outerHeight() ) * baseline.y; + el.from.left = ( original.outerWidth - el.outerWidth() ) * baseline.x; + el.to.top = ( original.outerHeight - el.to.outerHeight ) * baseline.y; + el.to.left = ( original.outerWidth - el.to.outerWidth ) * baseline.x; + } + el.css( el.from ); // set top & left + + // Animate + if ( scale === "content" || scale === "both" ) { // Scale the children + + // Add margins/font-size + vProps = vProps.concat([ "marginTop", "marginBottom" ]).concat(cProps); + hProps = hProps.concat([ "marginLeft", "marginRight" ]); + props2 = props0.concat(vProps).concat(hProps); + + el.find( "*[width]" ).each( function(){ + var child = $( this ), + c_original = { + height: child.height(), + width: child.width(), + outerHeight: child.outerHeight(), + outerWidth: child.outerWidth() + }; + if (restore) { + $.effects.save(child, props2); + } + + child.from = { + height: c_original.height * factor.from.y, + width: c_original.width * factor.from.x, + outerHeight: c_original.outerHeight * factor.from.y, + outerWidth: c_original.outerWidth * factor.from.x }; - if ($.effects && $.effects[showAnim]) - inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); - else - inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' : - (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess); - if (!showAnim) - postProcess(); - $.datepicker._triggerOnClose(inst); - this._datepickerShowing = false; - this._lastInput = null; - if (this._inDialog) { - this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); - if ($.blockUI) { - $.unblockUI(); - $('body').append(this.dpDiv); + child.to = { + height: c_original.height * factor.to.y, + width: c_original.width * factor.to.x, + outerHeight: c_original.height * factor.to.y, + outerWidth: c_original.width * factor.to.x + }; + + // Vertical props scaling + if ( factor.from.y !== factor.to.y ) { + child.from = $.effects.setTransition( child, vProps, factor.from.y, child.from ); + child.to = $.effects.setTransition( child, vProps, factor.to.y, child.to ); + } + + // Horizontal props scaling + if ( factor.from.x !== factor.to.x ) { + child.from = $.effects.setTransition( child, hProps, factor.from.x, child.from ); + child.to = $.effects.setTransition( child, hProps, factor.to.x, child.to ); + } + + // Animate children + child.css( child.from ); + child.animate( child.to, o.duration, o.easing, function() { + + // Restore children + if ( restore ) { + $.effects.restore( child, props2 ); + } + }); + }); + } + + // Animate + el.animate( el.to, { + queue: false, + duration: o.duration, + easing: o.easing, + complete: function() { + if ( el.to.opacity === 0 ) { + el.css( "opacity", el.from.opacity ); + } + if( mode === "hide" ) { + el.hide(); + } + $.effects.restore( el, props ); + if ( !restore ) { + + // we need to calculate our new positioning based on the scaling + if ( position === "static" ) { + el.css({ + position: "relative", + top: el.to.top, + left: el.to.left + }); + } else { + $.each([ "top", "left" ], function( idx, pos ) { + el.css( pos, function( _, str ) { + var val = parseInt( str, 10 ), + toRef = idx ? el.to.left : el.to.top; + + // if original was "auto", recalculate the new value from wrapper + if ( str === "auto" ) { + return toRef + "px"; + } + + return val + toRef + "px"; + }); + }); } } - this._inDialog = false; + + $.effects.removeWrapper( el ); + done(); } - }, + }); - /* Tidy up after a dialog display. */ - _tidyDialog: function(inst) { - inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar'); - }, +}; - /* Close date picker if clicked elsewhere. */ - _checkExternalClick: function(event) { - if (!$.datepicker._curInst) - return; - var $target = $(event.target); - if ($target[0].id != $.datepicker._mainDivId && - $target.parents('#' + $.datepicker._mainDivId).length == 0 && - !$target.hasClass($.datepicker.markerClassName) && - !$target.hasClass($.datepicker._triggerClass) && - $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI)) - $.datepicker._hideDatepicker(); - }, +})(jQuery); - /* Adjust one of the date sub-fields. */ - _adjustDate: function(id, offset, period) { - var target = $(id); - var inst = this._getInst(target[0]); - if (this._isDisabledDatepicker(target[0])) { - return; - } - this._adjustInstDate(inst, offset + - (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning - period); - this._updateDatepicker(inst); - }, +(function( $, undefined ) { - /* Action for current link. */ - _gotoToday: function(id) { - var target = $(id); - var inst = this._getInst(target[0]); - if (this._get(inst, 'gotoCurrent') && inst.currentDay) { - inst.selectedDay = inst.currentDay; - inst.drawMonth = inst.selectedMonth = inst.currentMonth; - inst.drawYear = inst.selectedYear = inst.currentYear; - } - else { - var date = new Date(); - inst.selectedDay = date.getDate(); - inst.drawMonth = inst.selectedMonth = date.getMonth(); - inst.drawYear = inst.selectedYear = date.getFullYear(); +$.effects.effect.shake = function( o, done ) { + + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "height", "width" ], + mode = $.effects.setMode( el, o.mode || "effect" ), + direction = o.direction || "left", + distance = o.distance || 20, + times = o.times || 3, + anims = times * 2 + 1, + speed = Math.round(o.duration/anims), + ref = (direction === "up" || direction === "down") ? "top" : "left", + positiveMotion = (direction === "up" || direction === "left"), + animation = {}, + animation1 = {}, + animation2 = {}, + i, + + // we will need to re-assemble the queue to stack our animations in place + queue = el.queue(), + queuelen = queue.length; + + $.effects.save( el, props ); + el.show(); + $.effects.createWrapper( el ); + + // Animation + animation[ ref ] = ( positiveMotion ? "-=" : "+=" ) + distance; + animation1[ ref ] = ( positiveMotion ? "+=" : "-=" ) + distance * 2; + animation2[ ref ] = ( positiveMotion ? "-=" : "+=" ) + distance * 2; + + // Animate + el.animate( animation, speed, o.easing ); + + // Shakes + for ( i = 1; i < times; i++ ) { + el.animate( animation1, speed, o.easing ).animate( animation2, speed, o.easing ); + } + el + .animate( animation1, speed, o.easing ) + .animate( animation, speed / 2, o.easing ) + .queue(function() { + if ( mode === "hide" ) { + el.hide(); + } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); + }); + + // inject all the animations we just queued to be first in line (after "inprogress") + if ( queuelen > 1) { + queue.splice.apply( queue, + [ 1, 0 ].concat( queue.splice( queuelen, anims + 1 ) ) ); + } + el.dequeue(); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.effect.slide = function( o, done ) { + + // Create element + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "width", "height" ], + mode = $.effects.setMode( el, o.mode || "show" ), + show = mode === "show", + direction = o.direction || "left", + ref = (direction === "up" || direction === "down") ? "top" : "left", + positiveMotion = (direction === "up" || direction === "left"), + distance, + animation = {}; + + // Adjust + $.effects.save( el, props ); + el.show(); + distance = o.distance || el[ ref === "top" ? "outerHeight" : "outerWidth" ]( true ); + + $.effects.createWrapper( el ).css({ + overflow: "hidden" + }); + + if ( show ) { + el.css( ref, positiveMotion ? (isNaN(distance) ? "-" + distance : -distance) : distance ); + } + + // Animation + animation[ ref ] = ( show ? + ( positiveMotion ? "+=" : "-=") : + ( positiveMotion ? "-=" : "+=")) + + distance; + + // Animate + el.animate( animation, { + queue: false, + duration: o.duration, + easing: o.easing, + complete: function() { + if ( mode === "hide" ) { + el.hide(); + } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); } - this._notifyChange(inst); - this._adjustDate(target); - }, + }); +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.effect.transfer = function( o, done ) { + var elem = $( this ), + target = $( o.to ), + targetFixed = target.css( "position" ) === "fixed", + body = $("body"), + fixTop = targetFixed ? body.scrollTop() : 0, + fixLeft = targetFixed ? body.scrollLeft() : 0, + endPosition = target.offset(), + animation = { + top: endPosition.top - fixTop , + left: endPosition.left - fixLeft , + height: target.innerHeight(), + width: target.innerWidth() + }, + startPosition = elem.offset(), + transfer = $( '
        ' ) + .appendTo( document.body ) + .addClass( o.className ) + .css({ + top: startPosition.top - fixTop , + left: startPosition.left - fixLeft , + height: elem.innerHeight(), + width: elem.innerWidth(), + position: targetFixed ? "fixed" : "absolute" + }) + .animate( animation, o.duration, o.easing, function() { + transfer.remove(); + done(); + }); +}; - /* Action for selecting a new month/year. */ - _selectMonthYear: function(id, select, period) { - var target = $(id); - var inst = this._getInst(target[0]); - inst['selected' + (period == 'M' ? 'Month' : 'Year')] = - inst['draw' + (period == 'M' ? 'Month' : 'Year')] = - parseInt(select.options[select.selectedIndex].value,10); - this._notifyChange(inst); - this._adjustDate(target); - }, +})(jQuery); - /* Action for selecting a day. */ - _selectDay: function(id, month, year, td) { - var target = $(id); - if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { - return; - } - var inst = this._getInst(target[0]); - inst.selectedDay = inst.currentDay = $('a', td).html(); - inst.selectedMonth = inst.currentMonth = month; - inst.selectedYear = inst.currentYear = year; - this._selectDate(id, this._formatDate(inst, - inst.currentDay, inst.currentMonth, inst.currentYear)); - }, +(function( $, undefined ) { - /* Erase the input field and hide the date picker. */ - _clearDate: function(id) { - var target = $(id); - var inst = this._getInst(target[0]); - this._selectDate(target, ''); - }, +var mouseHandled = false; - /* Update the input field with the selected date. */ - _selectDate: function(id, dateStr) { - var target = $(id); - var inst = this._getInst(target[0]); - dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); - if (inst.input) - inst.input.val(dateStr); - this._updateAlternate(inst); - var onSelect = this._get(inst, 'onSelect'); - if (onSelect) - onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback - else if (inst.input) - inst.input.trigger('change'); // fire the change event - if (inst.inline) - this._updateDatepicker(inst); - else { - this._hideDatepicker(); - this._lastInput = inst.input[0]; - if (typeof(inst.input[0]) != 'object') - inst.input.focus(); // restore focus - this._lastInput = null; - } +$.widget( "ui.menu", { + version: "1.9.2", + defaultElement: "
          ", + delay: 300, + options: { + icons: { + submenu: "ui-icon-carat-1-e" + }, + menus: "ul", + position: { + my: "left top", + at: "right top" + }, + role: "menu", + + // callbacks + blur: null, + focus: null, + select: null }, - /* Update any alternate field to synchronise with the main field. */ - _updateAlternate: function(inst) { - var altField = this._get(inst, 'altField'); - if (altField) { // update alternate field too - var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat'); - var date = this._getDate(inst); - var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); - $(altField).each(function() { $(this).val(dateStr); }); + _create: function() { + this.activeMenu = this.element; + this.element + .uniqueId() + .addClass( "ui-menu ui-widget ui-widget-content ui-corner-all" ) + .toggleClass( "ui-menu-icons", !!this.element.find( ".ui-icon" ).length ) + .attr({ + role: this.options.role, + tabIndex: 0 + }) + // need to catch all clicks on disabled menu + // not possible through _on + .bind( "click" + this.eventNamespace, $.proxy(function( event ) { + if ( this.options.disabled ) { + event.preventDefault(); + } + }, this )); + + if ( this.options.disabled ) { + this.element + .addClass( "ui-state-disabled" ) + .attr( "aria-disabled", "true" ); } - }, - /* Set as beforeShowDay function to prevent selection of weekends. - @param date Date - the date to customise - @return [boolean, string] - is this date selectable?, what is its CSS class? */ - noWeekends: function(date) { - var day = date.getDay(); - return [(day > 0 && day < 6), '']; + this._on({ + // Prevent focus from sticking to links inside menu after clicking + // them (focus should always stay on UL during navigation). + "mousedown .ui-menu-item > a": function( event ) { + event.preventDefault(); + }, + "click .ui-state-disabled > a": function( event ) { + event.preventDefault(); + }, + "click .ui-menu-item:has(a)": function( event ) { + var target = $( event.target ).closest( ".ui-menu-item" ); + if ( !mouseHandled && target.not( ".ui-state-disabled" ).length ) { + mouseHandled = true; + + this.select( event ); + // Open submenu on click + if ( target.has( ".ui-menu" ).length ) { + this.expand( event ); + } else if ( !this.element.is( ":focus" ) ) { + // Redirect focus to the menu + this.element.trigger( "focus", [ true ] ); + + // If the active item is on the top level, let it stay active. + // Otherwise, blur the active item since it is no longer visible. + if ( this.active && this.active.parents( ".ui-menu" ).length === 1 ) { + clearTimeout( this.timer ); + } + } + } + }, + "mouseenter .ui-menu-item": function( event ) { + var target = $( event.currentTarget ); + // Remove ui-state-active class from siblings of the newly focused menu item + // to avoid a jump caused by adjacent elements both having a class with a border + target.siblings().children( ".ui-state-active" ).removeClass( "ui-state-active" ); + this.focus( event, target ); + }, + mouseleave: "collapseAll", + "mouseleave .ui-menu": "collapseAll", + focus: function( event, keepActiveItem ) { + // If there's already an active item, keep it active + // If not, activate the first item + var item = this.active || this.element.children( ".ui-menu-item" ).eq( 0 ); + + if ( !keepActiveItem ) { + this.focus( event, item ); + } + }, + blur: function( event ) { + this._delay(function() { + if ( !$.contains( this.element[0], this.document[0].activeElement ) ) { + this.collapseAll( event ); + } + }); + }, + keydown: "_keydown" + }); + + this.refresh(); + + // Clicks outside of a menu collapse any open menus + this._on( this.document, { + click: function( event ) { + if ( !$( event.target ).closest( ".ui-menu" ).length ) { + this.collapseAll( event ); + } + + // Reset the mouseHandled flag + mouseHandled = false; + } + }); }, - /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. - @param date Date - the date to get the week for - @return number - the number of the week within the year that contains this date */ - iso8601Week: function(date) { - var checkDate = new Date(date.getTime()); - // Find Thursday of this week starting on Monday - checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); - var time = checkDate.getTime(); - checkDate.setMonth(0); // Compare with Jan 1 - checkDate.setDate(1); - return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; + _destroy: function() { + // Destroy (sub)menus + this.element + .removeAttr( "aria-activedescendant" ) + .find( ".ui-menu" ).andSelf() + .removeClass( "ui-menu ui-widget ui-widget-content ui-corner-all ui-menu-icons" ) + .removeAttr( "role" ) + .removeAttr( "tabIndex" ) + .removeAttr( "aria-labelledby" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "aria-hidden" ) + .removeAttr( "aria-disabled" ) + .removeUniqueId() + .show(); + + // Destroy menu items + this.element.find( ".ui-menu-item" ) + .removeClass( "ui-menu-item" ) + .removeAttr( "role" ) + .removeAttr( "aria-disabled" ) + .children( "a" ) + .removeUniqueId() + .removeClass( "ui-corner-all ui-state-hover" ) + .removeAttr( "tabIndex" ) + .removeAttr( "role" ) + .removeAttr( "aria-haspopup" ) + .children().each( function() { + var elem = $( this ); + if ( elem.data( "ui-menu-submenu-carat" ) ) { + elem.remove(); + } + }); + + // Destroy menu dividers + this.element.find( ".ui-menu-divider" ).removeClass( "ui-menu-divider ui-widget-content" ); }, - /* Parse a string value into a date object. - See formatDate below for the possible formats. + _keydown: function( event ) { + var match, prev, character, skip, regex, + preventDefault = true; - @param format string - the expected format of the date - @param value string - the date in the above format - @param settings Object - attributes include: - shortYearCutoff number - the cutoff year for determining the century (optional) - dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) - dayNames string[7] - names of the days from Sunday (optional) - monthNamesShort string[12] - abbreviated names of the months (optional) - monthNames string[12] - names of the months (optional) - @return Date - the extracted date value or null if value is blank */ - parseDate: function (format, value, settings) { - if (format == null || value == null) - throw 'Invalid arguments'; - value = (typeof value == 'object' ? value.toString() : value + ''); - if (value == '') - return null; - var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; - shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : - new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); - var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; - var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; - var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; - var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; - var year = -1; - var month = -1; - var day = -1; - var doy = -1; - var literal = false; - // Check whether a format character is doubled - var lookAhead = function(match) { - var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); - if (matches) - iFormat++; - return matches; - }; - // Extract a number from the string value - var getNumber = function(match) { - var isDoubled = lookAhead(match); - var size = (match == '@' ? 14 : (match == '!' ? 20 : - (match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2)))); - var digits = new RegExp('^\\d{1,' + size + '}'); - var num = value.substring(iValue).match(digits); - if (!num) - throw 'Missing number at position ' + iValue; - iValue += num[0].length; - return parseInt(num[0], 10); - }; - // Extract a name from the string value and convert to an index - var getName = function(match, shortNames, longNames) { - var names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) { - return [ [k, v] ]; - }).sort(function (a, b) { - return -(a[1].length - b[1].length); - }); - var index = -1; - $.each(names, function (i, pair) { - var name = pair[1]; - if (value.substr(iValue, name.length).toLowerCase() == name.toLowerCase()) { - index = pair[0]; - iValue += name.length; - return false; - } - }); - if (index != -1) - return index + 1; - else - throw 'Unknown name at position ' + iValue; - }; - // Confirm that a literal character matches the string value - var checkLiteral = function() { - if (value.charAt(iValue) != format.charAt(iFormat)) - throw 'Unexpected literal at position ' + iValue; - iValue++; - }; - var iValue = 0; - for (var iFormat = 0; iFormat < format.length; iFormat++) { - if (literal) - if (format.charAt(iFormat) == "'" && !lookAhead("'")) - literal = false; - else - checkLiteral(); - else - switch (format.charAt(iFormat)) { - case 'd': - day = getNumber('d'); - break; - case 'D': - getName('D', dayNamesShort, dayNames); - break; - case 'o': - doy = getNumber('o'); - break; - case 'm': - month = getNumber('m'); - break; - case 'M': - month = getName('M', monthNamesShort, monthNames); - break; - case 'y': - year = getNumber('y'); - break; - case '@': - var date = new Date(getNumber('@')); - year = date.getFullYear(); - month = date.getMonth() + 1; - day = date.getDate(); - break; - case '!': - var date = new Date((getNumber('!') - this._ticksTo1970) / 10000); - year = date.getFullYear(); - month = date.getMonth() + 1; - day = date.getDate(); - break; - case "'": - if (lookAhead("'")) - checkLiteral(); - else - literal = true; - break; - default: - checkLiteral(); + function escape( value ) { + return value.replace( /[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&" ); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.PAGE_UP: + this.previousPage( event ); + break; + case $.ui.keyCode.PAGE_DOWN: + this.nextPage( event ); + break; + case $.ui.keyCode.HOME: + this._move( "first", "first", event ); + break; + case $.ui.keyCode.END: + this._move( "last", "last", event ); + break; + case $.ui.keyCode.UP: + this.previous( event ); + break; + case $.ui.keyCode.DOWN: + this.next( event ); + break; + case $.ui.keyCode.LEFT: + this.collapse( event ); + break; + case $.ui.keyCode.RIGHT: + if ( this.active && !this.active.is( ".ui-state-disabled" ) ) { + this.expand( event ); + } + break; + case $.ui.keyCode.ENTER: + case $.ui.keyCode.SPACE: + this._activate( event ); + break; + case $.ui.keyCode.ESCAPE: + this.collapse( event ); + break; + default: + preventDefault = false; + prev = this.previousFilter || ""; + character = String.fromCharCode( event.keyCode ); + skip = false; + + clearTimeout( this.filterTimer ); + + if ( character === prev ) { + skip = true; + } else { + character = prev + character; + } + + regex = new RegExp( "^" + escape( character ), "i" ); + match = this.activeMenu.children( ".ui-menu-item" ).filter(function() { + return regex.test( $( this ).children( "a" ).text() ); + }); + match = skip && match.index( this.active.next() ) !== -1 ? + this.active.nextAll( ".ui-menu-item" ) : + match; + + // If no matches on the current filter, reset to the last character pressed + // to move down the menu to the first item that starts with that character + if ( !match.length ) { + character = String.fromCharCode( event.keyCode ); + regex = new RegExp( "^" + escape( character ), "i" ); + match = this.activeMenu.children( ".ui-menu-item" ).filter(function() { + return regex.test( $( this ).children( "a" ).text() ); + }); + } + + if ( match.length ) { + this.focus( event, match ); + if ( match.length > 1 ) { + this.previousFilter = character; + this.filterTimer = this._delay(function() { + delete this.previousFilter; + }, 1000 ); + } else { + delete this.previousFilter; } + } else { + delete this.previousFilter; + } } - if (iValue < value.length){ - throw "Extra/unparsed characters found in date: " + value.substring(iValue); + + if ( preventDefault ) { + event.preventDefault(); } - if (year == -1) - year = new Date().getFullYear(); - else if (year < 100) - year += new Date().getFullYear() - new Date().getFullYear() % 100 + - (year <= shortYearCutoff ? 0 : -100); - if (doy > -1) { - month = 1; - day = doy; - do { - var dim = this._getDaysInMonth(year, month - 1); - if (day <= dim) - break; - month++; - day -= dim; - } while (true); + }, + + _activate: function( event ) { + if ( !this.active.is( ".ui-state-disabled" ) ) { + if ( this.active.children( "a[aria-haspopup='true']" ).length ) { + this.expand( event ); + } else { + this.select( event ); + } } - var date = this._daylightSavingAdjust(new Date(year, month - 1, day)); - if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) - throw 'Invalid date'; // E.g. 31/02/00 - return date; }, - /* Standard date formats. */ - ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) - COOKIE: 'D, dd M yy', - ISO_8601: 'yy-mm-dd', - RFC_822: 'D, d M y', - RFC_850: 'DD, dd-M-y', - RFC_1036: 'D, d M y', - RFC_1123: 'D, d M yy', - RFC_2822: 'D, d M yy', - RSS: 'D, d M y', // RFC 822 - TICKS: '!', - TIMESTAMP: '@', - W3C: 'yy-mm-dd', // ISO 8601 + refresh: function() { + var menus, + icon = this.options.icons.submenu, + submenus = this.element.find( this.options.menus ); - _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + - Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), + // Initialize nested menus + submenus.filter( ":not(.ui-menu)" ) + .addClass( "ui-menu ui-widget ui-widget-content ui-corner-all" ) + .hide() + .attr({ + role: this.options.role, + "aria-hidden": "true", + "aria-expanded": "false" + }) + .each(function() { + var menu = $( this ), + item = menu.prev( "a" ), + submenuCarat = $( "" ) + .addClass( "ui-menu-icon ui-icon " + icon ) + .data( "ui-menu-submenu-carat", true ); + + item + .attr( "aria-haspopup", "true" ) + .prepend( submenuCarat ); + menu.attr( "aria-labelledby", item.attr( "id" ) ); + }); - /* Format a date object into a string value. - The format can be combinations of the following: - d - day of month (no leading zero) - dd - day of month (two digit) - o - day of year (no leading zeros) - oo - day of year (three digit) - D - day name short - DD - day name long - m - month of year (no leading zero) - mm - month of year (two digit) - M - month name short - MM - month name long - y - year (two digit) - yy - year (four digit) - @ - Unix timestamp (ms since 01/01/1970) - ! - Windows ticks (100ns since 01/01/0001) - '...' - literal text - '' - single quote + menus = submenus.add( this.element ); - @param format string - the desired format of the date - @param date Date - the date value to format - @param settings Object - attributes include: - dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) - dayNames string[7] - names of the days from Sunday (optional) - monthNamesShort string[12] - abbreviated names of the months (optional) - monthNames string[12] - names of the months (optional) - @return string - the date in the above format */ - formatDate: function (format, date, settings) { - if (!date) - return ''; - var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; - var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; - var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; - var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; - // Check whether a format character is doubled - var lookAhead = function(match) { - var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); - if (matches) - iFormat++; - return matches; - }; - // Format a number, with leading zero if necessary - var formatNumber = function(match, value, len) { - var num = '' + value; - if (lookAhead(match)) - while (num.length < len) - num = '0' + num; - return num; - }; - // Format a name, short or long as requested - var formatName = function(match, value, shortNames, longNames) { - return (lookAhead(match) ? longNames[value] : shortNames[value]); - }; - var output = ''; - var literal = false; - if (date) - for (var iFormat = 0; iFormat < format.length; iFormat++) { - if (literal) - if (format.charAt(iFormat) == "'" && !lookAhead("'")) - literal = false; - else - output += format.charAt(iFormat); - else - switch (format.charAt(iFormat)) { - case 'd': - output += formatNumber('d', date.getDate(), 2); - break; - case 'D': - output += formatName('D', date.getDay(), dayNamesShort, dayNames); - break; - case 'o': - output += formatNumber('o', - Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3); - break; - case 'm': - output += formatNumber('m', date.getMonth() + 1, 2); - break; - case 'M': - output += formatName('M', date.getMonth(), monthNamesShort, monthNames); - break; - case 'y': - output += (lookAhead('y') ? date.getFullYear() : - (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); - break; - case '@': - output += date.getTime(); - break; - case '!': - output += date.getTime() * 10000 + this._ticksTo1970; - break; - case "'": - if (lookAhead("'")) - output += "'"; - else - literal = true; - break; - default: - output += format.charAt(iFormat); - } + // Don't refresh list items that are already adapted + menus.children( ":not(.ui-menu-item):has(a)" ) + .addClass( "ui-menu-item" ) + .attr( "role", "presentation" ) + .children( "a" ) + .uniqueId() + .addClass( "ui-corner-all" ) + .attr({ + tabIndex: -1, + role: this._itemRole() + }); + + // Initialize unlinked menu-items containing spaces and/or dashes only as dividers + menus.children( ":not(.ui-menu-item)" ).each(function() { + var item = $( this ); + // hyphen, em dash, en dash + if ( !/[^\-—–\s]/.test( item.text() ) ) { + item.addClass( "ui-widget-content ui-menu-divider" ); } - return output; + }); + + // Add aria-disabled attribute to any disabled menu item + menus.children( ".ui-state-disabled" ).attr( "aria-disabled", "true" ); + + // If the active item has been removed, blur the menu + if ( this.active && !$.contains( this.element[ 0 ], this.active[ 0 ] ) ) { + this.blur(); + } }, - /* Extract all possible characters from the date format. */ - _possibleChars: function (format) { - var chars = ''; - var literal = false; - // Check whether a format character is doubled - var lookAhead = function(match) { - var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); - if (matches) - iFormat++; - return matches; - }; - for (var iFormat = 0; iFormat < format.length; iFormat++) - if (literal) - if (format.charAt(iFormat) == "'" && !lookAhead("'")) - literal = false; - else - chars += format.charAt(iFormat); - else - switch (format.charAt(iFormat)) { - case 'd': case 'm': case 'y': case '@': - chars += '0123456789'; - break; - case 'D': case 'M': - return null; // Accept anything - case "'": - if (lookAhead("'")) - chars += "'"; - else - literal = true; - break; - default: - chars += format.charAt(iFormat); - } - return chars; + _itemRole: function() { + return { + menu: "menuitem", + listbox: "option" + }[ this.options.role ]; }, - /* Get a setting value, defaulting if necessary. */ - _get: function(inst, name) { - return inst.settings[name] !== undefined ? - inst.settings[name] : this._defaults[name]; + focus: function( event, item ) { + var nested, focused; + this.blur( event, event && event.type === "focus" ); + + this._scrollIntoView( item ); + + this.active = item.first(); + focused = this.active.children( "a" ).addClass( "ui-state-focus" ); + // Only update aria-activedescendant if there's a role + // otherwise we assume focus is managed elsewhere + if ( this.options.role ) { + this.element.attr( "aria-activedescendant", focused.attr( "id" ) ); + } + + // Highlight active parent menu item, if any + this.active + .parent() + .closest( ".ui-menu-item" ) + .children( "a:first" ) + .addClass( "ui-state-active" ); + + if ( event && event.type === "keydown" ) { + this._close(); + } else { + this.timer = this._delay(function() { + this._close(); + }, this.delay ); + } + + nested = item.children( ".ui-menu" ); + if ( nested.length && ( /^mouse/.test( event.type ) ) ) { + this._startOpening(nested); + } + this.activeMenu = item.parent(); + + this._trigger( "focus", event, { item: item } ); + }, + + _scrollIntoView: function( item ) { + var borderTop, paddingTop, offset, scroll, elementHeight, itemHeight; + if ( this._hasScroll() ) { + borderTop = parseFloat( $.css( this.activeMenu[0], "borderTopWidth" ) ) || 0; + paddingTop = parseFloat( $.css( this.activeMenu[0], "paddingTop" ) ) || 0; + offset = item.offset().top - this.activeMenu.offset().top - borderTop - paddingTop; + scroll = this.activeMenu.scrollTop(); + elementHeight = this.activeMenu.height(); + itemHeight = item.height(); + + if ( offset < 0 ) { + this.activeMenu.scrollTop( scroll + offset ); + } else if ( offset + itemHeight > elementHeight ) { + this.activeMenu.scrollTop( scroll + offset - elementHeight + itemHeight ); + } + } + }, + + blur: function( event, fromFocus ) { + if ( !fromFocus ) { + clearTimeout( this.timer ); + } + + if ( !this.active ) { + return; + } + + this.active.children( "a" ).removeClass( "ui-state-focus" ); + this.active = null; + + this._trigger( "blur", event, { item: this.active } ); + }, + + _startOpening: function( submenu ) { + clearTimeout( this.timer ); + + // Don't open if already open fixes a Firefox bug that caused a .5 pixel + // shift in the submenu position when mousing over the carat icon + if ( submenu.attr( "aria-hidden" ) !== "true" ) { + return; + } + + this.timer = this._delay(function() { + this._close(); + this._open( submenu ); + }, this.delay ); + }, + + _open: function( submenu ) { + var position = $.extend({ + of: this.active + }, this.options.position ); + + clearTimeout( this.timer ); + this.element.find( ".ui-menu" ).not( submenu.parents( ".ui-menu" ) ) + .hide() + .attr( "aria-hidden", "true" ); + + submenu + .show() + .removeAttr( "aria-hidden" ) + .attr( "aria-expanded", "true" ) + .position( position ); + }, + + collapseAll: function( event, all ) { + clearTimeout( this.timer ); + this.timer = this._delay(function() { + // If we were passed an event, look for the submenu that contains the event + var currentMenu = all ? this.element : + $( event && event.target ).closest( this.element.find( ".ui-menu" ) ); + + // If we found no valid submenu ancestor, use the main menu to close all sub menus anyway + if ( !currentMenu.length ) { + currentMenu = this.element; + } + + this._close( currentMenu ); + + this.blur( event ); + this.activeMenu = currentMenu; + }, this.delay ); + }, + + // With no arguments, closes the currently active menu - if nothing is active + // it closes all menus. If passed an argument, it will search for menus BELOW + _close: function( startMenu ) { + if ( !startMenu ) { + startMenu = this.active ? this.active.parent() : this.element; + } + + startMenu + .find( ".ui-menu" ) + .hide() + .attr( "aria-hidden", "true" ) + .attr( "aria-expanded", "false" ) + .end() + .find( "a.ui-state-active" ) + .removeClass( "ui-state-active" ); }, - /* Parse existing date and initialise date picker. */ - _setDateFromField: function(inst, noDefault) { - if (inst.input.val() == inst.lastVal) { - return; + collapse: function( event ) { + var newItem = this.active && + this.active.parent().closest( ".ui-menu-item", this.element ); + if ( newItem && newItem.length ) { + this._close(); + this.focus( event, newItem ); } - var dateFormat = this._get(inst, 'dateFormat'); - var dates = inst.lastVal = inst.input ? inst.input.val() : null; - var date, defaultDate; - date = defaultDate = this._getDefaultDate(inst); - var settings = this._getFormatConfig(inst); - try { - date = this.parseDate(dateFormat, dates, settings) || defaultDate; - } catch (event) { - this.log(event); - dates = (noDefault ? '' : dates); + }, + + expand: function( event ) { + var newItem = this.active && + this.active + .children( ".ui-menu " ) + .children( ".ui-menu-item" ) + .first(); + + if ( newItem && newItem.length ) { + this._open( newItem.parent() ); + + // Delay so Firefox will not hide activedescendant change in expanding submenu from AT + this._delay(function() { + this.focus( event, newItem ); + }); } - inst.selectedDay = date.getDate(); - inst.drawMonth = inst.selectedMonth = date.getMonth(); - inst.drawYear = inst.selectedYear = date.getFullYear(); - inst.currentDay = (dates ? date.getDate() : 0); - inst.currentMonth = (dates ? date.getMonth() : 0); - inst.currentYear = (dates ? date.getFullYear() : 0); - this._adjustInstDate(inst); }, - /* Retrieve the default date shown on opening. */ - _getDefaultDate: function(inst) { - return this._restrictMinMax(inst, - this._determineDate(inst, this._get(inst, 'defaultDate'), new Date())); + next: function( event ) { + this._move( "next", "first", event ); }, - /* A date may be specified as an exact value or a relative one. */ - _determineDate: function(inst, date, defaultDate) { - var offsetNumeric = function(offset) { - var date = new Date(); - date.setDate(date.getDate() + offset); - return date; - }; - var offsetString = function(offset) { - try { - return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), - offset, $.datepicker._getFormatConfig(inst)); - } - catch (e) { - // Ignore - } - var date = (offset.toLowerCase().match(/^c/) ? - $.datepicker._getDate(inst) : null) || new Date(); - var year = date.getFullYear(); - var month = date.getMonth(); - var day = date.getDate(); - var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; - var matches = pattern.exec(offset); - while (matches) { - switch (matches[2] || 'd') { - case 'd' : case 'D' : - day += parseInt(matches[1],10); break; - case 'w' : case 'W' : - day += parseInt(matches[1],10) * 7; break; - case 'm' : case 'M' : - month += parseInt(matches[1],10); - day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); - break; - case 'y': case 'Y' : - year += parseInt(matches[1],10); - day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); - break; - } - matches = pattern.exec(offset); + previous: function( event ) { + this._move( "prev", "last", event ); + }, + + isFirstItem: function() { + return this.active && !this.active.prevAll( ".ui-menu-item" ).length; + }, + + isLastItem: function() { + return this.active && !this.active.nextAll( ".ui-menu-item" ).length; + }, + + _move: function( direction, filter, event ) { + var next; + if ( this.active ) { + if ( direction === "first" || direction === "last" ) { + next = this.active + [ direction === "first" ? "prevAll" : "nextAll" ]( ".ui-menu-item" ) + .eq( -1 ); + } else { + next = this.active + [ direction + "All" ]( ".ui-menu-item" ) + .eq( 0 ); } - return new Date(year, month, day); - }; - var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) : - (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime())))); - newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate); - if (newDate) { - newDate.setHours(0); - newDate.setMinutes(0); - newDate.setSeconds(0); - newDate.setMilliseconds(0); } - return this._daylightSavingAdjust(newDate); + if ( !next || !next.length || !this.active ) { + next = this.activeMenu.children( ".ui-menu-item" )[ filter ](); + } + + this.focus( event, next ); }, - /* Handle switch to/from daylight saving. - Hours may be non-zero on daylight saving cut-over: - > 12 when midnight changeover, but then cannot generate - midnight datetime, so jump to 1AM, otherwise reset. - @param date (Date) the date to check - @return (Date) the corrected date */ - _daylightSavingAdjust: function(date) { - if (!date) return null; - date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); - return date; + nextPage: function( event ) { + var item, base, height; + + if ( !this.active ) { + this.next( event ); + return; + } + if ( this.isLastItem() ) { + return; + } + if ( this._hasScroll() ) { + base = this.active.offset().top; + height = this.element.height(); + this.active.nextAll( ".ui-menu-item" ).each(function() { + item = $( this ); + return item.offset().top - base - height < 0; + }); + + this.focus( event, item ); + } else { + this.focus( event, this.activeMenu.children( ".ui-menu-item" ) + [ !this.active ? "first" : "last" ]() ); + } }, - /* Set the date(s) directly. */ - _setDate: function(inst, date, noChange) { - var clear = !date; - var origMonth = inst.selectedMonth; - var origYear = inst.selectedYear; - var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); - inst.selectedDay = inst.currentDay = newDate.getDate(); - inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); - inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); - if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange) - this._notifyChange(inst); - this._adjustInstDate(inst); - if (inst.input) { - inst.input.val(clear ? '' : this._formatDate(inst)); + previousPage: function( event ) { + var item, base, height; + if ( !this.active ) { + this.next( event ); + return; + } + if ( this.isFirstItem() ) { + return; + } + if ( this._hasScroll() ) { + base = this.active.offset().top; + height = this.element.height(); + this.active.prevAll( ".ui-menu-item" ).each(function() { + item = $( this ); + return item.offset().top - base + height > 0; + }); + + this.focus( event, item ); + } else { + this.focus( event, this.activeMenu.children( ".ui-menu-item" ).first() ); } }, - /* Retrieve the date(s) directly. */ - _getDate: function(inst) { - var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : - this._daylightSavingAdjust(new Date( - inst.currentYear, inst.currentMonth, inst.currentDay))); - return startDate; + _hasScroll: function() { + return this.element.outerHeight() < this.element.prop( "scrollHeight" ); }, - /* Generate the HTML for the current state of the date picker. */ - _generateHTML: function(inst) { - var today = new Date(); - today = this._daylightSavingAdjust( - new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time - var isRTL = this._get(inst, 'isRTL'); - var showButtonPanel = this._get(inst, 'showButtonPanel'); - var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); - var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); - var numMonths = this._getNumberOfMonths(inst); - var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); - var stepMonths = this._get(inst, 'stepMonths'); - var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); - var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : - new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); - var minDate = this._getMinMaxDate(inst, 'min'); - var maxDate = this._getMinMaxDate(inst, 'max'); - var drawMonth = inst.drawMonth - showCurrentAtPos; - var drawYear = inst.drawYear; - if (drawMonth < 0) { - drawMonth += 12; - drawYear--; + select: function( event ) { + // TODO: It should never be possible to not have an active item at this + // point, but the tests don't trigger mouseenter before click. + this.active = this.active || $( event.target ).closest( ".ui-menu-item" ); + var ui = { item: this.active }; + if ( !this.active.has( ".ui-menu" ).length ) { + this.collapseAll( event, true ); + } + this._trigger( "select", event, ui ); + } +}); + +}( jQuery )); + +(function( $, undefined ) { + +$.ui = $.ui || {}; + +var cachedScrollbarWidth, + max = Math.max, + abs = Math.abs, + round = Math.round, + rhorizontal = /left|center|right/, + rvertical = /top|center|bottom/, + roffset = /[\+\-]\d+%?/, + rposition = /^\w+/, + rpercent = /%$/, + _position = $.fn.position; + +function getOffsets( offsets, width, height ) { + return [ + parseInt( offsets[ 0 ], 10 ) * ( rpercent.test( offsets[ 0 ] ) ? width / 100 : 1 ), + parseInt( offsets[ 1 ], 10 ) * ( rpercent.test( offsets[ 1 ] ) ? height / 100 : 1 ) + ]; +} +function parseCss( element, property ) { + return parseInt( $.css( element, property ), 10 ) || 0; +} + +$.position = { + scrollbarWidth: function() { + if ( cachedScrollbarWidth !== undefined ) { + return cachedScrollbarWidth; } - if (maxDate) { - var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), - maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); - maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); - while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { - drawMonth--; - if (drawMonth < 0) { - drawMonth = 11; - drawYear--; - } + var w1, w2, + div = $( "
          " ), + innerDiv = div.children()[0]; + + $( "body" ).append( div ); + w1 = innerDiv.offsetWidth; + div.css( "overflow", "scroll" ); + + w2 = innerDiv.offsetWidth; + + if ( w1 === w2 ) { + w2 = div[0].clientWidth; + } + + div.remove(); + + return (cachedScrollbarWidth = w1 - w2); + }, + getScrollInfo: function( within ) { + var overflowX = within.isWindow ? "" : within.element.css( "overflow-x" ), + overflowY = within.isWindow ? "" : within.element.css( "overflow-y" ), + hasOverflowX = overflowX === "scroll" || + ( overflowX === "auto" && within.width < within.element[0].scrollWidth ), + hasOverflowY = overflowY === "scroll" || + ( overflowY === "auto" && within.height < within.element[0].scrollHeight ); + return { + width: hasOverflowX ? $.position.scrollbarWidth() : 0, + height: hasOverflowY ? $.position.scrollbarWidth() : 0 + }; + }, + getWithinInfo: function( element ) { + var withinElement = $( element || window ), + isWindow = $.isWindow( withinElement[0] ); + return { + element: withinElement, + isWindow: isWindow, + offset: withinElement.offset() || { left: 0, top: 0 }, + scrollLeft: withinElement.scrollLeft(), + scrollTop: withinElement.scrollTop(), + width: isWindow ? withinElement.width() : withinElement.outerWidth(), + height: isWindow ? withinElement.height() : withinElement.outerHeight() + }; + } +}; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var atOffset, targetWidth, targetHeight, targetOffset, basePosition, + target = $( options.of ), + within = $.position.getWithinInfo( options.within ), + scrollInfo = $.position.getScrollInfo( within ), + targetElem = target[0], + collision = ( options.collision || "flip" ).split( " " ), + offsets = {}; + + if ( targetElem.nodeType === 9 ) { + targetWidth = target.width(); + targetHeight = target.height(); + targetOffset = { top: 0, left: 0 }; + } else if ( $.isWindow( targetElem ) ) { + targetWidth = target.width(); + targetHeight = target.height(); + targetOffset = { top: target.scrollTop(), left: target.scrollLeft() }; + } else if ( targetElem.preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + targetWidth = targetHeight = 0; + targetOffset = { top: targetElem.pageY, left: targetElem.pageX }; + } else { + targetWidth = target.outerWidth(); + targetHeight = target.outerHeight(); + targetOffset = target.offset(); + } + // clone to reuse original targetOffset later + basePosition = $.extend( {}, targetOffset ); + + // force my and at to have valid horizontal and vertical positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[ this ] || "" ).split( " " ), + horizontalOffset, + verticalOffset; + + if ( pos.length === 1) { + pos = rhorizontal.test( pos[ 0 ] ) ? + pos.concat( [ "center" ] ) : + rvertical.test( pos[ 0 ] ) ? + [ "center" ].concat( pos ) : + [ "center", "center" ]; + } + pos[ 0 ] = rhorizontal.test( pos[ 0 ] ) ? pos[ 0 ] : "center"; + pos[ 1 ] = rvertical.test( pos[ 1 ] ) ? pos[ 1 ] : "center"; + + // calculate offsets + horizontalOffset = roffset.exec( pos[ 0 ] ); + verticalOffset = roffset.exec( pos[ 1 ] ); + offsets[ this ] = [ + horizontalOffset ? horizontalOffset[ 0 ] : 0, + verticalOffset ? verticalOffset[ 0 ] : 0 + ]; + + // reduce to just the positions without the offsets + options[ this ] = [ + rposition.exec( pos[ 0 ] )[ 0 ], + rposition.exec( pos[ 1 ] )[ 0 ] + ]; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + if ( options.at[ 0 ] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[ 0 ] === "center" ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[ 1 ] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[ 1 ] === "center" ) { + basePosition.top += targetHeight / 2; + } + + atOffset = getOffsets( offsets.at, targetWidth, targetHeight ); + basePosition.left += atOffset[ 0 ]; + basePosition.top += atOffset[ 1 ]; + + return this.each(function() { + var collisionPosition, using, + elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseCss( this, "marginLeft" ), + marginTop = parseCss( this, "marginTop" ), + collisionWidth = elemWidth + marginLeft + parseCss( this, "marginRight" ) + scrollInfo.width, + collisionHeight = elemHeight + marginTop + parseCss( this, "marginBottom" ) + scrollInfo.height, + position = $.extend( {}, basePosition ), + myOffset = getOffsets( offsets.my, elem.outerWidth(), elem.outerHeight() ); + + if ( options.my[ 0 ] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[ 0 ] === "center" ) { + position.left -= elemWidth / 2; + } + + if ( options.my[ 1 ] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[ 1 ] === "center" ) { + position.top -= elemHeight / 2; + } + + position.left += myOffset[ 0 ]; + position.top += myOffset[ 1 ]; + + // if the browser doesn't support fractions, then round for consistent results + if ( !$.support.offsetFractions ) { + position.left = round( position.left ); + position.top = round( position.top ); + } + + collisionPosition = { + marginLeft: marginLeft, + marginTop: marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[ i ] ] ) { + $.ui.position[ collision[ i ] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: [ atOffset[ 0 ] + myOffset[ 0 ], atOffset [ 1 ] + myOffset[ 1 ] ], + my: options.my, + at: options.at, + within: within, + elem : elem + }); } + }); + + if ( $.fn.bgiframe ) { + elem.bgiframe(); } - inst.drawMonth = drawMonth; - inst.drawYear = drawYear; - var prevText = this._get(inst, 'prevText'); - prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, - this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), - this._getFormatConfig(inst))); - var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? - '' + prevText + '' : - (hideIfNoPrevNext ? '' : '' + prevText + '')); - var nextText = this._get(inst, 'nextText'); - nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, - this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), - this._getFormatConfig(inst))); - var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? - '' + nextText + '' : - (hideIfNoPrevNext ? '' : '' + nextText + '')); - var currentText = this._get(inst, 'currentText'); - var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); - currentText = (!navigationAsDateFormat ? currentText : - this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); - var controls = (!inst.inline ? '' : ''); - var buttonPanel = (showButtonPanel) ? '
          ' + (isRTL ? controls : '') + - (this._isInRange(inst, gotoDate) ? '' : '') + (isRTL ? '' : controls) + '
          ' : ''; - var firstDay = parseInt(this._get(inst, 'firstDay'),10); - firstDay = (isNaN(firstDay) ? 0 : firstDay); - var showWeek = this._get(inst, 'showWeek'); - var dayNames = this._get(inst, 'dayNames'); - var dayNamesShort = this._get(inst, 'dayNamesShort'); - var dayNamesMin = this._get(inst, 'dayNamesMin'); - var monthNames = this._get(inst, 'monthNames'); - var monthNamesShort = this._get(inst, 'monthNamesShort'); - var beforeShowDay = this._get(inst, 'beforeShowDay'); - var showOtherMonths = this._get(inst, 'showOtherMonths'); - var selectOtherMonths = this._get(inst, 'selectOtherMonths'); - var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; - var defaultDate = this._getDefaultDate(inst); - var html = ''; - for (var row = 0; row < numMonths[0]; row++) { - var group = ''; - this.maxRows = 4; - for (var col = 0; col < numMonths[1]; col++) { - var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); - var cornerClass = ' ui-corner-all'; - var calender = ''; - if (isMultiMonth) { - calender += '
          '; + + if ( options.using ) { + // adds feedback as second argument to using callback, if present + using = function( props ) { + var left = targetOffset.left - position.left, + right = left + targetWidth - elemWidth, + top = targetOffset.top - position.top, + bottom = top + targetHeight - elemHeight, + feedback = { + target: { + element: target, + left: targetOffset.left, + top: targetOffset.top, + width: targetWidth, + height: targetHeight + }, + element: { + element: elem, + left: position.left, + top: position.top, + width: elemWidth, + height: elemHeight + }, + horizontal: right < 0 ? "left" : left > 0 ? "right" : "center", + vertical: bottom < 0 ? "top" : top > 0 ? "bottom" : "middle" + }; + if ( targetWidth < elemWidth && abs( left + right ) < targetWidth ) { + feedback.horizontal = "center"; } - calender += '
          ' + - (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') + - (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') + - this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, - row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers - '
        ' + - ''; - var thead = (showWeek ? '' : ''); - for (var dow = 0; dow < 7; dow++) { // days of the week - var day = (dow + firstDay) % 7; - thead += '= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' + - '' + dayNamesMin[day] + ''; + if ( targetHeight < elemHeight && abs( top + bottom ) < targetHeight ) { + feedback.vertical = "middle"; } - calender += thead + ''; - var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); - if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) - inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); - var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; - var curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate - var numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043) - this.maxRows = numRows; - var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); - for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows - calender += ''; - var tbody = (!showWeek ? '' : ''); - for (var dow = 0; dow < 7; dow++) { // create date picker days - var daySettings = (beforeShowDay ? - beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); - var otherMonth = (printDate.getMonth() != drawMonth); - var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || - (minDate && printDate < minDate) || (maxDate && printDate > maxDate); - tbody += ''; // display selectable date - printDate.setDate(printDate.getDate() + 1); - printDate = this._daylightSavingAdjust(printDate); + if ( max( abs( left ), abs( right ) ) > max( abs( top ), abs( bottom ) ) ) { + feedback.important = "horizontal"; + } else { + feedback.important = "vertical"; + } + options.using.call( this, props, feedback ); + }; + } + + elem.offset( $.extend( position, { using: using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var within = data.within, + withinOffset = within.isWindow ? within.scrollLeft : within.offset.left, + outerWidth = within.width, + collisionPosLeft = position.left - data.collisionPosition.marginLeft, + overLeft = withinOffset - collisionPosLeft, + overRight = collisionPosLeft + data.collisionWidth - outerWidth - withinOffset, + newOverRight; + + // element is wider than within + if ( data.collisionWidth > outerWidth ) { + // element is initially over the left side of within + if ( overLeft > 0 && overRight <= 0 ) { + newOverRight = position.left + overLeft + data.collisionWidth - outerWidth - withinOffset; + position.left += overLeft - newOverRight; + // element is initially over right side of within + } else if ( overRight > 0 && overLeft <= 0 ) { + position.left = withinOffset; + // element is initially over both left and right sides of within + } else { + if ( overLeft > overRight ) { + position.left = withinOffset + outerWidth - data.collisionWidth; + } else { + position.left = withinOffset; } - calender += tbody + ''; } - drawMonth++; - if (drawMonth > 11) { - drawMonth = 0; - drawYear++; + // too far left -> align with left edge + } else if ( overLeft > 0 ) { + position.left += overLeft; + // too far right -> align with right edge + } else if ( overRight > 0 ) { + position.left -= overRight; + // adjust based on position and margin + } else { + position.left = max( position.left - collisionPosLeft, position.left ); + } + }, + top: function( position, data ) { + var within = data.within, + withinOffset = within.isWindow ? within.scrollTop : within.offset.top, + outerHeight = data.within.height, + collisionPosTop = position.top - data.collisionPosition.marginTop, + overTop = withinOffset - collisionPosTop, + overBottom = collisionPosTop + data.collisionHeight - outerHeight - withinOffset, + newOverBottom; + + // element is taller than within + if ( data.collisionHeight > outerHeight ) { + // element is initially over the top of within + if ( overTop > 0 && overBottom <= 0 ) { + newOverBottom = position.top + overTop + data.collisionHeight - outerHeight - withinOffset; + position.top += overTop - newOverBottom; + // element is initially over bottom of within + } else if ( overBottom > 0 && overTop <= 0 ) { + position.top = withinOffset; + // element is initially over both top and bottom of within + } else { + if ( overTop > overBottom ) { + position.top = withinOffset + outerHeight - data.collisionHeight; + } else { + position.top = withinOffset; + } } - calender += '
        ' + this._get(inst, 'weekHeader') + '
        ' + - this._get(inst, 'calculateWeek')(printDate) + '' + // actions - (otherMonth && !showOtherMonths ? ' ' : // display for other months - (unselectable ? '' + printDate.getDate() + '' : '' + printDate.getDate() + '')) + '
        ' + (isMultiMonth ? '
        ' + - ((numMonths[0] > 0 && col == numMonths[1]-1) ? '
        ' : '') : ''); - group += calender; + // too far up -> align with top + } else if ( overTop > 0 ) { + position.top += overTop; + // too far down -> align with bottom edge + } else if ( overBottom > 0 ) { + position.top -= overBottom; + // adjust based on position and margin + } else { + position.top = max( position.top - collisionPosTop, position.top ); } - html += group; } - html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ? - '' : ''); - inst._keyEvent = false; - return html; }, - - /* Generate the month and year header. */ - _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, - secondary, monthNames, monthNamesShort) { - var changeMonth = this._get(inst, 'changeMonth'); - var changeYear = this._get(inst, 'changeYear'); - var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); - var html = '
        '; - var monthHtml = ''; - // month selection - if (secondary || !changeMonth) - monthHtml += '' + monthNames[drawMonth] + ''; - else { - var inMinYear = (minDate && minDate.getFullYear() == drawYear); - var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); - monthHtml += ''; - } - if (!showMonthAfterYear) - html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : ''); - // year selection - if ( !inst.yearshtml ) { - inst.yearshtml = ''; - if (secondary || !changeYear) - html += '' + drawYear + ''; - else { - // determine range of years to display - var years = this._get(inst, 'yearRange').split(':'); - var thisYear = new Date().getFullYear(); - var determineYear = function(value) { - var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) : - (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) : - parseInt(value, 10))); - return (isNaN(year) ? thisYear : year); - }; - var year = determineYear(years[0]); - var endYear = Math.max(year, determineYear(years[1] || '')); - year = (minDate ? Math.max(year, minDate.getFullYear()) : year); - endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); - inst.yearshtml += ''; - - html += inst.yearshtml; - inst.yearshtml = null; } } - html += this._get(inst, 'yearSuffix'); - if (showMonthAfterYear) - html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml; - html += '
        '; // Close datepicker_header - return html; }, + flipfit: { + left: function() { + $.ui.position.flip.left.apply( this, arguments ); + $.ui.position.fit.left.apply( this, arguments ); + }, + top: function() { + $.ui.position.flip.top.apply( this, arguments ); + $.ui.position.fit.top.apply( this, arguments ); + } + } +}; + +// fraction support test +(function () { + var testElement, testElementParent, testElementStyle, offsetLeft, i, + body = document.getElementsByTagName( "body" )[ 0 ], + div = document.createElement( "div" ); + + //Create a "fake body" for testing based on method used in jQuery.support + testElement = document.createElement( body ? "div" : "body" ); + testElementStyle = { + visibility: "hidden", + width: 0, + height: 0, + border: 0, + margin: 0, + background: "none" + }; + if ( body ) { + $.extend( testElementStyle, { + position: "absolute", + left: "-1000px", + top: "-1000px" + }); + } + for ( i in testElementStyle ) { + testElement.style[ i ] = testElementStyle[ i ]; + } + testElement.appendChild( div ); + testElementParent = body || document.documentElement; + testElementParent.insertBefore( testElement, testElementParent.firstChild ); + + div.style.cssText = "position: absolute; left: 10.7432222px;"; + + offsetLeft = $( div ).offset().left; + $.support.offsetFractions = offsetLeft > 10 && offsetLeft < 11; + + testElement.innerHTML = ""; + testElementParent.removeChild( testElement ); +})(); + +// DEPRECATED +if ( $.uiBackCompat !== false ) { + // offset option + (function( $ ) { + var _position = $.fn.position; + $.fn.position = function( options ) { + if ( !options || !options.offset ) { + return _position.call( this, options ); + } + var offset = options.offset.split( " " ), + at = options.at.split( " " ); + if ( offset.length === 1 ) { + offset[ 1 ] = offset[ 0 ]; + } + if ( /^\d/.test( offset[ 0 ] ) ) { + offset[ 0 ] = "+" + offset[ 0 ]; + } + if ( /^\d/.test( offset[ 1 ] ) ) { + offset[ 1 ] = "+" + offset[ 1 ]; + } + if ( at.length === 1 ) { + if ( /left|center|right/.test( at[ 0 ] ) ) { + at[ 1 ] = "center"; + } else { + at[ 1 ] = at[ 0 ]; + at[ 0 ] = "center"; + } + } + return _position.call( this, $.extend( options, { + at: at[ 0 ] + offset[ 0 ] + " " + at[ 1 ] + offset[ 1 ], + offset: undefined + } ) ); + }; + }( jQuery ) ); +} + +}( jQuery ) ); - /* Adjust one of the date sub-fields. */ - _adjustInstDate: function(inst, offset, period) { - var year = inst.drawYear + (period == 'Y' ? offset : 0); - var month = inst.drawMonth + (period == 'M' ? offset : 0); - var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + - (period == 'D' ? offset : 0); - var date = this._restrictMinMax(inst, - this._daylightSavingAdjust(new Date(year, month, day))); - inst.selectedDay = date.getDate(); - inst.drawMonth = inst.selectedMonth = date.getMonth(); - inst.drawYear = inst.selectedYear = date.getFullYear(); - if (period == 'M' || period == 'Y') - this._notifyChange(inst); - }, +(function( $, undefined ) { - /* Ensure a date is within any min/max bounds. */ - _restrictMinMax: function(inst, date) { - var minDate = this._getMinMaxDate(inst, 'min'); - var maxDate = this._getMinMaxDate(inst, 'max'); - var newDate = (minDate && date < minDate ? minDate : date); - newDate = (maxDate && newDate > maxDate ? maxDate : newDate); - return newDate; +$.widget( "ui.progressbar", { + version: "1.9.2", + options: { + value: 0, + max: 100 }, - /* Notify change of month/year. */ - _notifyChange: function(inst) { - var onChange = this._get(inst, 'onChangeMonthYear'); - if (onChange) - onChange.apply((inst.input ? inst.input[0] : null), - [inst.selectedYear, inst.selectedMonth + 1, inst]); - }, + min: 0, - /* Determine the number of months to show. */ - _getNumberOfMonths: function(inst) { - var numMonths = this._get(inst, 'numberOfMonths'); - return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); - }, + _create: function() { + this.element + .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .attr({ + role: "progressbar", + "aria-valuemin": this.min, + "aria-valuemax": this.options.max, + "aria-valuenow": this._value() + }); - /* Determine the current maximum date - ensure no time components are set. */ - _getMinMaxDate: function(inst, minMax) { - return this._determineDate(inst, this._get(inst, minMax + 'Date'), null); + this.valueDiv = $( "
        " ) + .appendTo( this.element ); + + this.oldValue = this._value(); + this._refreshValue(); }, - /* Find the number of days in a given month. */ - _getDaysInMonth: function(year, month) { - return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate(); + _destroy: function() { + this.element + .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + + this.valueDiv.remove(); }, - /* Find the day of the week of the first of a month. */ - _getFirstDayOfMonth: function(year, month) { - return new Date(year, month, 1).getDay(); + value: function( newValue ) { + if ( newValue === undefined ) { + return this._value(); + } + + this._setOption( "value", newValue ); + return this; }, - /* Determines if we should allow a "next/prev" month display change. */ - _canAdjustMonth: function(inst, offset, curYear, curMonth) { - var numMonths = this._getNumberOfMonths(inst); - var date = this._daylightSavingAdjust(new Date(curYear, - curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); - if (offset < 0) - date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); - return this._isInRange(inst, date); + _setOption: function( key, value ) { + if ( key === "value" ) { + this.options.value = value; + this._refreshValue(); + if ( this._value() === this.options.max ) { + this._trigger( "complete" ); + } + } + + this._super( key, value ); }, - /* Is the given date in the accepted range? */ - _isInRange: function(inst, date) { - var minDate = this._getMinMaxDate(inst, 'min'); - var maxDate = this._getMinMaxDate(inst, 'max'); - return ((!minDate || date.getTime() >= minDate.getTime()) && - (!maxDate || date.getTime() <= maxDate.getTime())); + _value: function() { + var val = this.options.value; + // normalize invalid value + if ( typeof val !== "number" ) { + val = 0; + } + return Math.min( this.options.max, Math.max( this.min, val ) ); }, - /* Provide the configuration settings for formatting/parsing. */ - _getFormatConfig: function(inst) { - var shortYearCutoff = this._get(inst, 'shortYearCutoff'); - shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : - new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); - return {shortYearCutoff: shortYearCutoff, - dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), - monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + _percentage: function() { + return 100 * this._value() / this.options.max; }, - /* Format the given date for display. */ - _formatDate: function(inst, day, month, year) { - if (!day) { - inst.currentDay = inst.selectedDay; - inst.currentMonth = inst.selectedMonth; - inst.currentYear = inst.selectedYear; + _refreshValue: function() { + var value = this.value(), + percentage = this._percentage(); + + if ( this.oldValue !== value ) { + this.oldValue = value; + this._trigger( "change" ); } - var date = (day ? (typeof day == 'object' ? day : - this._daylightSavingAdjust(new Date(year, month, day))) : - this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); - return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); + + this.valueDiv + .toggle( value > this.min ) + .toggleClass( "ui-corner-right", value === this.options.max ) + .width( percentage.toFixed(0) + "%" ); + this.element.attr( "aria-valuenow", value ); } }); -/* - * Bind hover events for datepicker elements. - * Done via delegate so the binding only occurs once in the lifetime of the parent div. - * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker. - */ -function bindHover(dpDiv) { - var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a'; - return dpDiv.bind('mouseout', function(event) { - var elem = $( event.target ).closest( selector ); - if ( !elem.length ) { - return; - } - elem.removeClass( "ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover" ); - }) - .bind('mouseover', function(event) { - var elem = $( event.target ).closest( selector ); - if ($.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0]) || - !elem.length ) { - return; - } - elem.parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); - elem.addClass('ui-state-hover'); - if (elem.hasClass('ui-datepicker-prev')) elem.addClass('ui-datepicker-prev-hover'); - if (elem.hasClass('ui-datepicker-next')) elem.addClass('ui-datepicker-next-hover'); - }); -} +})( jQuery ); -/* jQuery extend now ignores nulls! */ -function extendRemove(target, props) { - $.extend(target, props); - for (var name in props) - if (props[name] == null || props[name] == undefined) - target[name] = props[name]; - return target; -}; +(function( $, undefined ) { -/* Determine whether an object is an array. */ -function isArray(a) { - return (a && (($.browser.safari && typeof a == 'object' && a.length) || - (a.constructor && a.constructor.toString().match(/\Array\(\)/)))); -}; +// number of pages in a slider +// (how many times can you page up/down to go through the whole range) +var numPages = 5; -/* Invoke the datepicker functionality. - @param options string - a command, optionally followed by additional parameters or - Object - settings for attaching new datepicker functionality - @return jQuery object */ -$.fn.datepicker = function(options){ - - /* Verify an empty collection wasn't passed - Fixes #6976 */ - if ( !this.length ) { - return this; - } - - /* Initialise the date picker. */ - if (!$.datepicker.initialized) { - $(document).mousedown($.datepicker._checkExternalClick). - find('body').append($.datepicker.dpDiv); - $.datepicker.initialized = true; - } +$.widget( "ui.slider", $.ui.mouse, { + version: "1.9.2", + widgetEventPrefix: "slide", - var otherArgs = Array.prototype.slice.call(arguments, 1); - if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget')) - return $.datepicker['_' + options + 'Datepicker']. - apply($.datepicker, [this[0]].concat(otherArgs)); - if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string') - return $.datepicker['_' + options + 'Datepicker']. - apply($.datepicker, [this[0]].concat(otherArgs)); - return this.each(function() { - typeof options == 'string' ? - $.datepicker['_' + options + 'Datepicker']. - apply($.datepicker, [this].concat(otherArgs)) : - $.datepicker._attachDatepicker(this, options); - }); -}; + options: { + animate: false, + distance: 0, + max: 100, + min: 0, + orientation: "horizontal", + range: false, + step: 1, + value: 0, + values: null + }, -$.datepicker = new Datepicker(); // singleton instance -$.datepicker.initialized = false; -$.datepicker.uuid = new Date().getTime(); -$.datepicker.version = "1.8.16"; + _create: function() { + var i, handleCount, + o = this.options, + existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ), + handle = "", + handles = []; -// Workaround for #4055 -// Add another global to avoid noConflict issues with inline event handlers -window['DP_jQuery_' + dpuuid] = $; + this._keySliding = false; + this._mouseSliding = false; + this._animateOff = true; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); -})(jQuery); -/* - * jQuery UI Dialog 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Dialog - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - * jquery.ui.button.js - * jquery.ui.draggable.js - * jquery.ui.mouse.js - * jquery.ui.position.js - * jquery.ui.resizable.js - */ -(function( $, undefined ) { + this.element + .addClass( "ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" + + ( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) ); -var uiDialogClasses = - 'ui-dialog ' + - 'ui-widget ' + - 'ui-widget-content ' + - 'ui-corner-all ', - sizeRelatedOptions = { - buttons: true, - height: true, - maxHeight: true, - maxWidth: true, - minHeight: true, - minWidth: true, - width: true - }, - resizableRelatedOptions = { - maxHeight: true, - maxWidth: true, - minHeight: true, - minWidth: true - }, - // support for jQuery 1.3.2 - handle common attrFn methods for dialog - attrFn = $.attrFn || { - val: true, - css: true, - html: true, - text: true, - data: true, - width: true, - height: true, - offset: true, - click: true - }; + this.range = $([]); -$.widget("ui.dialog", { - options: { - autoOpen: true, - buttons: {}, - closeOnEscape: true, - closeText: 'close', - dialogClass: '', - draggable: true, - hide: null, - height: 'auto', - maxHeight: false, - maxWidth: false, - minHeight: 150, - minWidth: 150, - modal: false, - position: { - my: 'center', - at: 'center', - collision: 'fit', - // ensure that the titlebar is never outside the document - using: function(pos) { - var topOffset = $(this).css(pos).offset().top; - if (topOffset < 0) { - $(this).css('top', pos.top - topOffset); + if ( o.range ) { + if ( o.range === true ) { + if ( !o.values ) { + o.values = [ this._valueMin(), this._valueMin() ]; + } + if ( o.values.length && o.values.length !== 2 ) { + o.values = [ o.values[0], o.values[0] ]; } } - }, - resizable: true, - show: null, - stack: true, - title: '', - width: 300, - zIndex: 1000 - }, - _create: function() { - this.originalTitle = this.element.attr('title'); - // #5742 - .attr() might return a DOMElement - if ( typeof this.originalTitle !== "string" ) { - this.originalTitle = ""; + this.range = $( "
        " ) + .appendTo( this.element ) + .addClass( "ui-slider-range" + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + " ui-widget-header" + + ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) ); } - this.options.title = this.options.title || this.originalTitle; - var self = this, - options = self.options, + handleCount = ( o.values && o.values.length ) || 1; + + for ( i = existingHandles.length; i < handleCount; i++ ) { + handles.push( handle ); + } - title = options.title || ' ', - titleId = $.ui.dialog.getTitleId(self.element), + this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( this.element ) ); - uiDialog = (self.uiDialog = $('
        ')) - .appendTo(document.body) - .hide() - .addClass(uiDialogClasses + options.dialogClass) - .css({ - zIndex: options.zIndex - }) - // setting tabIndex makes the div focusable - // setting outline to 0 prevents a border on focus in Mozilla - .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { - if (options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && - event.keyCode === $.ui.keyCode.ESCAPE) { - - self.close(event); + this.handle = this.handles.eq( 0 ); + + this.handles.add( this.range ).filter( "a" ) + .click(function( event ) { + event.preventDefault(); + }) + .mouseenter(function() { + if ( !o.disabled ) { + $( this ).addClass( "ui-state-hover" ); + } + }) + .mouseleave(function() { + $( this ).removeClass( "ui-state-hover" ); + }) + .focus(function() { + if ( !o.disabled ) { + $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); + $( this ).addClass( "ui-state-focus" ); + } else { + $( this ).blur(); + } + }) + .blur(function() { + $( this ).removeClass( "ui-state-focus" ); + }); + + this.handles.each(function( i ) { + $( this ).data( "ui-slider-handle-index", i ); + }); + + this._on( this.handles, { + keydown: function( event ) { + var allowed, curVal, newVal, step, + index = $( event.target ).data( "ui-slider-handle-index" ); + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_UP: + case $.ui.keyCode.PAGE_DOWN: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: event.preventDefault(); - } - }) - .attr({ - role: 'dialog', - 'aria-labelledby': titleId - }) - .mousedown(function(event) { - self.moveToTop(false, event); - }), + if ( !this._keySliding ) { + this._keySliding = true; + $( event.target ).addClass( "ui-state-active" ); + allowed = this._start( event, index ); + if ( allowed === false ) { + return; + } + } + break; + } - uiDialogContent = self.element - .show() - .removeAttr('title') - .addClass( - 'ui-dialog-content ' + - 'ui-widget-content') - .appendTo(uiDialog), - - uiDialogTitlebar = (self.uiDialogTitlebar = $('
        ')) - .addClass( - 'ui-dialog-titlebar ' + - 'ui-widget-header ' + - 'ui-corner-all ' + - 'ui-helper-clearfix' - ) - .prependTo(uiDialog), - - uiDialogTitlebarClose = $('') - .addClass( - 'ui-dialog-titlebar-close ' + - 'ui-corner-all' - ) - .attr('role', 'button') - .hover( - function() { - uiDialogTitlebarClose.addClass('ui-state-hover'); - }, - function() { - uiDialogTitlebarClose.removeClass('ui-state-hover'); - } - ) - .focus(function() { - uiDialogTitlebarClose.addClass('ui-state-focus'); - }) - .blur(function() { - uiDialogTitlebarClose.removeClass('ui-state-focus'); - }) - .click(function(event) { - self.close(event); - return false; - }) - .appendTo(uiDialogTitlebar), + step = this.options.step; + if ( this.options.values && this.options.values.length ) { + curVal = newVal = this.values( index ); + } else { + curVal = newVal = this.value(); + } - uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('')) - .addClass( - 'ui-icon ' + - 'ui-icon-closethick' - ) - .text(options.closeText) - .appendTo(uiDialogTitlebarClose), + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + newVal = this._valueMin(); + break; + case $.ui.keyCode.END: + newVal = this._valueMax(); + break; + case $.ui.keyCode.PAGE_UP: + newVal = this._trimAlignValue( curVal + ( (this._valueMax() - this._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.PAGE_DOWN: + newVal = this._trimAlignValue( curVal - ( (this._valueMax() - this._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if ( curVal === this._valueMax() ) { + return; + } + newVal = this._trimAlignValue( curVal + step ); + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if ( curVal === this._valueMin() ) { + return; + } + newVal = this._trimAlignValue( curVal - step ); + break; + } - uiDialogTitle = $('') - .addClass('ui-dialog-title') - .attr('id', titleId) - .html(title) - .prependTo(uiDialogTitlebar); + this._slide( event, index, newVal ); + }, + keyup: function( event ) { + var index = $( event.target ).data( "ui-slider-handle-index" ); + + if ( this._keySliding ) { + this._keySliding = false; + this._stop( event, index ); + this._change( event, index ); + $( event.target ).removeClass( "ui-state-active" ); + } + } + }); - //handling of deprecated beforeclose (vs beforeClose) option - //Ticket #4669 http://dev.jqueryui.com/ticket/4669 - //TODO: remove in 1.9pre - if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { - options.beforeClose = options.beforeclose; - } + this._refreshValue(); - uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + this._animateOff = false; + }, - if (options.draggable && $.fn.draggable) { - self._makeDraggable(); - } - if (options.resizable && $.fn.resizable) { - self._makeResizable(); - } + _destroy: function() { + this.handles.remove(); + this.range.remove(); - self._createButtons(options.buttons); - self._isOpen = false; + this.element + .removeClass( "ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-slider-disabled" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ); - if ($.fn.bgiframe) { - uiDialog.bgiframe(); - } + this._mouseDestroy(); }, - _init: function() { - if ( this.options.autoOpen ) { - this.open(); + _mouseCapture: function( event ) { + var position, normValue, distance, closestHandle, index, allowed, offset, mouseOverHandle, + that = this, + o = this.options; + + if ( o.disabled ) { + return false; } - }, - destroy: function() { - var self = this; - - if (self.overlay) { - self.overlay.destroy(); + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + position = { x: event.pageX, y: event.pageY }; + normValue = this._normValueFromMouse( position ); + distance = this._valueMax() - this._valueMin() + 1; + this.handles.each(function( i ) { + var thisDistance = Math.abs( normValue - that.values(i) ); + if ( distance > thisDistance ) { + distance = thisDistance; + closestHandle = $( this ); + index = i; + } + }); + + // workaround for bug #3736 (if both handles of a range are at 0, + // the first is always used as the one with least distance, + // and moving it is obviously prevented by preventing negative ranges) + if( o.range === true && this.values(1) === o.min ) { + index += 1; + closestHandle = $( this.handles[index] ); } - self.uiDialog.hide(); - self.element - .unbind('.dialog') - .removeData('dialog') - .removeClass('ui-dialog-content ui-widget-content') - .hide().appendTo('body'); - self.uiDialog.remove(); - if (self.originalTitle) { - self.element.attr('title', self.originalTitle); + allowed = this._start( event, index ); + if ( allowed === false ) { + return false; } + this._mouseSliding = true; + + this._handleIndex = index; + + closestHandle + .addClass( "ui-state-active" ) + .focus(); + + offset = closestHandle.offset(); + mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - ( closestHandle.width() / 2 ), + top: event.pageY - offset.top - + ( closestHandle.height() / 2 ) - + ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - + ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + + ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) + }; - return self; + if ( !this.handles.hasClass( "ui-state-hover" ) ) { + this._slide( event, index, normValue ); + } + this._animateOff = true; + return true; }, - widget: function() { - return this.uiDialog; + _mouseStart: function() { + return true; }, - close: function(event) { - var self = this, - maxZ, thisZ; - - if (false === self._trigger('beforeClose', event)) { - return; - } + _mouseDrag: function( event ) { + var position = { x: event.pageX, y: event.pageY }, + normValue = this._normValueFromMouse( position ); - if (self.overlay) { - self.overlay.destroy(); - } - self.uiDialog.unbind('keypress.ui-dialog'); + this._slide( event, this._handleIndex, normValue ); - self._isOpen = false; + return false; + }, - if (self.options.hide) { - self.uiDialog.hide(self.options.hide, function() { - self._trigger('close', event); - }); - } else { - self.uiDialog.hide(); - self._trigger('close', event); - } + _mouseStop: function( event ) { + this.handles.removeClass( "ui-state-active" ); + this._mouseSliding = false; - $.ui.dialog.overlay.resize(); + this._stop( event, this._handleIndex ); + this._change( event, this._handleIndex ); - // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) - if (self.options.modal) { - maxZ = 0; - $('.ui-dialog').each(function() { - if (this !== self.uiDialog[0]) { - thisZ = $(this).css('z-index'); - if(!isNaN(thisZ)) { - maxZ = Math.max(maxZ, thisZ); - } - } - }); - $.ui.dialog.maxZ = maxZ; - } + this._handleIndex = null; + this._clickOffset = null; + this._animateOff = false; - return self; + return false; }, - isOpen: function() { - return this._isOpen; + _detectOrientation: function() { + this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; }, - // the force parameter allows us to move modal dialogs to their correct - // position on open - moveToTop: function(force, event) { - var self = this, - options = self.options, - saveScroll; + _normValueFromMouse: function( position ) { + var pixelTotal, + pixelMouse, + percentMouse, + valueTotal, + valueMouse; - if ((options.modal && !force) || - (!options.stack && !options.modal)) { - return self._trigger('focus', event); + if ( this.orientation === "horizontal" ) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); } - if (options.zIndex > $.ui.dialog.maxZ) { - $.ui.dialog.maxZ = options.zIndex; + percentMouse = ( pixelMouse / pixelTotal ); + if ( percentMouse > 1 ) { + percentMouse = 1; } - if (self.overlay) { - $.ui.dialog.maxZ += 1; - self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); + if ( percentMouse < 0 ) { + percentMouse = 0; + } + if ( this.orientation === "vertical" ) { + percentMouse = 1 - percentMouse; } - //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. - // http://ui.jquery.com/bugs/ticket/3193 - saveScroll = { scrollTop: self.element.scrollTop(), scrollLeft: self.element.scrollLeft() }; - $.ui.dialog.maxZ += 1; - self.uiDialog.css('z-index', $.ui.dialog.maxZ); - self.element.attr(saveScroll); - self._trigger('focus', event); + valueTotal = this._valueMax() - this._valueMin(); + valueMouse = this._valueMin() + percentMouse * valueTotal; - return self; + return this._trimAlignValue( valueMouse ); }, - open: function() { - if (this._isOpen) { return; } - - var self = this, - options = self.options, - uiDialog = self.uiDialog; + _start: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + return this._trigger( "start", event, uiHash ); + }, - self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; - self._size(); - self._position(options.position); - uiDialog.show(options.show); - self.moveToTop(true); + _slide: function( event, index, newVal ) { + var otherVal, + newValues, + allowed; - // prevent tabbing out of modal dialogs - if (options.modal) { - uiDialog.bind('keypress.ui-dialog', function(event) { - if (event.keyCode !== $.ui.keyCode.TAB) { - return; - } + if ( this.options.values && this.options.values.length ) { + otherVal = this.values( index ? 0 : 1 ); - var tabbables = $(':tabbable', this), - first = tabbables.filter(':first'), - last = tabbables.filter(':last'); + if ( ( this.options.values.length === 2 && this.options.range === true ) && + ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) + ) { + newVal = otherVal; + } - if (event.target === last[0] && !event.shiftKey) { - first.focus(1); - return false; - } else if (event.target === first[0] && event.shiftKey) { - last.focus(1); - return false; + if ( newVal !== this.values( index ) ) { + newValues = this.values(); + newValues[ index ] = newVal; + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal, + values: newValues + } ); + otherVal = this.values( index ? 0 : 1 ); + if ( allowed !== false ) { + this.values( index, newVal, true ); } - }); - } - - // set focus to the first tabbable element in the content area or the first button - // if there are no tabbable elements, set focus on the dialog itself - $(self.element.find(':tabbable').get().concat( - uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( - uiDialog.get()))).eq(0).focus(); - - self._isOpen = true; - self._trigger('open'); - - return self; - }, - - _createButtons: function(buttons) { - var self = this, - hasButtons = false, - uiDialogButtonPane = $('
        ') - .addClass( - 'ui-dialog-buttonpane ' + - 'ui-widget-content ' + - 'ui-helper-clearfix' - ), - uiButtonSet = $( "
        " ) - .addClass( "ui-dialog-buttonset" ) - .appendTo( uiDialogButtonPane ); - - // if we already have a button pane, remove it - self.uiDialog.find('.ui-dialog-buttonpane').remove(); - - if (typeof buttons === 'object' && buttons !== null) { - $.each(buttons, function() { - return !(hasButtons = true); - }); - } - if (hasButtons) { - $.each(buttons, function(name, props) { - props = $.isFunction( props ) ? - { click: props, text: name } : - props; - var button = $('') - .click(function() { - props.click.apply(self.element[0], arguments); - }) - .appendTo(uiButtonSet); - // can't use .attr( props, true ) with jQuery 1.3.2. - $.each( props, function( key, value ) { - if ( key === "click" ) { - return; - } - if ( key in attrFn ) { - button[ key ]( value ); - } else { - button.attr( key, value ); - } - }); - if ($.fn.button) { - button.button(); + } + } else { + if ( newVal !== this.value() ) { + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal + } ); + if ( allowed !== false ) { + this.value( newVal ); } - }); - uiDialogButtonPane.appendTo(self.uiDialog); + } } }, - _makeDraggable: function() { - var self = this, - options = self.options, - doc = $(document), - heightBeforeDrag; - - function filteredUi(ui) { - return { - position: ui.position, - offset: ui.offset - }; + _stop: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); } - self.uiDialog.draggable({ - cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', - handle: '.ui-dialog-titlebar', - containment: 'document', - start: function(event, ui) { - heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); - $(this).height($(this).height()).addClass("ui-dialog-dragging"); - self._trigger('dragStart', event, filteredUi(ui)); - }, - drag: function(event, ui) { - self._trigger('drag', event, filteredUi(ui)); - }, - stop: function(event, ui) { - options.position = [ui.position.left - doc.scrollLeft(), - ui.position.top - doc.scrollTop()]; - $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); - self._trigger('dragStop', event, filteredUi(ui)); - $.ui.dialog.overlay.resize(); - } - }); + this._trigger( "stop", event, uiHash ); }, - _makeResizable: function(handles) { - handles = (handles === undefined ? this.options.resizable : handles); - var self = this, - options = self.options, - // .ui-resizable has position: relative defined in the stylesheet - // but dialogs have to use absolute or fixed positioning - position = self.uiDialog.css('position'), - resizeHandles = (typeof handles === 'string' ? - handles : - 'n,e,s,w,se,sw,ne,nw' - ); - - function filteredUi(ui) { - return { - originalPosition: ui.originalPosition, - originalSize: ui.originalSize, - position: ui.position, - size: ui.size + _change: function( event, index ) { + if ( !this._keySliding && !this._mouseSliding ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() }; - } - - self.uiDialog.resizable({ - cancel: '.ui-dialog-content', - containment: 'document', - alsoResize: self.element, - maxWidth: options.maxWidth, - maxHeight: options.maxHeight, - minWidth: options.minWidth, - minHeight: self._minHeight(), - handles: resizeHandles, - start: function(event, ui) { - $(this).addClass("ui-dialog-resizing"); - self._trigger('resizeStart', event, filteredUi(ui)); - }, - resize: function(event, ui) { - self._trigger('resize', event, filteredUi(ui)); - }, - stop: function(event, ui) { - $(this).removeClass("ui-dialog-resizing"); - options.height = $(this).height(); - options.width = $(this).width(); - self._trigger('resizeStop', event, filteredUi(ui)); - $.ui.dialog.overlay.resize(); + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); } - }) - .css('position', position) - .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); - }, - - _minHeight: function() { - var options = this.options; - if (options.height === 'auto') { - return options.minHeight; - } else { - return Math.min(options.minHeight, options.height); + this._trigger( "change", event, uiHash ); } }, - _position: function(position) { - var myAt = [], - offset = [0, 0], - isVisible; - - if (position) { - // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( - // if (typeof position == 'string' || $.isArray(position)) { - // myAt = $.isArray(position) ? position : position.split(' '); - - if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { - myAt = position.split ? position.split(' ') : [position[0], position[1]]; - if (myAt.length === 1) { - myAt[1] = myAt[0]; - } + value: function( newValue ) { + if ( arguments.length ) { + this.options.value = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, 0 ); + return; + } - $.each(['left', 'top'], function(i, offsetPosition) { - if (+myAt[i] === myAt[i]) { - offset[i] = myAt[i]; - myAt[i] = offsetPosition; - } - }); + return this._value(); + }, - position = { - my: myAt.join(" "), - at: myAt.join(" "), - offset: offset.join(" ") - }; - } + values: function( index, newValue ) { + var vals, + newValues, + i; - position = $.extend({}, $.ui.dialog.prototype.options.position, position); - } else { - position = $.ui.dialog.prototype.options.position; + if ( arguments.length > 1 ) { + this.options.values[ index ] = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, index ); + return; } - // need to show the dialog to get the actual offset in the position plugin - isVisible = this.uiDialog.is(':visible'); - if (!isVisible) { - this.uiDialog.show(); - } - this.uiDialog - // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 - .css({ top: 0, left: 0 }) - .position($.extend({ of: window }, position)); - if (!isVisible) { - this.uiDialog.hide(); + if ( arguments.length ) { + if ( $.isArray( arguments[ 0 ] ) ) { + vals = this.options.values; + newValues = arguments[ 0 ]; + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( newValues[ i ] ); + this._change( null, i ); + } + this._refreshValue(); + } else { + if ( this.options.values && this.options.values.length ) { + return this._values( index ); + } else { + return this.value(); + } + } + } else { + return this._values(); } }, - _setOptions: function( options ) { - var self = this, - resizableOptions = {}, - resize = false; - - $.each( options, function( key, value ) { - self._setOption( key, value ); - - if ( key in sizeRelatedOptions ) { - resize = true; - } - if ( key in resizableRelatedOptions ) { - resizableOptions[ key ] = value; - } - }); + _setOption: function( key, value ) { + var i, + valsLength = 0; - if ( resize ) { - this._size(); - } - if ( this.uiDialog.is( ":data(resizable)" ) ) { - this.uiDialog.resizable( "option", resizableOptions ); + if ( $.isArray( this.options.values ) ) { + valsLength = this.options.values.length; } - }, - _setOption: function(key, value){ - var self = this, - uiDialog = self.uiDialog; - - switch (key) { - //handling of deprecated beforeclose (vs beforeClose) option - //Ticket #4669 http://dev.jqueryui.com/ticket/4669 - //TODO: remove in 1.9pre - case "beforeclose": - key = "beforeClose"; - break; - case "buttons": - self._createButtons(value); - break; - case "closeText": - // ensure that we always pass a string - self.uiDialogTitlebarCloseText.text("" + value); - break; - case "dialogClass": - uiDialog - .removeClass(self.options.dialogClass) - .addClass(uiDialogClasses + value); - break; + $.Widget.prototype._setOption.apply( this, arguments ); + + switch ( key ) { case "disabled": - if (value) { - uiDialog.addClass('ui-dialog-disabled'); + if ( value ) { + this.handles.filter( ".ui-state-focus" ).blur(); + this.handles.removeClass( "ui-state-hover" ); + this.handles.prop( "disabled", true ); + this.element.addClass( "ui-disabled" ); } else { - uiDialog.removeClass('ui-dialog-disabled'); + this.handles.prop( "disabled", false ); + this.element.removeClass( "ui-disabled" ); } break; - case "draggable": - var isDraggable = uiDialog.is( ":data(draggable)" ); - if ( isDraggable && !value ) { - uiDialog.draggable( "destroy" ); - } - - if ( !isDraggable && value ) { - self._makeDraggable(); - } + case "orientation": + this._detectOrientation(); + this.element + .removeClass( "ui-slider-horizontal ui-slider-vertical" ) + .addClass( "ui-slider-" + this.orientation ); + this._refreshValue(); break; - case "position": - self._position(value); + case "value": + this._animateOff = true; + this._refreshValue(); + this._change( null, 0 ); + this._animateOff = false; break; - case "resizable": - // currently resizable, becoming non-resizable - var isResizable = uiDialog.is( ":data(resizable)" ); - if (isResizable && !value) { - uiDialog.resizable('destroy'); - } - - // currently resizable, changing handles - if (isResizable && typeof value === 'string') { - uiDialog.resizable('option', 'handles', value); - } - - // currently non-resizable, becoming resizable - if (!isResizable && value !== false) { - self._makeResizable(value); + case "values": + this._animateOff = true; + this._refreshValue(); + for ( i = 0; i < valsLength; i += 1 ) { + this._change( null, i ); } + this._animateOff = false; break; - case "title": - // convert whatever was passed in o a string, for html() to not throw up - $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); + case "min": + case "max": + this._animateOff = true; + this._refreshValue(); + this._animateOff = false; break; } + }, - $.Widget.prototype._setOption.apply(self, arguments); + //internal value getter + // _value() returns value trimmed by min and max, aligned by step + _value: function() { + var val = this.options.value; + val = this._trimAlignValue( val ); + + return val; }, - _size: function() { - /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content - * divs will both have width and height set, so we need to reset them - */ - var options = this.options, - nonContentHeight, - minContentHeight, - isVisible = this.uiDialog.is( ":visible" ); + //internal values getter + // _values() returns array of values trimmed by min and max, aligned by step + // _values( index ) returns single value trimmed by min and max, aligned by step + _values: function( index ) { + var val, + vals, + i; - // reset content sizing - this.element.show().css({ - width: 'auto', - minHeight: 0, - height: 0 - }); + if ( arguments.length ) { + val = this.options.values[ index ]; + val = this._trimAlignValue( val ); - if (options.minWidth > options.width) { - options.width = options.minWidth; + return val; + } else { + // .slice() creates a copy of the array + // this copy gets trimmed by min and max and then returned + vals = this.options.values.slice(); + for ( i = 0; i < vals.length; i+= 1) { + vals[ i ] = this._trimAlignValue( vals[ i ] ); + } + + return vals; } + }, - // reset wrapper sizing - // determine the height of all the non-content elements - nonContentHeight = this.uiDialog.css({ - height: 'auto', - width: options.width - }) - .height(); - minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); - - if ( options.height === "auto" ) { - // only needed for IE6 support - if ( $.support.minHeight ) { - this.element.css({ - minHeight: minContentHeight, - height: "auto" - }); - } else { - this.uiDialog.show(); - var autoHeight = this.element.css( "height", "auto" ).height(); - if ( !isVisible ) { - this.uiDialog.hide(); - } - this.element.height( Math.max( autoHeight, minContentHeight ) ); - } - } else { - this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); + // returns the step-aligned value that val is closest to, between (inclusive) min and max + _trimAlignValue: function( val ) { + if ( val <= this._valueMin() ) { + return this._valueMin(); + } + if ( val >= this._valueMax() ) { + return this._valueMax(); } + var step = ( this.options.step > 0 ) ? this.options.step : 1, + valModStep = (val - this._valueMin()) % step, + alignValue = val - valModStep; - if (this.uiDialog.is(':data(resizable)')) { - this.uiDialog.resizable('option', 'minHeight', this._minHeight()); + if ( Math.abs(valModStep) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); } - } -}); -$.extend($.ui.dialog, { - version: "1.8.16", + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat( alignValue.toFixed(5) ); + }, - uuid: 0, - maxZ: 0, + _valueMin: function() { + return this.options.min; + }, - getTitleId: function($el) { - var id = $el.attr('id'); - if (!id) { - this.uuid += 1; - id = this.uuid; - } - return 'ui-dialog-title-' + id; + _valueMax: function() { + return this.options.max; }, - overlay: function(dialog) { - this.$el = $.ui.dialog.overlay.create(dialog); - } -}); + _refreshValue: function() { + var lastValPercent, valPercent, value, valueMin, valueMax, + oRange = this.options.range, + o = this.options, + that = this, + animate = ( !this._animateOff ) ? o.animate : false, + _set = {}; -$.extend($.ui.dialog.overlay, { - instances: [], - // reuse old instances due to IE memory leak with alpha transparency (see #5185) - oldInstances: [], - maxZ: 0, - events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), - function(event) { return event + '.dialog-overlay'; }).join(' '), - create: function(dialog) { - if (this.instances.length === 0) { - // prevent use of anchors and inputs - // we use a setTimeout in case the overlay is created from an - // event that we're going to be cancelling (see #2804) - setTimeout(function() { - // handle $(el).dialog().dialog('close') (see #4065) - if ($.ui.dialog.overlay.instances.length) { - $(document).bind($.ui.dialog.overlay.events, function(event) { - // stop events if the z-index of the target is < the z-index of the overlay - // we cannot return true when we don't want to cancel the event (#3523) - if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { - return false; + if ( this.options.values && this.options.values.length ) { + this.handles.each(function( i ) { + valPercent = ( that.values(i) - that._valueMin() ) / ( that._valueMax() - that._valueMin() ) * 100; + _set[ that.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + if ( that.options.range === true ) { + if ( that.orientation === "horizontal" ) { + if ( i === 0 ) { + that.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); } - }); - } - }, 1); - - // allow closing by pressing the escape key - $(document).bind('keydown.dialog-overlay', function(event) { - if (dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && - event.keyCode === $.ui.keyCode.ESCAPE) { - - dialog.close(event); - event.preventDefault(); + if ( i === 1 ) { + that.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } else { + if ( i === 0 ) { + that.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); + } + if ( i === 1 ) { + that.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } } + lastValPercent = valPercent; }); + } else { + value = this.value(); + valueMin = this._valueMin(); + valueMax = this._valueMax(); + valPercent = ( valueMax !== valueMin ) ? + ( value - valueMin ) / ( valueMax - valueMin ) * 100 : + 0; + _set[ this.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); - // handle window resize - $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + if ( oRange === "min" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "horizontal" ) { + this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + if ( oRange === "min" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "vertical" ) { + this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } } + } - var $el = (this.oldInstances.pop() || $('
        ').addClass('ui-widget-overlay')) - .appendTo(document.body) - .css({ - width: this.width(), - height: this.height() - }); +}); - if ($.fn.bgiframe) { - $el.bgiframe(); - } +}(jQuery)); - this.instances.push($el); - return $el; - }, +(function( $ ) { - destroy: function($el) { - var indexOf = $.inArray($el, this.instances); - if (indexOf != -1){ - this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); +function modifier( fn ) { + return function() { + var previous = this.element.val(); + fn.apply( this, arguments ); + this._refresh(); + if ( previous !== this.element.val() ) { + this._trigger( "change" ); } + }; +} - if (this.instances.length === 0) { - $([document, window]).unbind('.dialog-overlay'); - } +$.widget( "ui.spinner", { + version: "1.9.2", + defaultElement: "", + widgetEventPrefix: "spin", + options: { + culture: null, + icons: { + down: "ui-icon-triangle-1-s", + up: "ui-icon-triangle-1-n" + }, + incremental: true, + max: null, + min: null, + numberFormat: null, + page: 10, + step: 1, - $el.remove(); - - // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) - var maxZ = 0; - $.each(this.instances, function() { - maxZ = Math.max(maxZ, this.css('z-index')); - }); - this.maxZ = maxZ; + change: null, + spin: null, + start: null, + stop: null }, - height: function() { - var scrollHeight, - offsetHeight; - // handle IE 6 - if ($.browser.msie && $.browser.version < 7) { - scrollHeight = Math.max( - document.documentElement.scrollHeight, - document.body.scrollHeight - ); - offsetHeight = Math.max( - document.documentElement.offsetHeight, - document.body.offsetHeight - ); + _create: function() { + // handle string values that need to be parsed + this._setOption( "max", this.options.max ); + this._setOption( "min", this.options.min ); + this._setOption( "step", this.options.step ); - if (scrollHeight < offsetHeight) { - return $(window).height() + 'px'; - } else { - return scrollHeight + 'px'; + // format the value, but don't constrain + this._value( this.element.val(), true ); + + this._draw(); + this._on( this._events ); + this._refresh(); + + // turning off autocomplete prevents the browser from remembering the + // value when navigating through history, so we re-enable autocomplete + // if the page is unloaded before the widget is destroyed. #7790 + this._on( this.window, { + beforeunload: function() { + this.element.removeAttr( "autocomplete" ); } - // handle "good" browsers - } else { - return $(document).height() + 'px'; - } + }); }, - width: function() { - var scrollWidth, - offsetWidth; - // handle IE - if ( $.browser.msie ) { - scrollWidth = Math.max( - document.documentElement.scrollWidth, - document.body.scrollWidth - ); - offsetWidth = Math.max( - document.documentElement.offsetWidth, - document.body.offsetWidth - ); + _getCreateOptions: function() { + var options = {}, + element = this.element; - if (scrollWidth < offsetWidth) { - return $(window).width() + 'px'; - } else { - return scrollWidth + 'px'; + $.each( [ "min", "max", "step" ], function( i, option ) { + var value = element.attr( option ); + if ( value !== undefined && value.length ) { + options[ option ] = value; } - // handle "good" browsers - } else { - return $(document).width() + 'px'; - } + }); + + return options; }, - resize: function() { - /* If the dialog is draggable and the user drags it past the - * right edge of the window, the document becomes wider so we - * need to stretch the overlay. If the user then drags the - * dialog back to the left, the document will become narrower, - * so we need to shrink the overlay to the appropriate size. - * This is handled by shrinking the overlay before setting it - * to the full document size. - */ - var $overlays = $([]); - $.each($.ui.dialog.overlay.instances, function() { - $overlays = $overlays.add(this); - }); + _events: { + keydown: function( event ) { + if ( this._start( event ) && this._keydown( event ) ) { + event.preventDefault(); + } + }, + keyup: "_stop", + focus: function() { + this.previous = this.element.val(); + }, + blur: function( event ) { + if ( this.cancelBlur ) { + delete this.cancelBlur; + return; + } - $overlays.css({ - width: 0, - height: 0 - }).css({ - width: $.ui.dialog.overlay.width(), - height: $.ui.dialog.overlay.height() - }); - } -}); + this._refresh(); + if ( this.previous !== this.element.val() ) { + this._trigger( "change", event ); + } + }, + mousewheel: function( event, delta ) { + if ( !delta ) { + return; + } + if ( !this.spinning && !this._start( event ) ) { + return false; + } -$.extend($.ui.dialog.overlay.prototype, { - destroy: function() { - $.ui.dialog.overlay.destroy(this.$el); - } -}); + this._spin( (delta > 0 ? 1 : -1) * this.options.step, event ); + clearTimeout( this.mousewheelTimer ); + this.mousewheelTimer = this._delay(function() { + if ( this.spinning ) { + this._stop( event ); + } + }, 100 ); + event.preventDefault(); + }, + "mousedown .ui-spinner-button": function( event ) { + var previous; + + // We never want the buttons to have focus; whenever the user is + // interacting with the spinner, the focus should be on the input. + // If the input is focused then this.previous is properly set from + // when the input first received focus. If the input is not focused + // then we need to set this.previous based on the value before spinning. + previous = this.element[0] === this.document[0].activeElement ? + this.previous : this.element.val(); + function checkFocus() { + var isActive = this.element[0] === this.document[0].activeElement; + if ( !isActive ) { + this.element.focus(); + this.previous = previous; + // support: IE + // IE sets focus asynchronously, so we need to check if focus + // moved off of the input because the user clicked on the button. + this._delay(function() { + this.previous = previous; + }); + } + } -}(jQuery)); -/* - * jQuery UI Position 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Position - */ -(function( $, undefined ) { + // ensure focus is on (or stays on) the text field + event.preventDefault(); + checkFocus.call( this ); + + // support: IE + // IE doesn't prevent moving focus even with event.preventDefault() + // so we set a flag to know when we should ignore the blur event + // and check (again) if focus moved off of the input. + this.cancelBlur = true; + this._delay(function() { + delete this.cancelBlur; + checkFocus.call( this ); + }); -$.ui = $.ui || {}; + if ( this._start( event ) === false ) { + return; + } -var horizontalPositions = /left|center|right/, - verticalPositions = /top|center|bottom/, - center = "center", - _position = $.fn.position, - _offset = $.fn.offset; + this._repeat( null, $( event.currentTarget ).hasClass( "ui-spinner-up" ) ? 1 : -1, event ); + }, + "mouseup .ui-spinner-button": "_stop", + "mouseenter .ui-spinner-button": function( event ) { + // button will add ui-state-active if mouse was down while mouseleave and kept down + if ( !$( event.currentTarget ).hasClass( "ui-state-active" ) ) { + return; + } -$.fn.position = function( options ) { - if ( !options || !options.of ) { - return _position.apply( this, arguments ); - } + if ( this._start( event ) === false ) { + return false; + } + this._repeat( null, $( event.currentTarget ).hasClass( "ui-spinner-up" ) ? 1 : -1, event ); + }, + // TODO: do we really want to consider this a stop? + // shouldn't we just stop the repeater and wait until mouseup before + // we trigger the stop event? + "mouseleave .ui-spinner-button": "_stop" + }, - // make a copy, we don't want to modify arguments - options = $.extend( {}, options ); + _draw: function() { + var uiSpinner = this.uiSpinner = this.element + .addClass( "ui-spinner-input" ) + .attr( "autocomplete", "off" ) + .wrap( this._uiSpinnerHtml() ) + .parent() + // add buttons + .append( this._buttonHtml() ); - var target = $( options.of ), - targetElem = target[0], - collision = ( options.collision || "flip" ).split( " " ), - offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], - targetWidth, - targetHeight, - basePosition; + this.element.attr( "role", "spinbutton" ); - if ( targetElem.nodeType === 9 ) { - targetWidth = target.width(); - targetHeight = target.height(); - basePosition = { top: 0, left: 0 }; - // TODO: use $.isWindow() in 1.9 - } else if ( targetElem.setTimeout ) { - targetWidth = target.width(); - targetHeight = target.height(); - basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; - } else if ( targetElem.preventDefault ) { - // force left top to allow flipping - options.at = "left top"; - targetWidth = targetHeight = 0; - basePosition = { top: options.of.pageY, left: options.of.pageX }; - } else { - targetWidth = target.outerWidth(); - targetHeight = target.outerHeight(); - basePosition = target.offset(); - } + // button bindings + this.buttons = uiSpinner.find( ".ui-spinner-button" ) + .attr( "tabIndex", -1 ) + .button() + .removeClass( "ui-corner-all" ); - // force my and at to have valid horizontal and veritcal positions - // if a value is missing or invalid, it will be converted to center - $.each( [ "my", "at" ], function() { - var pos = ( options[this] || "" ).split( " " ); - if ( pos.length === 1) { - pos = horizontalPositions.test( pos[0] ) ? - pos.concat( [center] ) : - verticalPositions.test( pos[0] ) ? - [ center ].concat( pos ) : - [ center, center ]; - } - pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; - pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; - options[ this ] = pos; - }); + // IE 6 doesn't understand height: 50% for the buttons + // unless the wrapper has an explicit height + if ( this.buttons.height() > Math.ceil( uiSpinner.height() * 0.5 ) && + uiSpinner.height() > 0 ) { + uiSpinner.height( uiSpinner.height() ); + } - // normalize collision option - if ( collision.length === 1 ) { - collision[ 1 ] = collision[ 0 ]; - } + // disable spinner if element was already disabled + if ( this.options.disabled ) { + this.disable(); + } + }, - // normalize offset option - offset[ 0 ] = parseInt( offset[0], 10 ) || 0; - if ( offset.length === 1 ) { - offset[ 1 ] = offset[ 0 ]; - } - offset[ 1 ] = parseInt( offset[1], 10 ) || 0; + _keydown: function( event ) { + var options = this.options, + keyCode = $.ui.keyCode; - if ( options.at[0] === "right" ) { - basePosition.left += targetWidth; - } else if ( options.at[0] === center ) { - basePosition.left += targetWidth / 2; - } + switch ( event.keyCode ) { + case keyCode.UP: + this._repeat( null, 1, event ); + return true; + case keyCode.DOWN: + this._repeat( null, -1, event ); + return true; + case keyCode.PAGE_UP: + this._repeat( null, options.page, event ); + return true; + case keyCode.PAGE_DOWN: + this._repeat( null, -options.page, event ); + return true; + } - if ( options.at[1] === "bottom" ) { - basePosition.top += targetHeight; - } else if ( options.at[1] === center ) { - basePosition.top += targetHeight / 2; - } + return false; + }, - basePosition.left += offset[ 0 ]; - basePosition.top += offset[ 1 ]; + _uiSpinnerHtml: function() { + return ""; + }, - return this.each(function() { - var elem = $( this ), - elemWidth = elem.outerWidth(), - elemHeight = elem.outerHeight(), - marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, - marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, - collisionWidth = elemWidth + marginLeft + - ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ), - collisionHeight = elemHeight + marginTop + - ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ), - position = $.extend( {}, basePosition ), - collisionPosition; + _buttonHtml: function() { + return "" + + "" + + ""; + }, - if ( options.my[0] === "right" ) { - position.left -= elemWidth; - } else if ( options.my[0] === center ) { - position.left -= elemWidth / 2; + _start: function( event ) { + if ( !this.spinning && this._trigger( "start", event ) === false ) { + return false; } - if ( options.my[1] === "bottom" ) { - position.top -= elemHeight; - } else if ( options.my[1] === center ) { - position.top -= elemHeight / 2; + if ( !this.counter ) { + this.counter = 1; } + this.spinning = true; + return true; + }, - // prevent fractions (see #5280) - position.left = Math.round( position.left ); - position.top = Math.round( position.top ); + _repeat: function( i, steps, event ) { + i = i || 500; - collisionPosition = { - left: position.left - marginLeft, - top: position.top - marginTop - }; + clearTimeout( this.timer ); + this.timer = this._delay(function() { + this._repeat( 40, steps, event ); + }, i ); - $.each( [ "left", "top" ], function( i, dir ) { - if ( $.ui.position[ collision[i] ] ) { - $.ui.position[ collision[i] ][ dir ]( position, { - targetWidth: targetWidth, - targetHeight: targetHeight, - elemWidth: elemWidth, - elemHeight: elemHeight, - collisionPosition: collisionPosition, - collisionWidth: collisionWidth, - collisionHeight: collisionHeight, - offset: offset, - my: options.my, - at: options.at - }); - } - }); + this._spin( steps * this.options.step, event ); + }, - if ( $.fn.bgiframe ) { - elem.bgiframe(); + _spin: function( step, event ) { + var value = this.value() || 0; + + if ( !this.counter ) { + this.counter = 1; } - elem.offset( $.extend( position, { using: options.using } ) ); - }); -}; -$.ui.position = { - fit: { - left: function( position, data ) { - var win = $( window ), - over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); - position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); - }, - top: function( position, data ) { - var win = $( window ), - over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); - position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); + value = this._adjustValue( value + step * this._increment( this.counter ) ); + + if ( !this.spinning || this._trigger( "spin", event, { value: value } ) !== false) { + this._value( value ); + this.counter++; } }, - flip: { - left: function( position, data ) { - if ( data.at[0] === center ) { - return; - } - var win = $( window ), - over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), - myOffset = data.my[ 0 ] === "left" ? - -data.elemWidth : - data.my[ 0 ] === "right" ? - data.elemWidth : - 0, - atOffset = data.at[ 0 ] === "left" ? - data.targetWidth : - -data.targetWidth, - offset = -2 * data.offset[ 0 ]; - position.left += data.collisionPosition.left < 0 ? - myOffset + atOffset + offset : - over > 0 ? - myOffset + atOffset + offset : - 0; - }, - top: function( position, data ) { - if ( data.at[1] === center ) { - return; - } - var win = $( window ), - over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), - myOffset = data.my[ 1 ] === "top" ? - -data.elemHeight : - data.my[ 1 ] === "bottom" ? - data.elemHeight : - 0, - atOffset = data.at[ 1 ] === "top" ? - data.targetHeight : - -data.targetHeight, - offset = -2 * data.offset[ 1 ]; - position.top += data.collisionPosition.top < 0 ? - myOffset + atOffset + offset : - over > 0 ? - myOffset + atOffset + offset : - 0; + _increment: function( i ) { + var incremental = this.options.incremental; + + if ( incremental ) { + return $.isFunction( incremental ) ? + incremental( i ) : + Math.floor( i*i*i/50000 - i*i/500 + 17*i/200 + 1 ); } - } -}; -// offset setter from jQuery 1.4 -if ( !$.offset.setOffset ) { - $.offset.setOffset = function( elem, options ) { - // set position first, in-case top/left are set even on static elem - if ( /static/.test( $.curCSS( elem, "position" ) ) ) { - elem.style.position = "relative"; - } - var curElem = $( elem ), - curOffset = curElem.offset(), - curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, - curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, - props = { - top: (options.top - curOffset.top) + curTop, - left: (options.left - curOffset.left) + curLeft - }; - - if ( 'using' in options ) { - options.using.call( elem, props ); - } else { - curElem.css( props ); + return 1; + }, + + _precision: function() { + var precision = this._precisionOf( this.options.step ); + if ( this.options.min !== null ) { + precision = Math.max( precision, this._precisionOf( this.options.min ) ); } - }; + return precision; + }, - $.fn.offset = function( options ) { - var elem = this[ 0 ]; - if ( !elem || !elem.ownerDocument ) { return null; } - if ( options ) { - return this.each(function() { - $.offset.setOffset( this, options ); - }); + _precisionOf: function( num ) { + var str = num.toString(), + decimal = str.indexOf( "." ); + return decimal === -1 ? 0 : str.length - decimal - 1; + }, + + _adjustValue: function( value ) { + var base, aboveMin, + options = this.options; + + // make sure we're at a valid step + // - find out where we are relative to the base (min or 0) + base = options.min !== null ? options.min : 0; + aboveMin = value - base; + // - round to the nearest step + aboveMin = Math.round(aboveMin / options.step) * options.step; + // - rounding is based on 0, so adjust back to our base + value = base + aboveMin; + + // fix precision from bad JS floating point math + value = parseFloat( value.toFixed( this._precision() ) ); + + // clamp the value + if ( options.max !== null && value > options.max) { + return options.max; + } + if ( options.min !== null && value < options.min ) { + return options.min; } - return _offset.call( this ); - }; -} -}( jQuery )); -/* - * jQuery UI Progressbar 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Progressbar - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - */ -(function( $, undefined ) { + return value; + }, -$.widget( "ui.progressbar", { - options: { - value: 0, - max: 100 + _stop: function( event ) { + if ( !this.spinning ) { + return; + } + + clearTimeout( this.timer ); + clearTimeout( this.mousewheelTimer ); + this.counter = 0; + this.spinning = false; + this._trigger( "stop", event ); }, - min: 0, + _setOption: function( key, value ) { + if ( key === "culture" || key === "numberFormat" ) { + var prevValue = this._parse( this.element.val() ); + this.options[ key ] = value; + this.element.val( this._format( prevValue ) ); + return; + } - _create: function() { - this.element - .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) - .attr({ - role: "progressbar", - "aria-valuemin": this.min, - "aria-valuemax": this.options.max, - "aria-valuenow": this._value() - }); + if ( key === "max" || key === "min" || key === "step" ) { + if ( typeof value === "string" ) { + value = this._parse( value ); + } + } - this.valueDiv = $( "
        " ) - .appendTo( this.element ); + this._super( key, value ); - this.oldValue = this._value(); - this._refreshValue(); + if ( key === "disabled" ) { + if ( value ) { + this.element.prop( "disabled", true ); + this.buttons.button( "disable" ); + } else { + this.element.prop( "disabled", false ); + this.buttons.button( "enable" ); + } + } }, - destroy: function() { - this.element - .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) - .removeAttr( "role" ) - .removeAttr( "aria-valuemin" ) - .removeAttr( "aria-valuemax" ) - .removeAttr( "aria-valuenow" ); - - this.valueDiv.remove(); + _setOptions: modifier(function( options ) { + this._super( options ); + this._value( this.element.val() ); + }), - $.Widget.prototype.destroy.apply( this, arguments ); + _parse: function( val ) { + if ( typeof val === "string" && val !== "" ) { + val = window.Globalize && this.options.numberFormat ? + Globalize.parseFloat( val, 10, this.options.culture ) : +val; + } + return val === "" || isNaN( val ) ? null : val; }, - value: function( newValue ) { - if ( newValue === undefined ) { - return this._value(); + _format: function( value ) { + if ( value === "" ) { + return ""; } + return window.Globalize && this.options.numberFormat ? + Globalize.format( value, this.options.numberFormat, this.options.culture ) : + value; + }, - this._setOption( "value", newValue ); - return this; + _refresh: function() { + this.element.attr({ + "aria-valuemin": this.options.min, + "aria-valuemax": this.options.max, + // TODO: what should we do with values that can't be parsed? + "aria-valuenow": this._parse( this.element.val() ) + }); }, - _setOption: function( key, value ) { - if ( key === "value" ) { - this.options.value = value; - this._refreshValue(); - if ( this._value() === this.options.max ) { - this._trigger( "complete" ); + // update the value without triggering change + _value: function( value, allowAny ) { + var parsed; + if ( value !== "" ) { + parsed = this._parse( value ); + if ( parsed !== null ) { + if ( !allowAny ) { + parsed = this._adjustValue( parsed ); + } + value = this._format( parsed ); } } + this.element.val( value ); + this._refresh(); + }, - $.Widget.prototype._setOption.apply( this, arguments ); + _destroy: function() { + this.element + .removeClass( "ui-spinner-input" ) + .prop( "disabled", false ) + .removeAttr( "autocomplete" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + this.uiSpinner.replaceWith( this.element ); }, - _value: function() { - var val = this.options.value; - // normalize invalid value - if ( typeof val !== "number" ) { - val = 0; - } - return Math.min( this.options.max, Math.max( this.min, val ) ); + stepUp: modifier(function( steps ) { + this._stepUp( steps ); + }), + _stepUp: function( steps ) { + this._spin( (steps || 1) * this.options.step ); }, - _percentage: function() { - return 100 * this._value() / this.options.max; + stepDown: modifier(function( steps ) { + this._stepDown( steps ); + }), + _stepDown: function( steps ) { + this._spin( (steps || 1) * -this.options.step ); }, - _refreshValue: function() { - var value = this.value(); - var percentage = this._percentage(); + pageUp: modifier(function( pages ) { + this._stepUp( (pages || 1) * this.options.page ); + }), - if ( this.oldValue !== value ) { - this.oldValue = value; - this._trigger( "change" ); - } + pageDown: modifier(function( pages ) { + this._stepDown( (pages || 1) * this.options.page ); + }), - this.valueDiv - .toggle( value > this.min ) - .toggleClass( "ui-corner-right", value === this.options.max ) - .width( percentage.toFixed(0) + "%" ); - this.element.attr( "aria-valuenow", value ); + value: function( newVal ) { + if ( !arguments.length ) { + return this._parse( this.element.val() ); + } + modifier( this._value ).call( this, newVal ); + }, + + widget: function() { + return this.uiSpinner; } }); -$.extend( $.ui.progressbar, { - version: "1.8.16" -}); +}( jQuery ) ); -})( jQuery ); -/* - * jQuery UI Slider 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Slider - * - * Depends: - * jquery.ui.core.js - * jquery.ui.mouse.js - * jquery.ui.widget.js - */ (function( $, undefined ) { -// number of pages in a slider -// (how many times can you page up/down to go through the whole range) -var numPages = 5; +var tabId = 0, + rhash = /#.*$/; -$.widget( "ui.slider", $.ui.mouse, { +function getNextTabId() { + return ++tabId; +} - widgetEventPrefix: "slide", +function isLocal( anchor ) { + return anchor.hash.length > 1 && + anchor.href.replace( rhash, "" ) === + location.href.replace( rhash, "" ) + // support: Safari 5.1 + // Safari 5.1 doesn't encode spaces in window.location + // but it does encode spaces from anchors (#8777) + .replace( /\s/g, "%20" ); +} +$.widget( "ui.tabs", { + version: "1.9.2", + delay: 300, options: { - animate: false, - distance: 0, - max: 100, - min: 0, - orientation: "horizontal", - range: false, - step: 1, - value: 0, - values: null + active: null, + collapsible: false, + event: "click", + heightStyle: "content", + hide: null, + show: null, + + // callbacks + activate: null, + beforeActivate: null, + beforeLoad: null, + load: null }, _create: function() { - var self = this, - o = this.options, - existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ), - handle = "", - handleCount = ( o.values && o.values.length ) || 1, - handles = []; + var that = this, + options = this.options, + active = options.active, + locationHash = location.hash.substring( 1 ); - this._keySliding = false; - this._mouseSliding = false; - this._animateOff = true; - this._handleIndex = null; - this._detectOrientation(); - this._mouseInit(); + this.running = false; this.element - .addClass( "ui-slider" + - " ui-slider-" + this.orientation + - " ui-widget" + - " ui-widget-content" + - " ui-corner-all" + - ( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) ); - - this.range = $([]); - - if ( o.range ) { - if ( o.range === true ) { - if ( !o.values ) { - o.values = [ this._valueMin(), this._valueMin() ]; + .addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" ) + .toggleClass( "ui-tabs-collapsible", options.collapsible ) + // Prevent users from focusing disabled tabs via click + .delegate( ".ui-tabs-nav > li", "mousedown" + this.eventNamespace, function( event ) { + if ( $( this ).is( ".ui-state-disabled" ) ) { + event.preventDefault(); } - if ( o.values.length && o.values.length !== 2 ) { - o.values = [ o.values[0], o.values[0] ]; + }) + // support: IE <9 + // Preventing the default action in mousedown doesn't prevent IE + // from focusing the element, so if the anchor gets focused, blur. + // We don't have to worry about focusing the previously focused + // element since clicking on a non-focusable element should focus + // the body anyway. + .delegate( ".ui-tabs-anchor", "focus" + this.eventNamespace, function() { + if ( $( this ).closest( "li" ).is( ".ui-state-disabled" ) ) { + this.blur(); } + }); + + this._processTabs(); + + if ( active === null ) { + // check the fragment identifier in the URL + if ( locationHash ) { + this.tabs.each(function( i, tab ) { + if ( $( tab ).attr( "aria-controls" ) === locationHash ) { + active = i; + return false; + } + }); } - this.range = $( "
        " ) - .appendTo( this.element ) - .addClass( "ui-slider-range" + - // note: this isn't the most fittingly semantic framework class for this element, - // but worked best visually with a variety of themes - " ui-widget-header" + - ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) ); - } + // check for a tab marked active via a class + if ( active === null ) { + active = this.tabs.index( this.tabs.filter( ".ui-tabs-active" ) ); + } - for ( var i = existingHandles.length; i < handleCount; i += 1 ) { - handles.push( handle ); + // no active tab, set to false + if ( active === null || active === -1 ) { + active = this.tabs.length ? 0 : false; + } } - this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) ); + // handle numbers: negative, out of range + if ( active !== false ) { + active = this.tabs.index( this.tabs.eq( active ) ); + if ( active === -1 ) { + active = options.collapsible ? false : 0; + } + } + options.active = active; - this.handle = this.handles.eq( 0 ); + // don't allow collapsible: false and active: false + if ( !options.collapsible && options.active === false && this.anchors.length ) { + options.active = 0; + } - this.handles.add( this.range ).filter( "a" ) - .click(function( event ) { - event.preventDefault(); - }) - .hover(function() { - if ( !o.disabled ) { - $( this ).addClass( "ui-state-hover" ); - } - }, function() { - $( this ).removeClass( "ui-state-hover" ); - }) - .focus(function() { - if ( !o.disabled ) { - $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); - $( this ).addClass( "ui-state-focus" ); - } else { - $( this ).blur(); - } - }) - .blur(function() { - $( this ).removeClass( "ui-state-focus" ); - }); + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + if ( $.isArray( options.disabled ) ) { + options.disabled = $.unique( options.disabled.concat( + $.map( this.tabs.filter( ".ui-state-disabled" ), function( li ) { + return that.tabs.index( li ); + }) + ) ).sort(); + } - this.handles.each(function( i ) { - $( this ).data( "index.ui-slider-handle", i ); - }); + // check for length avoids error when initializing empty list + if ( this.options.active !== false && this.anchors.length ) { + this.active = this._findActive( this.options.active ); + } else { + this.active = $(); + } - this.handles - .keydown(function( event ) { - var ret = true, - index = $( this ).data( "index.ui-slider-handle" ), - allowed, - curVal, - newVal, - step; - - if ( self.options.disabled ) { - return; - } - - switch ( event.keyCode ) { - case $.ui.keyCode.HOME: - case $.ui.keyCode.END: - case $.ui.keyCode.PAGE_UP: - case $.ui.keyCode.PAGE_DOWN: - case $.ui.keyCode.UP: - case $.ui.keyCode.RIGHT: - case $.ui.keyCode.DOWN: - case $.ui.keyCode.LEFT: - ret = false; - if ( !self._keySliding ) { - self._keySliding = true; - $( this ).addClass( "ui-state-active" ); - allowed = self._start( event, index ); - if ( allowed === false ) { - return; - } - } - break; - } - - step = self.options.step; - if ( self.options.values && self.options.values.length ) { - curVal = newVal = self.values( index ); - } else { - curVal = newVal = self.value(); - } - - switch ( event.keyCode ) { - case $.ui.keyCode.HOME: - newVal = self._valueMin(); - break; - case $.ui.keyCode.END: - newVal = self._valueMax(); - break; - case $.ui.keyCode.PAGE_UP: - newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) ); - break; - case $.ui.keyCode.PAGE_DOWN: - newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) ); - break; - case $.ui.keyCode.UP: - case $.ui.keyCode.RIGHT: - if ( curVal === self._valueMax() ) { - return; - } - newVal = self._trimAlignValue( curVal + step ); - break; - case $.ui.keyCode.DOWN: - case $.ui.keyCode.LEFT: - if ( curVal === self._valueMin() ) { - return; - } - newVal = self._trimAlignValue( curVal - step ); - break; - } - - self._slide( event, index, newVal ); - - return ret; - - }) - .keyup(function( event ) { - var index = $( this ).data( "index.ui-slider-handle" ); - - if ( self._keySliding ) { - self._keySliding = false; - self._stop( event, index ); - self._change( event, index ); - $( this ).removeClass( "ui-state-active" ); - } - - }); + this._refresh(); - this._refreshValue(); + if ( this.active.length ) { + this.load( options.active ); + } + }, - this._animateOff = false; + _getCreateEventData: function() { + return { + tab: this.active, + panel: !this.active.length ? $() : this._getPanelForTab( this.active ) + }; }, - destroy: function() { - this.handles.remove(); - this.range.remove(); + _tabKeydown: function( event ) { + var focusedTab = $( this.document[0].activeElement ).closest( "li" ), + selectedIndex = this.tabs.index( focusedTab ), + goingForward = true; - this.element - .removeClass( "ui-slider" + - " ui-slider-horizontal" + - " ui-slider-vertical" + - " ui-slider-disabled" + - " ui-widget" + - " ui-widget-content" + - " ui-corner-all" ) - .removeData( "slider" ) - .unbind( ".slider" ); + if ( this._handlePageNav( event ) ) { + return; + } - this._mouseDestroy(); + switch ( event.keyCode ) { + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + selectedIndex++; + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.LEFT: + goingForward = false; + selectedIndex--; + break; + case $.ui.keyCode.END: + selectedIndex = this.anchors.length - 1; + break; + case $.ui.keyCode.HOME: + selectedIndex = 0; + break; + case $.ui.keyCode.SPACE: + // Activate only, no collapsing + event.preventDefault(); + clearTimeout( this.activating ); + this._activate( selectedIndex ); + return; + case $.ui.keyCode.ENTER: + // Toggle (cancel delayed activation, allow collapsing) + event.preventDefault(); + clearTimeout( this.activating ); + // Determine if we should collapse or activate + this._activate( selectedIndex === this.options.active ? false : selectedIndex ); + return; + default: + return; + } - return this; + // Focus the appropriate tab, based on which key was pressed + event.preventDefault(); + clearTimeout( this.activating ); + selectedIndex = this._focusNextTab( selectedIndex, goingForward ); + + // Navigating with control key will prevent automatic activation + if ( !event.ctrlKey ) { + // Update aria-selected immediately so that AT think the tab is already selected. + // Otherwise AT may confuse the user by stating that they need to activate the tab, + // but the tab will already be activated by the time the announcement finishes. + focusedTab.attr( "aria-selected", "false" ); + this.tabs.eq( selectedIndex ).attr( "aria-selected", "true" ); + + this.activating = this._delay(function() { + this.option( "active", selectedIndex ); + }, this.delay ); + } }, - _mouseCapture: function( event ) { - var o = this.options, - position, - normValue, - distance, - closestHandle, - self, - index, - allowed, - offset, - mouseOverHandle; + _panelKeydown: function( event ) { + if ( this._handlePageNav( event ) ) { + return; + } - if ( o.disabled ) { - return false; + // Ctrl+up moves focus to the current tab + if ( event.ctrlKey && event.keyCode === $.ui.keyCode.UP ) { + event.preventDefault(); + this.active.focus(); } + }, - this.elementSize = { - width: this.element.outerWidth(), - height: this.element.outerHeight() - }; - this.elementOffset = this.element.offset(); + // Alt+page up/down moves focus to the previous/next tab (and activates) + _handlePageNav: function( event ) { + if ( event.altKey && event.keyCode === $.ui.keyCode.PAGE_UP ) { + this._activate( this._focusNextTab( this.options.active - 1, false ) ); + return true; + } + if ( event.altKey && event.keyCode === $.ui.keyCode.PAGE_DOWN ) { + this._activate( this._focusNextTab( this.options.active + 1, true ) ); + return true; + } + }, - position = { x: event.pageX, y: event.pageY }; - normValue = this._normValueFromMouse( position ); - distance = this._valueMax() - this._valueMin() + 1; - self = this; - this.handles.each(function( i ) { - var thisDistance = Math.abs( normValue - self.values(i) ); - if ( distance > thisDistance ) { - distance = thisDistance; - closestHandle = $( this ); - index = i; + _findNextTab: function( index, goingForward ) { + var lastTabIndex = this.tabs.length - 1; + + function constrain() { + if ( index > lastTabIndex ) { + index = 0; } - }); + if ( index < 0 ) { + index = lastTabIndex; + } + return index; + } - // workaround for bug #3736 (if both handles of a range are at 0, - // the first is always used as the one with least distance, - // and moving it is obviously prevented by preventing negative ranges) - if( o.range === true && this.values(1) === o.min ) { - index += 1; - closestHandle = $( this.handles[index] ); + while ( $.inArray( constrain(), this.options.disabled ) !== -1 ) { + index = goingForward ? index + 1 : index - 1; } - allowed = this._start( event, index ); - if ( allowed === false ) { - return false; + return index; + }, + + _focusNextTab: function( index, goingForward ) { + index = this._findNextTab( index, goingForward ); + this.tabs.eq( index ).focus(); + return index; + }, + + _setOption: function( key, value ) { + if ( key === "active" ) { + // _activate() will handle invalid values and update this.options + this._activate( value ); + return; + } + + if ( key === "disabled" ) { + // don't use the widget factory's disabled handling + this._setupDisabled( value ); + return; } - this._mouseSliding = true; - self._handleIndex = index; + this._super( key, value); - closestHandle - .addClass( "ui-state-active" ) - .focus(); - - offset = closestHandle.offset(); - mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); - this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { - left: event.pageX - offset.left - ( closestHandle.width() / 2 ), - top: event.pageY - offset.top - - ( closestHandle.height() / 2 ) - - ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - - ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + - ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) - }; + if ( key === "collapsible" ) { + this.element.toggleClass( "ui-tabs-collapsible", value ); + // Setting collapsible: false while collapsed; open first panel + if ( !value && this.options.active === false ) { + this._activate( 0 ); + } + } - if ( !this.handles.hasClass( "ui-state-hover" ) ) { - this._slide( event, index, normValue ); + if ( key === "event" ) { + this._setupEvents( value ); } - this._animateOff = true; - return true; - }, - _mouseStart: function( event ) { - return true; + if ( key === "heightStyle" ) { + this._setupHeightStyle( value ); + } }, - _mouseDrag: function( event ) { - var position = { x: event.pageX, y: event.pageY }, - normValue = this._normValueFromMouse( position ); - - this._slide( event, this._handleIndex, normValue ); + _tabId: function( tab ) { + return tab.attr( "aria-controls" ) || "ui-tabs-" + getNextTabId(); + }, - return false; + _sanitizeSelector: function( hash ) { + return hash ? hash.replace( /[!"$%&'()*+,.\/:;<=>?@\[\]\^`{|}~]/g, "\\$&" ) : ""; }, - _mouseStop: function( event ) { - this.handles.removeClass( "ui-state-active" ); - this._mouseSliding = false; + refresh: function() { + var options = this.options, + lis = this.tablist.children( ":has(a[href])" ); - this._stop( event, this._handleIndex ); - this._change( event, this._handleIndex ); + // get disabled tabs from class attribute from HTML + // this will get converted to a boolean if needed in _refresh() + options.disabled = $.map( lis.filter( ".ui-state-disabled" ), function( tab ) { + return lis.index( tab ); + }); - this._handleIndex = null; - this._clickOffset = null; - this._animateOff = false; + this._processTabs(); + + // was collapsed or no tabs + if ( options.active === false || !this.anchors.length ) { + options.active = false; + this.active = $(); + // was active, but active tab is gone + } else if ( this.active.length && !$.contains( this.tablist[ 0 ], this.active[ 0 ] ) ) { + // all remaining tabs are disabled + if ( this.tabs.length === options.disabled.length ) { + options.active = false; + this.active = $(); + // activate previous tab + } else { + this._activate( this._findNextTab( Math.max( 0, options.active - 1 ), false ) ); + } + // was active, active tab still exists + } else { + // make sure active index is correct + options.active = this.tabs.index( this.active ); + } - return false; - }, - - _detectOrientation: function() { - this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; + this._refresh(); }, - _normValueFromMouse: function( position ) { - var pixelTotal, - pixelMouse, - percentMouse, - valueTotal, - valueMouse; + _refresh: function() { + this._setupDisabled( this.options.disabled ); + this._setupEvents( this.options.event ); + this._setupHeightStyle( this.options.heightStyle ); - if ( this.orientation === "horizontal" ) { - pixelTotal = this.elementSize.width; - pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + this.tabs.not( this.active ).attr({ + "aria-selected": "false", + tabIndex: -1 + }); + this.panels.not( this._getPanelForTab( this.active ) ) + .hide() + .attr({ + "aria-expanded": "false", + "aria-hidden": "true" + }); + + // Make sure one tab is in the tab order + if ( !this.active.length ) { + this.tabs.eq( 0 ).attr( "tabIndex", 0 ); } else { - pixelTotal = this.elementSize.height; - pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); + this.active + .addClass( "ui-tabs-active ui-state-active" ) + .attr({ + "aria-selected": "true", + tabIndex: 0 + }); + this._getPanelForTab( this.active ) + .show() + .attr({ + "aria-expanded": "true", + "aria-hidden": "false" + }); } + }, - percentMouse = ( pixelMouse / pixelTotal ); - if ( percentMouse > 1 ) { - percentMouse = 1; - } - if ( percentMouse < 0 ) { - percentMouse = 0; - } - if ( this.orientation === "vertical" ) { - percentMouse = 1 - percentMouse; - } + _processTabs: function() { + var that = this; - valueTotal = this._valueMax() - this._valueMin(); - valueMouse = this._valueMin() + percentMouse * valueTotal; + this.tablist = this._getList() + .addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ) + .attr( "role", "tablist" ); - return this._trimAlignValue( valueMouse ); - }, + this.tabs = this.tablist.find( "> li:has(a[href])" ) + .addClass( "ui-state-default ui-corner-top" ) + .attr({ + role: "tab", + tabIndex: -1 + }); - _start: function( event, index ) { - var uiHash = { - handle: this.handles[ index ], - value: this.value() - }; - if ( this.options.values && this.options.values.length ) { - uiHash.value = this.values( index ); - uiHash.values = this.values(); - } - return this._trigger( "start", event, uiHash ); - }, + this.anchors = this.tabs.map(function() { + return $( "a", this )[ 0 ]; + }) + .addClass( "ui-tabs-anchor" ) + .attr({ + role: "presentation", + tabIndex: -1 + }); - _slide: function( event, index, newVal ) { - var otherVal, - newValues, - allowed; + this.panels = $(); - if ( this.options.values && this.options.values.length ) { - otherVal = this.values( index ? 0 : 1 ); + this.anchors.each(function( i, anchor ) { + var selector, panel, panelId, + anchorId = $( anchor ).uniqueId().attr( "id" ), + tab = $( anchor ).closest( "li" ), + originalAriaControls = tab.attr( "aria-controls" ); - if ( ( this.options.values.length === 2 && this.options.range === true ) && - ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) - ) { - newVal = otherVal; + // inline tab + if ( isLocal( anchor ) ) { + selector = anchor.hash; + panel = that.element.find( that._sanitizeSelector( selector ) ); + // remote tab + } else { + panelId = that._tabId( tab ); + selector = "#" + panelId; + panel = that.element.find( selector ); + if ( !panel.length ) { + panel = that._createPanel( panelId ); + panel.insertAfter( that.panels[ i - 1 ] || that.tablist ); + } + panel.attr( "aria-live", "polite" ); } - if ( newVal !== this.values( index ) ) { - newValues = this.values(); - newValues[ index ] = newVal; - // A slide can be canceled by returning false from the slide callback - allowed = this._trigger( "slide", event, { - handle: this.handles[ index ], - value: newVal, - values: newValues - } ); - otherVal = this.values( index ? 0 : 1 ); - if ( allowed !== false ) { - this.values( index, newVal, true ); - } + if ( panel.length) { + that.panels = that.panels.add( panel ); } - } else { - if ( newVal !== this.value() ) { - // A slide can be canceled by returning false from the slide callback - allowed = this._trigger( "slide", event, { - handle: this.handles[ index ], - value: newVal - } ); - if ( allowed !== false ) { - this.value( newVal ); - } + if ( originalAriaControls ) { + tab.data( "ui-tabs-aria-controls", originalAriaControls ); } - } + tab.attr({ + "aria-controls": selector.substring( 1 ), + "aria-labelledby": anchorId + }); + panel.attr( "aria-labelledby", anchorId ); + }); + + this.panels + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .attr( "role", "tabpanel" ); }, - _stop: function( event, index ) { - var uiHash = { - handle: this.handles[ index ], - value: this.value() - }; - if ( this.options.values && this.options.values.length ) { - uiHash.value = this.values( index ); - uiHash.values = this.values(); - } + // allow overriding how to find the list for rare usage scenarios (#7715) + _getList: function() { + return this.element.find( "ol,ul" ).eq( 0 ); + }, - this._trigger( "stop", event, uiHash ); + _createPanel: function( id ) { + return $( "
        " ) + .attr( "id", id ) + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .data( "ui-tabs-destroy", true ); }, - _change: function( event, index ) { - if ( !this._keySliding && !this._mouseSliding ) { - var uiHash = { - handle: this.handles[ index ], - value: this.value() - }; - if ( this.options.values && this.options.values.length ) { - uiHash.value = this.values( index ); - uiHash.values = this.values(); + _setupDisabled: function( disabled ) { + if ( $.isArray( disabled ) ) { + if ( !disabled.length ) { + disabled = false; + } else if ( disabled.length === this.anchors.length ) { + disabled = true; } + } - this._trigger( "change", event, uiHash ); + // disable tabs + for ( var i = 0, li; ( li = this.tabs[ i ] ); i++ ) { + if ( disabled === true || $.inArray( i, disabled ) !== -1 ) { + $( li ) + .addClass( "ui-state-disabled" ) + .attr( "aria-disabled", "true" ); + } else { + $( li ) + .removeClass( "ui-state-disabled" ) + .removeAttr( "aria-disabled" ); + } } + + this.options.disabled = disabled; }, - value: function( newValue ) { - if ( arguments.length ) { - this.options.value = this._trimAlignValue( newValue ); - this._refreshValue(); - this._change( null, 0 ); - return; + _setupEvents: function( event ) { + var events = { + click: function( event ) { + event.preventDefault(); + } + }; + if ( event ) { + $.each( event.split(" "), function( index, eventName ) { + events[ eventName ] = "_eventHandler"; + }); } - return this._value(); + this._off( this.anchors.add( this.tabs ).add( this.panels ) ); + this._on( this.anchors, events ); + this._on( this.tabs, { keydown: "_tabKeydown" } ); + this._on( this.panels, { keydown: "_panelKeydown" } ); + + this._focusable( this.tabs ); + this._hoverable( this.tabs ); }, - values: function( index, newValue ) { - var vals, - newValues, - i; + _setupHeightStyle: function( heightStyle ) { + var maxHeight, overflow, + parent = this.element.parent(); - if ( arguments.length > 1 ) { - this.options.values[ index ] = this._trimAlignValue( newValue ); - this._refreshValue(); - this._change( null, index ); - return; - } + if ( heightStyle === "fill" ) { + // IE 6 treats height like minHeight, so we need to turn off overflow + // in order to get a reliable height + // we use the minHeight support test because we assume that only + // browsers that don't support minHeight will treat height as minHeight + if ( !$.support.minHeight ) { + overflow = parent.css( "overflow" ); + parent.css( "overflow", "hidden"); + } + maxHeight = parent.height(); + this.element.siblings( ":visible" ).each(function() { + var elem = $( this ), + position = elem.css( "position" ); - if ( arguments.length ) { - if ( $.isArray( arguments[ 0 ] ) ) { - vals = this.options.values; - newValues = arguments[ 0 ]; - for ( i = 0; i < vals.length; i += 1 ) { - vals[ i ] = this._trimAlignValue( newValues[ i ] ); - this._change( null, i ); - } - this._refreshValue(); - } else { - if ( this.options.values && this.options.values.length ) { - return this._values( index ); - } else { - return this.value(); + if ( position === "absolute" || position === "fixed" ) { + return; } + maxHeight -= elem.outerHeight( true ); + }); + if ( overflow ) { + parent.css( "overflow", overflow ); } - } else { - return this._values(); + + this.element.children().not( this.panels ).each(function() { + maxHeight -= $( this ).outerHeight( true ); + }); + + this.panels.each(function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + }) + .css( "overflow", "auto" ); + } else if ( heightStyle === "auto" ) { + maxHeight = 0; + this.panels.each(function() { + maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() ); + }).height( maxHeight ); } }, - _setOption: function( key, value ) { - var i, - valsLength = 0; + _eventHandler: function( event ) { + var options = this.options, + active = this.active, + anchor = $( event.currentTarget ), + tab = anchor.closest( "li" ), + clickedIsActive = tab[ 0 ] === active[ 0 ], + collapsing = clickedIsActive && options.collapsible, + toShow = collapsing ? $() : this._getPanelForTab( tab ), + toHide = !active.length ? $() : this._getPanelForTab( active ), + eventData = { + oldTab: active, + oldPanel: toHide, + newTab: collapsing ? $() : tab, + newPanel: toShow + }; - if ( $.isArray( this.options.values ) ) { - valsLength = this.options.values.length; + event.preventDefault(); + + if ( tab.hasClass( "ui-state-disabled" ) || + // tab is already loading + tab.hasClass( "ui-tabs-loading" ) || + // can't switch durning an animation + this.running || + // click on active header, but not collapsible + ( clickedIsActive && !options.collapsible ) || + // allow canceling activation + ( this._trigger( "beforeActivate", event, eventData ) === false ) ) { + return; } - $.Widget.prototype._setOption.apply( this, arguments ); + options.active = collapsing ? false : this.tabs.index( tab ); - switch ( key ) { - case "disabled": - if ( value ) { - this.handles.filter( ".ui-state-focus" ).blur(); - this.handles.removeClass( "ui-state-hover" ); - this.handles.propAttr( "disabled", true ); - this.element.addClass( "ui-disabled" ); - } else { - this.handles.propAttr( "disabled", false ); - this.element.removeClass( "ui-disabled" ); - } - break; - case "orientation": - this._detectOrientation(); - this.element - .removeClass( "ui-slider-horizontal ui-slider-vertical" ) - .addClass( "ui-slider-" + this.orientation ); - this._refreshValue(); - break; - case "value": - this._animateOff = true; - this._refreshValue(); - this._change( null, 0 ); - this._animateOff = false; - break; - case "values": - this._animateOff = true; - this._refreshValue(); - for ( i = 0; i < valsLength; i += 1 ) { - this._change( null, i ); - } - this._animateOff = false; - break; + this.active = clickedIsActive ? $() : tab; + if ( this.xhr ) { + this.xhr.abort(); } - }, - - //internal value getter - // _value() returns value trimmed by min and max, aligned by step - _value: function() { - var val = this.options.value; - val = this._trimAlignValue( val ); - return val; + if ( !toHide.length && !toShow.length ) { + $.error( "jQuery UI Tabs: Mismatching fragment identifier." ); + } + + if ( toShow.length ) { + this.load( this.tabs.index( tab ), event ); + } + this._toggle( event, eventData ); }, - //internal values getter - // _values() returns array of values trimmed by min and max, aligned by step - // _values( index ) returns single value trimmed by min and max, aligned by step - _values: function( index ) { - var val, - vals, - i; + // handles show/hide for selecting tabs + _toggle: function( event, eventData ) { + var that = this, + toShow = eventData.newPanel, + toHide = eventData.oldPanel; - if ( arguments.length ) { - val = this.options.values[ index ]; - val = this._trimAlignValue( val ); + this.running = true; - return val; - } else { - // .slice() creates a copy of the array - // this copy gets trimmed by min and max and then returned - vals = this.options.values.slice(); - for ( i = 0; i < vals.length; i+= 1) { - vals[ i ] = this._trimAlignValue( vals[ i ] ); + function complete() { + that.running = false; + that._trigger( "activate", event, eventData ); + } + + function show() { + eventData.newTab.closest( "li" ).addClass( "ui-tabs-active ui-state-active" ); + + if ( toShow.length && that.options.show ) { + that._show( toShow, that.options.show, complete ); + } else { + toShow.show(); + complete(); } + } - return vals; + // start out by hiding, then showing, then completing + if ( toHide.length && this.options.hide ) { + this._hide( toHide, this.options.hide, function() { + eventData.oldTab.closest( "li" ).removeClass( "ui-tabs-active ui-state-active" ); + show(); + }); + } else { + eventData.oldTab.closest( "li" ).removeClass( "ui-tabs-active ui-state-active" ); + toHide.hide(); + show(); } - }, - - // returns the step-aligned value that val is closest to, between (inclusive) min and max - _trimAlignValue: function( val ) { - if ( val <= this._valueMin() ) { - return this._valueMin(); + + toHide.attr({ + "aria-expanded": "false", + "aria-hidden": "true" + }); + eventData.oldTab.attr( "aria-selected", "false" ); + // If we're switching tabs, remove the old tab from the tab order. + // If we're opening from collapsed state, remove the previous tab from the tab order. + // If we're collapsing, then keep the collapsing tab in the tab order. + if ( toShow.length && toHide.length ) { + eventData.oldTab.attr( "tabIndex", -1 ); + } else if ( toShow.length ) { + this.tabs.filter(function() { + return $( this ).attr( "tabIndex" ) === 0; + }) + .attr( "tabIndex", -1 ); } - if ( val >= this._valueMax() ) { - return this._valueMax(); + + toShow.attr({ + "aria-expanded": "true", + "aria-hidden": "false" + }); + eventData.newTab.attr({ + "aria-selected": "true", + tabIndex: 0 + }); + }, + + _activate: function( index ) { + var anchor, + active = this._findActive( index ); + + // trying to activate the already active panel + if ( active[ 0 ] === this.active[ 0 ] ) { + return; } - var step = ( this.options.step > 0 ) ? this.options.step : 1, - valModStep = (val - this._valueMin()) % step, - alignValue = val - valModStep; - if ( Math.abs(valModStep) * 2 >= step ) { - alignValue += ( valModStep > 0 ) ? step : ( -step ); + // trying to collapse, simulate a click on the current active header + if ( !active.length ) { + active = this.active; } - // Since JavaScript has problems with large floats, round - // the final value to 5 digits after the decimal point (see #4124) - return parseFloat( alignValue.toFixed(5) ); + anchor = active.find( ".ui-tabs-anchor" )[ 0 ]; + this._eventHandler({ + target: anchor, + currentTarget: anchor, + preventDefault: $.noop + }); }, - _valueMin: function() { - return this.options.min; + _findActive: function( index ) { + return index === false ? $() : this.tabs.eq( index ); }, - _valueMax: function() { - return this.options.max; - }, - - _refreshValue: function() { - var oRange = this.options.range, - o = this.options, - self = this, - animate = ( !this._animateOff ) ? o.animate : false, - valPercent, - _set = {}, - lastValPercent, - value, - valueMin, - valueMax; + _getIndex: function( index ) { + // meta-function to give users option to provide a href string instead of a numerical index. + if ( typeof index === "string" ) { + index = this.anchors.index( this.anchors.filter( "[href$='" + index + "']" ) ); + } - if ( this.options.values && this.options.values.length ) { - this.handles.each(function( i, j ) { - valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100; - _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; - $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); - if ( self.options.range === true ) { - if ( self.orientation === "horizontal" ) { - if ( i === 0 ) { - self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); - } - if ( i === 1 ) { - self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); - } - } else { - if ( i === 0 ) { - self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); - } - if ( i === 1 ) { - self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); - } - } - } - lastValPercent = valPercent; - }); - } else { - value = this.value(); - valueMin = this._valueMin(); - valueMax = this._valueMax(); - valPercent = ( valueMax !== valueMin ) ? - ( value - valueMin ) / ( valueMax - valueMin ) * 100 : - 0; - _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; - this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + return index; + }, - if ( oRange === "min" && this.orientation === "horizontal" ) { - this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); - } - if ( oRange === "max" && this.orientation === "horizontal" ) { - this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); - } - if ( oRange === "min" && this.orientation === "vertical" ) { - this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); - } - if ( oRange === "max" && this.orientation === "vertical" ) { - this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); - } + _destroy: function() { + if ( this.xhr ) { + this.xhr.abort(); } - } -}); + this.element.removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ); -$.extend( $.ui.slider, { - version: "1.8.16" -}); + this.tablist + .removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ) + .removeAttr( "role" ); -}(jQuery)); -/* - * jQuery UI Tabs 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Tabs - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - */ -(function( $, undefined ) { + this.anchors + .removeClass( "ui-tabs-anchor" ) + .removeAttr( "role" ) + .removeAttr( "tabIndex" ) + .removeData( "href.tabs" ) + .removeData( "load.tabs" ) + .removeUniqueId(); -var tabId = 0, - listId = 0; + this.tabs.add( this.panels ).each(function() { + if ( $.data( this, "ui-tabs-destroy" ) ) { + $( this ).remove(); + } else { + $( this ) + .removeClass( "ui-state-default ui-state-active ui-state-disabled " + + "ui-corner-top ui-corner-bottom ui-widget-content ui-tabs-active ui-tabs-panel" ) + .removeAttr( "tabIndex" ) + .removeAttr( "aria-live" ) + .removeAttr( "aria-busy" ) + .removeAttr( "aria-selected" ) + .removeAttr( "aria-labelledby" ) + .removeAttr( "aria-hidden" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "role" ); + } + }); -function getNextTabId() { - return ++tabId; -} + this.tabs.each(function() { + var li = $( this ), + prev = li.data( "ui-tabs-aria-controls" ); + if ( prev ) { + li.attr( "aria-controls", prev ); + } else { + li.removeAttr( "aria-controls" ); + } + }); -function getNextListId() { - return ++listId; -} + this.panels.show(); -$.widget( "ui.tabs", { - options: { - add: null, - ajaxOptions: null, - cache: false, - cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } - collapsible: false, - disable: null, - disabled: [], - enable: null, - event: "click", - fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } - idPrefix: "ui-tabs-", - load: null, - panelTemplate: "
        ", - remove: null, - select: null, - show: null, - spinner: "Loading…", - tabTemplate: "
      • #{label}
        • " + if ( this.options.heightStyle !== "content" ) { + this.panels.css( "height", "" ); + } }, - _create: function() { - this._tabify( true ); + enable: function( index ) { + var disabled = this.options.disabled; + if ( disabled === false ) { + return; + } + + if ( index === undefined ) { + disabled = false; + } else { + index = this._getIndex( index ); + if ( $.isArray( disabled ) ) { + disabled = $.map( disabled, function( num ) { + return num !== index ? num : null; + }); + } else { + disabled = $.map( this.tabs, function( li, num ) { + return num !== index ? num : null; + }); + } + } + this._setupDisabled( disabled ); }, - _setOption: function( key, value ) { - if ( key == "selected" ) { - if (this.options.collapsible && value == this.options.selected ) { + disable: function( index ) { + var disabled = this.options.disabled; + if ( disabled === true ) { + return; + } + + if ( index === undefined ) { + disabled = true; + } else { + index = this._getIndex( index ); + if ( $.inArray( index, disabled ) !== -1 ) { return; } - this.select( value ); - } else { - this.options[ key ] = value; - this._tabify(); + if ( $.isArray( disabled ) ) { + disabled = $.merge( [ index ], disabled ).sort(); + } else { + disabled = [ index ]; + } } + this._setupDisabled( disabled ); }, - _tabId: function( a ) { - return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) || - this.options.idPrefix + getNextTabId(); - }, + load: function( index, event ) { + index = this._getIndex( index ); + var that = this, + tab = this.tabs.eq( index ), + anchor = tab.find( ".ui-tabs-anchor" ), + panel = this._getPanelForTab( tab ), + eventData = { + tab: tab, + panel: panel + }; - _sanitizeSelector: function( hash ) { - // we need this because an id may contain a ":" - return hash.replace( /:/g, "\\:" ); + // not remote + if ( isLocal( anchor[ 0 ] ) ) { + return; + } + + this.xhr = $.ajax( this._ajaxSettings( anchor, event, eventData ) ); + + // support: jQuery <1.8 + // jQuery <1.8 returns false if the request is canceled in beforeSend, + // but as of 1.8, $.ajax() always returns a jqXHR object. + if ( this.xhr && this.xhr.statusText !== "canceled" ) { + tab.addClass( "ui-tabs-loading" ); + panel.attr( "aria-busy", "true" ); + + this.xhr + .success(function( response ) { + // support: jQuery <1.8 + // http://bugs.jquery.com/ticket/11778 + setTimeout(function() { + panel.html( response ); + that._trigger( "load", event, eventData ); + }, 1 ); + }) + .complete(function( jqXHR, status ) { + // support: jQuery <1.8 + // http://bugs.jquery.com/ticket/11778 + setTimeout(function() { + if ( status === "abort" ) { + that.panels.stop( false, true ); + } + + tab.removeClass( "ui-tabs-loading" ); + panel.removeAttr( "aria-busy" ); + + if ( jqXHR === that.xhr ) { + delete that.xhr; + } + }, 1 ); + }); + } }, - _cookie: function() { - var cookie = this.cookie || - ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() ); - return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) ); + // TODO: Remove this function in 1.10 when ajaxOptions is removed + _ajaxSettings: function( anchor, event, eventData ) { + var that = this; + return { + url: anchor.attr( "href" ), + beforeSend: function( jqXHR, settings ) { + return that._trigger( "beforeLoad", event, + $.extend( { jqXHR : jqXHR, ajaxSettings: settings }, eventData ) ); + } + }; }, - _ui: function( tab, panel ) { + _getPanelForTab: function( tab ) { + var id = $( tab ).attr( "aria-controls" ); + return this.element.find( this._sanitizeSelector( "#" + id ) ); + } +}); + +// DEPRECATED +if ( $.uiBackCompat !== false ) { + + // helper method for a lot of the back compat extensions + $.ui.tabs.prototype._ui = function( tab, panel ) { return { tab: tab, panel: panel, index: this.anchors.index( tab ) }; - }, + }; - _cleanup: function() { - // restore all former loading tabs labels - this.lis.filter( ".ui-state-processing" ) - .removeClass( "ui-state-processing" ) - .find( "span:data(label.tabs)" ) - .each(function() { - var el = $( this ); - el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" ); + // url method + $.widget( "ui.tabs", $.ui.tabs, { + url: function( index, url ) { + this.anchors.eq( index ).attr( "href", url ); + } + }); + + // TODO: Remove _ajaxSettings() method when removing this extension + // ajaxOptions and cache options + $.widget( "ui.tabs", $.ui.tabs, { + options: { + ajaxOptions: null, + cache: false + }, + + _create: function() { + this._super(); + + var that = this; + + this._on({ tabsbeforeload: function( event, ui ) { + // tab is already cached + if ( $.data( ui.tab[ 0 ], "cache.tabs" ) ) { + event.preventDefault(); + return; + } + + ui.jqXHR.success(function() { + if ( that.options.cache ) { + $.data( ui.tab[ 0 ], "cache.tabs", true ); + } }); - }, + }}); + }, - _tabify: function( init ) { - var self = this, - o = this.options, - fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash + _ajaxSettings: function( anchor, event, ui ) { + var ajaxOptions = this.options.ajaxOptions; + return $.extend( {}, ajaxOptions, { + error: function( xhr, status ) { + try { + // Passing index avoid a race condition when this method is + // called after the user has selected another tab. + // Pass the anchor that initiated this request allows + // loadError to manipulate the tab content panel via $(a.hash) + ajaxOptions.error( + xhr, status, ui.tab.closest( "li" ).index(), ui.tab[ 0 ] ); + } + catch ( error ) {} + } + }, this._superApply( arguments ) ); + }, - this.list = this.element.find( "ol,ul" ).eq( 0 ); - this.lis = $( " > li:has(a[href])", this.list ); - this.anchors = this.lis.map(function() { - return $( "a", this )[ 0 ]; - }); - this.panels = $( [] ); - - this.anchors.each(function( i, a ) { - var href = $( a ).attr( "href" ); - // For dynamically created HTML that contains a hash as href IE < 8 expands - // such href to the full page url with hash and then misinterprets tab as ajax. - // Same consideration applies for an added tab with a fragment identifier - // since a[href=#fragment-identifier] does unexpectedly not match. - // Thus normalize href attribute... - var hrefBase = href.split( "#" )[ 0 ], - baseEl; - if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] || - ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) { - href = a.hash; - a.href = href; + _setOption: function( key, value ) { + // reset cache if switching from cached to not cached + if ( key === "cache" && value === false ) { + this.anchors.removeData( "cache.tabs" ); } + this._super( key, value ); + }, - // inline tab - if ( fragmentId.test( href ) ) { - self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) ); - // remote tab - // prevent loading the page itself if href is just "#" - } else if ( href && href !== "#" ) { - // required for restore on destroy - $.data( a, "href.tabs", href ); - - // TODO until #3808 is fixed strip fragment identifier from url - // (IE fails to load from such url) - $.data( a, "load.tabs", href.replace( /#.*$/, "" ) ); - - var id = self._tabId( a ); - a.href = "#" + id; - var $panel = self.element.find( "#" + id ); - if ( !$panel.length ) { - $panel = $( o.panelTemplate ) - .attr( "id", id ) - .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) - .insertAfter( self.panels[ i - 1 ] || self.list ); - $panel.data( "destroy.tabs", true ); - } - self.panels = self.panels.add( $panel ); - // invalid tab href - } else { - o.disabled.push( i ); + _destroy: function() { + this.anchors.removeData( "cache.tabs" ); + this._super(); + }, + + url: function( index ){ + this.anchors.eq( index ).removeData( "cache.tabs" ); + this._superApply( arguments ); + } + }); + + // abort method + $.widget( "ui.tabs", $.ui.tabs, { + abort: function() { + if ( this.xhr ) { + this.xhr.abort(); } - }); + } + }); - // initialization from scratch - if ( init ) { - // attach necessary classes for styling - this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" ); - this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); - this.lis.addClass( "ui-state-default ui-corner-top" ); - this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ); - - // Selected tab - // use "selected" option or try to retrieve: - // 1. from fragment identifier in url - // 2. from cookie - // 3. from selected class attribute on
      • - if ( o.selected === undefined ) { - if ( location.hash ) { - this.anchors.each(function( i, a ) { - if ( a.hash == location.hash ) { - o.selected = i; - return false; - } + // spinner + $.widget( "ui.tabs", $.ui.tabs, { + options: { + spinner: "Loading…" + }, + _create: function() { + this._super(); + this._on({ + tabsbeforeload: function( event, ui ) { + // Don't react to nested tabs or tabs that don't use a spinner + if ( event.target !== this.element[ 0 ] || + !this.options.spinner ) { + return; + } + + var span = ui.tab.find( "span" ), + html = span.html(); + span.html( this.options.spinner ); + ui.jqXHR.complete(function() { + span.html( html ); }); } - if ( typeof o.selected !== "number" && o.cookie ) { - o.selected = parseInt( self._cookie(), 10 ); - } - if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) { - o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + }); + } + }); + + // enable/disable events + $.widget( "ui.tabs", $.ui.tabs, { + options: { + enable: null, + disable: null + }, + + enable: function( index ) { + var options = this.options, + trigger; + + if ( index && options.disabled === true || + ( $.isArray( options.disabled ) && $.inArray( index, options.disabled ) !== -1 ) ) { + trigger = true; + } + + this._superApply( arguments ); + + if ( trigger ) { + this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + } + }, + + disable: function( index ) { + var options = this.options, + trigger; + + if ( index && options.disabled === false || + ( $.isArray( options.disabled ) && $.inArray( index, options.disabled ) === -1 ) ) { + trigger = true; + } + + this._superApply( arguments ); + + if ( trigger ) { + this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + } + } + }); + + // add/remove methods and events + $.widget( "ui.tabs", $.ui.tabs, { + options: { + add: null, + remove: null, + tabTemplate: "
      • #{label}
        • " + }, + + add: function( url, label, index ) { + if ( index === undefined ) { + index = this.anchors.length; + } + + var doInsertAfter, panel, + options = this.options, + li = $( options.tabTemplate + .replace( /#\{href\}/g, url ) + .replace( /#\{label\}/g, label ) ), + id = !url.indexOf( "#" ) ? + url.replace( "#", "" ) : + this._tabId( li ); + + li.addClass( "ui-state-default ui-corner-top" ).data( "ui-tabs-destroy", true ); + li.attr( "aria-controls", id ); + + doInsertAfter = index >= this.tabs.length; + + // try to find an existing element before creating a new one + panel = this.element.find( "#" + id ); + if ( !panel.length ) { + panel = this._createPanel( id ); + if ( doInsertAfter ) { + if ( index > 0 ) { + panel.insertAfter( this.panels.eq( -1 ) ); + } else { + panel.appendTo( this.element ); + } + } else { + panel.insertBefore( this.panels[ index ] ); } - o.selected = o.selected || ( this.lis.length ? 0 : -1 ); - } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release - o.selected = -1; } + panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ).hide(); - // sanity check - default to first tab... - o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 ) - ? o.selected - : 0; + if ( doInsertAfter ) { + li.appendTo( this.tablist ); + } else { + li.insertBefore( this.tabs[ index ] ); + } - // Take disabling tabs via class attribute from HTML - // into account and update option properly. - // A selected tab cannot become disabled. - o.disabled = $.unique( o.disabled.concat( - $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) { - return self.lis.index( n ); - }) - ) ).sort(); + options.disabled = $.map( options.disabled, function( n ) { + return n >= index ? ++n : n; + }); - if ( $.inArray( o.selected, o.disabled ) != -1 ) { - o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 ); + this.refresh(); + if ( this.tabs.length === 1 && options.active === false ) { + this.option( "active", 0 ); } - // highlight selected tab - this.panels.addClass( "ui-tabs-hide" ); - this.lis.removeClass( "ui-tabs-selected ui-state-active" ); - // check for length avoids error when initializing empty list - if ( o.selected >= 0 && this.anchors.length ) { - self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" ); - this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" ); + this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, - // seems to be expected behavior that the show callback is fired - self.element.queue( "tabs", function() { - self._trigger( "show", null, - self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) ); - }); + remove: function( index ) { + index = this._getIndex( index ); + var options = this.options, + tab = this.tabs.eq( index ).remove(), + panel = this._getPanelForTab( tab ).remove(); - this.load( o.selected ); + // If selected tab was removed focus tab to the right or + // in case the last tab was removed the tab to the left. + // We check for more than 2 tabs, because if there are only 2, + // then when we remove this tab, there will only be one tab left + // so we don't need to detect which tab to activate. + if ( tab.hasClass( "ui-tabs-active" ) && this.anchors.length > 2 ) { + this._activate( index + ( index + 1 < this.anchors.length ? 1 : -1 ) ); } - // clean up to avoid memory leaks in certain versions of IE 6 - // TODO: namespace this event - $( window ).bind( "unload", function() { - self.lis.add( self.anchors ).unbind( ".tabs" ); - self.lis = self.anchors = self.panels = null; - }); - // update selected after add/remove - } else { - o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); - } + options.disabled = $.map( + $.grep( options.disabled, function( n ) { + return n !== index; + }), + function( n ) { + return n >= index ? --n : n; + }); - // update collapsible - // TODO: use .toggleClass() - this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" ); + this.refresh(); - // set or update cookie after init and add/remove respectively - if ( o.cookie ) { - this._cookie( o.selected, o.cookie ); + this._trigger( "remove", null, this._ui( tab.find( "a" )[ 0 ], panel[ 0 ] ) ); + return this; } + }); - // disable tabs - for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) { - $( li )[ $.inArray( i, o.disabled ) != -1 && - // TODO: use .toggleClass() - !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" ); + // length method + $.widget( "ui.tabs", $.ui.tabs, { + length: function() { + return this.anchors.length; } + }); - // reset cache if switching from cached to not cached - if ( o.cache === false ) { - this.anchors.removeData( "cache.tabs" ); + // panel ids (idPrefix option + title attribute) + $.widget( "ui.tabs", $.ui.tabs, { + options: { + idPrefix: "ui-tabs-" + }, + + _tabId: function( tab ) { + var a = tab.is( "li" ) ? tab.find( "a[href]" ) : tab; + a = a[0]; + return $( a ).closest( "li" ).attr( "aria-controls" ) || + a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF\-]/g, "" ) || + this.options.idPrefix + getNextTabId(); } + }); - // remove all handlers before, tabify may run on existing tabs after add or option change - this.lis.add( this.anchors ).unbind( ".tabs" ); + // _createPanel method + $.widget( "ui.tabs", $.ui.tabs, { + options: { + panelTemplate: "
        " + }, - if ( o.event !== "mouseover" ) { - var addState = function( state, el ) { - if ( el.is( ":not(.ui-state-disabled)" ) ) { - el.addClass( "ui-state-" + state ); - } - }; - var removeState = function( state, el ) { - el.removeClass( "ui-state-" + state ); - }; - this.lis.bind( "mouseover.tabs" , function() { - addState( "hover", $( this ) ); - }); - this.lis.bind( "mouseout.tabs", function() { - removeState( "hover", $( this ) ); - }); - this.anchors.bind( "focus.tabs", function() { - addState( "focus", $( this ).closest( "li" ) ); - }); - this.anchors.bind( "blur.tabs", function() { - removeState( "focus", $( this ).closest( "li" ) ); - }); + _createPanel: function( id ) { + return $( this.options.panelTemplate ) + .attr( "id", id ) + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .data( "ui-tabs-destroy", true ); } + }); - // set up animations - var hideFx, showFx; - if ( o.fx ) { - if ( $.isArray( o.fx ) ) { - hideFx = o.fx[ 0 ]; - showFx = o.fx[ 1 ]; - } else { - hideFx = showFx = o.fx; + // selected option + $.widget( "ui.tabs", $.ui.tabs, { + _create: function() { + var options = this.options; + if ( options.active === null && options.selected !== undefined ) { + options.active = options.selected === -1 ? false : options.selected; } - } + this._super(); + options.selected = options.active; + if ( options.selected === false ) { + options.selected = -1; + } + }, - // Reset certain styles left over from animation - // and prevent IE's ClearType bug... - function resetStyle( $el, fx ) { - $el.css( "display", "" ); - if ( !$.support.opacity && fx.opacity ) { - $el[ 0 ].style.removeAttribute( "filter" ); + _setOption: function( key, value ) { + if ( key !== "selected" ) { + return this._super( key, value ); } - } - // Show a tab... - var showTab = showFx - ? function( clicked, $show ) { - $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); - $show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way - .animate( showFx, showFx.duration || "normal", function() { - resetStyle( $show, showFx ); - self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); - }); + var options = this.options; + this._super( "active", value === -1 ? false : value ); + options.selected = options.active; + if ( options.selected === false ) { + options.selected = -1; } - : function( clicked, $show ) { - $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); - $show.removeClass( "ui-tabs-hide" ); - self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); - }; + }, - // Hide a tab, $show is optional... - var hideTab = hideFx - ? function( clicked, $hide ) { - $hide.animate( hideFx, hideFx.duration || "normal", function() { - self.lis.removeClass( "ui-tabs-selected ui-state-active" ); - $hide.addClass( "ui-tabs-hide" ); - resetStyle( $hide, hideFx ); - self.element.dequeue( "tabs" ); - }); + _eventHandler: function() { + this._superApply( arguments ); + this.options.selected = this.options.active; + if ( this.options.selected === false ) { + this.options.selected = -1; } - : function( clicked, $hide, $show ) { - self.lis.removeClass( "ui-tabs-selected ui-state-active" ); - $hide.addClass( "ui-tabs-hide" ); - self.element.dequeue( "tabs" ); - }; + } + }); + + // show and select event + $.widget( "ui.tabs", $.ui.tabs, { + options: { + show: null, + select: null + }, + _create: function() { + this._super(); + if ( this.options.active !== false ) { + this._trigger( "show", null, this._ui( + this.active.find( ".ui-tabs-anchor" )[ 0 ], + this._getPanelForTab( this.active )[ 0 ] ) ); + } + }, + _trigger: function( type, event, data ) { + var tab, panel, + ret = this._superApply( arguments ); - // attach tab event handler, unbind to avoid duplicates from former tabifying... - this.anchors.bind( o.event + ".tabs", function() { - var el = this, - $li = $(el).closest( "li" ), - $hide = self.panels.filter( ":not(.ui-tabs-hide)" ), - $show = self.element.find( self._sanitizeSelector( el.hash ) ); - - // If tab is already selected and not collapsible or tab disabled or - // or is already loading or click callback returns false stop here. - // Check if click handler returns false last so that it is not executed - // for a disabled or loading tab! - if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) || - $li.hasClass( "ui-state-disabled" ) || - $li.hasClass( "ui-state-processing" ) || - self.panels.filter( ":animated" ).length || - self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) { - this.blur(); + if ( !ret ) { return false; } - o.selected = self.anchors.index( this ); + if ( type === "beforeActivate" ) { + tab = data.newTab.length ? data.newTab : data.oldTab; + panel = data.newPanel.length ? data.newPanel : data.oldPanel; + ret = this._super( "select", event, { + tab: tab.find( ".ui-tabs-anchor" )[ 0], + panel: panel[ 0 ], + index: tab.closest( "li" ).index() + }); + } else if ( type === "activate" && data.newTab.length ) { + ret = this._super( "show", event, { + tab: data.newTab.find( ".ui-tabs-anchor" )[ 0 ], + panel: data.newPanel[ 0 ], + index: data.newTab.closest( "li" ).index() + }); + } + return ret; + } + }); + + // select method + $.widget( "ui.tabs", $.ui.tabs, { + select: function( index ) { + index = this._getIndex( index ); + if ( index === -1 ) { + if ( this.options.collapsible && this.options.selected !== -1 ) { + index = this.options.selected; + } else { + return; + } + } + this.anchors.eq( index ).trigger( this.options.event + this.eventNamespace ); + } + }); - self.abort(); + // cookie option + (function() { - // if tab may be closed - if ( o.collapsible ) { - if ( $li.hasClass( "ui-tabs-selected" ) ) { - o.selected = -1; + var listId = 0; - if ( o.cookie ) { - self._cookie( o.selected, o.cookie ); - } + $.widget( "ui.tabs", $.ui.tabs, { + options: { + cookie: null // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } + }, + _create: function() { + var options = this.options, + active; + if ( options.active == null && options.cookie ) { + active = parseInt( this._cookie(), 10 ); + if ( active === -1 ) { + active = false; + } + options.active = active; + } + this._super(); + }, + _cookie: function( active ) { + var cookie = [ this.cookie || + ( this.cookie = this.options.cookie.name || "ui-tabs-" + (++listId) ) ]; + if ( arguments.length ) { + cookie.push( active === false ? -1 : active ); + cookie.push( this.options.cookie ); + } + return $.cookie.apply( null, cookie ); + }, + _refresh: function() { + this._super(); + if ( this.options.cookie ) { + this._cookie( this.options.active, this.options.cookie ); + } + }, + _eventHandler: function() { + this._superApply( arguments ); + if ( this.options.cookie ) { + this._cookie( this.options.active, this.options.cookie ); + } + }, + _destroy: function() { + this._super(); + if ( this.options.cookie ) { + this._cookie( null, this.options.cookie ); + } + } + }); - self.element.queue( "tabs", function() { - hideTab( el, $hide ); - }).dequeue( "tabs" ); + })(); - this.blur(); - return false; - } else if ( !$hide.length ) { - if ( o.cookie ) { - self._cookie( o.selected, o.cookie ); - } + // load event + $.widget( "ui.tabs", $.ui.tabs, { + _trigger: function( type, event, data ) { + var _data = $.extend( {}, data ); + if ( type === "load" ) { + _data.panel = _data.panel[ 0 ]; + _data.tab = _data.tab.find( ".ui-tabs-anchor" )[ 0 ]; + } + return this._super( type, event, _data ); + } + }); - self.element.queue( "tabs", function() { - showTab( el, $show ); - }); + // fx option + // The new animation options (show, hide) conflict with the old show callback. + // The old fx option wins over show/hide anyway (always favor back-compat). + // If a user wants to use the new animation API, they must give up the old API. + $.widget( "ui.tabs", $.ui.tabs, { + options: { + fx: null // e.g. { height: "toggle", opacity: "toggle", duration: 200 } + }, - // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171 - self.load( self.anchors.index( this ) ); + _getFx: function() { + var hide, show, + fx = this.options.fx; - this.blur(); - return false; + if ( fx ) { + if ( $.isArray( fx ) ) { + hide = fx[ 0 ]; + show = fx[ 1 ]; + } else { + hide = show = fx; } } - if ( o.cookie ) { - self._cookie( o.selected, o.cookie ); - } + return fx ? { show: show, hide: hide } : null; + }, - // show new tab - if ( $show.length ) { - if ( $hide.length ) { - self.element.queue( "tabs", function() { - hideTab( el, $hide ); - }); - } - self.element.queue( "tabs", function() { - showTab( el, $show ); - }); + _toggle: function( event, eventData ) { + var that = this, + toShow = eventData.newPanel, + toHide = eventData.oldPanel, + fx = this._getFx(); - self.load( self.anchors.index( this ) ); - } else { - throw "jQuery UI Tabs: Mismatching fragment identifier."; + if ( !fx ) { + return this._super( event, eventData ); } - // Prevent IE from keeping other link focussed when using the back button - // and remove dotted border from clicked link. This is controlled via CSS - // in modern browsers; blur() removes focus from address bar in Firefox - // which can become a usability and annoying problem with tabs('rotate'). - if ( $.browser.msie ) { - this.blur(); + that.running = true; + + function complete() { + that.running = false; + that._trigger( "activate", event, eventData ); } - }); - // disable click in any case - this.anchors.bind( "click.tabs", function(){ - return false; - }); - }, + function show() { + eventData.newTab.closest( "li" ).addClass( "ui-tabs-active ui-state-active" ); - _getIndex: function( index ) { - // meta-function to give users option to provide a href string instead of a numerical index. - // also sanitizes numerical indexes to valid values. - if ( typeof index == "string" ) { - index = this.anchors.index( this.anchors.filter( "[href$=" + index + "]" ) ); - } + if ( toShow.length && fx.show ) { + toShow + .animate( fx.show, fx.show.duration, function() { + complete(); + }); + } else { + toShow.show(); + complete(); + } + } - return index; - }, + // start out by hiding, then showing, then completing + if ( toHide.length && fx.hide ) { + toHide.animate( fx.hide, fx.hide.duration, function() { + eventData.oldTab.closest( "li" ).removeClass( "ui-tabs-active ui-state-active" ); + show(); + }); + } else { + eventData.oldTab.closest( "li" ).removeClass( "ui-tabs-active ui-state-active" ); + toHide.hide(); + show(); + } + } + }); +} - destroy: function() { - var o = this.options; +})( jQuery ); - this.abort(); +(function( $ ) { - this.element - .unbind( ".tabs" ) - .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ) - .removeData( "tabs" ); +var increments = 0; - this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); +function addDescribedBy( elem, id ) { + var describedby = (elem.attr( "aria-describedby" ) || "").split( /\s+/ ); + describedby.push( id ); + elem + .data( "ui-tooltip-id", id ) + .attr( "aria-describedby", $.trim( describedby.join( " " ) ) ); +} - this.anchors.each(function() { - var href = $.data( this, "href.tabs" ); - if ( href ) { - this.href = href; - } - var $this = $( this ).unbind( ".tabs" ); - $.each( [ "href", "load", "cache" ], function( i, prefix ) { - $this.removeData( prefix + ".tabs" ); - }); - }); +function removeDescribedBy( elem ) { + var id = elem.data( "ui-tooltip-id" ), + describedby = (elem.attr( "aria-describedby" ) || "").split( /\s+/ ), + index = $.inArray( id, describedby ); + if ( index !== -1 ) { + describedby.splice( index, 1 ); + } - this.lis.unbind( ".tabs" ).add( this.panels ).each(function() { - if ( $.data( this, "destroy.tabs" ) ) { - $( this ).remove(); - } else { - $( this ).removeClass([ - "ui-state-default", - "ui-corner-top", - "ui-tabs-selected", - "ui-state-active", - "ui-state-hover", - "ui-state-focus", - "ui-state-disabled", - "ui-tabs-panel", - "ui-widget-content", - "ui-corner-bottom", - "ui-tabs-hide" - ].join( " " ) ); - } - }); + elem.removeData( "ui-tooltip-id" ); + describedby = $.trim( describedby.join( " " ) ); + if ( describedby ) { + elem.attr( "aria-describedby", describedby ); + } else { + elem.removeAttr( "aria-describedby" ); + } +} - if ( o.cookie ) { - this._cookie( null, o.cookie ); - } +$.widget( "ui.tooltip", { + version: "1.9.2", + options: { + content: function() { + return $( this ).attr( "title" ); + }, + hide: true, + // Disabled elements have inconsistent behavior across browsers (#8661) + items: "[title]:not([disabled])", + position: { + my: "left top+15", + at: "left bottom", + collision: "flipfit flip" + }, + show: true, + tooltipClass: null, + track: false, - return this; + // callbacks + close: null, + open: null }, - add: function( url, label, index ) { - if ( index === undefined ) { - index = this.anchors.length; - } - - var self = this, - o = this.options, - $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ), - id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] ); + _create: function() { + this._on({ + mouseover: "open", + focusin: "open" + }); - $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true ); + // IDs of generated tooltips, needed for destroy + this.tooltips = {}; + // IDs of parent tooltips where we removed the title attribute + this.parents = {}; - // try to find an existing element before creating a new one - var $panel = self.element.find( "#" + id ); - if ( !$panel.length ) { - $panel = $( o.panelTemplate ) - .attr( "id", id ) - .data( "destroy.tabs", true ); + if ( this.options.disabled ) { + this._disable(); } - $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" ); + }, - if ( index >= this.lis.length ) { - $li.appendTo( this.list ); - $panel.appendTo( this.list[ 0 ].parentNode ); - } else { - $li.insertBefore( this.lis[ index ] ); - $panel.insertBefore( this.panels[ index ] ); - } + _setOption: function( key, value ) { + var that = this; - o.disabled = $.map( o.disabled, function( n, i ) { - return n >= index ? ++n : n; - }); + if ( key === "disabled" ) { + this[ value ? "_disable" : "_enable" ](); + this.options[ key ] = value; + // disable element style changes + return; + } - this._tabify(); + this._super( key, value ); - if ( this.anchors.length == 1 ) { - o.selected = 0; - $li.addClass( "ui-tabs-selected ui-state-active" ); - $panel.removeClass( "ui-tabs-hide" ); - this.element.queue( "tabs", function() { - self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) ); + if ( key === "content" ) { + $.each( this.tooltips, function( id, element ) { + that._updateContent( element ); }); - - this.load( 0 ); } - - this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); - return this; }, - remove: function( index ) { - index = this._getIndex( index ); - var o = this.options, - $li = this.lis.eq( index ).remove(), - $panel = this.panels.eq( index ).remove(); - - // If selected tab was removed focus tab to the right or - // in case the last tab was removed the tab to the left. - if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) { - this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) ); - } - - o.disabled = $.map( - $.grep( o.disabled, function(n, i) { - return n != index; - }), - function( n, i ) { - return n >= index ? --n : n; - }); + _disable: function() { + var that = this; - this._tabify(); + // close open tooltips + $.each( this.tooltips, function( id, element ) { + var event = $.Event( "blur" ); + event.target = event.currentTarget = element[0]; + that.close( event, true ); + }); - this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) ); - return this; + // remove title attributes to prevent native tooltips + this.element.find( this.options.items ).andSelf().each(function() { + var element = $( this ); + if ( element.is( "[title]" ) ) { + element + .data( "ui-tooltip-title", element.attr( "title" ) ) + .attr( "title", "" ); + } + }); }, - enable: function( index ) { - index = this._getIndex( index ); - var o = this.options; - if ( $.inArray( index, o.disabled ) == -1 ) { - return; - } - - this.lis.eq( index ).removeClass( "ui-state-disabled" ); - o.disabled = $.grep( o.disabled, function( n, i ) { - return n != index; + _enable: function() { + // restore title attributes + this.element.find( this.options.items ).andSelf().each(function() { + var element = $( this ); + if ( element.data( "ui-tooltip-title" ) ) { + element.attr( "title", element.data( "ui-tooltip-title" ) ); + } }); - - this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); - return this; }, - disable: function( index ) { - index = this._getIndex( index ); - var self = this, o = this.options; - // cannot disable already selected tab - if ( index != o.selected ) { - this.lis.eq( index ).addClass( "ui-state-disabled" ); + open: function( event ) { + var that = this, + target = $( event ? event.target : this.element ) + // we need closest here due to mouseover bubbling, + // but always pointing at the same event target + .closest( this.options.items ); - o.disabled.push( index ); - o.disabled.sort(); + // No element to show a tooltip for or the tooltip is already open + if ( !target.length || target.data( "ui-tooltip-id" ) ) { + return; + } - this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + if ( target.attr( "title" ) ) { + target.data( "ui-tooltip-title", target.attr( "title" ) ); } - return this; + target.data( "ui-tooltip-open", true ); + + // kill parent tooltips, custom or native, for hover + if ( event && event.type === "mouseover" ) { + target.parents().each(function() { + var parent = $( this ), + blurEvent; + if ( parent.data( "ui-tooltip-open" ) ) { + blurEvent = $.Event( "blur" ); + blurEvent.target = blurEvent.currentTarget = this; + that.close( blurEvent, true ); + } + if ( parent.attr( "title" ) ) { + parent.uniqueId(); + that.parents[ this.id ] = { + element: this, + title: parent.attr( "title" ) + }; + parent.attr( "title", "" ); + } + }); + } + + this._updateContent( target, event ); }, - select: function( index ) { - index = this._getIndex( index ); - if ( index == -1 ) { - if ( this.options.collapsible && this.options.selected != -1 ) { - index = this.options.selected; - } else { - return this; + _updateContent: function( target, event ) { + var content, + contentOption = this.options.content, + that = this, + eventType = event ? event.type : null; + + if ( typeof contentOption === "string" ) { + return this._open( event, target, contentOption ); + } + + content = contentOption.call( target[0], function( response ) { + // ignore async response if tooltip was closed already + if ( !target.data( "ui-tooltip-open" ) ) { + return; } + // IE may instantly serve a cached response for ajax requests + // delay this call to _open so the other call to _open runs first + that._delay(function() { + // jQuery creates a special event for focusin when it doesn't + // exist natively. To improve performance, the native event + // object is reused and the type is changed. Therefore, we can't + // rely on the type being correct after the event finished + // bubbling, so we set it back to the previous value. (#8740) + if ( event ) { + event.type = eventType; + } + this._open( event, target, response ); + }); + }); + if ( content ) { + this._open( event, target, content ); } - this.anchors.eq( index ).trigger( this.options.event + ".tabs" ); - return this; }, - load: function( index ) { - index = this._getIndex( index ); - var self = this, - o = this.options, - a = this.anchors.eq( index )[ 0 ], - url = $.data( a, "load.tabs" ); + _open: function( event, target, content ) { + var tooltip, events, delayedShow, + positionOption = $.extend( {}, this.options.position ); - this.abort(); - - // not remote or from cache - if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) { - this.element.dequeue( "tabs" ); + if ( !content ) { return; } - // load remote from here on - this.lis.eq( index ).addClass( "ui-state-processing" ); - - if ( o.spinner ) { - var span = $( "span", a ); - span.data( "label.tabs", span.html() ).html( o.spinner ); + // Content can be updated multiple times. If the tooltip already + // exists, then just update the content and bail. + tooltip = this._find( target ); + if ( tooltip.length ) { + tooltip.find( ".ui-tooltip-content" ).html( content ); + return; } - this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, { - url: url, - success: function( r, s ) { - self.element.find( self._sanitizeSelector( a.hash ) ).html( r ); + // if we have a title, clear it to prevent the native tooltip + // we have to check first to avoid defining a title if none exists + // (we don't want to cause an element to start matching [title]) + // + // We use removeAttr only for key events, to allow IE to export the correct + // accessible attributes. For mouse events, set to empty string to avoid + // native tooltip showing up (happens only when removing inside mouseover). + if ( target.is( "[title]" ) ) { + if ( event && event.type === "mouseover" ) { + target.attr( "title", "" ); + } else { + target.removeAttr( "title" ); + } + } - // take care of tab labels - self._cleanup(); + tooltip = this._tooltip( target ); + addDescribedBy( target, tooltip.attr( "id" ) ); + tooltip.find( ".ui-tooltip-content" ).html( content ); - if ( o.cache ) { - $.data( a, "cache.tabs", true ); + function position( event ) { + positionOption.of = event; + if ( tooltip.is( ":hidden" ) ) { + return; + } + tooltip.position( positionOption ); + } + if ( this.options.track && event && /^mouse/.test( event.type ) ) { + this._on( this.document, { + mousemove: position + }); + // trigger once to override element-relative positioning + position( event ); + } else { + tooltip.position( $.extend({ + of: target + }, this.options.position ) ); + } + + tooltip.hide(); + + this._show( tooltip, this.options.show ); + // Handle tracking tooltips that are shown with a delay (#8644). As soon + // as the tooltip is visible, position the tooltip using the most recent + // event. + if ( this.options.show && this.options.show.delay ) { + delayedShow = setInterval(function() { + if ( tooltip.is( ":visible" ) ) { + position( positionOption.of ); + clearInterval( delayedShow ); } + }, $.fx.interval ); + } - self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); - try { - o.ajaxOptions.success( r, s ); - } - catch ( e ) {} - }, - error: function( xhr, s, e ) { - // take care of tab labels - self._cleanup(); + this._trigger( "open", event, { tooltip: tooltip } ); - self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); - try { - // Passing index avoid a race condition when this method is - // called after the user has selected another tab. - // Pass the anchor that initiated this request allows - // loadError to manipulate the tab content panel via $(a.hash) - o.ajaxOptions.error( xhr, s, index, a ); + events = { + keyup: function( event ) { + if ( event.keyCode === $.ui.keyCode.ESCAPE ) { + var fakeEvent = $.Event(event); + fakeEvent.currentTarget = target[0]; + this.close( fakeEvent, true ); } - catch ( e ) {} + }, + remove: function() { + this._removeTooltip( tooltip ); } - } ) ); + }; + if ( !event || event.type === "mouseover" ) { + events.mouseleave = "close"; + } + if ( !event || event.type === "focusin" ) { + events.focusout = "close"; + } + this._on( true, target, events ); + }, - // last, so that load event is fired before show... - self.element.dequeue( "tabs" ); + close: function( event ) { + var that = this, + target = $( event ? event.currentTarget : this.element ), + tooltip = this._find( target ); - return this; - }, + // disabling closes the tooltip, so we need to track when we're closing + // to avoid an infinite loop in case the tooltip becomes disabled on close + if ( this.closing ) { + return; + } - abort: function() { - // stop possibly running animations - this.element.queue( [] ); - this.panels.stop( false, true ); + // only set title if we had one before (see comment in _open()) + if ( target.data( "ui-tooltip-title" ) ) { + target.attr( "title", target.data( "ui-tooltip-title" ) ); + } - // "tabs" queue must not contain more than two elements, - // which are the callbacks for the latest clicked tab... - this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) ); + removeDescribedBy( target ); - // terminate pending requests from other tabs - if ( this.xhr ) { - this.xhr.abort(); - delete this.xhr; + tooltip.stop( true ); + this._hide( tooltip, this.options.hide, function() { + that._removeTooltip( $( this ) ); + }); + + target.removeData( "ui-tooltip-open" ); + this._off( target, "mouseleave focusout keyup" ); + // Remove 'remove' binding only on delegated targets + if ( target[0] !== this.element[0] ) { + this._off( target, "remove" ); } + this._off( this.document, "mousemove" ); - // take care of tab labels - this._cleanup(); - return this; + if ( event && event.type === "mouseleave" ) { + $.each( this.parents, function( id, parent ) { + $( parent.element ).attr( "title", parent.title ); + delete that.parents[ id ]; + }); + } + + this.closing = true; + this._trigger( "close", event, { tooltip: tooltip } ); + this.closing = false; }, - url: function( index, url ) { - this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url ); - return this; + _tooltip: function( element ) { + var id = "ui-tooltip-" + increments++, + tooltip = $( "
        " ) + .attr({ + id: id, + role: "tooltip" + }) + .addClass( "ui-tooltip ui-widget ui-corner-all ui-widget-content " + + ( this.options.tooltipClass || "" ) ); + $( "
        " ) + .addClass( "ui-tooltip-content" ) + .appendTo( tooltip ); + tooltip.appendTo( this.document[0].body ); + if ( $.fn.bgiframe ) { + tooltip.bgiframe(); + } + this.tooltips[ id ] = element; + return tooltip; }, - length: function() { - return this.anchors.length; - } -}); + _find: function( target ) { + var id = target.data( "ui-tooltip-id" ); + return id ? $( "#" + id ) : $(); + }, -$.extend( $.ui.tabs, { - version: "1.8.16" -}); + _removeTooltip: function( tooltip ) { + tooltip.remove(); + delete this.tooltips[ tooltip.attr( "id" ) ]; + }, -/* - * Tabs Extensions - */ + _destroy: function() { + var that = this; -/* - * Rotate - */ -$.extend( $.ui.tabs.prototype, { - rotation: null, - rotate: function( ms, continuing ) { - var self = this, - o = this.options; + // close open tooltips + $.each( this.tooltips, function( id, element ) { + // Delegate to close method to handle common cleanup + var event = $.Event( "blur" ); + event.target = event.currentTarget = element[0]; + that.close( event, true ); - var rotate = self._rotate || ( self._rotate = function( e ) { - clearTimeout( self.rotation ); - self.rotation = setTimeout(function() { - var t = o.selected; - self.select( ++t < self.anchors.length ? t : 0 ); - }, ms ); - - if ( e ) { - e.stopPropagation(); - } - }); + // Remove immediately; destroying an open tooltip doesn't use the + // hide animation + $( "#" + id ).remove(); - var stop = self._unrotate || ( self._unrotate = !continuing - ? function(e) { - if (e.clientX) { // in case of a true click - self.rotate(null); - } + // Restore the title + if ( element.data( "ui-tooltip-title" ) ) { + element.attr( "title", element.data( "ui-tooltip-title" ) ); + element.removeData( "ui-tooltip-title" ); } - : function( e ) { - t = o.selected; - rotate(); - }); - - // start rotation - if ( ms ) { - this.element.bind( "tabsshow", rotate ); - this.anchors.bind( o.event + ".tabs", stop ); - rotate(); - // stop rotation - } else { - clearTimeout( self.rotation ); - this.element.unbind( "tabsshow", rotate ); - this.anchors.unbind( o.event + ".tabs", stop ); - delete this._rotate; - delete this._unrotate; - } - - return this; + }); } }); -})( jQuery ); +}( jQuery ) ); diff --git a/web/external/jquery-ui/jquery-ui.min.js b/web/external/jquery-ui/jquery-ui.min.js index 0202506..bc01354 100644 --- a/web/external/jquery-ui/jquery-ui.min.js +++ b/web/external/jquery-ui/jquery-ui.min.js @@ -1,414 +1,5 @@ -/*! - * jQuery UI 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI - */ -(function(a,d){function c(h,g){var i=h.nodeName.toLowerCase();if("area"===i){g=h.parentNode;i=g.name;if(!h.href||!i||g.nodeName.toLowerCase()!=="map")return false;h=a("img[usemap=#"+i+"]")[0];return!!h&&e(h)}return(/input|select|textarea|button|object/.test(i)?!h.disabled:"a"==i?h.href||g:g)&&e(h)}function e(h){return!a(h).parents().andSelf().filter(function(){return a.curCSS(this,"visibility")==="hidden"||a.expr.filters.hidden(this)}).length}a.ui=a.ui||{};if(!a.ui.version){a.extend(a.ui,{version:"1.8.16", -keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});a.fn.extend({propAttr:a.fn.prop||a.fn.attr,_focus:a.fn.focus,focus:function(h,g){return typeof h==="number"?this.each(function(){var i= -this;setTimeout(function(){a(i).focus();g&&g.call(i)},h)}):this._focus.apply(this,arguments)},scrollParent:function(){var h;h=a.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(a.curCSS(this,"position",1))&&/(auto|scroll)/.test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(a.curCSS(this, -"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!h.length?a(document):h},zIndex:function(h){if(h!==d)return this.css("zIndex",h);if(this.length){h=a(this[0]);for(var g;h.length&&h[0]!==document;){g=h.css("position");if(g==="absolute"||g==="relative"||g==="fixed"){g=parseInt(h.css("zIndex"),10);if(!isNaN(g)&&g!==0)return g}h=h.parent()}}return 0},disableSelection:function(){return this.bind((a.support.selectstart?"selectstart": -"mousedown")+".ui-disableSelection",function(h){h.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});a.each(["Width","Height"],function(h,g){function i(l,o,n,k){a.each(b,function(){o-=parseFloat(a.curCSS(l,"padding"+this,true))||0;if(n)o-=parseFloat(a.curCSS(l,"border"+this+"Width",true))||0;if(k)o-=parseFloat(a.curCSS(l,"margin"+this,true))||0});return o}var b=g==="Width"?["Left","Right"]:["Top","Bottom"],f=g.toLowerCase(),j={innerWidth:a.fn.innerWidth,innerHeight:a.fn.innerHeight, -outerWidth:a.fn.outerWidth,outerHeight:a.fn.outerHeight};a.fn["inner"+g]=function(l){if(l===d)return j["inner"+g].call(this);return this.each(function(){a(this).css(f,i(this,l)+"px")})};a.fn["outer"+g]=function(l,o){if(typeof l!=="number")return j["outer"+g].call(this,l);return this.each(function(){a(this).css(f,i(this,l,true,o)+"px")})}});a.extend(a.expr[":"],{data:function(h,g,i){return!!a.data(h,i[3])},focusable:function(h){return c(h,!isNaN(a.attr(h,"tabindex")))},tabbable:function(h){var g=a.attr(h, -"tabindex"),i=isNaN(g);return(i||g>=0)&&c(h,!i)}});a(function(){var h=document.body,g=h.appendChild(g=document.createElement("div"));a.extend(g.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});a.support.minHeight=g.offsetHeight===100;a.support.selectstart="onselectstart"in g;h.removeChild(g).style.display="none"});a.extend(a.ui,{plugin:{add:function(h,g,i){h=a.ui[h].prototype;for(var b in i){h.plugins[b]=h.plugins[b]||[];h.plugins[b].push([g,i[b]])}},call:function(h,g,i){if((g=h.plugins[g])&& -h.element[0].parentNode)for(var b=0;b0)return true;h[g]=1;i=h[g]>0;h[g]=0;return i},isOverAxis:function(h,g,i){return h>g&&h=9)&&!c.button)return this._mouseUp(c);if(this._mouseStarted){this._mouseDrag(c);return c.preventDefault()}if(this._mouseDistanceMet(c)&&this._mouseDelayMet(c))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,c)!==false)?this._mouseDrag(c):this._mouseUp(c);return!this._mouseStarted},_mouseUp:function(c){a(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted= -false;c.target==this._mouseDownEvent.target&&a.data(c.target,this.widgetName+".preventClickEvent",true);this._mouseStop(c)}return false},_mouseDistanceMet:function(c){return Math.max(Math.abs(this._mouseDownEvent.pageX-c.pageX),Math.abs(this._mouseDownEvent.pageY-c.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); -(function(a){a.widget("ui.draggable",a.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== -"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(d){var c= -this.options;if(this.helper||c.disabled||a(d.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(d);if(!this.handle)return false;if(c.iframeFix)a(c.iframeFix===true?"iframe":c.iframeFix).each(function(){a('
        ').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(a(this).offset()).appendTo("body")});return true},_mouseStart:function(d){var c=this.options; -this.helper=this._createHelper(d);this._cacheHelperProportions();if(a.ui.ddmanager)a.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};a.extend(this.offset,{click:{left:d.pageX-this.offset.left,top:d.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}); -this.originalPosition=this.position=this._generatePosition(d);this.originalPageX=d.pageX;this.originalPageY=d.pageY;c.cursorAt&&this._adjustOffsetFromHelper(c.cursorAt);c.containment&&this._setContainment();if(this._trigger("start",d)===false){this._clear();return false}this._cacheHelperProportions();a.ui.ddmanager&&!c.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,d);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(d,true);a.ui.ddmanager&&a.ui.ddmanager.dragStart(this,d);return true}, -_mouseDrag:function(d,c){this.position=this._generatePosition(d);this.positionAbs=this._convertPositionTo("absolute");if(!c){c=this._uiHash();if(this._trigger("drag",d,c)===false){this._mouseUp({});return false}this.position=c.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";a.ui.ddmanager&&a.ui.ddmanager.drag(this,d);return false},_mouseStop:function(d){var c= -false;if(a.ui.ddmanager&&!this.options.dropBehaviour)c=a.ui.ddmanager.drop(this,d);if(this.dropped){c=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!c||this.options.revert=="valid"&&c||this.options.revert===true||a.isFunction(this.options.revert)&&this.options.revert.call(this.element,c)){var e=this;a(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration, -10),function(){e._trigger("stop",d)!==false&&e._clear()})}else this._trigger("stop",d)!==false&&this._clear();return false},_mouseUp:function(d){this.options.iframeFix===true&&a("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)});a.ui.ddmanager&&a.ui.ddmanager.dragStop(this,d);return a.ui.mouse.prototype._mouseUp.call(this,d)},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(d){var c=!this.options.handle|| -!a(this.options.handle,this.element).length?true:false;a(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==d.target)c=true});return c},_createHelper:function(d){var c=this.options;d=a.isFunction(c.helper)?a(c.helper.apply(this.element[0],[d])):c.helper=="clone"?this.element.clone().removeAttr("id"):this.element;d.parents("body").length||d.appendTo(c.appendTo=="parent"?this.element[0].parentNode:c.appendTo);d[0]!=this.element[0]&&!/(fixed|absolute)/.test(d.css("position"))&& -d.css("position","absolute");return d},_adjustOffsetFromHelper:function(d){if(typeof d=="string")d=d.split(" ");if(a.isArray(d))d={left:+d[0],top:+d[1]||0};if("left"in d)this.offset.click.left=d.left+this.margins.left;if("right"in d)this.offset.click.left=this.helperProportions.width-d.right+this.margins.left;if("top"in d)this.offset.click.top=d.top+this.margins.top;if("bottom"in d)this.offset.click.top=this.helperProportions.height-d.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent= -this.helper.offsetParent();var d=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])){d.left+=this.scrollParent.scrollLeft();d.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)d={top:0,left:0};return{top:d.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:d.left+(parseInt(this.offsetParent.css("borderLeftWidth"), -10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var d=this.element.position();return{top:d.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:d.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"), -10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var d=this.options;if(d.containment=="parent")d.containment=this.helper[0].parentNode;if(d.containment=="document"||d.containment=="window")this.containment=[d.containment=="document"?0:a(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,d.containment=="document"?0:a(window).scrollTop()-this.offset.relative.top-this.offset.parent.top, -(d.containment=="document"?0:a(window).scrollLeft())+a(d.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(d.containment=="document"?0:a(window).scrollTop())+(a(d.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(d.containment)&&d.containment.constructor!=Array){d=a(d.containment);var c=d[0];if(c){d.offset();var e=a(c).css("overflow")!= -"hidden";this.containment=[(parseInt(a(c).css("borderLeftWidth"),10)||0)+(parseInt(a(c).css("paddingLeft"),10)||0),(parseInt(a(c).css("borderTopWidth"),10)||0)+(parseInt(a(c).css("paddingTop"),10)||0),(e?Math.max(c.scrollWidth,c.offsetWidth):c.offsetWidth)-(parseInt(a(c).css("borderLeftWidth"),10)||0)-(parseInt(a(c).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(e?Math.max(c.scrollHeight,c.offsetHeight):c.offsetHeight)-(parseInt(a(c).css("borderTopWidth"), -10)||0)-(parseInt(a(c).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom];this.relative_container=d}}else if(d.containment.constructor==Array)this.containment=d.containment},_convertPositionTo:function(d,c){if(!c)c=this.position;d=d=="absolute"?1:-1;var e=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,h=/(html|body)/i.test(e[0].tagName);return{top:c.top+ -this.offset.relative.top*d+this.offset.parent.top*d-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():h?0:e.scrollTop())*d),left:c.left+this.offset.relative.left*d+this.offset.parent.left*d-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():h?0:e.scrollLeft())*d)}},_generatePosition:function(d){var c=this.options,e=this.cssPosition=="absolute"&& -!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,h=/(html|body)/i.test(e[0].tagName),g=d.pageX,i=d.pageY;if(this.originalPosition){var b;if(this.containment){if(this.relative_container){b=this.relative_container.offset();b=[this.containment[0]+b.left,this.containment[1]+b.top,this.containment[2]+b.left,this.containment[3]+b.top]}else b=this.containment;if(d.pageX-this.offset.click.leftb[2])g=b[2]+this.offset.click.left;if(d.pageY-this.offset.click.top>b[3])i=b[3]+this.offset.click.top}if(c.grid){i=c.grid[1]?this.originalPageY+Math.round((i-this.originalPageY)/c.grid[1])*c.grid[1]:this.originalPageY;i=b?!(i-this.offset.click.topb[3])?i:!(i-this.offset.click.topb[2])?g:!(g-this.offset.click.left=0;l--){var o=e.snapElements[l].left,n=o+e.snapElements[l].width,k=e.snapElements[l].top,m=k+e.snapElements[l].height;if(o-g=l&&i<=o||b>=l&&b<=o||io)&&(h>= -f&&h<=j||g>=f&&g<=j||hj);default:return false}};a.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(d,c){var e=a.ui.ddmanager.droppables[d.options.scope]||[],h=c?c.type:null,g=(d.currentItem||d.element).find(":data(droppable)").andSelf(),i=0;a:for(;i
        ').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(), -top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle= -this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=h.handles||(!a(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne", -nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var g=this.handles.split(",");this.handles={};for(var i=0;i
        ');/sw|se|ne|nw/.test(b)&&f.css({zIndex:++h.zIndex});"se"==b&&f.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[b]=".ui-resizable-"+b;this.element.append(f)}}this._renderAxis=function(j){j=j||this.element;for(var l in this.handles){if(this.handles[l].constructor== -String)this.handles[l]=a(this.handles[l],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var o=a(this.handles[l],this.element),n=0;n=/sw|ne|nw|se|n|s/.test(l)?o.outerHeight():o.outerWidth();o=["padding",/ne|nw|n/.test(l)?"Top":/se|sw|s/.test(l)?"Bottom":/^e$/.test(l)?"Right":"Left"].join("");j.css(o,n);this._proportionallyResize()}a(this.handles[l])}};this._renderAxis(this.element);this._handles=a(".ui-resizable-handle",this.element).disableSelection(); -this._handles.mouseover(function(){if(!e.resizing){if(this.className)var j=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);e.axis=j&&j[1]?j[1]:"se"}});if(h.autoHide){this._handles.hide();a(this.element).addClass("ui-resizable-autohide").hover(function(){if(!h.disabled){a(this).removeClass("ui-resizable-autohide");e._handles.show()}},function(){if(!h.disabled)if(!e.resizing){a(this).addClass("ui-resizable-autohide");e._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy(); -var e=function(g){a(g).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){e(this.element);var h=this.element;h.after(this.originalElement.css({position:h.css("position"),width:h.outerWidth(),height:h.outerHeight(),top:h.css("top"),left:h.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);e(this.originalElement);return this},_mouseCapture:function(e){var h= -false;for(var g in this.handles)if(a(this.handles[g])[0]==e.target)h=true;return!this.options.disabled&&h},_mouseStart:function(e){var h=this.options,g=this.element.position(),i=this.element;this.resizing=true;this.documentScroll={top:a(document).scrollTop(),left:a(document).scrollLeft()};if(i.is(".ui-draggable")||/absolute/.test(i.css("position")))i.css({position:"absolute",top:g.top,left:g.left});a.browser.opera&&/relative/.test(i.css("position"))&&i.css({position:"relative",top:"auto",left:"auto"}); -this._renderProxy();g=d(this.helper.css("left"));var b=d(this.helper.css("top"));if(h.containment){g+=a(h.containment).scrollLeft()||0;b+=a(h.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:g,top:b};this.size=this._helper?{width:i.outerWidth(),height:i.outerHeight()}:{width:i.width(),height:i.height()};this.originalSize=this._helper?{width:i.outerWidth(),height:i.outerHeight()}:{width:i.width(),height:i.height()};this.originalPosition={left:g,top:b};this.sizeDiff= -{width:i.outerWidth()-i.width(),height:i.outerHeight()-i.height()};this.originalMousePosition={left:e.pageX,top:e.pageY};this.aspectRatio=typeof h.aspectRatio=="number"?h.aspectRatio:this.originalSize.width/this.originalSize.height||1;h=a(".ui-resizable-"+this.axis).css("cursor");a("body").css("cursor",h=="auto"?this.axis+"-resize":h);i.addClass("ui-resizable-resizing");this._propagate("start",e);return true},_mouseDrag:function(e){var h=this.helper,g=this.originalMousePosition,i=this._change[this.axis]; -if(!i)return false;g=i.apply(this,[e,e.pageX-g.left||0,e.pageY-g.top||0]);this._updateVirtualBoundaries(e.shiftKey);if(this._aspectRatio||e.shiftKey)g=this._updateRatio(g,e);g=this._respectSize(g,e);this._propagate("resize",e);h.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(g);this._trigger("resize",e,this.ui());return false}, -_mouseStop:function(e){this.resizing=false;var h=this.options,g=this;if(this._helper){var i=this._proportionallyResizeElements,b=i.length&&/textarea/i.test(i[0].nodeName);i=b&&a.ui.hasScroll(i[0],"left")?0:g.sizeDiff.height;b=b?0:g.sizeDiff.width;b={width:g.helper.width()-b,height:g.helper.height()-i};i=parseInt(g.element.css("left"),10)+(g.position.left-g.originalPosition.left)||null;var f=parseInt(g.element.css("top"),10)+(g.position.top-g.originalPosition.top)||null;h.animate||this.element.css(a.extend(b, -{top:f,left:i}));g.helper.height(g.size.height);g.helper.width(g.size.width);this._helper&&!h.animate&&this._proportionallyResize()}a("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",e);this._helper&&this.helper.remove();return false},_updateVirtualBoundaries:function(e){var h=this.options,g,i,b;h={minWidth:c(h.minWidth)?h.minWidth:0,maxWidth:c(h.maxWidth)?h.maxWidth:Infinity,minHeight:c(h.minHeight)?h.minHeight:0,maxHeight:c(h.maxHeight)?h.maxHeight: -Infinity};if(this._aspectRatio||e){e=h.minHeight*this.aspectRatio;i=h.minWidth/this.aspectRatio;g=h.maxHeight*this.aspectRatio;b=h.maxWidth/this.aspectRatio;if(e>h.minWidth)h.minWidth=e;if(i>h.minHeight)h.minHeight=i;if(ge.width,j=c(e.height)&&h.minHeight&&h.minHeight>e.height;if(f)e.width=h.minWidth;if(j)e.height=h.minHeight;if(i)e.width=h.maxWidth;if(b)e.height=h.maxHeight;var l=this.originalPosition.left+this.originalSize.width,o=this.position.top+this.size.height,n=/sw|nw|w/.test(g);g=/nw|ne|n/.test(g);if(f&&n)e.left=l-h.minWidth;if(i&&n)e.left=l-h.maxWidth;if(j&&g)e.top=o-h.minHeight;if(b&&g)e.top=o-h.maxHeight;if((h=!e.width&&!e.height)&&!e.left&&e.top)e.top=null;else if(h&&!e.top&&e.left)e.left= -null;return e},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var e=this.helper||this.element,h=0;h
        ');var h=a.browser.msie&&a.browser.version<7,g=h?1:0;h=h?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+ -h,height:this.element.outerHeight()+h,position:"absolute",left:this.elementOffset.left-g+"px",top:this.elementOffset.top-g+"px",zIndex:++e.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(e,h){return{width:this.originalSize.width+h}},w:function(e,h){return{left:this.originalPosition.left+h,width:this.originalSize.width-h}},n:function(e,h,g){return{top:this.originalPosition.top+g,height:this.originalSize.height-g}},s:function(e,h,g){return{height:this.originalSize.height+ -g}},se:function(e,h,g){return a.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[e,h,g]))},sw:function(e,h,g){return a.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[e,h,g]))},ne:function(e,h,g){return a.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[e,h,g]))},nw:function(e,h,g){return a.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[e,h,g]))}},_propagate:function(e,h){a.ui.plugin.call(this,e,[h,this.ui()]); -e!="resize"&&this._trigger(e,h,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});a.extend(a.ui.resizable,{version:"1.8.16"});a.ui.plugin.add("resizable","alsoResize",{start:function(){var e=a(this).data("resizable").options,h=function(g){a(g).each(function(){var i=a(this);i.data("resizable-alsoresize",{width:parseInt(i.width(), -10),height:parseInt(i.height(),10),left:parseInt(i.css("left"),10),top:parseInt(i.css("top"),10),position:i.css("position")})})};if(typeof e.alsoResize=="object"&&!e.alsoResize.parentNode)if(e.alsoResize.length){e.alsoResize=e.alsoResize[0];h(e.alsoResize)}else a.each(e.alsoResize,function(g){h(g)});else h(e.alsoResize)},resize:function(e,h){var g=a(this).data("resizable");e=g.options;var i=g.originalSize,b=g.originalPosition,f={height:g.size.height-i.height||0,width:g.size.width-i.width||0,top:g.position.top- -b.top||0,left:g.position.left-b.left||0},j=function(l,o){a(l).each(function(){var n=a(this),k=a(this).data("resizable-alsoresize"),m={},p=o&&o.length?o:n.parents(h.originalElement[0]).length?["width","height"]:["width","height","top","left"];a.each(p,function(q,s){if((q=(k[s]||0)+(f[s]||0))&&q>=0)m[s]=q||null});if(a.browser.opera&&/relative/.test(n.css("position"))){g._revertToRelativePosition=true;n.css({position:"absolute",top:"auto",left:"auto"})}n.css(m)})};typeof e.alsoResize=="object"&&!e.alsoResize.nodeType? -a.each(e.alsoResize,function(l,o){j(l,o)}):j(e.alsoResize)},stop:function(){var e=a(this).data("resizable"),h=e.options,g=function(i){a(i).each(function(){var b=a(this);b.css({position:b.data("resizable-alsoresize").position})})};if(e._revertToRelativePosition){e._revertToRelativePosition=false;typeof h.alsoResize=="object"&&!h.alsoResize.nodeType?a.each(h.alsoResize,function(i){g(i)}):g(h.alsoResize)}a(this).removeData("resizable-alsoresize")}});a.ui.plugin.add("resizable","animate",{stop:function(e){var h= -a(this).data("resizable"),g=h.options,i=h._proportionallyResizeElements,b=i.length&&/textarea/i.test(i[0].nodeName),f=b&&a.ui.hasScroll(i[0],"left")?0:h.sizeDiff.height;b={width:h.size.width-(b?0:h.sizeDiff.width),height:h.size.height-f};f=parseInt(h.element.css("left"),10)+(h.position.left-h.originalPosition.left)||null;var j=parseInt(h.element.css("top"),10)+(h.position.top-h.originalPosition.top)||null;h.element.animate(a.extend(b,j&&f?{top:j,left:f}:{}),{duration:g.animateDuration,easing:g.animateEasing, -step:function(){var l={width:parseInt(h.element.css("width"),10),height:parseInt(h.element.css("height"),10),top:parseInt(h.element.css("top"),10),left:parseInt(h.element.css("left"),10)};i&&i.length&&a(i[0]).css({width:l.width,height:l.height});h._updateCache(l);h._propagate("resize",e)}})}});a.ui.plugin.add("resizable","containment",{start:function(){var e=a(this).data("resizable"),h=e.element,g=e.options.containment;if(h=g instanceof a?g.get(0):/parent/.test(g)?h.parent().get(0):g){e.containerElement= -a(h);if(/document/.test(g)||g==document){e.containerOffset={left:0,top:0};e.containerPosition={left:0,top:0};e.parentData={element:a(document),left:0,top:0,width:a(document).width(),height:a(document).height()||document.body.parentNode.scrollHeight}}else{var i=a(h),b=[];a(["Top","Right","Left","Bottom"]).each(function(l,o){b[l]=d(i.css("padding"+o))});e.containerOffset=i.offset();e.containerPosition=i.position();e.containerSize={height:i.innerHeight()-b[3],width:i.innerWidth()-b[1]};g=e.containerOffset; -var f=e.containerSize.height,j=e.containerSize.width;j=a.ui.hasScroll(h,"left")?h.scrollWidth:j;f=a.ui.hasScroll(h)?h.scrollHeight:f;e.parentData={element:h,left:g.left,top:g.top,width:j,height:f}}}},resize:function(e){var h=a(this).data("resizable"),g=h.options,i=h.containerOffset,b=h.position;e=h._aspectRatio||e.shiftKey;var f={top:0,left:0},j=h.containerElement;if(j[0]!=document&&/static/.test(j.css("position")))f=i;if(b.left<(h._helper?i.left:0)){h.size.width+=h._helper?h.position.left-i.left: -h.position.left-f.left;if(e)h.size.height=h.size.width/g.aspectRatio;h.position.left=g.helper?i.left:0}if(b.top<(h._helper?i.top:0)){h.size.height+=h._helper?h.position.top-i.top:h.position.top;if(e)h.size.width=h.size.height*g.aspectRatio;h.position.top=h._helper?i.top:0}h.offset.left=h.parentData.left+h.position.left;h.offset.top=h.parentData.top+h.position.top;g=Math.abs((h._helper?h.offset.left-f.left:h.offset.left-f.left)+h.sizeDiff.width);i=Math.abs((h._helper?h.offset.top-f.top:h.offset.top- -i.top)+h.sizeDiff.height);b=h.containerElement.get(0)==h.element.parent().get(0);f=/relative|absolute/.test(h.containerElement.css("position"));if(b&&f)g-=h.parentData.left;if(g+h.size.width>=h.parentData.width){h.size.width=h.parentData.width-g;if(e)h.size.height=h.size.width/h.aspectRatio}if(i+h.size.height>=h.parentData.height){h.size.height=h.parentData.height-i;if(e)h.size.width=h.size.height*h.aspectRatio}},stop:function(){var e=a(this).data("resizable"),h=e.options,g=e.containerOffset,i=e.containerPosition, -b=e.containerElement,f=a(e.helper),j=f.offset(),l=f.outerWidth()-e.sizeDiff.width;f=f.outerHeight()-e.sizeDiff.height;e._helper&&!h.animate&&/relative/.test(b.css("position"))&&a(this).css({left:j.left-i.left-g.left,width:l,height:f});e._helper&&!h.animate&&/static/.test(b.css("position"))&&a(this).css({left:j.left-i.left-g.left,width:l,height:f})}});a.ui.plugin.add("resizable","ghost",{start:function(){var e=a(this).data("resizable"),h=e.options,g=e.size;e.ghost=e.originalElement.clone();e.ghost.css({opacity:0.25, -display:"block",position:"relative",height:g.height,width:g.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof h.ghost=="string"?h.ghost:"");e.ghost.appendTo(e.helper)},resize:function(){var e=a(this).data("resizable");e.ghost&&e.ghost.css({position:"relative",height:e.size.height,width:e.size.width})},stop:function(){var e=a(this).data("resizable");e.ghost&&e.helper&&e.helper.get(0).removeChild(e.ghost.get(0))}});a.ui.plugin.add("resizable","grid",{resize:function(){var e= -a(this).data("resizable"),h=e.options,g=e.size,i=e.originalSize,b=e.originalPosition,f=e.axis;h.grid=typeof h.grid=="number"?[h.grid,h.grid]:h.grid;var j=Math.round((g.width-i.width)/(h.grid[0]||1))*(h.grid[0]||1);h=Math.round((g.height-i.height)/(h.grid[1]||1))*(h.grid[1]||1);if(/^(se|s|e)$/.test(f)){e.size.width=i.width+j;e.size.height=i.height+h}else if(/^(ne)$/.test(f)){e.size.width=i.width+j;e.size.height=i.height+h;e.position.top=b.top-h}else{if(/^(sw)$/.test(f)){e.size.width=i.width+j;e.size.height= -i.height+h}else{e.size.width=i.width+j;e.size.height=i.height+h;e.position.top=b.top-h}e.position.left=b.left-j}}});var d=function(e){return parseInt(e,10)||0},c=function(e){return!isNaN(parseInt(e,10))}})(jQuery); -(function(a){a.widget("ui.selectable",a.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var d=this;this.element.addClass("ui-selectable");this.dragged=false;var c;this.refresh=function(){c=a(d.options.filter,d.element[0]);c.each(function(){var e=a(this),h=e.offset();a.data(this,"selectable-item",{element:this,$element:e,left:h.left,top:h.top,right:h.left+e.outerWidth(),bottom:h.top+e.outerHeight(),startselected:false,selected:e.hasClass("ui-selected"), -selecting:e.hasClass("ui-selecting"),unselecting:e.hasClass("ui-unselecting")})})};this.refresh();this.selectees=c.addClass("ui-selectee");this._mouseInit();this.helper=a("
        ")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(d){var c=this;this.opos=[d.pageX, -d.pageY];if(!this.options.disabled){var e=this.options;this.selectees=a(e.filter,this.element[0]);this._trigger("start",d);a(e.appendTo).append(this.helper);this.helper.css({left:d.clientX,top:d.clientY,width:0,height:0});e.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var h=a.data(this,"selectable-item");h.startselected=true;if(!d.metaKey){h.$element.removeClass("ui-selected");h.selected=false;h.$element.addClass("ui-unselecting");h.unselecting=true;c._trigger("unselecting", -d,{unselecting:h.element})}});a(d.target).parents().andSelf().each(function(){var h=a.data(this,"selectable-item");if(h){var g=!d.metaKey||!h.$element.hasClass("ui-selected");h.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");h.unselecting=!g;h.selecting=g;(h.selected=g)?c._trigger("selecting",d,{selecting:h.element}):c._trigger("unselecting",d,{unselecting:h.element});return false}})}},_mouseDrag:function(d){var c=this;this.dragged=true;if(!this.options.disabled){var e= -this.options,h=this.opos[0],g=this.opos[1],i=d.pageX,b=d.pageY;if(h>i){var f=i;i=h;h=f}if(g>b){f=b;b=g;g=f}this.helper.css({left:h,top:g,width:i-h,height:b-g});this.selectees.each(function(){var j=a.data(this,"selectable-item");if(!(!j||j.element==c.element[0])){var l=false;if(e.tolerance=="touch")l=!(j.left>i||j.rightb||j.bottomh&&j.rightg&&j.bottom *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){var d=this.options;this.containerCache={};this.element.addClass("ui-sortable"); -this.refresh();this.floating=this.items.length?d.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var d=this.items.length-1;d>=0;d--)this.items[d].item.removeData("sortable-item");return this},_setOption:function(d,c){if(d=== -"disabled"){this.options[d]=c;this.widget()[c?"addClass":"removeClass"]("ui-sortable-disabled")}else a.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(d,c){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(d);var e=null,h=this;a(d.target).parents().each(function(){if(a.data(this,"sortable-item")==h){e=a(this);return false}});if(a.data(d.target,"sortable-item")==h)e=a(d.target);if(!e)return false;if(this.options.handle&& -!c){var g=false;a(this.options.handle,e).find("*").andSelf().each(function(){if(this==d.target)g=true});if(!g)return false}this.currentItem=e;this._removeCurrentsFromItems();return true},_mouseStart:function(d,c,e){c=this.options;var h=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(d);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top, -left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");a.extend(this.offset,{click:{left:d.pageX-this.offset.left,top:d.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(d);this.originalPageX=d.pageX;this.originalPageY=d.pageY;c.cursorAt&&this._adjustOffsetFromHelper(c.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]}; -this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();c.containment&&this._setContainment();if(c.cursor){if(a("body").css("cursor"))this._storedCursor=a("body").css("cursor");a("body").css("cursor",c.cursor)}if(c.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",c.opacity)}if(c.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",c.zIndex)}if(this.scrollParent[0]!= -document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",d,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!e)for(e=this.containers.length-1;e>=0;e--)this.containers[e]._trigger("activate",d,h._uiHash(this));if(a.ui.ddmanager)a.ui.ddmanager.current=this;a.ui.ddmanager&&!c.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,d);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(d); -return true},_mouseDrag:function(d){this.position=this._generatePosition(d);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var c=this.options,e=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-d.pageY=0;c--){e=this.items[c];var h=e.item[0],g=this._intersectsWithPointer(e);if(g)if(h!=this.currentItem[0]&&this.placeholder[g==1?"next":"prev"]()[0]!=h&&!a.ui.contains(this.placeholder[0],h)&&(this.options.type=="semi-dynamic"?!a.ui.contains(this.element[0], -h):true)){this.direction=g==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(e))this._rearrange(d,e);else break;this._trigger("change",d,this._uiHash());break}}this._contactContainers(d);a.ui.ddmanager&&a.ui.ddmanager.drag(this,d);this._trigger("sort",d,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(d,c){if(d){a.ui.ddmanager&&!this.options.dropBehaviour&&a.ui.ddmanager.drop(this,d);if(this.options.revert){var e=this;c=e.placeholder.offset(); -e.reverting=true;a(this.helper).animate({left:c.left-this.offset.parent.left-e.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:c.top-this.offset.parent.top-e.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){e._clear(d)})}else this._clear(d,c);return false}},cancel:function(){var d=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"): -this.currentItem.show();for(var c=this.containers.length-1;c>=0;c--){this.containers[c]._trigger("deactivate",null,d._uiHash(this));if(this.containers[c].containerCache.over){this.containers[c]._trigger("out",null,d._uiHash(this));this.containers[c].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();a.extend(this,{helper:null, -dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?a(this.domPosition.prev).after(this.currentItem):a(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(d){var c=this._getItemsAsjQuery(d&&d.connected),e=[];d=d||{};a(c).each(function(){var h=(a(d.item||this).attr(d.attribute||"id")||"").match(d.expression||/(.+)[-=_](.+)/);if(h)e.push((d.key||h[1]+"[]")+"="+(d.key&&d.expression?h[1]:h[2]))});!e.length&&d.key&&e.push(d.key+"=");return e.join("&")}, -toArray:function(d){var c=this._getItemsAsjQuery(d&&d.connected),e=[];d=d||{};c.each(function(){e.push(a(d.item||this).attr(d.attribute||"id")||"")});return e},_intersectsWith:function(d){var c=this.positionAbs.left,e=c+this.helperProportions.width,h=this.positionAbs.top,g=h+this.helperProportions.height,i=d.left,b=i+d.width,f=d.top,j=f+d.height,l=this.offset.click.top,o=this.offset.click.left;l=h+l>f&&h+li&&c+od[this.floating?"width":"height"]?l:i0?"down":"up")},_getDragHorizontalDirection:function(){var d=this.positionAbs.left-this.lastPositionAbs.left;return d!=0&&(d>0?"right":"left")},refresh:function(d){this._refreshItems(d);this.refreshPositions();return this},_connectWith:function(){var d=this.options;return d.connectWith.constructor==String?[d.connectWith]:d.connectWith},_getItemsAsjQuery:function(d){var c=[],e=[],h=this._connectWith(); -if(h&&d)for(d=h.length-1;d>=0;d--)for(var g=a(h[d]),i=g.length-1;i>=0;i--){var b=a.data(g[i],"sortable");if(b&&b!=this&&!b.options.disabled)e.push([a.isFunction(b.options.items)?b.options.items.call(b.element):a(b.options.items,b.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),b])}e.push([a.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):a(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), -this]);for(d=e.length-1;d>=0;d--)e[d][0].each(function(){c.push(this)});return a(c)},_removeCurrentsFromItems:function(){for(var d=this.currentItem.find(":data(sortable-item)"),c=0;c=0;g--)for(var i=a(h[g]),b=i.length-1;b>=0;b--){var f=a.data(i[b],"sortable");if(f&&f!=this&&!f.options.disabled){e.push([a.isFunction(f.options.items)?f.options.items.call(f.element[0],d,{item:this.currentItem}):a(f.options.items,f.element),f]);this.containers.push(f)}}for(g=e.length-1;g>=0;g--){d=e[g][1];h=e[g][0];b=0;for(i=h.length;b=0;c--){var e=this.items[c];if(!(e.instance!=this.currentContainer&&this.currentContainer&&e.item[0]!=this.currentItem[0])){var h=this.options.toleranceElement?a(this.options.toleranceElement,e.item):e.item;if(!d){e.width=h.outerWidth();e.height=h.outerHeight()}h=h.offset();e.left=h.left;e.top=h.top}}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(c= -this.containers.length-1;c>=0;c--){h=this.containers[c].element.offset();this.containers[c].containerCache.left=h.left;this.containers[c].containerCache.top=h.top;this.containers[c].containerCache.width=this.containers[c].element.outerWidth();this.containers[c].containerCache.height=this.containers[c].element.outerHeight()}return this},_createPlaceholder:function(d){var c=d||this,e=c.options;if(!e.placeholder||e.placeholder.constructor==String){var h=e.placeholder;e.placeholder={element:function(){var g= -a(document.createElement(c.currentItem[0].nodeName)).addClass(h||c.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!h)g.style.visibility="hidden";return g},update:function(g,i){if(!(h&&!e.forcePlaceholderSize)){i.height()||i.height(c.currentItem.innerHeight()-parseInt(c.currentItem.css("paddingTop")||0,10)-parseInt(c.currentItem.css("paddingBottom")||0,10));i.width()||i.width(c.currentItem.innerWidth()-parseInt(c.currentItem.css("paddingLeft")||0,10)-parseInt(c.currentItem.css("paddingRight")|| -0,10))}}}}c.placeholder=a(e.placeholder.element.call(c.element,c.currentItem));c.currentItem.after(c.placeholder);e.placeholder.update(c,c.placeholder)},_contactContainers:function(d){for(var c=null,e=null,h=this.containers.length-1;h>=0;h--)if(!a.ui.contains(this.currentItem[0],this.containers[h].element[0]))if(this._intersectsWith(this.containers[h].containerCache)){if(!(c&&a.ui.contains(this.containers[h].element[0],c.element[0]))){c=this.containers[h];e=h}}else if(this.containers[h].containerCache.over){this.containers[h]._trigger("out", -d,this._uiHash(this));this.containers[h].containerCache.over=0}if(c)if(this.containers.length===1){this.containers[e]._trigger("over",d,this._uiHash(this));this.containers[e].containerCache.over=1}else if(this.currentContainer!=this.containers[e]){c=1E4;h=null;for(var g=this.positionAbs[this.containers[e].floating?"left":"top"],i=this.items.length-1;i>=0;i--)if(a.ui.contains(this.containers[e].element[0],this.items[i].item[0])){var b=this.items[i][this.containers[e].floating?"left":"top"];if(Math.abs(b- -g)this.containment[2])g=this.containment[2]+this.offset.click.left;if(d.pageY-this.offset.click.top>this.containment[3])i=this.containment[3]+this.offset.click.top}if(c.grid){i=this.originalPageY+Math.round((i- -this.originalPageY)/c.grid[1])*c.grid[1];i=this.containment?!(i-this.offset.click.topthis.containment[3])?i:!(i-this.offset.click.topthis.containment[2])?g:!(g-this.offset.click.left=0;h--)if(a.ui.contains(this.containers[h].element[0],this.currentItem[0])&&!c){e.push(function(g){return function(i){g._trigger("receive",i,this._uiHash(this))}}.call(this,this.containers[h]));e.push(function(g){return function(i){g._trigger("update",i,this._uiHash(this))}}.call(this,this.containers[h]))}}for(h=this.containers.length-1;h>=0;h--){c||e.push(function(g){return function(i){g._trigger("deactivate",i,this._uiHash(this))}}.call(this, -this.containers[h]));if(this.containers[h].containerCache.over){e.push(function(g){return function(i){g._trigger("out",i,this._uiHash(this))}}.call(this,this.containers[h]));this.containers[h].containerCache.over=0}}this._storedCursor&&a("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!c){this._trigger("beforeStop", -d,this._uiHash());for(h=0;h
        ").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}), -p=document.activeElement;n.wrap(m);if(n[0]===p||a.contains(n[0],p))a(p).focus();m=n.parent();if(n.css("position")=="static"){m.css({position:"relative"});n.css({position:"relative"})}else{a.extend(k,{position:n.css("position"),zIndex:n.css("z-index")});a.each(["top","left","bottom","right"],function(q,s){k[s]=n.css(s);if(isNaN(parseInt(k[s],10)))k[s]="auto"});n.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return m.css(k).show()},removeWrapper:function(n){var k,m=document.activeElement; -if(n.parent().is(".ui-effects-wrapper")){k=n.parent().replaceWith(n);if(n[0]===m||a.contains(n[0],m))a(m).focus();return k}return n},setTransition:function(n,k,m,p){p=p||{};a.each(k,function(q,s){unit=n.cssUnit(s);if(unit[0]>0)p[s]=unit[0]*m+unit[1]});return p}});a.fn.extend({effect:function(n){var k=b.apply(this,arguments),m={options:k[1],duration:k[2],callback:k[3]};k=m.options.mode;var p=a.effects[n];if(a.fx.off||!p)return k?this[k](m.duration,m.callback):this.each(function(){m.callback&&m.callback.call(this)}); -return p.call(this,m)},_show:a.fn.show,show:function(n){if(f(n))return this._show.apply(this,arguments);else{var k=b.apply(this,arguments);k[1].mode="show";return this.effect.apply(this,k)}},_hide:a.fn.hide,hide:function(n){if(f(n))return this._hide.apply(this,arguments);else{var k=b.apply(this,arguments);k[1].mode="hide";return this.effect.apply(this,k)}},__toggle:a.fn.toggle,toggle:function(n){if(f(n)||typeof n==="boolean"||a.isFunction(n))return this.__toggle.apply(this,arguments);else{var k=b.apply(this, -arguments);k[1].mode="toggle";return this.effect.apply(this,k)}},cssUnit:function(n){var k=this.css(n),m=[];a.each(["em","px","%","pt"],function(p,q){if(k.indexOf(q)>0)m=[parseFloat(k),q]});return m}});a.easing.jswing=a.easing.swing;a.extend(a.easing,{def:"easeOutQuad",swing:function(n,k,m,p,q){return a.easing[a.easing.def](n,k,m,p,q)},easeInQuad:function(n,k,m,p,q){return p*(k/=q)*k+m},easeOutQuad:function(n,k,m,p,q){return-p*(k/=q)*(k-2)+m},easeInOutQuad:function(n,k,m,p,q){if((k/=q/2)<1)return p/ -2*k*k+m;return-p/2*(--k*(k-2)-1)+m},easeInCubic:function(n,k,m,p,q){return p*(k/=q)*k*k+m},easeOutCubic:function(n,k,m,p,q){return p*((k=k/q-1)*k*k+1)+m},easeInOutCubic:function(n,k,m,p,q){if((k/=q/2)<1)return p/2*k*k*k+m;return p/2*((k-=2)*k*k+2)+m},easeInQuart:function(n,k,m,p,q){return p*(k/=q)*k*k*k+m},easeOutQuart:function(n,k,m,p,q){return-p*((k=k/q-1)*k*k*k-1)+m},easeInOutQuart:function(n,k,m,p,q){if((k/=q/2)<1)return p/2*k*k*k*k+m;return-p/2*((k-=2)*k*k*k-2)+m},easeInQuint:function(n,k,m, -p,q){return p*(k/=q)*k*k*k*k+m},easeOutQuint:function(n,k,m,p,q){return p*((k=k/q-1)*k*k*k*k+1)+m},easeInOutQuint:function(n,k,m,p,q){if((k/=q/2)<1)return p/2*k*k*k*k*k+m;return p/2*((k-=2)*k*k*k*k+2)+m},easeInSine:function(n,k,m,p,q){return-p*Math.cos(k/q*(Math.PI/2))+p+m},easeOutSine:function(n,k,m,p,q){return p*Math.sin(k/q*(Math.PI/2))+m},easeInOutSine:function(n,k,m,p,q){return-p/2*(Math.cos(Math.PI*k/q)-1)+m},easeInExpo:function(n,k,m,p,q){return k==0?m:p*Math.pow(2,10*(k/q-1))+m},easeOutExpo:function(n, -k,m,p,q){return k==q?m+p:p*(-Math.pow(2,-10*k/q)+1)+m},easeInOutExpo:function(n,k,m,p,q){if(k==0)return m;if(k==q)return m+p;if((k/=q/2)<1)return p/2*Math.pow(2,10*(k-1))+m;return p/2*(-Math.pow(2,-10*--k)+2)+m},easeInCirc:function(n,k,m,p,q){return-p*(Math.sqrt(1-(k/=q)*k)-1)+m},easeOutCirc:function(n,k,m,p,q){return p*Math.sqrt(1-(k=k/q-1)*k)+m},easeInOutCirc:function(n,k,m,p,q){if((k/=q/2)<1)return-p/2*(Math.sqrt(1-k*k)-1)+m;return p/2*(Math.sqrt(1-(k-=2)*k)+1)+m},easeInElastic:function(n,k,m, -p,q){n=1.70158;var s=0,r=p;if(k==0)return m;if((k/=q)==1)return m+p;s||(s=q*0.3);if(r
        ").css({position:"absolute",visibility:"visible",left:-j*(i/e),top:-f*(b/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:i/e,height:b/c,left:g.left+j*(i/e)+(d.options.mode=="show"?(j-Math.floor(e/2))*(i/e):0),top:g.top+f*(b/c)+(d.options.mode=="show"?(f-Math.floor(c/2))*(b/c):0),opacity:d.options.mode=="show"?0:1}).animate({left:g.left+j*(i/e)+(d.options.mode=="show"?0:(j-Math.floor(e/2))*(i/e)),top:g.top+ -f*(b/c)+(d.options.mode=="show"?0:(f-Math.floor(c/2))*(b/c)),opacity:d.options.mode=="show"?1:0},d.duration||500);setTimeout(function(){d.options.mode=="show"?h.css({visibility:"visible"}):h.css({visibility:"visible"}).hide();d.callback&&d.callback.apply(h[0]);h.dequeue();a("div.ui-effects-explode").remove()},d.duration||500)})}})(jQuery); -(function(a){a.effects.fade=function(d){return this.queue(function(){var c=a(this),e=a.effects.setMode(c,d.options.mode||"hide");c.animate({opacity:e},{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){d.callback&&d.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); -(function(a){a.effects.fold=function(d){return this.queue(function(){var c=a(this),e=["position","top","bottom","left","right"],h=a.effects.setMode(c,d.options.mode||"hide"),g=d.options.size||15,i=!!d.options.horizFirst,b=d.duration?d.duration/2:a.fx.speeds._default/2;a.effects.save(c,e);c.show();var f=a.effects.createWrapper(c).css({overflow:"hidden"}),j=h=="show"!=i,l=j?["width","height"]:["height","width"];j=j?[f.width(),f.height()]:[f.height(),f.width()];var o=/([0-9]+)%/.exec(g);if(o)g=parseInt(o[1], -10)/100*j[h=="hide"?0:1];if(h=="show")f.css(i?{height:0,width:g}:{height:g,width:0});i={};o={};i[l[0]]=h=="show"?j[0]:g;o[l[1]]=h=="show"?j[1]:0;f.animate(i,b,d.options.easing).animate(o,b,d.options.easing,function(){h=="hide"&&c.hide();a.effects.restore(c,e);a.effects.removeWrapper(c);d.callback&&d.callback.apply(c[0],arguments);c.dequeue()})})}})(jQuery); -(function(a){a.effects.highlight=function(d){return this.queue(function(){var c=a(this),e=["backgroundImage","backgroundColor","opacity"],h=a.effects.setMode(c,d.options.mode||"show"),g={backgroundColor:c.css("backgroundColor")};if(h=="hide")g.opacity=0;a.effects.save(c,e);c.show().css({backgroundImage:"none",backgroundColor:d.options.color||"#ffff99"}).animate(g,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){h=="hide"&&c.hide();a.effects.restore(c,e);h=="show"&&!a.support.opacity&& -this.style.removeAttribute("filter");d.callback&&d.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); -(function(a){a.effects.pulsate=function(d){return this.queue(function(){var c=a(this),e=a.effects.setMode(c,d.options.mode||"show");times=(d.options.times||5)*2-1;duration=d.duration?d.duration/2:a.fx.speeds._default/2;isVisible=c.is(":visible");animateTo=0;if(!isVisible){c.css("opacity",0).show();animateTo=1}if(e=="hide"&&isVisible||e=="show"&&!isVisible)times--;for(e=0;e
      ').appendTo(document.body).addClass(d.options.className).css({top:h.top,left:h.left,height:c.innerHeight(),width:c.innerWidth(),position:"absolute"}).animate(e,d.duration,d.options.easing,function(){g.remove();d.callback&&d.callback.apply(c[0],arguments); -c.dequeue()})})}})(jQuery); -(function(a){a.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var d=this,c=d.options;d.running=0;d.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix");d.headers= -d.element.find(c.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){c.disabled||a(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){c.disabled||a(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){c.disabled||a(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){c.disabled||a(this).removeClass("ui-state-focus")});d.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); -if(c.navigation){var e=d.element.find("a").filter(c.navigationFilter).eq(0);if(e.length){var h=e.closest(".ui-accordion-header");d.active=h.length?h:e.closest(".ui-accordion-content").prev()}}d.active=d._findActive(d.active||c.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");d.active.next().addClass("ui-accordion-content-active");d._createIcons();d.resize();d.element.attr("role","tablist");d.headers.attr("role","tab").bind("keydown.accordion", -function(g){return d._keydown(g)}).next().attr("role","tabpanel");d.headers.not(d.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();d.active.length?d.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):d.headers.eq(0).attr("tabIndex",0);a.browser.safari||d.headers.find("a").attr("tabIndex",-1);c.event&&d.headers.bind(c.event.split(" ").join(".accordion ")+".accordion",function(g){d._clickHandler.call(d,g,this);g.preventDefault()})},_createIcons:function(){var d= -this.options;if(d.icons){a("").addClass("ui-icon "+d.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(d.icons.header).toggleClass(d.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var d=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"); -this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var c=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(d.autoHeight||d.fillHeight)c.css("height","");return a.Widget.prototype.destroy.call(this)},_setOption:function(d,c){a.Widget.prototype._setOption.apply(this,arguments);d=="active"&&this.activate(c);if(d=="icons"){this._destroyIcons(); -c&&this._createIcons()}if(d=="disabled")this.headers.add(this.headers.next())[c?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(d){if(!(this.options.disabled||d.altKey||d.ctrlKey)){var c=a.ui.keyCode,e=this.headers.length,h=this.headers.index(d.target),g=false;switch(d.keyCode){case c.RIGHT:case c.DOWN:g=this.headers[(h+1)%e];break;case c.LEFT:case c.UP:g=this.headers[(h-1+e)%e];break;case c.SPACE:case c.ENTER:this._clickHandler({target:d.target},d.target); -d.preventDefault()}if(g){a(d.target).attr("tabIndex",-1);a(g).attr("tabIndex",0);g.focus();return false}return true}},resize:function(){var d=this.options,c;if(d.fillSpace){if(a.browser.msie){var e=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}c=this.element.parent().height();a.browser.msie&&this.element.parent().css("overflow",e);this.headers.each(function(){c-=a(this).outerHeight(true)});this.headers.next().each(function(){a(this).height(Math.max(0,c-a(this).innerHeight()+ -a(this).height()))}).css("overflow","auto")}else if(d.autoHeight){c=0;this.headers.next().each(function(){c=Math.max(c,a(this).height("").height())}).height(c)}return this},activate:function(d){this.options.active=d;d=this._findActive(d)[0];this._clickHandler({target:d},d);return this},_findActive:function(d){return d?typeof d==="number"?this.headers.filter(":eq("+d+")"):this.headers.not(this.headers.not(d)):d===false?a([]):this.headers.filter(":eq(0)")},_clickHandler:function(d,c){var e=this.options; -if(!e.disabled)if(d.target){d=a(d.currentTarget||c);c=d[0]===this.active[0];e.active=e.collapsible&&c?false:this.headers.index(d);if(!(this.running||!e.collapsible&&c)){var h=this.active;f=d.next();i=this.active.next();b={options:e,newHeader:c&&e.collapsible?a([]):d,oldHeader:this.active,newContent:c&&e.collapsible?a([]):f,oldContent:i};var g=this.headers.index(this.active[0])>this.headers.index(d[0]);this.active=c?a([]):d;this._toggle(f,i,b,c,g);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(e.icons.headerSelected).addClass(e.icons.header); -if(!c){d.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(e.icons.header).addClass(e.icons.headerSelected);d.next().addClass("ui-accordion-content-active")}}}else if(e.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(e.icons.headerSelected).addClass(e.icons.header);this.active.next().addClass("ui-accordion-content-active");var i=this.active.next(), -b={options:e,newHeader:a([]),oldHeader:e.active,newContent:a([]),oldContent:i},f=this.active=a([]);this._toggle(f,i,b)}},_toggle:function(d,c,e,h,g){var i=this,b=i.options;i.toShow=d;i.toHide=c;i.data=e;var f=function(){if(i)return i._completed.apply(i,arguments)};i._trigger("changestart",null,i.data);i.running=c.size()===0?d.size():c.size();if(b.animated){e={};e=b.collapsible&&h?{toShow:a([]),toHide:c,complete:f,down:g,autoHeight:b.autoHeight||b.fillSpace}:{toShow:d,toHide:c,complete:f,down:g,autoHeight:b.autoHeight|| -b.fillSpace};if(!b.proxied)b.proxied=b.animated;if(!b.proxiedDuration)b.proxiedDuration=b.duration;b.animated=a.isFunction(b.proxied)?b.proxied(e):b.proxied;b.duration=a.isFunction(b.proxiedDuration)?b.proxiedDuration(e):b.proxiedDuration;h=a.ui.accordion.animations;var j=b.duration,l=b.animated;if(l&&!h[l]&&!a.easing[l])l="slide";h[l]||(h[l]=function(o){this.slide(o,{easing:l,duration:j||700})});h[l](e)}else{if(b.collapsible&&h)d.toggle();else{c.hide();d.show()}f(true)}c.prev().attr({"aria-expanded":"false", -"aria-selected":"false",tabIndex:-1}).blur();d.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(d){this.running=d?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});a.extend(a.ui.accordion,{version:"1.8.16", -animations:{slide:function(d,c){d=a.extend({easing:"swing",duration:300},d,c);if(d.toHide.size())if(d.toShow.size()){var e=d.toShow.css("overflow"),h=0,g={},i={},b;c=d.toShow;b=c[0].style.width;c.width(parseInt(c.parent().width(),10)-parseInt(c.css("paddingLeft"),10)-parseInt(c.css("paddingRight"),10)-(parseInt(c.css("borderLeftWidth"),10)||0)-(parseInt(c.css("borderRightWidth"),10)||0));a.each(["height","paddingTop","paddingBottom"],function(f,j){i[j]="hide";f=(""+a.css(d.toShow[0],j)).match(/^([\d+-.]+)(.*)$/); -g[j]={value:f[1],unit:f[2]||"px"}});d.toShow.css({height:0,overflow:"hidden"}).show();d.toHide.filter(":hidden").each(d.complete).end().filter(":visible").animate(i,{step:function(f,j){if(j.prop=="height")h=j.end-j.start===0?0:(j.now-j.start)/(j.end-j.start);d.toShow[0].style[j.prop]=h*g[j.prop].value+g[j.prop].unit},duration:d.duration,easing:d.easing,complete:function(){d.autoHeight||d.toShow.css("height","");d.toShow.css({width:b,overflow:e});d.complete()}})}else d.toHide.animate({height:"hide", -paddingTop:"hide",paddingBottom:"hide"},d);else d.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},d)},bounceslide:function(d){this.slide(d,{easing:d.down?"easeOutBounce":"swing",duration:d.down?1E3:200})}}})})(jQuery); -(function(a){var d=0;a.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var c=this,e=this.element[0].ownerDocument,h;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(g){if(!(c.options.disabled||c.element.propAttr("readOnly"))){h= -false;var i=a.ui.keyCode;switch(g.keyCode){case i.PAGE_UP:c._move("previousPage",g);break;case i.PAGE_DOWN:c._move("nextPage",g);break;case i.UP:c._move("previous",g);g.preventDefault();break;case i.DOWN:c._move("next",g);g.preventDefault();break;case i.ENTER:case i.NUMPAD_ENTER:if(c.menu.active){h=true;g.preventDefault()}case i.TAB:if(!c.menu.active)return;c.menu.select(g);break;case i.ESCAPE:c.element.val(c.term);c.close(g);break;default:clearTimeout(c.searching);c.searching=setTimeout(function(){if(c.term!= -c.element.val()){c.selectedItem=null;c.search(null,g)}},c.options.delay);break}}}).bind("keypress.autocomplete",function(g){if(h){h=false;g.preventDefault()}}).bind("focus.autocomplete",function(){if(!c.options.disabled){c.selectedItem=null;c.previous=c.element.val()}}).bind("blur.autocomplete",function(g){if(!c.options.disabled){clearTimeout(c.searching);c.closing=setTimeout(function(){c.close(g);c._change(g)},150)}});this._initSource();this.response=function(){return c._response.apply(c,arguments)}; -this.menu=a("
        ").addClass("ui-autocomplete").appendTo(a(this.options.appendTo||"body",e)[0]).mousedown(function(g){var i=c.menu.element[0];a(g.target).closest(".ui-menu-item").length||setTimeout(function(){a(document).one("mousedown",function(b){b.target!==c.element[0]&&b.target!==i&&!a.ui.contains(i,b.target)&&c.close()})},1);setTimeout(function(){clearTimeout(c.closing)},13)}).menu({focus:function(g,i){i=i.item.data("item.autocomplete");false!==c._trigger("focus",g,{item:i})&&/^key/.test(g.originalEvent.type)&& -c.element.val(i.value)},selected:function(g,i){var b=i.item.data("item.autocomplete"),f=c.previous;if(c.element[0]!==e.activeElement){c.element.focus();c.previous=f;setTimeout(function(){c.previous=f;c.selectedItem=b},1)}false!==c._trigger("select",g,{item:b})&&c.element.val(b.value);c.term=c.element.val();c.close(g);c.selectedItem=b},blur:function(){c.menu.element.is(":visible")&&c.element.val()!==c.term&&c.element.val(c.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"); -a.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();a.Widget.prototype.destroy.call(this)},_setOption:function(c,e){a.Widget.prototype._setOption.apply(this,arguments);c==="source"&&this._initSource();if(c==="appendTo")this.menu.element.appendTo(a(e||"body",this.element[0].ownerDocument)[0]);c==="disabled"&& -e&&this.xhr&&this.xhr.abort()},_initSource:function(){var c=this,e,h;if(a.isArray(this.options.source)){e=this.options.source;this.source=function(g,i){i(a.ui.autocomplete.filter(e,g.term))}}else if(typeof this.options.source==="string"){h=this.options.source;this.source=function(g,i){c.xhr&&c.xhr.abort();c.xhr=a.ajax({url:h,data:g,dataType:"json",autocompleteRequest:++d,success:function(b){this.autocompleteRequest===d&&i(b)},error:function(){this.autocompleteRequest===d&&i([])}})}}else this.source= -this.options.source},search:function(c,e){c=c!=null?c:this.element.val();this.term=this.element.val();if(c.length
        • ").data("item.autocomplete",e).append(a("").text(e.label)).appendTo(c)},_move:function(c,e){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(c)||this.menu.last()&&/^next/.test(c)){this.element.val(this.term);this.menu.deactivate()}else this.menu[c](e);else this.search(null,e)},widget:function(){return this.menu.element}});a.extend(a.ui.autocomplete,{escapeRegex:function(c){return c.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, -"\\$&")},filter:function(c,e){var h=new RegExp(a.ui.autocomplete.escapeRegex(e),"i");return a.grep(c,function(g){return h.test(g.label||g.value||g)})}})})(jQuery); -(function(a){a.widget("ui.menu",{_create:function(){var d=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(c){if(a(c.target).closest(".ui-menu-item a").length){c.preventDefault();d.select(c)}});this.refresh()},refresh:function(){var d=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex", --1).mouseenter(function(c){d.activate(c,a(this).parent())}).mouseleave(function(){d.deactivate()})},activate:function(d,c){this.deactivate();if(this.hasScroll()){var e=c.offset().top-this.element.offset().top,h=this.element.scrollTop(),g=this.element.height();if(e<0)this.element.scrollTop(h+e);else e>=g&&this.element.scrollTop(h+e-g+c.height())}this.active=c.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",d,{item:c})},deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id"); -this._trigger("blur");this.active=null}},next:function(d){this.move("next",".ui-menu-item:first",d)},previous:function(d){this.move("prev",".ui-menu-item:last",d)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(d,c,e){if(this.active){d=this.active[d+"All"](".ui-menu-item").eq(0);d.length?this.activate(e,d):this.activate(e,this.element.children(c))}else this.activate(e, -this.element.children(c))},nextPage:function(d){if(this.hasScroll())if(!this.active||this.last())this.activate(d,this.element.children(".ui-menu-item:first"));else{var c=this.active.offset().top,e=this.element.height(),h=this.element.children(".ui-menu-item").filter(function(){var g=a(this).offset().top-c-e+a(this).height();return g<10&&g>-10});h.length||(h=this.element.children(".ui-menu-item:last"));this.activate(d,h)}else this.activate(d,this.element.children(".ui-menu-item").filter(!this.active|| -this.last()?":first":":last"))},previousPage:function(d){if(this.hasScroll())if(!this.active||this.first())this.activate(d,this.element.children(".ui-menu-item:last"));else{var c=this.active.offset().top,e=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var h=a(this).offset().top-c+e-a(this).height();return h<10&&h>-10});result.length||(result=this.element.children(".ui-menu-item:first"));this.activate(d,result)}else this.activate(d,this.element.children(".ui-menu-item").filter(!this.active|| -this.first()?":last":":first"))},hasScroll:function(){return this.element.height()").addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),j=this.options.icons,l=j.primary&&j.secondary,o=[];if(j.primary||j.secondary){if(this.options.text)o.push("ui-button-text-icon"+(l?"s":j.primary?"-primary":"-secondary"));j.primary&&b.prepend("");j.secondary&&b.append("");if(!this.options.text){o.push(l?"ui-button-icons-only": -"ui-button-icon-only");this.hasTitle||b.attr("title",f)}}else o.push("ui-button-text-only");b.addClass(o.join(" "))}}});a.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(b,f){b==="disabled"&&this.buttons.button("option",b,f);a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var b=this.element.css("direction")=== -"ltr";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(b?"ui-corner-left":"ui-corner-right").end().filter(":last").addClass(b?"ui-corner-right":"ui-corner-left").end().end()},destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy"); -a.Widget.prototype.destroy.call(this)}})})(jQuery); -(function(a,d){function c(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass= -"ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su", -"Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10", -minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false,disabled:false};a.extend(this._defaults,this.regional[""]);this.dpDiv=e(a('
        '))}function e(b){return b.bind("mouseout", -function(f){f=a(f.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");f.length&&f.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(f){f=a(f.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");if(!(a.datepicker._isDisabledDatepicker(i.inline?b.parent()[0]:i.input[0])||!f.length)){f.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover"); -f.addClass("ui-state-hover");f.hasClass("ui-datepicker-prev")&&f.addClass("ui-datepicker-prev-hover");f.hasClass("ui-datepicker-next")&&f.addClass("ui-datepicker-next-hover")}})}function h(b,f){a.extend(b,f);for(var j in f)if(f[j]==null||f[j]==d)b[j]=f[j];return b}a.extend(a.ui,{datepicker:{version:"1.8.16"}});var g=(new Date).getTime(),i;a.extend(c.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv}, -setDefaults:function(b){h(this._defaults,b||{});return this},_attachDatepicker:function(b,f){var j=null;for(var l in this._defaults){var o=b.getAttribute("date:"+l);if(o){j=j||{};try{j[l]=eval(o)}catch(n){j[l]=o}}}l=b.nodeName.toLowerCase();o=l=="div"||l=="span";if(!b.id){this.uuid+=1;b.id="dp"+this.uuid}var k=this._newInst(a(b),o);k.settings=a.extend({},f||{},j||{});if(l=="input")this._connectDatepicker(b,k);else o&&this._inlineDatepicker(b,k)},_newInst:function(b,f){return{id:b[0].id.replace(/([^A-Za-z0-9_-])/g, -"\\\\$1"),input:b,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:f,dpDiv:!f?this.dpDiv:e(a('
        '))}},_connectDatepicker:function(b,f){var j=a(b);f.append=a([]);f.trigger=a([]);if(!j.hasClass(this.markerClassName)){this._attachments(j,f);j.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker", -function(l,o,n){f.settings[o]=n}).bind("getData.datepicker",function(l,o){return this._get(f,o)});this._autoSize(f);a.data(b,"datepicker",f);f.settings.disabled&&this._disableDatepicker(b)}},_attachments:function(b,f){var j=this._get(f,"appendText"),l=this._get(f,"isRTL");f.append&&f.append.remove();if(j){f.append=a(''+j+"");b[l?"before":"after"](f.append)}b.unbind("focus",this._showDatepicker);f.trigger&&f.trigger.remove();j=this._get(f,"showOn");if(j== -"focus"||j=="both")b.focus(this._showDatepicker);if(j=="button"||j=="both"){j=this._get(f,"buttonText");var o=this._get(f,"buttonImage");f.trigger=a(this._get(f,"buttonImageOnly")?a("").addClass(this._triggerClass).attr({src:o,alt:j,title:j}):a('').addClass(this._triggerClass).html(o==""?j:a("").attr({src:o,alt:j,title:j})));b[l?"before":"after"](f.trigger);f.trigger.click(function(){a.datepicker._datepickerShowing&&a.datepicker._lastInput==b[0]?a.datepicker._hideDatepicker(): -a.datepicker._showDatepicker(b[0]);return false})}},_autoSize:function(b){if(this._get(b,"autoSize")&&!b.inline){var f=new Date(2009,11,20),j=this._get(b,"dateFormat");if(j.match(/[DM]/)){var l=function(o){for(var n=0,k=0,m=0;mn){n=o[m].length;k=m}return k};f.setMonth(l(this._get(b,j.match(/MM/)?"monthNames":"monthNamesShort")));f.setDate(l(this._get(b,j.match(/DD/)?"dayNames":"dayNamesShort"))+20-f.getDay())}b.input.attr("size",this._formatDate(b,f).length)}},_inlineDatepicker:function(b, -f){var j=a(b);if(!j.hasClass(this.markerClassName)){j.addClass(this.markerClassName).append(f.dpDiv).bind("setData.datepicker",function(l,o,n){f.settings[o]=n}).bind("getData.datepicker",function(l,o){return this._get(f,o)});a.data(b,"datepicker",f);this._setDate(f,this._getDefaultDate(f),true);this._updateDatepicker(f);this._updateAlternate(f);f.settings.disabled&&this._disableDatepicker(b);f.dpDiv.css("display","block")}},_dialogDatepicker:function(b,f,j,l,o){b=this._dialogInst;if(!b){this.uuid+= -1;this._dialogInput=a('');this._dialogInput.keydown(this._doKeyDown);a("body").append(this._dialogInput);b=this._dialogInst=this._newInst(this._dialogInput,false);b.settings={};a.data(this._dialogInput[0],"datepicker",b)}h(b.settings,l||{});f=f&&f.constructor==Date?this._formatDate(b,f):f;this._dialogInput.val(f);this._pos=o?o.length?o:[o.pageX,o.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/ -2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");b.settings.onSelect=j;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);a.blockUI&&a.blockUI(this.dpDiv);a.data(this._dialogInput[0],"datepicker",b);return this},_destroyDatepicker:function(b){var f= -a(b),j=a.data(b,"datepicker");if(f.hasClass(this.markerClassName)){var l=b.nodeName.toLowerCase();a.removeData(b,"datepicker");if(l=="input"){j.append.remove();j.trigger.remove();f.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else if(l=="div"||l=="span")f.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(b){var f=a(b),j=a.data(b,"datepicker");if(f.hasClass(this.markerClassName)){var l= -b.nodeName.toLowerCase();if(l=="input"){b.disabled=false;j.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(l=="div"||l=="span"){f=f.children("."+this._inlineClass);f.children().removeClass("ui-state-disabled");f.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=a.map(this._disabledInputs,function(o){return o==b?null:o})}},_disableDatepicker:function(b){var f=a(b),j=a.data(b, -"datepicker");if(f.hasClass(this.markerClassName)){var l=b.nodeName.toLowerCase();if(l=="input"){b.disabled=true;j.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(l=="div"||l=="span"){f=f.children("."+this._inlineClass);f.children().addClass("ui-state-disabled");f.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=a.map(this._disabledInputs,function(o){return o== -b?null:o});this._disabledInputs[this._disabledInputs.length]=b}},_isDisabledDatepicker:function(b){if(!b)return false;for(var f=0;f-1}},_doKeyUp:function(b){b=a.datepicker._getInst(b.target);if(b.input.val()!=b.lastVal)try{if(a.datepicker.parseDate(a.datepicker._get(b,"dateFormat"),b.input?b.input.val():null,a.datepicker._getFormatConfig(b))){a.datepicker._setDateFromField(b);a.datepicker._updateAlternate(b);a.datepicker._updateDatepicker(b)}}catch(f){a.datepicker.log(f)}return true},_showDatepicker:function(b){b=b.target||b;if(b.nodeName.toLowerCase()!="input")b=a("input", -b.parentNode)[0];if(!(a.datepicker._isDisabledDatepicker(b)||a.datepicker._lastInput==b)){var f=a.datepicker._getInst(b);if(a.datepicker._curInst&&a.datepicker._curInst!=f){a.datepicker._datepickerShowing&&a.datepicker._triggerOnClose(a.datepicker._curInst);a.datepicker._curInst.dpDiv.stop(true,true)}var j=a.datepicker._get(f,"beforeShow");j=j?j.apply(b,[b,f]):{};if(j!==false){h(f.settings,j);f.lastVal=null;a.datepicker._lastInput=b;a.datepicker._setDateFromField(f);if(a.datepicker._inDialog)b.value= -"";if(!a.datepicker._pos){a.datepicker._pos=a.datepicker._findPos(b);a.datepicker._pos[1]+=b.offsetHeight}var l=false;a(b).parents().each(function(){l|=a(this).css("position")=="fixed";return!l});if(l&&a.browser.opera){a.datepicker._pos[0]-=document.documentElement.scrollLeft;a.datepicker._pos[1]-=document.documentElement.scrollTop}j={left:a.datepicker._pos[0],top:a.datepicker._pos[1]};a.datepicker._pos=null;f.dpDiv.empty();f.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});a.datepicker._updateDatepicker(f); -j=a.datepicker._checkOffset(f,j,l);f.dpDiv.css({position:a.datepicker._inDialog&&a.blockUI?"static":l?"fixed":"absolute",display:"none",left:j.left+"px",top:j.top+"px"});if(!f.inline){j=a.datepicker._get(f,"showAnim");var o=a.datepicker._get(f,"duration"),n=function(){var k=f.dpDiv.find("iframe.ui-datepicker-cover");if(k.length){var m=a.datepicker._getBorders(f.dpDiv);k.css({left:-m[0],top:-m[1],width:f.dpDiv.outerWidth(),height:f.dpDiv.outerHeight()})}};f.dpDiv.zIndex(a(b).zIndex()+1);a.datepicker._datepickerShowing= -true;a.effects&&a.effects[j]?f.dpDiv.show(j,a.datepicker._get(f,"showOptions"),o,n):f.dpDiv[j||"show"](j?o:null,n);if(!j||!o)n();f.input.is(":visible")&&!f.input.is(":disabled")&&f.input.focus();a.datepicker._curInst=f}}}},_updateDatepicker:function(b){this.maxRows=4;var f=a.datepicker._getBorders(b.dpDiv);i=b;b.dpDiv.empty().append(this._generateHTML(b));var j=b.dpDiv.find("iframe.ui-datepicker-cover");j.length&&j.css({left:-f[0],top:-f[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()}); -b.dpDiv.find("."+this._dayOverClass+" a").mouseover();f=this._getNumberOfMonths(b);j=f[1];b.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");j>1&&b.dpDiv.addClass("ui-datepicker-multi-"+j).css("width",17*j+"em");b.dpDiv[(f[0]!=1||f[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");b.dpDiv[(this._get(b,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");b==a.datepicker._curInst&&a.datepicker._datepickerShowing&&b.input&&b.input.is(":visible")&& -!b.input.is(":disabled")&&b.input[0]!=document.activeElement&&b.input.focus();if(b.yearshtml){var l=b.yearshtml;setTimeout(function(){l===b.yearshtml&&b.yearshtml&&b.dpDiv.find("select.ui-datepicker-year:first").replaceWith(b.yearshtml);l=b.yearshtml=null},0)}},_getBorders:function(b){var f=function(j){return{thin:1,medium:2,thick:3}[j]||j};return[parseFloat(f(b.css("border-left-width"))),parseFloat(f(b.css("border-top-width")))]},_checkOffset:function(b,f,j){var l=b.dpDiv.outerWidth(),o=b.dpDiv.outerHeight(), -n=b.input?b.input.outerWidth():0,k=b.input?b.input.outerHeight():0,m=document.documentElement.clientWidth+a(document).scrollLeft(),p=document.documentElement.clientHeight+a(document).scrollTop();f.left-=this._get(b,"isRTL")?l-n:0;f.left-=j&&f.left==b.input.offset().left?a(document).scrollLeft():0;f.top-=j&&f.top==b.input.offset().top+k?a(document).scrollTop():0;f.left-=Math.min(f.left,f.left+l>m&&m>l?Math.abs(f.left+l-m):0);f.top-=Math.min(f.top,f.top+o>p&&p>o?Math.abs(o+k):0);return f},_findPos:function(b){for(var f= -this._get(this._getInst(b),"isRTL");b&&(b.type=="hidden"||b.nodeType!=1||a.expr.filters.hidden(b));)b=b[f?"previousSibling":"nextSibling"];b=a(b).offset();return[b.left,b.top]},_triggerOnClose:function(b){var f=this._get(b,"onClose");if(f)f.apply(b.input?b.input[0]:null,[b.input?b.input.val():"",b])},_hideDatepicker:function(b){var f=this._curInst;if(!(!f||b&&f!=a.data(b,"datepicker")))if(this._datepickerShowing){b=this._get(f,"showAnim");var j=this._get(f,"duration"),l=function(){a.datepicker._tidyDialog(f); -this._curInst=null};a.effects&&a.effects[b]?f.dpDiv.hide(b,a.datepicker._get(f,"showOptions"),j,l):f.dpDiv[b=="slideDown"?"slideUp":b=="fadeIn"?"fadeOut":"hide"](b?j:null,l);b||l();a.datepicker._triggerOnClose(f);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(a.blockUI){a.unblockUI();a("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(b){b.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")}, -_checkExternalClick:function(b){if(a.datepicker._curInst){b=a(b.target);b[0].id!=a.datepicker._mainDivId&&b.parents("#"+a.datepicker._mainDivId).length==0&&!b.hasClass(a.datepicker.markerClassName)&&!b.hasClass(a.datepicker._triggerClass)&&a.datepicker._datepickerShowing&&!(a.datepicker._inDialog&&a.blockUI)&&a.datepicker._hideDatepicker()}},_adjustDate:function(b,f,j){b=a(b);var l=this._getInst(b[0]);if(!this._isDisabledDatepicker(b[0])){this._adjustInstDate(l,f+(j=="M"?this._get(l,"showCurrentAtPos"): -0),j);this._updateDatepicker(l)}},_gotoToday:function(b){b=a(b);var f=this._getInst(b[0]);if(this._get(f,"gotoCurrent")&&f.currentDay){f.selectedDay=f.currentDay;f.drawMonth=f.selectedMonth=f.currentMonth;f.drawYear=f.selectedYear=f.currentYear}else{var j=new Date;f.selectedDay=j.getDate();f.drawMonth=f.selectedMonth=j.getMonth();f.drawYear=f.selectedYear=j.getFullYear()}this._notifyChange(f);this._adjustDate(b)},_selectMonthYear:function(b,f,j){b=a(b);var l=this._getInst(b[0]);l["selected"+(j=="M"? -"Month":"Year")]=l["draw"+(j=="M"?"Month":"Year")]=parseInt(f.options[f.selectedIndex].value,10);this._notifyChange(l);this._adjustDate(b)},_selectDay:function(b,f,j,l){var o=a(b);if(!(a(l).hasClass(this._unselectableClass)||this._isDisabledDatepicker(o[0]))){o=this._getInst(o[0]);o.selectedDay=o.currentDay=a("a",l).html();o.selectedMonth=o.currentMonth=f;o.selectedYear=o.currentYear=j;this._selectDate(b,this._formatDate(o,o.currentDay,o.currentMonth,o.currentYear))}},_clearDate:function(b){b=a(b); -this._getInst(b[0]);this._selectDate(b,"")},_selectDate:function(b,f){b=this._getInst(a(b)[0]);f=f!=null?f:this._formatDate(b);b.input&&b.input.val(f);this._updateAlternate(b);var j=this._get(b,"onSelect");if(j)j.apply(b.input?b.input[0]:null,[f,b]);else b.input&&b.input.trigger("change");if(b.inline)this._updateDatepicker(b);else{this._hideDatepicker();this._lastInput=b.input[0];typeof b.input[0]!="object"&&b.input.focus();this._lastInput=null}},_updateAlternate:function(b){var f=this._get(b,"altField"); -if(f){var j=this._get(b,"altFormat")||this._get(b,"dateFormat"),l=this._getDate(b),o=this.formatDate(j,l,this._getFormatConfig(b));a(f).each(function(){a(this).val(o)})}},noWeekends:function(b){b=b.getDay();return[b>0&&b<6,""]},iso8601Week:function(b){b=new Date(b.getTime());b.setDate(b.getDate()+4-(b.getDay()||7));var f=b.getTime();b.setMonth(0);b.setDate(1);return Math.floor(Math.round((f-b)/864E5)/7)+1},parseDate:function(b,f,j){if(b==null||f==null)throw"Invalid arguments";f=typeof f=="object"? -f.toString():f+"";if(f=="")return null;var l=(j?j.shortYearCutoff:null)||this._defaults.shortYearCutoff;l=typeof l!="string"?l:(new Date).getFullYear()%100+parseInt(l,10);for(var o=(j?j.dayNamesShort:null)||this._defaults.dayNamesShort,n=(j?j.dayNames:null)||this._defaults.dayNames,k=(j?j.monthNamesShort:null)||this._defaults.monthNamesShort,m=(j?j.monthNames:null)||this._defaults.monthNames,p=j=-1,q=-1,s=-1,r=false,u=function(z){(z=H+1-1){p=1;q=s;do{l=this._getDaysInMonth(j,p-1);if(q<=l)break;p++;q-=l}while(1)}C=this._daylightSavingAdjust(new Date(j,p-1,q));if(C.getFullYear()!=j||C.getMonth()+1!=p||C.getDate()!=q)throw"Invalid date";return C},ATOM:"yy-mm-dd", -COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(b,f,j){if(!f)return"";var l=(j?j.dayNamesShort:null)||this._defaults.dayNamesShort,o=(j?j.dayNames:null)||this._defaults.dayNames,n=(j?j.monthNamesShort:null)||this._defaults.monthNamesShort;j=(j?j.monthNames: -null)||this._defaults.monthNames;var k=function(u){(u=r+1 -12?b.getHours()+2:0);return b},_setDate:function(b,f,j){var l=!f,o=b.selectedMonth,n=b.selectedYear;f=this._restrictMinMax(b,this._determineDate(b,f,new Date));b.selectedDay=b.currentDay=f.getDate();b.drawMonth=b.selectedMonth=b.currentMonth=f.getMonth();b.drawYear=b.selectedYear=b.currentYear=f.getFullYear();if((o!=b.selectedMonth||n!=b.selectedYear)&&!j)this._notifyChange(b);this._adjustInstDate(b);if(b.input)b.input.val(l?"":this._formatDate(b))},_getDate:function(b){return!b.currentYear||b.input&& -b.input.val()==""?null:this._daylightSavingAdjust(new Date(b.currentYear,b.currentMonth,b.currentDay))},_generateHTML:function(b){var f=new Date;f=this._daylightSavingAdjust(new Date(f.getFullYear(),f.getMonth(),f.getDate()));var j=this._get(b,"isRTL"),l=this._get(b,"showButtonPanel"),o=this._get(b,"hideIfNoPrevNext"),n=this._get(b,"navigationAsDateFormat"),k=this._getNumberOfMonths(b),m=this._get(b,"showCurrentAtPos"),p=this._get(b,"stepMonths"),q=k[0]!=1||k[1]!=1,s=this._daylightSavingAdjust(!b.currentDay? -new Date(9999,9,9):new Date(b.currentYear,b.currentMonth,b.currentDay)),r=this._getMinMaxDate(b,"min"),u=this._getMinMaxDate(b,"max");m=b.drawMonth-m;var v=b.drawYear;if(m<0){m+=12;v--}if(u){var w=this._daylightSavingAdjust(new Date(u.getFullYear(),u.getMonth()-k[0]*k[1]+1,u.getDate()));for(w=r&&ww;){m--;if(m<0){m=11;v--}}}b.drawMonth=m;b.drawYear=v;w=this._get(b,"prevText");w=!n?w:this.formatDate(w,this._daylightSavingAdjust(new Date(v,m-p,1)),this._getFormatConfig(b)); -w=this._canAdjustMonth(b,-1,v,m)?''+w+"":o?"":''+w+"";var x=this._get(b,"nextText");x=!n?x:this.formatDate(x,this._daylightSavingAdjust(new Date(v, -m+p,1)),this._getFormatConfig(b));o=this._canAdjustMonth(b,+1,v,m)?''+x+"":o?"":''+x+"";p=this._get(b,"currentText");x=this._get(b,"gotoCurrent")&& -b.currentDay?s:f;p=!n?p:this.formatDate(p,x,this._getFormatConfig(b));n=!b.inline?'":"";l=l?'
        '+(j?n:"")+(this._isInRange(b,x)?'":"")+(j?"":n)+"
        ":"";n=parseInt(this._get(b,"firstDay"),10);n=isNaN(n)?0:n;p=this._get(b,"showWeek");x=this._get(b,"dayNames");this._get(b,"dayNamesShort");var y=this._get(b,"dayNamesMin"),H=this._get(b,"monthNames"),C=this._get(b,"monthNamesShort"),z=this._get(b,"beforeShowDay"),I=this._get(b,"showOtherMonths"),N=this._get(b,"selectOtherMonths");this._get(b,"calculateWeek");for(var J=this._getDefaultDate(b),D="",E=0;E1)switch(L){case 0:F+=" ui-datepicker-group-first";B=" ui-corner-"+(j?"right":"left");break;case k[1]-1:F+=" ui-datepicker-group-last";B=" ui-corner-"+(j?"left":"right");break;default:F+=" ui-datepicker-group-middle";B="";break}F+='">'}F+='
        '+(/all|left/.test(B)&& -E==0?j?o:w:"")+(/all|right/.test(B)&&E==0?j?w:o:"")+this._generateMonthYearHeader(b,m,v,r,u,E>0||L>0,H,C)+'
        ';var G=p?'":"";for(B=0;B<7;B++){var A=(B+n)%7;G+="=5?' class="ui-datepicker-week-end"':"")+'>'+y[A]+""}F+=G+"";G=this._getDaysInMonth(v,m);if(v==b.selectedYear&&m==b.selectedMonth)b.selectedDay=Math.min(b.selectedDay, -G);B=(this._getFirstDayOfMonth(v,m)-n+7)%7;G=Math.ceil((B+G)/7);this.maxRows=G=q?this.maxRows>G?this.maxRows:G:G;A=this._daylightSavingAdjust(new Date(v,m,1-B));for(var R=0;R";var S=!p?"":'";for(B=0;B<7;B++){var M=z?z.apply(b.input?b.input[0]:null,[A]):[true,""],K=A.getMonth()!=m,O=K&&!N||!M[0]||r&&Au;S+='";A.setDate(A.getDate()+1);A=this._daylightSavingAdjust(A)}F+=S+""}m++;if(m>11){m=0;v++}F+="
        '+this._get(b,"weekHeader")+"
        '+this._get(b,"calculateWeek")(A)+""+(K&&!I?" ":O?''+ -A.getDate()+"":''+A.getDate()+"")+"
        "+(q?"
      "+(k[0]>0&&L==k[1]-1?'
      ':""):"");P+=F}D+=P}D+=l+(a.browser.msie&&parseInt(a.browser.version,10)<7&&!b.inline?'': -"");b._keyEvent=false;return D},_generateMonthYearHeader:function(b,f,j,l,o,n,k,m){var p=this._get(b,"changeMonth"),q=this._get(b,"changeYear"),s=this._get(b,"showMonthAfterYear"),r='
      ',u="";if(n||!p)u+=''+k[f]+"";else{k=l&&l.getFullYear()==j;var v=o&&o.getFullYear()==j;u+='"}s||(r+=u+(n||!(p&&q)?" ":""));if(!b.yearshtml){b.yearshtml="";if(n||!q)r+=''+j+"";else{m=this._get(b,"yearRange").split(":");var x=(new Date).getFullYear();k=function(y){y=y.match(/c[+-].*/)?j+parseInt(y.substring(1),10):y.match(/[+-].*/)?x+parseInt(y,10):parseInt(y,10);return isNaN(y)?x:y};f=k(m[0]);m=Math.max(f,k(m[1]||""));f=l?Math.max(f, -l.getFullYear()):f;m=o?Math.min(m,o.getFullYear()):m;for(b.yearshtml+='";r+=b.yearshtml;b.yearshtml=null}}r+=this._get(b,"yearSuffix");if(s)r+=(n||!(p&&q)?" ":"")+u;r+="
      ";return r},_adjustInstDate:function(b,f,j){var l=b.drawYear+(j=="Y"?f:0),o=b.drawMonth+ -(j=="M"?f:0);f=Math.min(b.selectedDay,this._getDaysInMonth(l,o))+(j=="D"?f:0);l=this._restrictMinMax(b,this._daylightSavingAdjust(new Date(l,o,f)));b.selectedDay=l.getDate();b.drawMonth=b.selectedMonth=l.getMonth();b.drawYear=b.selectedYear=l.getFullYear();if(j=="M"||j=="Y")this._notifyChange(b)},_restrictMinMax:function(b,f){var j=this._getMinMaxDate(b,"min");b=this._getMinMaxDate(b,"max");f=j&&fb?b:f},_notifyChange:function(b){var f=this._get(b,"onChangeMonthYear");if(f)f.apply(b.input? -b.input[0]:null,[b.selectedYear,b.selectedMonth+1,b])},_getNumberOfMonths:function(b){b=this._get(b,"numberOfMonths");return b==null?[1,1]:typeof b=="number"?[1,b]:b},_getMinMaxDate:function(b,f){return this._determineDate(b,this._get(b,f+"Date"),null)},_getDaysInMonth:function(b,f){return 32-this._daylightSavingAdjust(new Date(b,f,32)).getDate()},_getFirstDayOfMonth:function(b,f){return(new Date(b,f,1)).getDay()},_canAdjustMonth:function(b,f,j,l){var o=this._getNumberOfMonths(b);j=this._daylightSavingAdjust(new Date(j, -l+(f<0?f:o[0]*o[1]),1));f<0&&j.setDate(this._getDaysInMonth(j.getFullYear(),j.getMonth()));return this._isInRange(b,j)},_isInRange:function(b,f){var j=this._getMinMaxDate(b,"min");b=this._getMinMaxDate(b,"max");return(!j||f.getTime()>=j.getTime())&&(!b||f.getTime()<=b.getTime())},_getFormatConfig:function(b){var f=this._get(b,"shortYearCutoff");f=typeof f!="string"?f:(new Date).getFullYear()%100+parseInt(f,10);return{shortYearCutoff:f,dayNamesShort:this._get(b,"dayNamesShort"),dayNames:this._get(b, -"dayNames"),monthNamesShort:this._get(b,"monthNamesShort"),monthNames:this._get(b,"monthNames")}},_formatDate:function(b,f,j,l){if(!f){b.currentDay=b.selectedDay;b.currentMonth=b.selectedMonth;b.currentYear=b.selectedYear}f=f?typeof f=="object"?f:this._daylightSavingAdjust(new Date(l,j,f)):this._daylightSavingAdjust(new Date(b.currentYear,b.currentMonth,b.currentDay));return this.formatDate(this._get(b,"dateFormat"),f,this._getFormatConfig(b))}});a.fn.datepicker=function(b){if(!this.length)return this; -if(!a.datepicker.initialized){a(document).mousedown(a.datepicker._checkExternalClick).find("body").append(a.datepicker.dpDiv);a.datepicker.initialized=true}var f=Array.prototype.slice.call(arguments,1);if(typeof b=="string"&&(b=="isDisabled"||b=="getDate"||b=="widget"))return a.datepicker["_"+b+"Datepicker"].apply(a.datepicker,[this[0]].concat(f));if(b=="option"&&arguments.length==2&&typeof arguments[1]=="string")return a.datepicker["_"+b+"Datepicker"].apply(a.datepicker,[this[0]].concat(f));return this.each(function(){typeof b== -"string"?a.datepicker["_"+b+"Datepicker"].apply(a.datepicker,[this].concat(f)):a.datepicker._attachDatepicker(this,b)})};a.datepicker=new c;a.datepicker.initialized=false;a.datepicker.uuid=(new Date).getTime();a.datepicker.version="1.8.16";window["DP_jQuery_"+g]=a})(jQuery); -(function(a,d){var c={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},e={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},h=a.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};a.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false, -position:{my:"center",at:"center",collision:"fit",using:function(g){var i=a(this).css(g).offset().top;i<0&&a(this).css("top",g.top-i)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var g=this,i=g.options,b=i.title||" ",f=a.ui.dialog.getTitleId(g.element),j=(g.uiDialog=a("
      ")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+ -i.dialogClass).css({zIndex:i.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(n){if(i.closeOnEscape&&!n.isDefaultPrevented()&&n.keyCode&&n.keyCode===a.ui.keyCode.ESCAPE){g.close(n);n.preventDefault()}}).attr({role:"dialog","aria-labelledby":f}).mousedown(function(n){g.moveToTop(false,n)});g.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(j);var l=(g.uiDialogTitlebar=a("
      ")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(j), -o=a('').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){o.addClass("ui-state-hover")},function(){o.removeClass("ui-state-hover")}).focus(function(){o.addClass("ui-state-focus")}).blur(function(){o.removeClass("ui-state-focus")}).click(function(n){g.close(n);return false}).appendTo(l);(g.uiDialogTitlebarCloseText=a("")).addClass("ui-icon ui-icon-closethick").text(i.closeText).appendTo(o);a("").addClass("ui-dialog-title").attr("id", -f).html(b).prependTo(l);if(a.isFunction(i.beforeclose)&&!a.isFunction(i.beforeClose))i.beforeClose=i.beforeclose;l.find("*").add(l).disableSelection();i.draggable&&a.fn.draggable&&g._makeDraggable();i.resizable&&a.fn.resizable&&g._makeResizable();g._createButtons(i.buttons);g._isOpen=false;a.fn.bgiframe&&j.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var g=this;g.overlay&&g.overlay.destroy();g.uiDialog.hide();g.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"); -g.uiDialog.remove();g.originalTitle&&g.element.attr("title",g.originalTitle);return g},widget:function(){return this.uiDialog},close:function(g){var i=this,b,f;if(false!==i._trigger("beforeClose",g)){i.overlay&&i.overlay.destroy();i.uiDialog.unbind("keypress.ui-dialog");i._isOpen=false;if(i.options.hide)i.uiDialog.hide(i.options.hide,function(){i._trigger("close",g)});else{i.uiDialog.hide();i._trigger("close",g)}a.ui.dialog.overlay.resize();if(i.options.modal){b=0;a(".ui-dialog").each(function(){if(this!== -i.uiDialog[0]){f=a(this).css("z-index");isNaN(f)||(b=Math.max(b,f))}});a.ui.dialog.maxZ=b}return i}},isOpen:function(){return this._isOpen},moveToTop:function(g,i){var b=this,f=b.options;if(f.modal&&!g||!f.stack&&!f.modal)return b._trigger("focus",i);if(f.zIndex>a.ui.dialog.maxZ)a.ui.dialog.maxZ=f.zIndex;if(b.overlay){a.ui.dialog.maxZ+=1;b.overlay.$el.css("z-index",a.ui.dialog.overlay.maxZ=a.ui.dialog.maxZ)}g={scrollTop:b.element.scrollTop(),scrollLeft:b.element.scrollLeft()};a.ui.dialog.maxZ+=1; -b.uiDialog.css("z-index",a.ui.dialog.maxZ);b.element.attr(g);b._trigger("focus",i);return b},open:function(){if(!this._isOpen){var g=this,i=g.options,b=g.uiDialog;g.overlay=i.modal?new a.ui.dialog.overlay(g):null;g._size();g._position(i.position);b.show(i.show);g.moveToTop(true);i.modal&&b.bind("keypress.ui-dialog",function(f){if(f.keyCode===a.ui.keyCode.TAB){var j=a(":tabbable",this),l=j.filter(":first");j=j.filter(":last");if(f.target===j[0]&&!f.shiftKey){l.focus(1);return false}else if(f.target=== -l[0]&&f.shiftKey){j.focus(1);return false}}});a(g.element.find(":tabbable").get().concat(b.find(".ui-dialog-buttonpane :tabbable").get().concat(b.get()))).eq(0).focus();g._isOpen=true;g._trigger("open");return g}},_createButtons:function(g){var i=this,b=false,f=a("
      ").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),j=a("
      ").addClass("ui-dialog-buttonset").appendTo(f);i.uiDialog.find(".ui-dialog-buttonpane").remove();typeof g==="object"&&g!==null&&a.each(g, -function(){return!(b=true)});if(b){a.each(g,function(l,o){o=a.isFunction(o)?{click:o,text:l}:o;var n=a('').click(function(){o.click.apply(i.element[0],arguments)}).appendTo(j);a.each(o,function(k,m){if(k!=="click")k in h?n[k](m):n.attr(k,m)});a.fn.button&&n.button()});f.appendTo(i.uiDialog)}},_makeDraggable:function(){function g(l){return{position:l.position,offset:l.offset}}var i=this,b=i.options,f=a(document),j;i.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close", -handle:".ui-dialog-titlebar",containment:"document",start:function(l,o){j=b.height==="auto"?"auto":a(this).height();a(this).height(a(this).height()).addClass("ui-dialog-dragging");i._trigger("dragStart",l,g(o))},drag:function(l,o){i._trigger("drag",l,g(o))},stop:function(l,o){b.position=[o.position.left-f.scrollLeft(),o.position.top-f.scrollTop()];a(this).removeClass("ui-dialog-dragging").height(j);i._trigger("dragStop",l,g(o));a.ui.dialog.overlay.resize()}})},_makeResizable:function(g){function i(l){return{originalPosition:l.originalPosition, -originalSize:l.originalSize,position:l.position,size:l.size}}g=g===d?this.options.resizable:g;var b=this,f=b.options,j=b.uiDialog.css("position");g=typeof g==="string"?g:"n,e,s,w,se,sw,ne,nw";b.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:b.element,maxWidth:f.maxWidth,maxHeight:f.maxHeight,minWidth:f.minWidth,minHeight:b._minHeight(),handles:g,start:function(l,o){a(this).addClass("ui-dialog-resizing");b._trigger("resizeStart",l,i(o))},resize:function(l,o){b._trigger("resize", -l,i(o))},stop:function(l,o){a(this).removeClass("ui-dialog-resizing");f.height=a(this).height();f.width=a(this).width();b._trigger("resizeStop",l,i(o));a.ui.dialog.overlay.resize()}}).css("position",j).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var g=this.options;return g.height==="auto"?g.minHeight:Math.min(g.minHeight,g.height)},_position:function(g){var i=[],b=[0,0],f;if(g){if(typeof g==="string"||typeof g==="object"&&"0"in g){i=g.split?g.split(" "): -[g[0],g[1]];if(i.length===1)i[1]=i[0];a.each(["left","top"],function(j,l){if(+i[j]===i[j]){b[j]=i[j];i[j]=l}});g={my:i.join(" "),at:i.join(" "),offset:b.join(" ")}}g=a.extend({},a.ui.dialog.prototype.options.position,g)}else g=a.ui.dialog.prototype.options.position;(f=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(a.extend({of:window},g));f||this.uiDialog.hide()},_setOptions:function(g){var i=this,b={},f=false;a.each(g,function(j,l){i._setOption(j,l); -if(j in c)f=true;if(j in e)b[j]=l});f&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",b)},_setOption:function(g,i){var b=this,f=b.uiDialog;switch(g){case "beforeclose":g="beforeClose";break;case "buttons":b._createButtons(i);break;case "closeText":b.uiDialogTitlebarCloseText.text(""+i);break;case "dialogClass":f.removeClass(b.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+i);break;case "disabled":i?f.addClass("ui-dialog-disabled"): -f.removeClass("ui-dialog-disabled");break;case "draggable":var j=f.is(":data(draggable)");j&&!i&&f.draggable("destroy");!j&&i&&b._makeDraggable();break;case "position":b._position(i);break;case "resizable":(j=f.is(":data(resizable)"))&&!i&&f.resizable("destroy");j&&typeof i==="string"&&f.resizable("option","handles",i);!j&&i!==false&&b._makeResizable(i);break;case "title":a(".ui-dialog-title",b.uiDialogTitlebar).html(""+(i||" "));break}a.Widget.prototype._setOption.apply(b,arguments)},_size:function(){var g= -this.options,i,b,f=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(g.minWidth>g.width)g.width=g.minWidth;i=this.uiDialog.css({height:"auto",width:g.width}).height();b=Math.max(0,g.minHeight-i);if(g.height==="auto")if(a.support.minHeight)this.element.css({minHeight:b,height:"auto"});else{this.uiDialog.show();g=this.element.css("height","auto").height();f||this.uiDialog.hide();this.element.height(Math.max(g,b))}else this.element.height(Math.max(g.height- -i,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});a.extend(a.ui.dialog,{version:"1.8.16",uuid:0,maxZ:0,getTitleId:function(g){g=g.attr("id");if(!g){this.uuid+=1;g=this.uuid}return"ui-dialog-title-"+g},overlay:function(g){this.$el=a.ui.dialog.overlay.create(g)}});a.extend(a.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:a.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(g){return g+".dialog-overlay"}).join(" "), -create:function(g){if(this.instances.length===0){setTimeout(function(){a.ui.dialog.overlay.instances.length&&a(document).bind(a.ui.dialog.overlay.events,function(b){if(a(b.target).zIndex()
      ").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),height:this.height()});a.fn.bgiframe&&i.bgiframe();this.instances.push(i);return i},destroy:function(g){var i=a.inArray(g,this.instances);i!=-1&&this.oldInstances.push(this.instances.splice(i,1)[0]);this.instances.length===0&&a([document,window]).unbind(".dialog-overlay");g.remove();var b=0;a.each(this.instances,function(){b=Math.max(b,this.css("z-index"))});this.maxZ=b},height:function(){var g,i;if(a.browser.msie&& -a.browser.version<7){g=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);i=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return g0?g.left-b:Math.max(g.left-i.collisionPosition.left,g.left)},top:function(g,i){var b=a(window);b=i.collisionPosition.top+i.collisionHeight-b.height()-b.scrollTop();g.top=b>0?g.top-b:Math.max(g.top-i.collisionPosition.top,g.top)}},flip:{left:function(g,i){if(i.at[0]!=="center"){var b=a(window);b=i.collisionPosition.left+i.collisionWidth-b.width()-b.scrollLeft();var f=i.my[0]==="left"?-i.elemWidth:i.my[0]==="right"?i.elemWidth:0,j=i.at[0]==="left"?i.targetWidth:-i.targetWidth,l=-2*i.offset[0];g.left+= -i.collisionPosition.left<0?f+j+l:b>0?f+j+l:0}},top:function(g,i){if(i.at[1]!=="center"){var b=a(window);b=i.collisionPosition.top+i.collisionHeight-b.height()-b.scrollTop();var f=i.my[1]==="top"?-i.elemHeight:i.my[1]==="bottom"?i.elemHeight:0,j=i.at[1]==="top"?i.targetHeight:-i.targetHeight,l=-2*i.offset[1];g.top+=i.collisionPosition.top<0?f+j+l:b>0?f+j+l:0}}}};if(!a.offset.setOffset){a.offset.setOffset=function(g,i){if(/static/.test(a.curCSS(g,"position")))g.style.position="relative";var b=a(g), -f=b.offset(),j=parseInt(a.curCSS(g,"top",true),10)||0,l=parseInt(a.curCSS(g,"left",true),10)||0;f={top:i.top-f.top+j,left:i.left-f.left+l};"using"in i?i.using.call(g,f):b.css(f)};a.fn.offset=function(g){var i=this[0];if(!i||!i.ownerDocument)return null;if(g)return this.each(function(){a.offset.setOffset(this,g)});return h.call(this)}}})(jQuery); -(function(a,d){a.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=a("
      ").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); -this.valueDiv.remove();a.Widget.prototype.destroy.apply(this,arguments)},value:function(c){if(c===d)return this._value();this._setOption("value",c);return this},_setOption:function(c,e){if(c==="value"){this.options.value=e;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}a.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var c=this.options.value;if(typeof c!=="number")c=0;return Math.min(this.options.max,Math.max(this.min,c))},_percentage:function(){return 100* -this._value()/this.options.max},_refreshValue:function(){var c=this.value(),e=this._percentage();if(this.oldValue!==c){this.oldValue=c;this._trigger("change")}this.valueDiv.toggle(c>this.min).toggleClass("ui-corner-right",c===this.options.max).width(e.toFixed(0)+"%");this.element.attr("aria-valuenow",c)}});a.extend(a.ui.progressbar,{version:"1.8.16"})})(jQuery); -(function(a){a.widget("ui.slider",a.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var d=this,c=this.options,e=this.element.find(".ui-slider-handle").addClass("ui-state-default ui-corner-all"),h=c.values&&c.values.length||1,g=[];this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+ -this.orientation+" ui-widget ui-widget-content ui-corner-all"+(c.disabled?" ui-slider-disabled ui-disabled":""));this.range=a([]);if(c.range){if(c.range===true){if(!c.values)c.values=[this._valueMin(),this._valueMin()];if(c.values.length&&c.values.length!==2)c.values=[c.values[0],c.values[0]]}this.range=a("
      ").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(c.range==="min"||c.range==="max"?" ui-slider-range-"+c.range:""))}for(var i=e.length;i"); -this.handles=e.add(a(g.join("")).appendTo(d.element));this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(b){b.preventDefault()}).hover(function(){c.disabled||a(this).addClass("ui-state-hover")},function(){a(this).removeClass("ui-state-hover")}).focus(function(){if(c.disabled)a(this).blur();else{a(".ui-slider .ui-state-focus").removeClass("ui-state-focus");a(this).addClass("ui-state-focus")}}).blur(function(){a(this).removeClass("ui-state-focus")});this.handles.each(function(b){a(this).data("index.ui-slider-handle", -b)});this.handles.keydown(function(b){var f=true,j=a(this).data("index.ui-slider-handle"),l,o,n;if(!d.options.disabled){switch(b.keyCode){case a.ui.keyCode.HOME:case a.ui.keyCode.END:case a.ui.keyCode.PAGE_UP:case a.ui.keyCode.PAGE_DOWN:case a.ui.keyCode.UP:case a.ui.keyCode.RIGHT:case a.ui.keyCode.DOWN:case a.ui.keyCode.LEFT:f=false;if(!d._keySliding){d._keySliding=true;a(this).addClass("ui-state-active");l=d._start(b,j);if(l===false)return}break}n=d.options.step;l=d.options.values&&d.options.values.length? -(o=d.values(j)):(o=d.value());switch(b.keyCode){case a.ui.keyCode.HOME:o=d._valueMin();break;case a.ui.keyCode.END:o=d._valueMax();break;case a.ui.keyCode.PAGE_UP:o=d._trimAlignValue(l+(d._valueMax()-d._valueMin())/5);break;case a.ui.keyCode.PAGE_DOWN:o=d._trimAlignValue(l-(d._valueMax()-d._valueMin())/5);break;case a.ui.keyCode.UP:case a.ui.keyCode.RIGHT:if(l===d._valueMax())return;o=d._trimAlignValue(l+n);break;case a.ui.keyCode.DOWN:case a.ui.keyCode.LEFT:if(l===d._valueMin())return;o=d._trimAlignValue(l- -n);break}d._slide(b,j,o);return f}}).keyup(function(b){var f=a(this).data("index.ui-slider-handle");if(d._keySliding){d._keySliding=false;d._stop(b,f);d._change(b,f);a(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy(); -return this},_mouseCapture:function(d){var c=this.options,e,h,g,i,b;if(c.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();e=this._normValueFromMouse({x:d.pageX,y:d.pageY});h=this._valueMax()-this._valueMin()+1;i=this;this.handles.each(function(f){var j=Math.abs(e-i.values(f));if(h>j){h=j;g=a(this);b=f}});if(c.range===true&&this.values(1)===c.min){b+=1;g=a(this.handles[b])}if(this._start(d,b)===false)return false; -this._mouseSliding=true;i._handleIndex=b;g.addClass("ui-state-active").focus();c=g.offset();this._clickOffset=!a(d.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:d.pageX-c.left-g.width()/2,top:d.pageY-c.top-g.height()/2-(parseInt(g.css("borderTopWidth"),10)||0)-(parseInt(g.css("borderBottomWidth"),10)||0)+(parseInt(g.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(d,b,e);return this._animateOff=true},_mouseStart:function(){return true},_mouseDrag:function(d){var c= -this._normValueFromMouse({x:d.pageX,y:d.pageY});this._slide(d,this._handleIndex,c);return false},_mouseStop:function(d){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(d,this._handleIndex);this._change(d,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(d){var c;if(this.orientation==="horizontal"){c= -this.elementSize.width;d=d.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{c=this.elementSize.height;d=d.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}c=d/c;if(c>1)c=1;if(c<0)c=0;if(this.orientation==="vertical")c=1-c;d=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+c*d)},_start:function(d,c){var e={handle:this.handles[c],value:this.value()};if(this.options.values&&this.options.values.length){e.value=this.values(c); -e.values=this.values()}return this._trigger("start",d,e)},_slide:function(d,c,e){var h;if(this.options.values&&this.options.values.length){h=this.values(c?0:1);if(this.options.values.length===2&&this.options.range===true&&(c===0&&e>h||c===1&&e1){this.options.values[d]=this._trimAlignValue(c);this._refreshValue();this._change(null,d)}else if(arguments.length)if(a.isArray(arguments[0])){e=this.options.values;h=arguments[0];for(g=0;g=this._valueMax())return this._valueMax();var c=this.options.step>0?this.options.step:1,e=(d-this._valueMin())%c;d=d-e;if(Math.abs(e)*2>=c)d+=e>0?c:-c;return parseFloat(d.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var d= -this.options.range,c=this.options,e=this,h=!this._animateOff?c.animate:false,g,i={},b,f,j,l;if(this.options.values&&this.options.values.length)this.handles.each(function(o){g=(e.values(o)-e._valueMin())/(e._valueMax()-e._valueMin())*100;i[e.orientation==="horizontal"?"left":"bottom"]=g+"%";a(this).stop(1,1)[h?"animate":"css"](i,c.animate);if(e.options.range===true)if(e.orientation==="horizontal"){if(o===0)e.range.stop(1,1)[h?"animate":"css"]({left:g+"%"},c.animate);if(o===1)e.range[h?"animate":"css"]({width:g- -b+"%"},{queue:false,duration:c.animate})}else{if(o===0)e.range.stop(1,1)[h?"animate":"css"]({bottom:g+"%"},c.animate);if(o===1)e.range[h?"animate":"css"]({height:g-b+"%"},{queue:false,duration:c.animate})}b=g});else{f=this.value();j=this._valueMin();l=this._valueMax();g=l!==j?(f-j)/(l-j)*100:0;i[e.orientation==="horizontal"?"left":"bottom"]=g+"%";this.handle.stop(1,1)[h?"animate":"css"](i,c.animate);if(d==="min"&&this.orientation==="horizontal")this.range.stop(1,1)[h?"animate":"css"]({width:g+"%"}, -c.animate);if(d==="max"&&this.orientation==="horizontal")this.range[h?"animate":"css"]({width:100-g+"%"},{queue:false,duration:c.animate});if(d==="min"&&this.orientation==="vertical")this.range.stop(1,1)[h?"animate":"css"]({height:g+"%"},c.animate);if(d==="max"&&this.orientation==="vertical")this.range[h?"animate":"css"]({height:100-g+"%"},{queue:false,duration:c.animate})}}});a.extend(a.ui.slider,{version:"1.8.16"})})(jQuery); -(function(a,d){function c(){return++h}function e(){return++g}var h=0,g=0;a.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"
      ",remove:null,select:null,show:null,spinner:"Loading…",tabTemplate:"
    • #{label}
      • "},_create:function(){this._tabify(true)},_setOption:function(i,b){if(i=="selected")this.options.collapsible&& -b==this.options.selected||this.select(b);else{this.options[i]=b;this._tabify()}},_tabId:function(i){return i.title&&i.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+c()},_sanitizeSelector:function(i){return i.replace(/:/g,"\\:")},_cookie:function(){var i=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+e());return a.cookie.apply(null,[i].concat(a.makeArray(arguments)))},_ui:function(i,b){return{tab:i,panel:b,index:this.anchors.index(i)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var i= -a(this);i.html(i.data("label.tabs")).removeData("label.tabs")})},_tabify:function(i){function b(r,u){r.css("display","");!a.support.opacity&&u.opacity&&r[0].style.removeAttribute("filter")}var f=this,j=this.options,l=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=a(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return a("a",this)[0]});this.panels=a([]);this.anchors.each(function(r,u){var v=a(u).attr("href"),w=v.split("#")[0],x;if(w&&(w===location.toString().split("#")[0]|| -(x=a("base")[0])&&w===x.href)){v=u.hash;u.href=v}if(l.test(v))f.panels=f.panels.add(f.element.find(f._sanitizeSelector(v)));else if(v&&v!=="#"){a.data(u,"href.tabs",v);a.data(u,"load.tabs",v.replace(/#.*$/,""));v=f._tabId(u);u.href="#"+v;u=f.element.find("#"+v);if(!u.length){u=a(j.panelTemplate).attr("id",v).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(f.panels[r-1]||f.list);u.data("destroy.tabs",true)}f.panels=f.panels.add(u)}else j.disabled.push(r)});if(i){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); -this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(j.selected===d){location.hash&&this.anchors.each(function(r,u){if(u.hash==location.hash){j.selected=r;return false}});if(typeof j.selected!=="number"&&j.cookie)j.selected=parseInt(f._cookie(),10);if(typeof j.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)j.selected= -this.lis.index(this.lis.filter(".ui-tabs-selected"));j.selected=j.selected||(this.lis.length?0:-1)}else if(j.selected===null)j.selected=-1;j.selected=j.selected>=0&&this.anchors[j.selected]||j.selected<0?j.selected:0;j.disabled=a.unique(j.disabled.concat(a.map(this.lis.filter(".ui-state-disabled"),function(r){return f.lis.index(r)}))).sort();a.inArray(j.selected,j.disabled)!=-1&&j.disabled.splice(a.inArray(j.selected,j.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); -if(j.selected>=0&&this.anchors.length){f.element.find(f._sanitizeSelector(f.anchors[j.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(j.selected).addClass("ui-tabs-selected ui-state-active");f.element.queue("tabs",function(){f._trigger("show",null,f._ui(f.anchors[j.selected],f.element.find(f._sanitizeSelector(f.anchors[j.selected].hash))[0]))});this.load(j.selected)}a(window).bind("unload",function(){f.lis.add(f.anchors).unbind(".tabs");f.lis=f.anchors=f.panels=null})}else j.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); -this.element[j.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");j.cookie&&this._cookie(j.selected,j.cookie);i=0;for(var o;o=this.lis[i];i++)a(o)[a.inArray(i,j.disabled)!=-1&&!a(o).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");j.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(j.event!=="mouseover"){var n=function(r,u){u.is(":not(.ui-state-disabled)")&&u.addClass("ui-state-"+r)},k=function(r,u){u.removeClass("ui-state-"+ -r)};this.lis.bind("mouseover.tabs",function(){n("hover",a(this))});this.lis.bind("mouseout.tabs",function(){k("hover",a(this))});this.anchors.bind("focus.tabs",function(){n("focus",a(this).closest("li"))});this.anchors.bind("blur.tabs",function(){k("focus",a(this).closest("li"))})}var m,p;if(j.fx)if(a.isArray(j.fx)){m=j.fx[0];p=j.fx[1]}else m=p=j.fx;var q=p?function(r,u){a(r).closest("li").addClass("ui-tabs-selected ui-state-active");u.hide().removeClass("ui-tabs-hide").animate(p,p.duration||"normal", -function(){b(u,p);f._trigger("show",null,f._ui(r,u[0]))})}:function(r,u){a(r).closest("li").addClass("ui-tabs-selected ui-state-active");u.removeClass("ui-tabs-hide");f._trigger("show",null,f._ui(r,u[0]))},s=m?function(r,u){u.animate(m,m.duration||"normal",function(){f.lis.removeClass("ui-tabs-selected ui-state-active");u.addClass("ui-tabs-hide");b(u,m);f.element.dequeue("tabs")})}:function(r,u){f.lis.removeClass("ui-tabs-selected ui-state-active");u.addClass("ui-tabs-hide");f.element.dequeue("tabs")}; -this.anchors.bind(j.event+".tabs",function(){var r=this,u=a(r).closest("li"),v=f.panels.filter(":not(.ui-tabs-hide)"),w=f.element.find(f._sanitizeSelector(r.hash));if(u.hasClass("ui-tabs-selected")&&!j.collapsible||u.hasClass("ui-state-disabled")||u.hasClass("ui-state-processing")||f.panels.filter(":animated").length||f._trigger("select",null,f._ui(this,w[0]))===false){this.blur();return false}j.selected=f.anchors.index(this);f.abort();if(j.collapsible)if(u.hasClass("ui-tabs-selected")){j.selected= --1;j.cookie&&f._cookie(j.selected,j.cookie);f.element.queue("tabs",function(){s(r,v)}).dequeue("tabs");this.blur();return false}else if(!v.length){j.cookie&&f._cookie(j.selected,j.cookie);f.element.queue("tabs",function(){q(r,w)});f.load(f.anchors.index(this));this.blur();return false}j.cookie&&f._cookie(j.selected,j.cookie);if(w.length){v.length&&f.element.queue("tabs",function(){s(r,v)});f.element.queue("tabs",function(){q(r,w)});f.load(f.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; -a.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(i){if(typeof i=="string")i=this.anchors.index(this.anchors.filter("[href$="+i+"]"));return i},destroy:function(){var i=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var b= -a.data(this,"href.tabs");if(b)this.href=b;var f=a(this).unbind(".tabs");a.each(["href","load","cache"],function(j,l){f.removeData(l+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){a.data(this,"destroy.tabs")?a(this).remove():a(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});i.cookie&&this._cookie(null,i.cookie);return this},add:function(i, -b,f){if(f===d)f=this.anchors.length;var j=this,l=this.options;b=a(l.tabTemplate.replace(/#\{href\}/g,i).replace(/#\{label\}/g,b));i=!i.indexOf("#")?i.replace("#",""):this._tabId(a("a",b)[0]);b.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var o=j.element.find("#"+i);o.length||(o=a(l.panelTemplate).attr("id",i).data("destroy.tabs",true));o.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(f>=this.lis.length){b.appendTo(this.list);o.appendTo(this.list[0].parentNode)}else{b.insertBefore(this.lis[f]); -o.insertBefore(this.panels[f])}l.disabled=a.map(l.disabled,function(n){return n>=f?++n:n});this._tabify();if(this.anchors.length==1){l.selected=0;b.addClass("ui-tabs-selected ui-state-active");o.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){j._trigger("show",null,j._ui(j.anchors[0],j.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[f],this.panels[f]));return this},remove:function(i){i=this._getIndex(i);var b=this.options,f=this.lis.eq(i).remove(),j=this.panels.eq(i).remove(); -if(f.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(i+(i+1=i?--l:l});this._tabify();this._trigger("remove",null,this._ui(f.find("a")[0],j[0]));return this},enable:function(i){i=this._getIndex(i);var b=this.options;if(a.inArray(i,b.disabled)!=-1){this.lis.eq(i).removeClass("ui-state-disabled");b.disabled=a.grep(b.disabled,function(f){return f!=i});this._trigger("enable",null, -this._ui(this.anchors[i],this.panels[i]));return this}},disable:function(i){i=this._getIndex(i);var b=this.options;if(i!=b.selected){this.lis.eq(i).addClass("ui-state-disabled");b.disabled.push(i);b.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[i],this.panels[i]))}return this},select:function(i){i=this._getIndex(i);if(i==-1)if(this.options.collapsible&&this.options.selected!=-1)i=this.options.selected;else return this;this.anchors.eq(i).trigger(this.options.event+".tabs");return this}, -load:function(i){i=this._getIndex(i);var b=this,f=this.options,j=this.anchors.eq(i)[0],l=a.data(j,"load.tabs");this.abort();if(!l||this.element.queue("tabs").length!==0&&a.data(j,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(i).addClass("ui-state-processing");if(f.spinner){var o=a("span",j);o.data("label.tabs",o.html()).html(f.spinner)}this.xhr=a.ajax(a.extend({},f.ajaxOptions,{url:l,success:function(n,k){b.element.find(b._sanitizeSelector(j.hash)).html(n);b._cleanup();f.cache&&a.data(j, -"cache.tabs",true);b._trigger("load",null,b._ui(b.anchors[i],b.panels[i]));try{f.ajaxOptions.success(n,k)}catch(m){}},error:function(n,k){b._cleanup();b._trigger("load",null,b._ui(b.anchors[i],b.panels[i]));try{f.ajaxOptions.error(n,k,i,j)}catch(m){}}}));b.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, -url:function(i,b){this.anchors.eq(i).removeData("cache.tabs").data("load.tabs",b);return this},length:function(){return this.anchors.length}});a.extend(a.ui.tabs,{version:"1.8.16"});a.extend(a.ui.tabs.prototype,{rotation:null,rotate:function(i,b){var f=this,j=this.options,l=f._rotate||(f._rotate=function(o){clearTimeout(f.rotation);f.rotation=setTimeout(function(){var n=j.selected;f.select(++n=0)&&i(t,!r)}}),e(function(){var t=document.body,n=t.appendChild(n=document.createElement("div"));n.offsetHeight,e.extend(n.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0}),e.support.minHeight=n.offsetHeight===100,e.support.selectstart="onselectstart"in n,t.removeChild(n).style.display="none"}),e("").outerWidth(1).jquery||e.each(["Width","Height"],function(n,r){function u(t,n,r,s){return e.each(i,function(){n-=parseFloat(e.css(t,"padding"+this))||0,r&&(n-=parseFloat(e.css(t,"border"+this+"Width"))||0),s&&(n-=parseFloat(e.css(t,"margin"+this))||0)}),n}var i=r==="Width"?["Left","Right"]:["Top","Bottom"],s=r.toLowerCase(),o={innerWidth:e.fn.innerWidth,innerHeight:e.fn.innerHeight,outerWidth:e.fn.outerWidth,outerHeight:e.fn.outerHeight};e.fn["inner"+r]=function(n){return n===t?o["inner"+r].call(this):this.each(function(){e(this).css(s,u(this,n)+"px")})},e.fn["outer"+r]=function(t,n){return typeof t!="number"?o["outer"+r].call(this,t):this.each(function(){e(this).css(s,u(this,t,!0,n)+"px")})}}),e("").data("a-b","a").removeData("a-b").data("a-b")&&(e.fn.removeData=function(t){return function(n){return arguments.length?t.call(this,e.camelCase(n)):t.call(this)}}(e.fn.removeData)),function(){var t=/msie ([\w.]+)/.exec(navigator.userAgent.toLowerCase())||[];e.ui.ie=t.length?!0:!1,e.ui.ie6=parseFloat(t[1],10)===6}(),e.fn.extend({disableSelection:function(){return this.bind((e.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(e){e.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}}),e.extend(e.ui,{plugin:{add:function(t,n,r){var i,s=e.ui[t].prototype;for(i in r)s.plugins[i]=s.plugins[i]||[],s.plugins[i].push([n,r[i]])},call:function(e,t,n){var r,i=e.plugins[t];if(!i||!e.element[0].parentNode||e.element[0].parentNode.nodeType===11)return;for(r=0;r0?!0:(t[r]=1,i=t[r]>0,t[r]=0,i)},isOverAxis:function(e,t,n){return e>t&&e",options:{disabled:!1,create:null},_createWidget:function(t,r){r=e(r||this.defaultElement||this)[0],this.element=e(r),this.uuid=n++,this.eventNamespace="."+this.widgetName+this.uuid,this.options=e.widget.extend({},this.options,this._getCreateOptions(),t),this.bindings=e(),this.hoverable=e(),this.focusable=e(),r!==this&&(e.data(r,this.widgetName,this),e.data(r,this.widgetFullName,this),this._on(!0,this.element,{remove:function(e){e.target===r&&this.destroy()}}),this.document=e(r.style?r.ownerDocument:r.document||r),this.window=e(this.document[0].defaultView||this.document[0].parentWindow)),this._create(),this._trigger("create",null,this._getCreateEventData()),this._init()},_getCreateOptions:e.noop,_getCreateEventData:e.noop,_create:e.noop,_init:e.noop,destroy:function(){this._destroy(),this.element.unbind(this.eventNamespace).removeData(this.widgetName).removeData(this.widgetFullName).removeData(e.camelCase(this.widgetFullName)),this.widget().unbind(this.eventNamespace).removeAttr("aria-disabled").removeClass(this.widgetFullName+"-disabled "+"ui-state-disabled"),this.bindings.unbind(this.eventNamespace),this.hoverable.removeClass("ui-state-hover"),this.focusable.removeClass("ui-state-focus")},_destroy:e.noop,widget:function(){return this.element},option:function(n,r){var i=n,s,o,u;if(arguments.length===0)return e.widget.extend({},this.options);if(typeof n=="string"){i={},s=n.split("."),n=s.shift();if(s.length){o=i[n]=e.widget.extend({},this.options[n]);for(u=0;u=9||!!t.button?this._mouseStarted?(this._mouseDrag(t),t.preventDefault()):(this._mouseDistanceMet(t)&&this._mouseDelayMet(t)&&(this._mouseStarted=this._mouseStart(this._mouseDownEvent,t)!==!1,this._mouseStarted?this._mouseDrag(t):this._mouseUp(t)),!this._mouseStarted):this._mouseUp(t)},_mouseUp:function(t){return e(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate),this._mouseStarted&&(this._mouseStarted=!1,t.target===this._mouseDownEvent.target&&e.data(t.target,this.widgetName+".preventClickEvent",!0),this._mouseStop(t)),!1},_mouseDistanceMet:function(e){return Math.max(Math.abs(this._mouseDownEvent.pageX-e.pageX),Math.abs(this._mouseDownEvent.pageY-e.pageY))>=this.options.distance},_mouseDelayMet:function(e){return this.mouseDelayMet},_mouseStart:function(e){},_mouseDrag:function(e){},_mouseStop:function(e){},_mouseCapture:function(e){return!0}})}(jQuery),function(e,t){e.widget("ui.draggable",e.ui.mouse,{version:"1.9.2",widgetEventPrefix:"drag",options:{addClasses:!0,appendTo:"parent",axis:!1,connectToSortable:!1,containment:!1,cursor:"auto",cursorAt:!1,grid:!1,handle:!1,helper:"original",iframeFix:!1,opacity:!1,refreshPositions:!1,revert:!1,revertDuration:500,scope:"default",scroll:!0,scrollSensitivity:20,scrollSpeed:20,snap:!1,snapMode:"both",snapTolerance:20,stack:!1,zIndex:!1},_create:function(){this.options.helper=="original"&&!/^(?:r|a|f)/.test(this.element.css("position"))&&(this.element[0].style.position="relative"),this.options.addClasses&&this.element.addClass("ui-draggable"),this.options.disabled&&this.element.addClass("ui-draggable-disabled"),this._mouseInit()},_destroy:function(){this.element.removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled"),this._mouseDestroy()},_mouseCapture:function(t){var n=this.options;return this.helper||n.disabled||e(t.target).is(".ui-resizable-handle")?!1:(this.handle=this._getHandle(t),this.handle?(e(n.iframeFix===!0?"iframe":n.iframeFix).each(function(){e('
      ').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1e3}).css(e(this).offset()).appendTo("body")}),!0):!1)},_mouseStart:function(t){var n=this.options;return this.helper=this._createHelper(t),this.helper.addClass("ui-draggable-dragging"),this._cacheHelperProportions(),e.ui.ddmanager&&(e.ui.ddmanager.current=this),this._cacheMargins(),this.cssPosition=this.helper.css("position"),this.scrollParent=this.helper.scrollParent(),this.offset=this.positionAbs=this.element.offset(),this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left},e.extend(this.offset,{click:{left:t.pageX-this.offset.left,top:t.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}),this.originalPosition=this.position=this._generatePosition(t),this.originalPageX=t.pageX,this.originalPageY=t.pageY,n.cursorAt&&this._adjustOffsetFromHelper(n.cursorAt),n.containment&&this._setContainment(),this._trigger("start",t)===!1?(this._clear(),!1):(this._cacheHelperProportions(),e.ui.ddmanager&&!n.dropBehaviour&&e.ui.ddmanager.prepareOffsets(this,t),this._mouseDrag(t,!0),e.ui.ddmanager&&e.ui.ddmanager.dragStart(this,t),!0)},_mouseDrag:function(t,n){this.position=this._generatePosition(t),this.positionAbs=this._convertPositionTo("absolute");if(!n){var r=this._uiHash();if(this._trigger("drag",t,r)===!1)return this._mouseUp({}),!1;this.position=r.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";return e.ui.ddmanager&&e.ui.ddmanager.drag(this,t),!1},_mouseStop:function(t){var n=!1;e.ui.ddmanager&&!this.options.dropBehaviour&&(n=e.ui.ddmanager.drop(this,t)),this.dropped&&(n=this.dropped,this.dropped=!1);var r=this.element[0],i=!1;while(r&&(r=r.parentNode))r==document&&(i=!0);if(!i&&this.options.helper==="original")return!1;if(this.options.revert=="invalid"&&!n||this.options.revert=="valid"&&n||this.options.revert===!0||e.isFunction(this.options.revert)&&this.options.revert.call(this.element,n)){var s=this;e(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){s._trigger("stop",t)!==!1&&s._clear()})}else this._trigger("stop",t)!==!1&&this._clear();return!1},_mouseUp:function(t){return e("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)}),e.ui.ddmanager&&e.ui.ddmanager.dragStop(this,t),e.ui.mouse.prototype._mouseUp.call(this,t)},cancel:function(){return this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear(),this},_getHandle:function(t){var n=!this.options.handle||!e(this.options.handle,this.element).length?!0:!1;return e(this.options.handle,this.element).find("*").andSelf().each(function(){this==t.target&&(n=!0)}),n},_createHelper:function(t){var n=this.options,r=e.isFunction(n.helper)?e(n.helper.apply(this.element[0],[t])):n.helper=="clone"?this.element.clone().removeAttr("id"):this.element;return r.parents("body").length||r.appendTo(n.appendTo=="parent"?this.element[0].parentNode:n.appendTo),r[0]!=this.element[0]&&!/(fixed|absolute)/.test(r.css("position"))&&r.css("position","absolute"),r},_adjustOffsetFromHelper:function(t){typeof t=="string"&&(t=t.split(" ")),e.isArray(t)&&(t={left:+t[0],top:+t[1]||0}),"left"in t&&(this.offset.click.left=t.left+this.margins.left),"right"in t&&(this.offset.click.left=this.helperProportions.width-t.right+this.margins.left),"top"in t&&(this.offset.click.top=t.top+this.margins.top),"bottom"in t&&(this.offset.click.top=this.helperProportions.height-t.bottom+this.margins.top)},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var t=this.offsetParent.offset();this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&e.contains(this.scrollParent[0],this.offsetParent[0])&&(t.left+=this.scrollParent.scrollLeft(),t.top+=this.scrollParent.scrollTop());if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&e.ui.ie)t={top:0,left:0};return{top:t.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:t.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var e=this.element.position();return{top:e.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:e.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var t=this.options;t.containment=="parent"&&(t.containment=this.helper[0].parentNode);if(t.containment=="document"||t.containment=="window")this.containment=[t.containment=="document"?0:e(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,t.containment=="document"?0:e(window).scrollTop()-this.offset.relative.top-this.offset.parent.top,(t.containment=="document"?0:e(window).scrollLeft())+e(t.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(t.containment=="document"?0:e(window).scrollTop())+(e(t.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(t.containment)&&t.containment.constructor!=Array){var n=e(t.containment),r=n[0];if(!r)return;var i=n.offset(),s=e(r).css("overflow")!="hidden";this.containment=[(parseInt(e(r).css("borderLeftWidth"),10)||0)+(parseInt(e(r).css("paddingLeft"),10)||0),(parseInt(e(r).css("borderTopWidth"),10)||0)+(parseInt(e(r).css("paddingTop"),10)||0),(s?Math.max(r.scrollWidth,r.offsetWidth):r.offsetWidth)-(parseInt(e(r).css("borderLeftWidth"),10)||0)-(parseInt(e(r).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(s?Math.max(r.scrollHeight,r.offsetHeight):r.offsetHeight)-(parseInt(e(r).css("borderTopWidth"),10)||0)-(parseInt(e(r).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom],this.relative_container=n}else t.containment.constructor==Array&&(this.containment=t.containment)},_convertPositionTo:function(t,n){n||(n=this.position);var r=t=="absolute"?1:-1,i=this.options,s=this.cssPosition!="absolute"||this.scrollParent[0]!=document&&!!e.contains(this.scrollParent[0],this.offsetParent[0])?this.scrollParent:this.offsetParent,o=/(html|body)/i.test(s[0].tagName);return{top:n.top+this.offset.relative.top*r+this.offset.parent.top*r-(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():o?0:s.scrollTop())*r,left:n.left+this.offset.relative.left*r+this.offset.parent.left*r-(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():o?0:s.scrollLeft())*r}},_generatePosition:function(t){var n=this.options,r=this.cssPosition!="absolute"||this.scrollParent[0]!=document&&!!e.contains(this.scrollParent[0],this.offsetParent[0])?this.scrollParent:this.offsetParent,i=/(html|body)/i.test(r[0].tagName),s=t.pageX,o=t.pageY;if(this.originalPosition){var u;if(this.containment){if(this.relative_container){var a=this.relative_container.offset();u=[this.containment[0]+a.left,this.containment[1]+a.top,this.containment[2]+a.left,this.containment[3]+a.top]}else u=this.containment;t.pageX-this.offset.click.leftu[2]&&(s=u[2]+this.offset.click.left),t.pageY-this.offset.click.top>u[3]&&(o=u[3]+this.offset.click.top)}if(n.grid){var f=n.grid[1]?this.originalPageY+Math.round((o-this.originalPageY)/n.grid[1])*n.grid[1]:this.originalPageY;o=u?f-this.offset.click.topu[3]?f-this.offset.click.topu[2]?l-this.offset.click.left=0;l--){var c=r.snapElements[l].left,h=c+r.snapElements[l].width,p=r.snapElements[l].top,d=p+r.snapElements[l].height;if(!(c-s=l&&o<=c||u>=l&&u<=c||oc)&&(i>=a&&i<=f||s>=a&&s<=f||if);default:return!1}},e.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(t,n){var r=e.ui.ddmanager.droppables[t.options.scope]||[],i=n?n.type:null,s=(t.currentItem||t.element).find(":data(droppable)").andSelf();e:for(var o=0;o
      ').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")})),this.element=this.element.parent().data("resizable",this.element.data("resizable")),this.elementIsWrapper=!0,this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")}),this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0}),this.originalResizeStyle=this.originalElement.css("resize"),this.originalElement.css("resize","none"),this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"})),this.originalElement.css({margin:this.originalElement.css("margin")}),this._proportionallyResize()),this.handles=n.handles||(e(".ui-resizable-handle",this.element).length?{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"}:"e,s,se");if(this.handles.constructor==String){this.handles=="all"&&(this.handles="n,e,s,w,se,sw,ne,nw");var r=this.handles.split(",");this.handles={};for(var i=0;i
      ');u.css({zIndex:n.zIndex}),"se"==s&&u.addClass("ui-icon ui-icon-gripsmall-diagonal-se"),this.handles[s]=".ui-resizable-"+s,this.element.append(u)}}this._renderAxis=function(t){t=t||this.element;for(var n in this.handles){this.handles[n].constructor==String&&(this.handles[n]=e(this.handles[n],this.element).show());if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var r=e(this.handles[n],this.element),i=0;i=/sw|ne|nw|se|n|s/.test(n)?r.outerHeight():r.outerWidth();var s=["padding",/ne|nw|n/.test(n)?"Top":/se|sw|s/.test(n)?"Bottom":/^e$/.test(n)?"Right":"Left"].join("");t.css(s,i),this._proportionallyResize()}if(!e(this.handles[n]).length)continue}},this._renderAxis(this.element),this._handles=e(".ui-resizable-handle",this.element).disableSelection(),this._handles.mouseover(function(){if(!t.resizing){if(this.className)var e=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);t.axis=e&&e[1]?e[1]:"se"}}),n.autoHide&&(this._handles.hide(),e(this.element).addClass("ui-resizable-autohide").mouseenter(function(){if(n.disabled)return;e(this).removeClass("ui-resizable-autohide"),t._handles.show()}).mouseleave(function(){if(n.disabled)return;t.resizing||(e(this).addClass("ui-resizable-autohide"),t._handles.hide())})),this._mouseInit()},_destroy:function(){this._mouseDestroy();var t=function(t){e(t).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").removeData("ui-resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){t(this.element);var n=this.element;this.originalElement.css({position:n.css("position"),width:n.outerWidth(),height:n.outerHeight(),top:n.css("top"),left:n.css("left")}).insertAfter(n),n.remove()}return this.originalElement.css("resize",this.originalResizeStyle),t(this.originalElement),this},_mouseCapture:function(t){var n=!1;for(var r in this.handles)e(this.handles[r])[0]==t.target&&(n=!0);return!this.options.disabled&&n},_mouseStart:function(t){var r=this.options,i=this.element.position(),s=this.element;this.resizing=!0,this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()},(s.is(".ui-draggable")||/absolute/.test(s.css("position")))&&s.css({position:"absolute",top:i.top,left:i.left}),this._renderProxy();var o=n(this.helper.css("left")),u=n(this.helper.css("top"));r.containment&&(o+=e(r.containment).scrollLeft()||0,u+=e(r.containment).scrollTop()||0),this.offset=this.helper.offset(),this.position={left:o,top:u},this.size=this._helper?{width:s.outerWidth(),height:s.outerHeight()}:{width:s.width(),height:s.height()},this.originalSize=this._helper?{width:s.outerWidth(),height:s.outerHeight()}:{width:s.width(),height:s.height()},this.originalPosition={left:o,top:u},this.sizeDiff={width:s.outerWidth()-s.width(),height:s.outerHeight()-s.height()},this.originalMousePosition={left:t.pageX,top:t.pageY},this.aspectRatio=typeof r.aspectRatio=="number"?r.aspectRatio:this.originalSize.width/this.originalSize.height||1;var a=e(".ui-resizable-"+this.axis).css("cursor");return e("body").css("cursor",a=="auto"?this.axis+"-resize":a),s.addClass("ui-resizable-resizing"),this._propagate("start",t),!0},_mouseDrag:function(e){var t=this.helper,n=this.options,r={},i=this,s=this.originalMousePosition,o=this.axis,u=e.pageX-s.left||0,a=e.pageY-s.top||0,f=this._change[o];if(!f)return!1;var l=f.apply(this,[e,u,a]);this._updateVirtualBoundaries(e.shiftKey);if(this._aspectRatio||e.shiftKey)l=this._updateRatio(l,e);return l=this._respectSize(l,e),this._propagate("resize",e),t.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"}),!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize(),this._updateCache(l),this._trigger("resize",e,this.ui()),!1},_mouseStop:function(t){this.resizing=!1;var n=this.options,r=this;if(this._helper){var i=this._proportionallyResizeElements,s=i.length&&/textarea/i.test(i[0].nodeName),o=s&&e.ui.hasScroll(i[0],"left")?0:r.sizeDiff.height,u=s?0:r.sizeDiff.width,a={width:r.helper.width()-u,height:r.helper.height()-o},f=parseInt(r.element.css("left"),10)+(r.position.left-r.originalPosition.left)||null,l=parseInt(r.element.css("top"),10)+(r.position.top-r.originalPosition.top)||null;n.animate||this.element.css(e.extend(a,{top:l,left:f})),r.helper.height(r.size.height),r.helper.width(r.size.width),this._helper&&!n.animate&&this._proportionallyResize()}return e("body").css("cursor","auto"),this.element.removeClass("ui-resizable-resizing"),this._propagate("stop",t),this._helper&&this.helper.remove(),!1},_updateVirtualBoundaries:function(e){var t=this.options,n,i,s,o,u;u={minWidth:r(t.minWidth)?t.minWidth:0,maxWidth:r(t.maxWidth)?t.maxWidth:Infinity,minHeight:r(t.minHeight)?t.minHeight:0,maxHeight:r(t.maxHeight)?t.maxHeight:Infinity};if(this._aspectRatio||e)n=u.minHeight*this.aspectRatio,s=u.minWidth/this.aspectRatio,i=u.maxHeight*this.aspectRatio,o=u.maxWidth/this.aspectRatio,n>u.minWidth&&(u.minWidth=n),s>u.minHeight&&(u.minHeight=s),ie.width,l=r(e.height)&&i.minHeight&&i.minHeight>e.height;f&&(e.width=i.minWidth),l&&(e.height=i.minHeight),u&&(e.width=i.maxWidth),a&&(e.height=i.maxHeight);var c=this.originalPosition.left+this.originalSize.width,h=this.position.top+this.size.height,p=/sw|nw|w/.test(o),d=/nw|ne|n/.test(o);f&&p&&(e.left=c-i.minWidth),u&&p&&(e.left=c-i.maxWidth),l&&d&&(e.top=h-i.minHeight),a&&d&&(e.top=h-i.maxHeight);var v=!e.width&&!e.height;return v&&!e.left&&e.top?e.top=null:v&&!e.top&&e.left&&(e.left=null),e},_proportionallyResize:function(){var t=this.options;if(!this._proportionallyResizeElements.length)return;var n=this.helper||this.element;for(var r=0;r');var r=e.ui.ie6?1:0,i=e.ui.ie6?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+i,height:this.element.outerHeight()+i,position:"absolute",left:this.elementOffset.left-r+"px",top:this.elementOffset.top-r+"px",zIndex:++n.zIndex}),this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(e,t,n){return{width:this.originalSize.width+t}},w:function(e,t,n){var r=this.options,i=this.originalSize,s=this.originalPosition;return{left:s.left+t,width:i.width-t}},n:function(e,t,n){var r=this.options,i=this.originalSize,s=this.originalPosition;return{top:s.top+n,height:i.height-n}},s:function(e,t,n){return{height:this.originalSize.height+n}},se:function(t,n,r){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[t,n,r]))},sw:function(t,n,r){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[t,n,r]))},ne:function(t,n,r){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[t,n,r]))},nw:function(t,n,r){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[t,n,r]))}},_propagate:function(t,n){e.ui.plugin.call(this,t,[n,this.ui()]),t!="resize"&&this._trigger(t,n,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}}),e.ui.plugin.add("resizable","alsoResize",{start:function(t,n){var r=e(this).data("resizable"),i=r.options,s=function(t){e(t).each(function(){var t=e(this);t.data("resizable-alsoresize",{width:parseInt(t.width(),10),height:parseInt(t.height(),10),left:parseInt(t.css("left"),10),top:parseInt(t.css("top"),10)})})};typeof i.alsoResize=="object"&&!i.alsoResize.parentNode?i.alsoResize.length?(i.alsoResize=i.alsoResize[0],s(i.alsoResize)):e.each(i.alsoResize,function(e){s(e)}):s(i.alsoResize)},resize:function(t,n){var r=e(this).data("resizable"),i=r.options,s=r.originalSize,o=r.originalPosition,u={height:r.size.height-s.height||0,width:r.size.width-s.width||0,top:r.position.top-o.top||0,left:r.position.left-o.left||0},a=function(t,r){e(t).each(function(){var t=e(this),i=e(this).data("resizable-alsoresize"),s={},o=r&&r.length?r:t.parents(n.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(o,function(e,t){var n=(i[t]||0)+(u[t]||0);n&&n>=0&&(s[t]=n||null)}),t.css(s)})};typeof i.alsoResize=="object"&&!i.alsoResize.nodeType?e.each(i.alsoResize,function(e,t){a(e,t)}):a(i.alsoResize)},stop:function(t,n){e(this).removeData("resizable-alsoresize")}}),e.ui.plugin.add("resizable","animate",{stop:function(t,n){var r=e(this).data("resizable"),i=r.options,s=r._proportionallyResizeElements,o=s.length&&/textarea/i.test(s[0].nodeName),u=o&&e.ui.hasScroll(s[0],"left")?0:r.sizeDiff.height,a=o?0:r.sizeDiff.width,f={width:r.size.width-a,height:r.size.height-u},l=parseInt(r.element.css("left"),10)+(r.position.left-r.originalPosition.left)||null,c=parseInt(r.element.css("top"),10)+(r.position.top-r.originalPosition.top)||null;r.element.animate(e.extend(f,c&&l?{top:c,left:l}:{}),{duration:i.animateDuration,easing:i.animateEasing,step:function(){var n={width:parseInt(r.element.css("width"),10),height:parseInt(r.element.css("height"),10),top:parseInt(r.element.css("top"),10),left:parseInt(r.element.css("left"),10)};s&&s.length&&e(s[0]).css({width:n.width,height:n.height}),r._updateCache(n),r._propagate("resize",t)}})}}),e.ui.plugin.add("resizable","containment",{start:function(t,r){var i=e(this).data("resizable"),s=i.options,o=i.element,u=s.containment,a=u instanceof e?u.get(0):/parent/.test(u)?o.parent().get(0):u;if(!a)return;i.containerElement=e(a);if(/document/.test(u)||u==document)i.containerOffset={left:0,top:0},i.containerPosition={left:0,top:0},i.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight};else{var f=e(a),l=[];e(["Top","Right","Left","Bottom"]).each(function(e,t){l[e]=n(f.css("padding"+t))}),i.containerOffset=f.offset(),i.containerPosition=f.position(),i.containerSize={height:f.innerHeight()-l[3],width:f.innerWidth()-l[1]};var c=i.containerOffset,h=i.containerSize.height,p=i.containerSize.width,d=e.ui.hasScroll(a,"left")?a.scrollWidth:p,v=e.ui.hasScroll(a)?a.scrollHeight:h;i.parentData={element:a,left:c.left,top:c.top,width:d,height:v}}},resize:function(t,n){var r=e(this).data("resizable"),i=r.options,s=r.containerSize,o=r.containerOffset,u=r.size,a=r.position,f=r._aspectRatio||t.shiftKey,l={top:0,left:0},c=r.containerElement;c[0]!=document&&/static/.test(c.css("position"))&&(l=o),a.left<(r._helper?o.left:0)&&(r.size.width=r.size.width+(r._helper?r.position.left-o.left:r.position.left-l.left),f&&(r.size.height=r.size.width/r.aspectRatio),r.position.left=i.helper?o.left:0),a.top<(r._helper?o.top:0)&&(r.size.height=r.size.height+(r._helper?r.position.top-o.top:r.position.top),f&&(r.size.width=r.size.height*r.aspectRatio),r.position.top=r._helper?o.top:0),r.offset.left=r.parentData.left+r.position.left,r.offset.top=r.parentData.top+r.position.top;var h=Math.abs((r._helper?r.offset.left-l.left:r.offset.left-l.left)+r.sizeDiff.width),p=Math.abs((r._helper?r.offset.top-l.top:r.offset.top-o.top)+r.sizeDiff.height),d=r.containerElement.get(0)==r.element.parent().get(0),v=/relative|absolute/.test(r.containerElement.css("position"));d&&v&&(h-=r.parentData.left),h+r.size.width>=r.parentData.width&&(r.size.width=r.parentData.width-h,f&&(r.size.height=r.size.width/r.aspectRatio)),p+r.size.height>=r.parentData.height&&(r.size.height=r.parentData.height-p,f&&(r.size.width=r.size.height*r.aspectRatio))},stop:function(t,n){var r=e(this).data("resizable"),i=r.options,s=r.position,o=r.containerOffset,u=r.containerPosition,a=r.containerElement,f=e(r.helper),l=f.offset(),c=f.outerWidth()-r.sizeDiff.width,h=f.outerHeight()-r.sizeDiff.height;r._helper&&!i.animate&&/relative/.test(a.css("position"))&&e(this).css({left:l.left-u.left-o.left,width:c,height:h}),r._helper&&!i.animate&&/static/.test(a.css("position"))&&e(this).css({left:l.left-u.left-o.left,width:c,height:h})}}),e.ui.plugin.add("resizable","ghost",{start:function(t,n){var r=e(this).data("resizable"),i=r.options,s=r.size;r.ghost=r.originalElement.clone(),r.ghost.css({opacity:.25,display:"block",position:"relative",height:s.height,width:s.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof i.ghost=="string"?i.ghost:""),r.ghost.appendTo(r.helper)},resize:function(t,n){var r=e(this).data("resizable"),i=r.options;r.ghost&&r.ghost.css({position:"relative",height:r.size.height,width:r.size.width})},stop:function(t,n){var r=e(this).data("resizable"),i=r.options;r.ghost&&r.helper&&r.helper.get(0).removeChild(r.ghost.get(0))}}),e.ui.plugin.add("resizable","grid",{resize:function(t,n){var r=e(this).data("resizable"),i=r.options,s=r.size,o=r.originalSize,u=r.originalPosition,a=r.axis,f=i._aspectRatio||t.shiftKey;i.grid=typeof i.grid=="number"?[i.grid,i.grid]:i.grid;var l=Math.round((s.width-o.width)/(i.grid[0]||1))*(i.grid[0]||1),c=Math.round((s.height-o.height)/(i.grid[1]||1))*(i.grid[1]||1);/^(se|s|e)$/.test(a)?(r.size.width=o.width+l,r.size.height=o.height+c):/^(ne)$/.test(a)?(r.size.width=o.width+l,r.size.height=o.height+c,r.position.top=u.top-c):/^(sw)$/.test(a)?(r.size.width=o.width+l,r.size.height=o.height+c,r.position.left=u.left-l):(r.size.width=o.width+l,r.size.height=o.height+c,r.position.top=u.top-c,r.position.left=u.left-l)}});var n=function(e){return parseInt(e,10)||0},r=function(e){return!isNaN(parseInt(e,10))}}(jQuery),function(e,t){e.widget("ui.selectable",e.ui.mouse,{version:"1.9.2",options:{appendTo:"body",autoRefresh:!0,distance:0,filter:"*",tolerance:"touch"},_create:function(){var t=this;this.element.addClass("ui-selectable"),this.dragged=!1;var n;this.refresh=function(){n=e(t.options.filter,t.element[0]),n.addClass("ui-selectee"),n.each(function(){var t=e(this),n=t.offset();e.data(this,"selectable-item",{element:this,$element:t,left:n.left,top:n.top,right:n.left+t.outerWidth(),bottom:n.top+t.outerHeight(),startselected:!1,selected:t.hasClass("ui-selected"),selecting:t.hasClass("ui-selecting"),unselecting:t.hasClass("ui-unselecting")})})},this.refresh(),this.selectees=n.addClass("ui-selectee"),this._mouseInit(),this.helper=e("
      ")},_destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item"),this.element.removeClass("ui-selectable ui-selectable-disabled"),this._mouseDestroy()},_mouseStart:function(t){var n=this;this.opos=[t.pageX,t.pageY];if(this.options.disabled)return;var r=this.options;this.selectees=e(r.filter,this.element[0]),this._trigger("start",t),e(r.appendTo).append(this.helper),this.helper.css({left:t.clientX,top:t.clientY,width:0,height:0}),r.autoRefresh&&this.refresh(),this.selectees.filter(".ui-selected").each(function(){var r=e.data(this,"selectable-item");r.startselected=!0,!t.metaKey&&!t.ctrlKey&&(r.$element.removeClass("ui-selected"),r.selected=!1,r.$element.addClass("ui-unselecting"),r.unselecting=!0,n._trigger("unselecting",t,{unselecting:r.element}))}),e(t.target).parents().andSelf().each(function(){var r=e.data(this,"selectable-item");if(r){var i=!t.metaKey&&!t.ctrlKey||!r.$element.hasClass("ui-selected");return r.$element.removeClass(i?"ui-unselecting":"ui-selected").addClass(i?"ui-selecting":"ui-unselecting"),r.unselecting=!i,r.selecting=i,r.selected=i,i?n._trigger("selecting",t,{selecting:r.element}):n._trigger("unselecting",t,{unselecting:r.element}),!1}})},_mouseDrag:function(t){var n=this;this.dragged=!0;if(this.options.disabled)return;var r=this.options,i=this.opos[0],s=this.opos[1],o=t.pageX,u=t.pageY;if(i>o){var a=o;o=i,i=a}if(s>u){var a=u;u=s,s=a}return this.helper.css({left:i,top:s,width:o-i,height:u-s}),this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!a||a.element==n.element[0])return;var f=!1;r.tolerance=="touch"?f=!(a.left>o||a.rightu||a.bottomi&&a.rights&&a.bottom *",opacity:!1,placeholder:!1,revert:!1,scroll:!0,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1e3},_create:function(){var e=this.options;this.containerCache={},this.element.addClass("ui-sortable"),this.refresh(),this.floating=this.items.length?e.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):!1,this.offset=this.element.offset(),this._mouseInit(),this.ready=!0},_destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled"),this._mouseDestroy();for(var e=this.items.length-1;e>=0;e--)this.items[e].item.removeData(this.widgetName+"-item");return this},_setOption:function(t,n){t==="disabled"?(this.options[t]=n,this.widget().toggleClass("ui-sortable-disabled",!!n)):e.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(t,n){var r=this;if(this.reverting)return!1;if(this.options.disabled||this.options.type=="static")return!1;this._refreshItems(t);var i=null,s=e(t.target).parents().each(function(){if(e.data(this,r.widgetName+"-item")==r)return i=e(this),!1});e.data(t.target,r.widgetName+"-item")==r&&(i=e(t.target));if(!i)return!1;if(this.options.handle&&!n){var o=!1;e(this.options.handle,i).find("*").andSelf().each(function(){this==t.target&&(o=!0)});if(!o)return!1}return this.currentItem=i,this._removeCurrentsFromItems(),!0},_mouseStart:function(t,n,r){var i=this.options;this.currentContainer=this,this.refreshPositions(),this.helper=this._createHelper(t),this._cacheHelperProportions(),this._cacheMargins(),this.scrollParent=this.helper.scrollParent(),this.offset=this.currentItem.offset(),this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left},e.extend(this.offset,{click:{left:t.pageX-this.offset.left,top:t.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}),this.helper.css("position","absolute"),this.cssPosition=this.helper.css("position"),this.originalPosition=this._generatePosition(t),this.originalPageX=t.pageX,this.originalPageY=t.pageY,i.cursorAt&&this._adjustOffsetFromHelper(i.cursorAt),this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]},this.helper[0]!=this.currentItem[0]&&this.currentItem.hide(),this._createPlaceholder(),i.containment&&this._setContainment(),i.cursor&&(e("body").css("cursor")&&(this._storedCursor=e("body").css("cursor")),e("body").css("cursor",i.cursor)),i.opacity&&(this.helper.css("opacity")&&(this._storedOpacity=this.helper.css("opacity")),this.helper.css("opacity",i.opacity)),i.zIndex&&(this.helper.css("zIndex")&&(this._storedZIndex=this.helper.css("zIndex")),this.helper.css("zIndex",i.zIndex)),this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"&&(this.overflowOffset=this.scrollParent.offset()),this._trigger("start",t,this._uiHash()),this._preserveHelperProportions||this._cacheHelperProportions();if(!r)for(var s=this.containers.length-1;s>=0;s--)this.containers[s]._trigger("activate",t,this._uiHash(this));return e.ui.ddmanager&&(e.ui.ddmanager.current=this),e.ui.ddmanager&&!i.dropBehaviour&&e.ui.ddmanager.prepareOffsets(this,t),this.dragging=!0,this.helper.addClass("ui-sortable-helper"),this._mouseDrag(t),!0},_mouseDrag:function(t){this.position=this._generatePosition(t),this.positionAbs=this._convertPositionTo("absolute"),this.lastPositionAbs||(this.lastPositionAbs=this.positionAbs);if(this.options.scroll){var n=this.options,r=!1;this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"?(this.overflowOffset.top+this.scrollParent[0].offsetHeight-t.pageY=0;i--){var s=this.items[i],o=s.item[0],u=this._intersectsWithPointer(s);if(!u)continue;if(s.instance!==this.currentContainer)continue;if(o!=this.currentItem[0]&&this.placeholder[u==1?"next":"prev"]()[0]!=o&&!e.contains(this.placeholder[0],o)&&(this.options.type=="semi-dynamic"?!e.contains(this.element[0],o):!0)){this.direction=u==1?"down":"up";if(this.options.tolerance!="pointer"&&!this._intersectsWithSides(s))break;this._rearrange(t,s),this._trigger("change",t,this._uiHash());break}}return this._contactContainers(t),e.ui.ddmanager&&e.ui.ddmanager.drag(this,t),this._trigger("sort",t,this._uiHash()),this.lastPositionAbs=this.positionAbs,!1},_mouseStop:function(t,n){if(!t)return;e.ui.ddmanager&&!this.options.dropBehaviour&&e.ui.ddmanager.drop(this,t);if(this.options.revert){var r=this,i=this.placeholder.offset();this.reverting=!0,e(this.helper).animate({left:i.left-this.offset.parent.left-this.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:i.top-this.offset.parent.top-this.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){r._clear(t)})}else this._clear(t,n);return!1},cancel:function(){if(this.dragging){this._mouseUp({target:null}),this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):this.currentItem.show();for(var t=this.containers.length-1;t>=0;t--)this.containers[t]._trigger("deactivate",null,this._uiHash(this)),this.containers[t].containerCache.over&&(this.containers[t]._trigger("out",null,this._uiHash(this)),this.containers[t].containerCache.over=0)}return this.placeholder&&(this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]),this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove(),e.extend(this,{helper:null,dragging:!1,reverting:!1,_noFinalSort:null}),this.domPosition.prev?e(this.domPosition.prev).after(this.currentItem):e(this.domPosition.parent).prepend(this.currentItem)),this},serialize:function(t){var n=this._getItemsAsjQuery(t&&t.connected),r=[];return t=t||{},e(n).each(function(){var n=(e(t.item||this).attr(t.attribute||"id")||"").match(t.expression||/(.+)[-=_](.+)/);n&&r.push((t.key||n[1]+"[]")+"="+(t.key&&t.expression?n[1]:n[2]))}),!r.length&&t.key&&r.push(t.key+"="),r.join("&")},toArray:function(t){var n=this._getItemsAsjQuery(t&&t.connected),r=[];return t=t||{},n.each(function(){r.push(e(t.item||this).attr(t.attribute||"id")||"")}),r},_intersectsWith:function(e){var t=this.positionAbs.left,n=t+this.helperProportions.width,r=this.positionAbs.top,i=r+this.helperProportions.height,s=e.left,o=s+e.width,u=e.top,a=u+e.height,f=this.offset.click.top,l=this.offset.click.left,c=r+f>u&&r+fs&&t+le[this.floating?"width":"height"]?c:s0?"down":"up")},_getDragHorizontalDirection:function(){var e=this.positionAbs.left-this.lastPositionAbs.left;return e!=0&&(e>0?"right":"left")},refresh:function(e){return this._refreshItems(e),this.refreshPositions(),this},_connectWith:function(){var e=this.options;return e.connectWith.constructor==String?[e.connectWith]:e.connectWith},_getItemsAsjQuery:function(t){var n=[],r=[],i=this._connectWith();if(i&&t)for(var s=i.length-1;s>=0;s--){var o=e(i[s]);for(var u=o.length-1;u>=0;u--){var a=e.data(o[u],this.widgetName);a&&a!=this&&!a.options.disabled&&r.push([e.isFunction(a.options.items)?a.options.items.call(a.element):e(a.options.items,a.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),a])}}r.push([e.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):e(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]);for(var s=r.length-1;s>=0;s--)r[s][0].each(function(){n.push(this)});return e(n)},_removeCurrentsFromItems:function(){var t=this.currentItem.find(":data("+this.widgetName+"-item)");this.items=e.grep(this.items,function(e){for(var n=0;n=0;s--){var o=e(i[s]);for(var u=o.length-1;u>=0;u--){var a=e.data(o[u],this.widgetName);a&&a!=this&&!a.options.disabled&&(r.push([e.isFunction(a.options.items)?a.options.items.call(a.element[0],t,{item:this.currentItem}):e(a.options.items,a.element),a]),this.containers.push(a))}}for(var s=r.length-1;s>=0;s--){var f=r[s][1],l=r[s][0];for(var u=0,c=l.length;u=0;n--){var r=this.items[n];if(r.instance!=this.currentContainer&&this.currentContainer&&r.item[0]!=this.currentItem[0])continue;var i=this.options.toleranceElement?e(this.options.toleranceElement,r.item):r.item;t||(r.width=i.outerWidth(),r.height=i.outerHeight());var s=i.offset();r.left=s.left,r.top=s.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(var n=this.containers.length-1;n>=0;n--){var s=this.containers[n].element.offset();this.containers[n].containerCache.left=s.left,this.containers[n].containerCache.top=s.top,this.containers[n].containerCache.width=this.containers[n].element.outerWidth(),this.containers[n].containerCache.height=this.containers[n].element.outerHeight()}return this},_createPlaceholder:function(t){t=t||this;var n=t.options;if(!n.placeholder||n.placeholder.constructor==String){var r=n.placeholder;n.placeholder={element:function(){var n=e(document.createElement(t.currentItem[0].nodeName)).addClass(r||t.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];return r||(n.style.visibility="hidden"),n},update:function(e,i){if(r&&!n.forcePlaceholderSize)return;i.height()||i.height(t.currentItem.innerHeight()-parseInt(t.currentItem.css("paddingTop")||0,10)-parseInt(t.currentItem.css("paddingBottom")||0,10)),i.width()||i.width(t.currentItem.innerWidth()-parseInt(t.currentItem.css("paddingLeft")||0,10)-parseInt(t.currentItem.css("paddingRight")||0,10))}}}t.placeholder=e(n.placeholder.element.call(t.element,t.currentItem)),t.currentItem.after(t.placeholder),n.placeholder.update(t,t.placeholder)},_contactContainers:function(t){var n=null,r=null;for(var i=this.containers.length-1;i>=0;i--){if(e.contains(this.currentItem[0],this.containers[i].element[0]))continue;if(this._intersectsWith(this.containers[i].containerCache)){if(n&&e.contains(this.containers[i].element[0],n.element[0]))continue;n=this.containers[i],r=i}else this.containers[i].containerCache.over&&(this.containers[i]._trigger("out",t,this._uiHash(this)),this.containers[i].containerCache.over=0)}if(!n)return;if(this.containers.length===1)this.containers[r]._trigger("over",t,this._uiHash(this)),this.containers[r].containerCache.over=1;else{var s=1e4,o=null,u=this.containers[r].floating?"left":"top",a=this.containers[r].floating?"width":"height",f=this.positionAbs[u]+this.offset.click[u];for(var l=this.items.length-1;l>=0;l--){if(!e.contains(this.containers[r].element[0],this.items[l].item[0]))continue;if(this.items[l].item[0]==this.currentItem[0])continue;var c=this.items[l].item.offset()[u],h=!1;Math.abs(c-f)>Math.abs(c+this.items[l][a]-f)&&(h=!0,c+=this.items[l][a]),Math.abs(c-f)this.containment[2]&&(s=this.containment[2]+this.offset.click.left),t.pageY-this.offset.click.top>this.containment[3]&&(o=this.containment[3]+this.offset.click.top));if(n.grid){var u=this.originalPageY+Math.round((o-this.originalPageY)/n.grid[1])*n.grid[1];o=this.containment?u-this.offset.click.topthis.containment[3]?u-this.offset.click.topthis.containment[2]?a-this.offset.click.left=0;i--)n||r.push(function(e){return function(t){e._trigger("deactivate",t,this._uiHash(this))}}.call(this,this.containers[i])),this.containers[i].containerCache.over&&(r.push(function(e){return function(t){e._trigger("out",t,this._uiHash(this))}}.call(this,this.containers[i])),this.containers[i].containerCache.over=0);this._storedCursor&&e("body").css("cursor",this._storedCursor),this._storedOpacity&&this.helper.css("opacity",this._storedOpacity),this._storedZIndex&&this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex),this.dragging=!1;if(this.cancelHelperRemoval){if(!n){this._trigger("beforeStop",t,this._uiHash());for(var i=0;ie?0:r.max")[0],c,h=t.each;l.style.cssText="background-color:rgba(1,1,1,.5)",f.rgba=l.style.backgroundColor.indexOf("rgba")>-1,h(u,function(e,t){t.cache="_"+e,t.props.alpha={idx:3,type:"percent",def:1}}),o.fn=t.extend(o.prototype,{parse:function(r,i,s,a){if(r===n)return this._rgba=[null,null,null,null],this;if(r.jquery||r.nodeType)r=t(r).css(i),i=n;var f=this,l=t.type(r),v=this._rgba=[];i!==n&&(r=[r,i,s,a],l="array");if(l==="string")return this.parse(d(r)||c._default);if(l==="array")return h(u.rgba.props,function(e,t){v[t.idx]=p(r[t.idx],t)}),this;if(l==="object")return r instanceof o?h(u,function(e,t){r[t.cache]&&(f[t.cache]=r[t.cache].slice())}):h(u,function(t,n){var i=n.cache;h(n.props,function(e,t){if(!f[i]&&n.to){if(e==="alpha"||r[e]==null)return;f[i]=n.to(f._rgba)}f[i][t.idx]=p(r[e],t,!0)}),f[i]&&e.inArray(null,f[i].slice(0,3))<0&&(f[i][3]=1,n.from&&(f._rgba=n.from(f[i])))}),this},is:function(e){var t=o(e),n=!0,r=this;return h(u,function(e,i){var s,o=t[i.cache];return o&&(s=r[i.cache]||i.to&&i.to(r._rgba)||[],h(i.props,function(e,t){if(o[t.idx]!=null)return n=o[t.idx]===s[t.idx],n})),n}),n},_space:function(){var e=[],t=this;return h(u,function(n,r){t[r.cache]&&e.push(n)}),e.pop()},transition:function(e,t){var n=o(e),r=n._space(),i=u[r],s=this.alpha()===0?o("transparent"):this,f=s[i.cache]||i.to(s._rgba),l=f.slice();return n=n[i.cache],h(i.props,function(e,r){var i=r.idx,s=f[i],o=n[i],u=a[r.type]||{};if(o===null)return;s===null?l[i]=o:(u.mod&&(o-s>u.mod/2?s+=u.mod:s-o>u.mod/2&&(s-=u.mod)),l[i]=p((o-s)*t+s,r))}),this[r](l)},blend:function(e){if(this._rgba[3]===1)return this;var n=this._rgba.slice(),r=n.pop(),i=o(e)._rgba;return o(t.map(n,function(e,t){return(1-r)*i[t]+r*e}))},toRgbaString:function(){var e="rgba(",n=t.map(this._rgba,function(e,t){return e==null?t>2?1:0:e});return n[3]===1&&(n.pop(),e="rgb("),e+n.join()+")"},toHslaString:function(){var e="hsla(",n=t.map(this.hsla(),function(e,t){return e==null&&(e=t>2?1:0),t&&t<3&&(e=Math.round(e*100)+"%"),e});return n[3]===1&&(n.pop(),e="hsl("),e+n.join()+")"},toHexString:function(e){var n=this._rgba.slice(),r=n.pop();return e&&n.push(~~(r*255)),"#"+t.map(n,function(e){return e=(e||0).toString(16),e.length===1?"0"+e:e}).join("")},toString:function(){return this._rgba[3]===0?"transparent":this.toRgbaString()}}),o.fn.parse.prototype=o.fn,u.hsla.to=function(e){if(e[0]==null||e[1]==null||e[2]==null)return[null,null,null,e[3]];var t=e[0]/255,n=e[1]/255,r=e[2]/255,i=e[3],s=Math.max(t,n,r),o=Math.min(t,n,r),u=s-o,a=s+o,f=a*.5,l,c;return o===s?l=0:t===s?l=60*(n-r)/u+360:n===s?l=60*(r-t)/u+120:l=60*(t-n)/u+240,f===0||f===1?c=f:f<=.5?c=u/a:c=u/(2-a),[Math.round(l)%360,c,f,i==null?1:i]},u.hsla.from=function(e){if(e[0]==null||e[1]==null||e[2]==null)return[null,null,null,e[3]];var t=e[0]/360,n=e[1],r=e[2],i=e[3],s=r<=.5?r*(1+n):r+n-r*n,o=2*r-s;return[Math.round(v(o,s,t+1/3)*255),Math.round(v(o,s,t)*255),Math.round(v(o,s,t-1/3)*255),i]},h(u,function(e,r){var s=r.props,u=r.cache,a=r.to,f=r.from;o.fn[e]=function(e){a&&!this[u]&&(this[u]=a(this._rgba));if(e===n)return this[u].slice();var r,i=t.type(e),l=i==="array"||i==="object"?e:arguments,c=this[u].slice();return h(s,function(e,t){var n=l[i==="object"?e:t.idx];n==null&&(n=c[t.idx]),c[t.idx]=p(n,t)}),f?(r=o(f(c)),r[u]=c,r):o(c)},h(s,function(n,r){if(o.fn[n])return;o.fn[n]=function(s){var o=t.type(s),u=n==="alpha"?this._hsla?"hsla":"rgba":e,a=this[u](),f=a[r.idx],l;return o==="undefined"?f:(o==="function"&&(s=s.call(this,f),o=t.type(s)),s==null&&r.empty?this:(o==="string"&&(l=i.exec(s),l&&(s=f+parseFloat(l[2])*(l[1]==="+"?1:-1))),a[r.idx]=s,this[u](a)))}})}),h(r,function(e,n){t.cssHooks[n]={set:function(e,r){var i,s,u="";if(t.type(r)!=="string"||(i=d(r))){r=o(i||r);if(!f.rgba&&r._rgba[3]!==1){s=n==="backgroundColor"?e.parentNode:e;while((u===""||u==="transparent")&&s&&s.style)try{u=t.css(s,"backgroundColor"),s=s.parentNode}catch(a){}r=r.blend(u&&u!=="transparent"?u:"_default")}r=r.toRgbaString()}try{e.style[n]=r}catch(l){}}},t.fx.step[n]=function(e){e.colorInit||(e.start=o(e.elem,n),e.end=o(e.end),e.colorInit=!0),t.cssHooks[n].set(e.elem,e.start.transition(e.end,e.pos))}}),t.cssHooks.borderColor={expand:function(e){var t={};return h(["Top","Right","Bottom","Left"],function(n,r){t["border"+r+"Color"]=e}),t}},c=t.Color.names={aqua:"#00ffff",black:"#000000",blue:"#0000ff",fuchsia:"#ff00ff",gray:"#808080",green:"#008000",lime:"#00ff00",maroon:"#800000",navy:"#000080",olive:"#808000",purple:"#800080",red:"#ff0000",silver:"#c0c0c0",teal:"#008080",white:"#ffffff",yellow:"#ffff00",transparent:[null,null,null,0],_default:"#ffffff"}}(jQuery),function(){function i(){var t=this.ownerDocument.defaultView?this.ownerDocument.defaultView.getComputedStyle(this,null):this.currentStyle,n={},r,i;if(t&&t.length&&t[0]&&t[t[0]]){i=t.length;while(i--)r=t[i],typeof t[r]=="string"&&(n[e.camelCase(r)]=t[r])}else for(r in t)typeof t[r]=="string"&&(n[r]=t[r]);return n}function s(t,n){var i={},s,o;for(s in n)o=n[s],t[s]!==o&&!r[s]&&(e.fx.step[s]||!isNaN(parseFloat(o)))&&(i[s]=o);return i}var n=["add","remove","toggle"],r={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};e.each(["borderLeftStyle","borderRightStyle","borderBottomStyle","borderTopStyle"],function(t,n){e.fx.step[n]=function(e){if(e.end!=="none"&&!e.setAttr||e.pos===1&&!e.setAttr)jQuery.style(e.elem,n,e.end),e.setAttr=!0}}),e.effects.animateClass=function(t,r,o,u){var a=e.speed(r,o,u);return this.queue(function(){var r=e(this),o=r.attr("class")||"",u,f=a.children?r.find("*").andSelf():r;f=f.map(function(){var t=e(this);return{el:t,start:i.call(this)}}),u=function(){e.each(n,function(e,n){t[n]&&r[n+"Class"](t[n])})},u(),f=f.map(function(){return this.end=i.call(this.el[0]),this.diff=s(this.start,this.end),this}),r.attr("class",o),f=f.map(function(){var t=this,n=e.Deferred(),r=jQuery.extend({},a,{queue:!1,complete:function(){n.resolve(t)}});return this.el.animate(this.diff,r),n.promise()}),e.when.apply(e,f.get()).done(function(){u(),e.each(arguments,function(){var t=this.el;e.each(this.diff,function(e){t.css(e,"")})}),a.complete.call(r[0])})})},e.fn.extend({_addClass:e.fn.addClass,addClass:function(t,n,r,i){return n?e.effects.animateClass.call(this,{add:t},n,r,i):this._addClass(t)},_removeClass:e.fn.removeClass,removeClass:function(t,n,r,i){return n?e.effects.animateClass.call(this,{remove:t},n,r,i):this._removeClass(t)},_toggleClass:e.fn.toggleClass,toggleClass:function(n,r,i,s,o){return typeof r=="boolean"||r===t?i?e.effects.animateClass.call(this,r?{add:n}:{remove:n},i,s,o):this._toggleClass(n,r):e.effects.animateClass.call(this,{toggle:n},r,i,s)},switchClass:function(t,n,r,i,s){return e.effects.animateClass.call(this,{add:n,remove:t},r,i,s)}})}(),function(){function i(t,n,r,i){e.isPlainObject(t)&&(n=t,t=t.effect),t={effect:t},n==null&&(n={}),e.isFunction(n)&&(i=n,r=null,n={});if(typeof n=="number"||e.fx.speeds[n])i=r,r=n,n={};return e.isFunction(r)&&(i=r,r=null),n&&e.extend(t,n),r=r||n.duration,t.duration=e.fx.off?0:typeof r=="number"?r:r in e.fx.speeds?e.fx.speeds[r]:e.fx.speeds._default,t.complete=i||n.complete,t}function s(t){return!t||typeof t=="number"||e.fx.speeds[t]?!0:typeof t=="string"&&!e.effects.effect[t]?n&&e.effects[t]?!1:!0:!1}e.extend(e.effects,{version:"1.9.2",save:function(e,t){for(var n=0;n").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}),i={width:t.width(),height:t.height()},s=document.activeElement;try{s.id}catch(o){s=document.body}return t.wrap(r),(t[0]===s||e.contains(t[0],s))&&e(s).focus(),r=t.parent(),t.css("position")==="static"?(r.css({position:"relative"}),t.css({position:"relative"})):(e.extend(n,{position:t.css("position"),zIndex:t.css("z-index")}),e.each(["top","left","bottom","right"],function(e,r){n[r]=t.css(r),isNaN(parseInt(n[r],10))&&(n[r]="auto")}),t.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})),t.css(i),r.css(n).show()},removeWrapper:function(t){var n=document.activeElement;return t.parent().is(".ui-effects-wrapper")&&(t.parent().replaceWith(t),(t[0]===n||e.contains(t[0],n))&&e(n).focus()),t},setTransition:function(t,n,r,i){return i=i||{},e.each(n,function(e,n){var s=t.cssUnit(n);s[0]>0&&(i[n]=s[0]*r+s[1])}),i}}),e.fn.extend({effect:function(){function a(n){function u(){e.isFunction(i)&&i.call(r[0]),e.isFunction(n)&&n()}var r=e(this),i=t.complete,s=t.mode;(r.is(":hidden")?s==="hide":s==="show")?u():o.call(r[0],t,u)}var t=i.apply(this,arguments),r=t.mode,s=t.queue,o=e.effects.effect[t.effect],u=!o&&n&&e.effects[t.effect];return e.fx.off||!o&&!u?r?this[r](t.duration,t.complete):this.each(function(){t.complete&&t.complete.call(this)}):o?s===!1?this.each(a):this.queue(s||"fx",a):u.call(this,{options:t,duration:t.duration,callback:t.complete,mode:t.mode})},_show:e.fn.show,show:function(e){if(s(e))return this._show.apply(this,arguments);var t=i.apply(this,arguments);return t.mode="show",this.effect.call(this,t)},_hide:e.fn.hide,hide:function(e){if(s(e))return this._hide.apply(this,arguments);var t=i.apply(this,arguments);return t.mode="hide",this.effect.call(this,t)},__toggle:e.fn.toggle,toggle:function(t){if(s(t)||typeof t=="boolean"||e.isFunction(t))return this.__toggle.apply(this,arguments);var n=i.apply(this,arguments);return n.mode="toggle",this.effect.call(this,n)},cssUnit:function(t){var n=this.css(t),r=[];return e.each(["em","px","%","pt"],function(e,t){n.indexOf(t)>0&&(r=[parseFloat(n),t])}),r}})}(),function(){var t={};e.each(["Quad","Cubic","Quart","Quint","Expo"],function(e,n){t[n]=function(t){return Math.pow(t,e+2)}}),e.extend(t,{Sine:function(e){return 1-Math.cos(e*Math.PI/2)},Circ:function(e){return 1-Math.sqrt(1-e*e)},Elastic:function(e){return e===0||e===1?e:-Math.pow(2,8*(e-1))*Math.sin(((e-1)*80-7.5)*Math.PI/15)},Back:function(e){return e*e*(3*e-2)},Bounce:function(e){var t,n=4;while(e<((t=Math.pow(2,--n))-1)/11);return 1/Math.pow(4,3-n)-7.5625*Math.pow((t*3-2)/22-e,2)}}),e.each(t,function(t,n){e.easing["easeIn"+t]=n,e.easing["easeOut"+t]=function(e){return 1-n(1-e)},e.easing["easeInOut"+t]=function(e){return e<.5?n(e*2)/2:1-n(e*-2+2)/2}})}()}(jQuery),function(e,t){var n=0,r={},i={};r.height=r.paddingTop=r.paddingBottom=r.borderTopWidth=r.borderBottomWidth="hide",i.height=i.paddingTop=i.paddingBottom=i.borderTopWidth=i.borderBottomWidth="show",e.widget("ui.accordion",{version:"1.9.2",options:{active:0,animate:{},collapsible:!1,event:"click",header:"> li > :first-child,> :not(li):even",heightStyle:"auto",icons:{activeHeader:"ui-icon-triangle-1-s",header:"ui-icon-triangle-1-e"},activate:null,beforeActivate:null},_create:function(){var t=this.accordionId="ui-accordion-"+(this.element.attr("id")||++n),r=this.options;this.prevShow=this.prevHide=e(),this.element.addClass("ui-accordion ui-widget ui-helper-reset"),this.headers=this.element.find(r.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all"),this._hoverable(this.headers),this._focusable(this.headers),this.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom").hide(),!r.collapsible&&(r.active===!1||r.active==null)&&(r.active=0),r.active<0&&(r.active+=this.headers.length),this.active=this._findActive(r.active).addClass("ui-accordion-header-active ui-state-active").toggleClass("ui-corner-all ui-corner-top"),this.active.next().addClass("ui-accordion-content-active").show(),this._createIcons(),this.refresh(),this.element.attr("role","tablist"),this.headers.attr("role","tab").each(function(n){var r=e(this),i=r.attr("id"),s=r.next(),o=s.attr("id");i||(i=t+"-header-"+n,r.attr("id",i)),o||(o=t+"-panel-"+n,s.attr("id",o)),r.attr("aria-controls",o),s.attr("aria-labelledby",i)}).next().attr("role","tabpanel"),this.headers.not(this.active).attr({"aria-selected":"false",tabIndex:-1}).next().attr({"aria-expanded":"false","aria-hidden":"true"}).hide(),this.active.length?this.active.attr({"aria-selected":"true",tabIndex:0}).next().attr({"aria-expanded":"true","aria-hidden":"false"}):this.headers.eq(0).attr("tabIndex",0),this._on(this.headers,{keydown:"_keydown"}),this._on(this.headers.next(),{keydown:"_panelKeyDown"}),this._setupEvents(r.event)},_getCreateEventData:function(){return{header:this.active,content:this.active.length?this.active.next():e()}},_createIcons:function(){var t=this.options.icons;t&&(e("").addClass("ui-accordion-header-icon ui-icon "+t.header).prependTo(this.headers),this.active.children(".ui-accordion-header-icon").removeClass(t.header).addClass(t.activeHeader),this.headers.addClass("ui-accordion-icons"))},_destroyIcons:function(){this.headers.removeClass("ui-accordion-icons").children(".ui-accordion-header-icon").remove()},_destroy:function(){var e;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role"),this.headers.removeClass("ui-accordion-header ui-accordion-header-active ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-selected").removeAttr("aria-controls").removeAttr("tabIndex").each(function(){/^ui-accordion/.test(this.id)&&this.removeAttribute("id")}),this._destroyIcons(),e=this.headers.next().css("display","").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-hidden").removeAttr("aria-labelledby").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-state-disabled").each(function(){/^ui-accordion/.test(this.id)&&this.removeAttribute("id")}),this.options.heightStyle!=="content"&&e.css("height","")},_setOption:function(e,t){if(e==="active"){this._activate(t);return}e==="event"&&(this.options.event&&this._off(this.headers,this.options.event),this._setupEvents(t)),this._super(e,t),e==="collapsible"&&!t&&this.options.active===!1&&this._activate(0),e==="icons"&&(this._destroyIcons(),t&&this._createIcons()),e==="disabled"&&this.headers.add(this.headers.next()).toggleClass("ui-state-disabled",!!t)},_keydown:function(t){if(t.altKey||t.ctrlKey)return;var n=e.ui.keyCode,r=this.headers.length,i=this.headers.index(t.target),s=!1;switch(t.keyCode){case n.RIGHT:case n.DOWN:s=this.headers[(i+1)%r];break;case n.LEFT:case n.UP:s=this.headers[(i-1+r)%r];break;case n.SPACE:case n.ENTER:this._eventHandler(t);break;case n.HOME:s=this.headers[0];break;case n.END:s=this.headers[r-1]}s&&(e(t.target).attr("tabIndex",-1),e(s).attr("tabIndex",0),s.focus(),t.preventDefault())},_panelKeyDown:function(t){t.keyCode===e.ui.keyCode.UP&&t.ctrlKey&&e(t.currentTarget).prev().focus()},refresh:function(){var t,n,r=this.options.heightStyle,i=this.element.parent();r==="fill"?(e.support.minHeight||(n=i.css("overflow"),i.css("overflow","hidden")),t=i.height(),this.element.siblings(":visible").each(function(){var n=e(this),r=n.css("position");if(r==="absolute"||r==="fixed")return;t-=n.outerHeight(!0)}),n&&i.css("overflow",n),this.headers.each(function(){t-=e(this).outerHeight(!0)}),this.headers.next().each(function(){e(this).height(Math.max(0,t-e(this).innerHeight()+e(this).height()))}).css("overflow","auto")):r==="auto"&&(t=0,this.headers.next().each(function(){t=Math.max(t,e(this).css("height","").height())}).height(t))},_activate:function(t){var n=this._findActive(t)[0];if(n===this.active[0])return;n=n||this.active[0],this._eventHandler({target:n,currentTarget:n,preventDefault:e.noop})},_findActive:function(t){return typeof t=="number"?this.headers.eq(t):e()},_setupEvents:function(t){var n={};if(!t)return;e.each(t.split(" "),function(e,t){n[t]="_eventHandler"}),this._on(this.headers,n)},_eventHandler:function(t){var n=this.options,r=this.active,i=e(t.currentTarget),s=i[0]===r[0],o=s&&n.collapsible,u=o?e():i.next(),a=r.next(),f={oldHeader:r,oldPanel:a,newHeader:o?e():i,newPanel:u};t.preventDefault();if(s&&!n.collapsible||this._trigger("beforeActivate",t,f)===!1)return;n.active=o?!1:this.headers.index(i),this.active=s?e():i,this._toggle(f),r.removeClass("ui-accordion-header-active ui-state-active"),n.icons&&r.children(".ui-accordion-header-icon").removeClass(n.icons.activeHeader).addClass(n.icons.header),s||(i.removeClass("ui-corner-all").addClass("ui-accordion-header-active ui-state-active ui-corner-top"),n.icons&&i.children(".ui-accordion-header-icon").removeClass(n.icons.header).addClass(n.icons.activeHeader),i.next().addClass("ui-accordion-content-active"))},_toggle:function(t){var n=t.newPanel,r=this.prevShow.length?this.prevShow:t.oldPanel;this.prevShow.add(this.prevHide).stop(!0,!0),this.prevShow=n,this.prevHide=r,this.options.animate?this._animate(n,r,t):(r.hide(),n.show(),this._toggleComplete(t)),r.attr({"aria-expanded":"false","aria-hidden":"true"}),r.prev().attr("aria-selected","false"),n.length&&r.length?r.prev().attr("tabIndex",-1):n.length&&this.headers.filter(function(){return e(this).attr("tabIndex")===0}).attr("tabIndex",-1),n.attr({"aria-expanded":"true","aria-hidden":"false"}).prev().attr({"aria-selected":"true",tabIndex:0})},_animate:function(e,t,n){var s,o,u,a=this,f=0,l=e.length&&(!t.length||e.index()",options:{appendTo:"body",autoFocus:!1,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null,change:null,close:null,focus:null,open:null,response:null,search:null,select:null},pending:0,_create:function(){var t,n,r;this.isMultiLine=this._isMultiLine(),this.valueMethod=this.element[this.element.is("input,textarea")?"val":"text"],this.isNewMenu=!0,this.element.addClass("ui-autocomplete-input").attr("autocomplete","off"),this._on(this.element,{keydown:function(i){if(this.element.prop("readOnly")){t=!0,r=!0,n=!0;return}t=!1,r=!1,n=!1;var s=e.ui.keyCode;switch(i.keyCode){case s.PAGE_UP:t=!0,this._move("previousPage",i);break;case s.PAGE_DOWN:t=!0,this._move("nextPage",i);break;case s.UP:t=!0,this._keyEvent("previous",i);break;case s.DOWN:t=!0,this._keyEvent("next",i);break;case s.ENTER:case s.NUMPAD_ENTER:this.menu.active&&(t=!0,i.preventDefault(),this.menu.select(i));break;case s.TAB:this.menu.active&&this.menu.select(i);break;case s.ESCAPE:this.menu.element.is(":visible")&&(this._value(this.term),this.close(i),i.preventDefault());break;default:n=!0,this._searchTimeout(i)}},keypress:function(r){if(t){t=!1,r.preventDefault();return}if(n)return;var i=e.ui.keyCode;switch(r.keyCode){case i.PAGE_UP:this._move("previousPage",r);break;case i.PAGE_DOWN:this._move("nextPage",r);break;case i.UP:this._keyEvent("previous",r);break;case i.DOWN:this._keyEvent("next",r)}},input:function(e){if(r){r=!1,e.preventDefault();return}this._searchTimeout(e)},focus:function(){this.selectedItem=null,this.previous=this._value()},blur:function(e){if(this.cancelBlur){delete this.cancelBlur;return}clearTimeout(this.searching),this.close(e),this._change(e)}}),this._initSource(),this.menu=e("